path: root/doc
diff options
Diffstat (limited to 'doc')
-rw-r--r--doc/doxyout/base/html/bc_s.pngbin0 -> 676 bytes
-rw-r--r--doc/doxyout/base/html/bdwn.pngbin0 -> 147 bytes
-rw-r--r--doc/doxyout/base/html/closed.pngbin0 -> 132 bytes
-rw-r--r--doc/doxyout/base/html/doc.pngbin0 -> 746 bytes
-rw-r--r--doc/doxyout/base/html/doxygen.pngbin0 -> 3779 bytes
-rw-r--r--doc/doxyout/base/html/folderclosed.pngbin0 -> 616 bytes
-rw-r--r--doc/doxyout/base/html/folderopen.pngbin0 -> 597 bytes
-rw-r--r--doc/doxyout/base/html/graph_legend.pngbin0 -> 25694 bytes
-rw-r--r--doc/doxyout/base/html/nav_f.pngbin0 -> 153 bytes
-rw-r--r--doc/doxyout/base/html/nav_g.pngbin0 -> 95 bytes
-rw-r--r--doc/doxyout/base/html/nav_h.pngbin0 -> 98 bytes
-rw-r--r--doc/doxyout/base/html/open.pngbin0 -> 123 bytes
-rw-r--r--doc/doxyout/base/html/splitbar.pngbin0 -> 314 bytes
-rw-r--r--doc/doxyout/base/html/sync_off.pngbin0 -> 853 bytes
-rw-r--r--doc/doxyout/base/html/sync_on.pngbin0 -> 845 bytes
-rw-r--r--doc/doxyout/base/html/tab_a.pngbin0 -> 142 bytes
-rw-r--r--doc/doxyout/base/html/tab_b.pngbin0 -> 169 bytes
-rw-r--r--doc/doxyout/base/html/tab_h.pngbin0 -> 177 bytes
-rw-r--r--doc/doxyout/base/html/tab_s.pngbin0 -> 184 bytes
-rw-r--r--doc/doxyout/gssapi/html/bc_s.pngbin0 -> 676 bytes
-rw-r--r--doc/doxyout/gssapi/html/bdwn.pngbin0 -> 147 bytes
-rw-r--r--doc/doxyout/gssapi/html/closed.pngbin0 -> 132 bytes
-rw-r--r--doc/doxyout/gssapi/html/doc.pngbin0 -> 746 bytes
-rw-r--r--doc/doxyout/gssapi/html/doxygen.pngbin1281 -> 3779 bytes
-rw-r--r--doc/doxyout/gssapi/html/folderclosed.pngbin0 -> 616 bytes
-rw-r--r--doc/doxyout/gssapi/html/folderopen.pngbin0 -> 597 bytes
-rw-r--r--doc/doxyout/gssapi/html/graph_legend.pngbin4256 -> 25694 bytes
-rw-r--r--doc/doxyout/gssapi/html/nav_f.pngbin0 -> 153 bytes
-rw-r--r--doc/doxyout/gssapi/html/nav_g.pngbin0 -> 95 bytes
-rw-r--r--doc/doxyout/gssapi/html/nav_h.pngbin0 -> 98 bytes
-rw-r--r--doc/doxyout/gssapi/html/open.pngbin0 -> 123 bytes
-rw-r--r--doc/doxyout/gssapi/html/splitbar.pngbin0 -> 314 bytes
-rw-r--r--doc/doxyout/gssapi/html/sync_off.pngbin0 -> 853 bytes
-rw-r--r--doc/doxyout/gssapi/html/sync_on.pngbin0 -> 845 bytes
-rw-r--r--doc/doxyout/gssapi/html/tab_a.pngbin0 -> 142 bytes
-rw-r--r--doc/doxyout/gssapi/html/tab_b.gifbin35 -> 0 bytes
-rw-r--r--doc/doxyout/gssapi/html/tab_b.pngbin0 -> 169 bytes
-rw-r--r--doc/doxyout/gssapi/html/tab_h.pngbin0 -> 177 bytes
-rw-r--r--doc/doxyout/gssapi/html/tab_l.gifbin706 -> 0 bytes
-rw-r--r--doc/doxyout/gssapi/html/tab_r.gifbin2585 -> 0 bytes
-rw-r--r--doc/doxyout/gssapi/html/tab_s.pngbin0 -> 184 bytes
-rw-r--r--doc/doxyout/gssapi/man/man3/gss_display_status.3 (renamed from doc/doxyout/gssapi/man/man3/__gss_c_attr_stream_sizes_oid_desc.3)0
-rw-r--r--doc/doxyout/hcrypto/html/bc_s.pngbin0 -> 676 bytes
-rw-r--r--doc/doxyout/hcrypto/html/bdwn.pngbin0 -> 147 bytes
-rw-r--r--doc/doxyout/hcrypto/html/closed.pngbin0 -> 132 bytes
-rw-r--r--doc/doxyout/hcrypto/html/doc.pngbin0 -> 746 bytes
-rw-r--r--doc/doxyout/hcrypto/html/doxygen.pngbin1281 -> 3779 bytes
-rw-r--r--doc/doxyout/hcrypto/html/folderclosed.pngbin0 -> 616 bytes
-rw-r--r--doc/doxyout/hcrypto/html/folderopen.pngbin0 -> 597 bytes
-rw-r--r--doc/doxyout/hcrypto/html/graph_legend.pngbin4256 -> 25694 bytes
-rw-r--r--doc/doxyout/hcrypto/html/nav_f.pngbin0 -> 153 bytes
-rw-r--r--doc/doxyout/hcrypto/html/nav_g.pngbin0 -> 95 bytes
-rw-r--r--doc/doxyout/hcrypto/html/nav_h.pngbin0 -> 98 bytes
-rw-r--r--doc/doxyout/hcrypto/html/open.pngbin0 -> 123 bytes
-rw-r--r--doc/doxyout/hcrypto/html/splitbar.pngbin0 -> 314 bytes
-rw-r--r--doc/doxyout/hcrypto/html/sync_off.pngbin0 -> 853 bytes
-rw-r--r--doc/doxyout/hcrypto/html/sync_on.pngbin0 -> 845 bytes
-rw-r--r--doc/doxyout/hcrypto/html/tab_a.pngbin0 -> 142 bytes
-rw-r--r--doc/doxyout/hcrypto/html/tab_b.gifbin35 -> 0 bytes
-rw-r--r--doc/doxyout/hcrypto/html/tab_b.pngbin0 -> 169 bytes
-rw-r--r--doc/doxyout/hcrypto/html/tab_h.pngbin0 -> 177 bytes
-rw-r--r--doc/doxyout/hcrypto/html/tab_l.gifbin706 -> 0 bytes
-rw-r--r--doc/doxyout/hcrypto/html/tab_r.gifbin2585 -> 0 bytes
-rw-r--r--doc/doxyout/hcrypto/html/tab_s.pngbin0 -> 184 bytes
-rw-r--r--doc/doxyout/hdb/html/bc_s.pngbin0 -> 676 bytes
-rw-r--r--doc/doxyout/hdb/html/bdwn.pngbin0 -> 147 bytes
-rw-r--r--doc/doxyout/hdb/html/closed.pngbin0 -> 132 bytes
-rw-r--r--doc/doxyout/hdb/html/doc.pngbin0 -> 746 bytes
-rw-r--r--doc/doxyout/hdb/html/doxygen.pngbin1281 -> 3779 bytes
-rw-r--r--doc/doxyout/hdb/html/folderclosed.pngbin0 -> 616 bytes
-rw-r--r--doc/doxyout/hdb/html/folderopen.pngbin0 -> 597 bytes
-rw-r--r--doc/doxyout/hdb/html/graph_legend.pngbin4256 -> 25694 bytes
-rw-r--r--doc/doxyout/hdb/html/nav_f.pngbin0 -> 153 bytes
-rw-r--r--doc/doxyout/hdb/html/nav_g.pngbin0 -> 95 bytes
-rw-r--r--doc/doxyout/hdb/html/nav_h.pngbin0 -> 98 bytes
-rw-r--r--doc/doxyout/hdb/html/open.pngbin0 -> 123 bytes
-rw-r--r--doc/doxyout/hdb/html/splitbar.pngbin0 -> 314 bytes
-rw-r--r--doc/doxyout/hdb/html/sync_off.pngbin0 -> 853 bytes
-rw-r--r--doc/doxyout/hdb/html/sync_on.pngbin0 -> 845 bytes
-rw-r--r--doc/doxyout/hdb/html/tab_a.pngbin0 -> 142 bytes
-rw-r--r--doc/doxyout/hdb/html/tab_b.gifbin35 -> 0 bytes
-rw-r--r--doc/doxyout/hdb/html/tab_b.pngbin0 -> 169 bytes
-rw-r--r--doc/doxyout/hdb/html/tab_h.pngbin0 -> 177 bytes
-rw-r--r--doc/doxyout/hdb/html/tab_l.gifbin706 -> 0 bytes
-rw-r--r--doc/doxyout/hdb/html/tab_r.gifbin2585 -> 0 bytes
-rw-r--r--doc/doxyout/hdb/html/tab_s.pngbin0 -> 184 bytes
-rw-r--r--doc/doxyout/hx509/html/bc_s.pngbin0 -> 676 bytes
-rw-r--r--doc/doxyout/hx509/html/bdwn.pngbin0 -> 147 bytes
-rw-r--r--doc/doxyout/hx509/html/closed.pngbin0 -> 132 bytes
-rw-r--r--doc/doxyout/hx509/html/doc.pngbin0 -> 746 bytes
-rw-r--r--doc/doxyout/hx509/html/doxygen.pngbin1281 -> 3779 bytes
-rw-r--r--doc/doxyout/hx509/html/folderclosed.pngbin0 -> 616 bytes
-rw-r--r--doc/doxyout/hx509/html/folderopen.pngbin0 -> 597 bytes
-rw-r--r--doc/doxyout/hx509/html/graph_legend.pngbin4256 -> 25694 bytes
-rw-r--r--doc/doxyout/hx509/html/nav_f.pngbin0 -> 153 bytes
-rw-r--r--doc/doxyout/hx509/html/nav_g.pngbin0 -> 95 bytes
-rw-r--r--doc/doxyout/hx509/html/nav_h.pngbin0 -> 98 bytes
-rw-r--r--doc/doxyout/hx509/html/open.pngbin0 -> 123 bytes
-rw-r--r--doc/doxyout/hx509/html/splitbar.pngbin0 -> 314 bytes
-rw-r--r--doc/doxyout/hx509/html/sync_off.pngbin0 -> 853 bytes
-rw-r--r--doc/doxyout/hx509/html/sync_on.pngbin0 -> 845 bytes
-rw-r--r--doc/doxyout/hx509/html/tab_a.pngbin0 -> 142 bytes
-rw-r--r--doc/doxyout/hx509/html/tab_b.gifbin35 -> 0 bytes
-rw-r--r--doc/doxyout/hx509/html/tab_b.pngbin0 -> 169 bytes
-rw-r--r--doc/doxyout/hx509/html/tab_h.pngbin0 -> 177 bytes
-rw-r--r--doc/doxyout/hx509/html/tab_l.gifbin706 -> 0 bytes
-rw-r--r--doc/doxyout/hx509/html/tab_r.gifbin2585 -> 0 bytes
-rw-r--r--doc/doxyout/hx509/html/tab_s.pngbin0 -> 184 bytes
-rw-r--r--doc/doxyout/krb5/html/bc_s.pngbin0 -> 676 bytes
-rw-r--r--doc/doxyout/krb5/html/bdwn.pngbin0 -> 147 bytes
-rw-r--r--doc/doxyout/krb5/html/closed.pngbin0 -> 132 bytes
-rw-r--r--doc/doxyout/krb5/html/doc.pngbin0 -> 746 bytes
-rw-r--r--doc/doxyout/krb5/html/doxygen.pngbin1281 -> 3779 bytes
-rw-r--r--doc/doxyout/krb5/html/folderclosed.pngbin0 -> 616 bytes
-rw-r--r--doc/doxyout/krb5/html/folderopen.pngbin0 -> 597 bytes
-rw-r--r--doc/doxyout/krb5/html/graph_legend.pngbin4256 -> 25694 bytes
-rw-r--r--doc/doxyout/krb5/html/nav_f.pngbin0 -> 153 bytes
-rw-r--r--doc/doxyout/krb5/html/nav_g.pngbin0 -> 95 bytes
-rw-r--r--doc/doxyout/krb5/html/nav_h.pngbin0 -> 98 bytes
-rw-r--r--doc/doxyout/krb5/html/open.pngbin0 -> 123 bytes
-rw-r--r--doc/doxyout/krb5/html/splitbar.pngbin0 -> 314 bytes
-rw-r--r--doc/doxyout/krb5/html/sync_off.pngbin0 -> 853 bytes
-rw-r--r--doc/doxyout/krb5/html/sync_on.pngbin0 -> 845 bytes
-rw-r--r--doc/doxyout/krb5/html/tab_a.pngbin0 -> 142 bytes
-rw-r--r--doc/doxyout/krb5/html/tab_b.gifbin35 -> 0 bytes
-rw-r--r--doc/doxyout/krb5/html/tab_b.pngbin0 -> 169 bytes
-rw-r--r--doc/doxyout/krb5/html/tab_h.pngbin0 -> 177 bytes
-rw-r--r--doc/doxyout/krb5/html/tab_l.gifbin706 -> 0 bytes
-rw-r--r--doc/doxyout/krb5/html/tab_r.gifbin2585 -> 0 bytes
-rw-r--r--doc/doxyout/krb5/html/tab_s.pngbin0 -> 184 bytes
-rw-r--r--doc/doxyout/ntlm/html/bc_s.pngbin0 -> 676 bytes
-rw-r--r--doc/doxyout/ntlm/html/bdwn.pngbin0 -> 147 bytes
-rw-r--r--doc/doxyout/ntlm/html/closed.pngbin0 -> 132 bytes
-rw-r--r--doc/doxyout/ntlm/html/doc.pngbin0 -> 746 bytes
-rw-r--r--doc/doxyout/ntlm/html/doxygen.pngbin1281 -> 3779 bytes
-rw-r--r--doc/doxyout/ntlm/html/folderclosed.pngbin0 -> 616 bytes
-rw-r--r--doc/doxyout/ntlm/html/folderopen.pngbin0 -> 597 bytes
-rw-r--r--doc/doxyout/ntlm/html/graph_legend.pngbin4256 -> 25694 bytes
-rw-r--r--doc/doxyout/ntlm/html/nav_f.pngbin0 -> 153 bytes
-rw-r--r--doc/doxyout/ntlm/html/nav_g.pngbin0 -> 95 bytes
-rw-r--r--doc/doxyout/ntlm/html/nav_h.pngbin0 -> 98 bytes
-rw-r--r--doc/doxyout/ntlm/html/open.pngbin0 -> 123 bytes
-rw-r--r--doc/doxyout/ntlm/html/splitbar.pngbin0 -> 314 bytes
-rw-r--r--doc/doxyout/ntlm/html/structntlm__type2__coll__graph.pngbin821 -> 4119 bytes
-rw-r--r--doc/doxyout/ntlm/html/structntlm__type3__coll__graph.pngbin951 -> 4997 bytes
-rw-r--r--doc/doxyout/ntlm/html/sync_off.pngbin0 -> 853 bytes
-rw-r--r--doc/doxyout/ntlm/html/sync_on.pngbin0 -> 845 bytes
-rw-r--r--doc/doxyout/ntlm/html/tab_a.pngbin0 -> 142 bytes
-rw-r--r--doc/doxyout/ntlm/html/tab_b.gifbin35 -> 0 bytes
-rw-r--r--doc/doxyout/ntlm/html/tab_b.pngbin0 -> 169 bytes
-rw-r--r--doc/doxyout/ntlm/html/tab_h.pngbin0 -> 177 bytes
-rw-r--r--doc/doxyout/ntlm/html/tab_l.gifbin706 -> 0 bytes
-rw-r--r--doc/doxyout/ntlm/html/tab_r.gifbin2585 -> 0 bytes
-rw-r--r--doc/doxyout/ntlm/html/tab_s.pngbin0 -> 184 bytes
-rw-r--r--doc/doxyout/wind/html/bc_s.pngbin0 -> 676 bytes
-rw-r--r--doc/doxyout/wind/html/bdwn.pngbin0 -> 147 bytes
-rw-r--r--doc/doxyout/wind/html/closed.pngbin0 -> 132 bytes
-rw-r--r--doc/doxyout/wind/html/doc.pngbin0 -> 746 bytes
-rw-r--r--doc/doxyout/wind/html/doxygen.pngbin1281 -> 3779 bytes
-rw-r--r--doc/doxyout/wind/html/folderclosed.pngbin0 -> 616 bytes
-rw-r--r--doc/doxyout/wind/html/folderopen.pngbin0 -> 597 bytes
-rw-r--r--doc/doxyout/wind/html/graph_legend.pngbin4256 -> 25694 bytes
-rw-r--r--doc/doxyout/wind/html/nav_f.pngbin0 -> 153 bytes
-rw-r--r--doc/doxyout/wind/html/nav_g.pngbin0 -> 95 bytes
-rw-r--r--doc/doxyout/wind/html/nav_h.pngbin0 -> 98 bytes
-rw-r--r--doc/doxyout/wind/html/open.pngbin0 -> 123 bytes
-rw-r--r--doc/doxyout/wind/html/splitbar.pngbin0 -> 314 bytes
-rw-r--r--doc/doxyout/wind/html/sync_off.pngbin0 -> 853 bytes
-rw-r--r--doc/doxyout/wind/html/sync_on.pngbin0 -> 845 bytes
-rw-r--r--doc/doxyout/wind/html/tab_a.pngbin0 -> 142 bytes
-rw-r--r--doc/doxyout/wind/html/tab_b.gifbin35 -> 0 bytes
-rw-r--r--doc/doxyout/wind/html/tab_b.pngbin0 -> 169 bytes
-rw-r--r--doc/doxyout/wind/html/tab_h.pngbin0 -> 177 bytes
-rw-r--r--doc/doxyout/wind/html/tab_l.gifbin706 -> 0 bytes
-rw-r--r--doc/doxyout/wind/html/tab_r.gifbin2585 -> 0 bytes
-rw-r--r--doc/doxyout/wind/html/tab_s.pngbin0 -> 184 bytes
526 files changed, 40885 insertions, 27313 deletions
diff --git a/doc/Makefile.am b/doc/Makefile.am
index 0f495704633c..ed95c305fe35 100644
--- a/doc/Makefile.am
+++ b/doc/Makefile.am
@@ -24,6 +24,11 @@ hdb.dxy: hdb.din Makefile
chmod +x hdb.dxy.tmp
mv hdb.dxy.tmp hdb.dxy
+base.dxy: base.din Makefile
+ $(dxy_subst) < $(srcdir)/base.din > base.dxy.tmp
+ chmod +x base.dxy.tmp
+ mv base.dxy.tmp base.dxy
hx509.dxy: hx509.din Makefile
$(dxy_subst) < $(srcdir)/hx509.din > hx509.dxy.tmp
chmod +x hx509.dxy.tmp
@@ -50,6 +55,7 @@ wind.dxy: wind.din Makefile
mv wind.dxy.tmp wind.dxy
texi_subst = sed -e 's,[@]dbdir[@],$(localstatedir),g' \
+ -e 's,[@]dbtype[@],$(db_type),g' \
vars.texi: vars.tin Makefile
@@ -57,16 +63,24 @@ vars.texi: vars.tin Makefile
chmod +x vars.texi.tmp
mv vars.texi.tmp vars.texi
-PROJECTS = hcrypto hdb hx509 gssapi krb5 ntlm wind
+PROJECTS = base hdb hx509 gssapi krb5 ntlm wind
+PROJECTS += hcrypto
-doxyout doxygen: hdb.dxy hx509.dxy hcrypto.dxy gssapi.dxy krb5.dxy ntlm.dxy wind.dxy
- @find $(srcdir)/doxyout -type d ! -perm -200 -exec chmod u+w {} ';' ; \
+doxyout doxygen: base.dxy hdb.dxy hx509.dxy hcrypto.dxy gssapi.dxy krb5.dxy ntlm.dxy wind.dxy
+ @test -d $(srcdir)/doxyout && \
+ find $(srcdir)/doxyout -type d ! -perm -200 -exec chmod u+w {} ';' ; \
rm -rf $(srcdir)/doxyout ; \
mkdir $(srcdir)/doxyout ; \
for a in $(PROJECTS) ; do \
echo $$a ; \
doxygen $$a.dxy; \
- (cd $(srcdir)/doxyout && find $$a/man -type f > $$a/manpages ) ; \
+ (cd $(srcdir)/doxyout && \
+ find $$a/man -name '_*' -type f -print | \
+ perl -lne unlink && \
+ find $$a/html -name 'dir_*.html' -type f -print | \
+ perl -lne unlink && \
+ find $$a/man -type f > $$a/manpages ) ; \
install-data-hook: install-doxygen-manpage
@@ -123,6 +137,7 @@ EXTRA_DIST = \
hcrypto.din \
header.html \
heimdal.css \
+ base.din \
hx509.din \
krb5.din \
ntlm.din \
@@ -131,10 +146,14 @@ EXTRA_DIST = \
layman.asc \
doxytmpl.dxy \
wind.din \
+ base.hhp \
+ heimdal.hhp \
+ hx509.hhp \
hcrypto.dxy* \
+ base.dxy* \
hx509.dxy* \
hdb.dxy* \
gssapi.dxy* \
diff --git a/doc/Makefile.in b/doc/Makefile.in
index 01b5d7f6c16c..cf154e8e7315 100644
--- a/doc/Makefile.in
+++ b/doc/Makefile.in
@@ -1,9 +1,8 @@
-# Makefile.in generated by automake 1.11.1 from Makefile.am.
+# Makefile.in generated by automake 1.15.1 from Makefile.am.
# @configure_input@
-# Copyright (C) 1994, 1995, 1996, 1997, 1998, 1999, 2000, 2001, 2002,
-# 2003, 2004, 2005, 2006, 2007, 2008, 2009 Free Software Foundation,
-# Inc.
+# Copyright (C) 1994-2017 Free Software Foundation, Inc.
# This Makefile.in is free software; the Free Software Foundation
# gives unlimited permission to copy and/or distribute it,
# with or without modifications, as long as this notice is preserved.
@@ -21,6 +20,61 @@
# $Id$
VPATH = @srcdir@
+am__is_gnu_make = { \
+ if test -z '$(MAKELEVEL)'; then \
+ false; \
+ elif test -n '$(MAKE_HOST)'; then \
+ true; \
+ elif test -n '$(MAKE_VERSION)' && test -n '$(CURDIR)'; then \
+ true; \
+ else \
+ false; \
+ fi; \
+am__make_running_with_option = \
+ case $${target_option-} in \
+ ?) ;; \
+ *) echo "am__make_running_with_option: internal error: invalid" \
+ "target option '$${target_option-}' specified" >&2; \
+ exit 1;; \
+ esac; \
+ has_opt=no; \
+ sane_makeflags=$$MAKEFLAGS; \
+ if $(am__is_gnu_make); then \
+ sane_makeflags=$$MFLAGS; \
+ else \
+ case $$MAKEFLAGS in \
+ *\\[\ \ ]*) \
+ bs=\\; \
+ sane_makeflags=`printf '%s\n' "$$MAKEFLAGS" \
+ | sed "s/$$bs$$bs[$$bs $$bs ]*//g"`;; \
+ esac; \
+ fi; \
+ skip_next=no; \
+ strip_trailopt () \
+ { \
+ flg=`printf '%s\n' "$$flg" | sed "s/$$1.*$$//"`; \
+ }; \
+ for flg in $$sane_makeflags; do \
+ test $$skip_next = yes && { skip_next=no; continue; }; \
+ case $$flg in \
+ *=*|--*) continue;; \
+ -*I) strip_trailopt 'I'; skip_next=yes;; \
+ -*I?*) strip_trailopt 'I';; \
+ -*O) strip_trailopt 'O'; skip_next=yes;; \
+ -*O?*) strip_trailopt 'O';; \
+ -*l) strip_trailopt 'l'; skip_next=yes;; \
+ -*l?*) strip_trailopt 'l';; \
+ -[dEDm]) skip_next=yes;; \
+ -[JT]) skip_next=yes;; \
+ esac; \
+ case $$flg in \
+ *$$target_option*) has_opt=yes; break;; \
+ esac; \
+ done; \
+ test $$has_opt = yes
+am__make_dryrun = (target_option=n; $(am__make_running_with_option))
+am__make_keepgoing = (target_option=k; $(am__make_running_with_option))
pkgdatadir = $(datadir)/@PACKAGE@
pkgincludedir = $(includedir)/@PACKAGE@
pkglibdir = $(libdir)/@PACKAGE@
@@ -39,9 +93,6 @@ PRE_UNINSTALL = :
build_triplet = @build@
host_triplet = @host@
-DIST_COMMON = $(heimdal_TEXINFOS) $(srcdir)/Makefile.am \
- $(srcdir)/Makefile.in $(top_srcdir)/Makefile.am.common \
- $(top_srcdir)/cf/Makefile.am.common mdate-sh
subdir = doc
ACLOCAL_M4 = $(top_srcdir)/aclocal.m4
am__aclocal_m4_deps = $(top_srcdir)/cf/aix.m4 \
@@ -57,8 +108,7 @@ am__aclocal_m4_deps = $(top_srcdir)/cf/aix.m4 \
$(top_srcdir)/cf/check-man.m4 \
$(top_srcdir)/cf/check-netinet-ip-and-tcp.m4 \
$(top_srcdir)/cf/check-type-extra.m4 \
- $(top_srcdir)/cf/check-var.m4 $(top_srcdir)/cf/check-x.m4 \
- $(top_srcdir)/cf/check-xau.m4 $(top_srcdir)/cf/crypto.m4 \
+ $(top_srcdir)/cf/check-var.m4 $(top_srcdir)/cf/crypto.m4 \
$(top_srcdir)/cf/db.m4 $(top_srcdir)/cf/destdirs.m4 \
$(top_srcdir)/cf/dispatch.m4 $(top_srcdir)/cf/dlopen.m4 \
$(top_srcdir)/cf/find-func-no-libs.m4 \
@@ -71,6 +121,7 @@ am__aclocal_m4_deps = $(top_srcdir)/cf/aix.m4 \
$(top_srcdir)/cf/krb-bigendian.m4 \
$(top_srcdir)/cf/krb-func-getlogin.m4 \
$(top_srcdir)/cf/krb-ipv6.m4 $(top_srcdir)/cf/krb-prog-ln-s.m4 \
+ $(top_srcdir)/cf/krb-prog-perl.m4 \
$(top_srcdir)/cf/krb-readline.m4 \
$(top_srcdir)/cf/krb-struct-spwd.m4 \
$(top_srcdir)/cf/krb-struct-winsize.m4 \
@@ -90,12 +141,53 @@ am__aclocal_m4_deps = $(top_srcdir)/cf/aix.m4 \
$(top_srcdir)/acinclude.m4 $(top_srcdir)/configure.ac
am__configure_deps = $(am__aclocal_m4_deps) $(CONFIGURE_DEPENDENCIES) \
+DIST_COMMON = $(srcdir)/Makefile.am $(am__DIST_COMMON)
mkinstalldirs = $(install_sh) -d
CONFIG_HEADER = $(top_builddir)/include/config.h
+AM_V_P = $(am__v_P_@AM_V@)
+am__v_P_ = $(am__v_P_@AM_DEFAULT_V@)
+am__v_P_0 = false
+am__v_P_1 = :
+AM_V_GEN = $(am__v_GEN_@AM_V@)
+am__v_GEN_ = $(am__v_GEN_@AM_DEFAULT_V@)
+am__v_GEN_0 = @echo " GEN " $@;
+am__v_GEN_1 =
+AM_V_at = $(am__v_at_@AM_V@)
+am__v_at_ = $(am__v_at_@AM_DEFAULT_V@)
+am__v_at_0 = @
+am__v_at_1 =
+AM_V_DVIPS = $(am__v_DVIPS_@AM_V@)
+am__v_DVIPS_ = $(am__v_DVIPS_@AM_DEFAULT_V@)
+am__v_DVIPS_0 = @echo " DVIPS " $@;
+am__v_DVIPS_1 =
+am__v_MAKEINFO_0 = @echo " MAKEINFO" $@;
+am__v_MAKEINFO_1 =
+am__v_INFOHTML_0 = @echo " INFOHTML" $@;
+am__v_INFOHTML_1 =
+AM_V_TEXI2DVI = $(am__v_TEXI2DVI_@AM_V@)
+am__v_TEXI2DVI_ = $(am__v_TEXI2DVI_@AM_DEFAULT_V@)
+am__v_TEXI2DVI_0 = @echo " TEXI2DVI" $@;
+am__v_TEXI2DVI_1 =
+AM_V_TEXI2PDF = $(am__v_TEXI2PDF_@AM_V@)
+am__v_TEXI2PDF_ = $(am__v_TEXI2PDF_@AM_DEFAULT_V@)
+am__v_TEXI2PDF_0 = @echo " TEXI2PDF" $@;
+am__v_TEXI2PDF_1 =
+AM_V_texinfo = $(am__v_texinfo_@AM_V@)
+am__v_texinfo_ = $(am__v_texinfo_@AM_DEFAULT_V@)
+am__v_texinfo_0 = -q
+am__v_texinfo_1 =
+AM_V_texidevnull = $(am__v_texidevnull_@AM_V@)
+am__v_texidevnull_ = $(am__v_texidevnull_@AM_DEFAULT_V@)
+am__v_texidevnull_0 = > /dev/null
+am__v_texidevnull_1 =
INFO_DEPS = $(srcdir)/heimdal.info $(srcdir)/hx509.info
am__TEXINFO_TEX_DIR = $(srcdir)
DVIS = heimdal.dvi hx509.dvi
@@ -107,6 +199,11 @@ TEXI2PDF = $(TEXI2DVI) --pdf --batch
DVIPS = dvips
+am__can_run_installinfo = \
+ case $$AM_UPDATE_INFO_DIR in \
+ n|no|NO) false;; \
+ *) (install-info --version) >/dev/null 2>&1;; \
+ esac
am__installdirs = "$(DESTDIR)$(infodir)"
am__vpath_adj_setup = srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`;
am__vpath_adj = case $$p in \
@@ -129,11 +226,23 @@ am__nobase_list = $(am__nobase_strip_setup); \
am__base_list = \
sed '$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;$$!N;s/\n/ /g' | \
sed '$$!N;$$!N;$$!N;$$!N;s/\n/ /g'
+am__uninstall_files_from_dir = { \
+ test -z "$$files" \
+ || { test ! -d "$$dir" && test ! -f "$$dir" && test ! -r "$$dir"; } \
+ || { echo " ( cd '$$dir' && rm -f" $$files ")"; \
+ $(am__cd) "$$dir" && rm -f $$files; }; \
+ }
+am__tagged_files = $(HEADERS) $(SOURCES) $(TAGS_FILES) $(LISP)
+am__DIST_COMMON = $(heimdal_TEXINFOS) $(srcdir)/Makefile.in \
+ $(top_srcdir)/Makefile.am.common \
+ $(top_srcdir)/cf/Makefile.am.common mdate-sh
AR = @AR@
+AS = @AS@
@@ -152,12 +261,12 @@ COMPILE_ET = @COMPILE_ET@
DIR_com_err = @DIR_com_err@
-DIR_hcrypto = @DIR_hcrypto@
DIR_hdbdir = @DIR_hdbdir@
DIR_roken = @DIR_roken@
@@ -167,17 +276,17 @@ ECHO_C = @ECHO_C@
INCLUDES_roken = @INCLUDES_roken@
-INCLUDE_hcrypto = @INCLUDE_hcrypto@
-INCLUDE_hesiod = @INCLUDE_hesiod@
-INCLUDE_krb4 = @INCLUDE_krb4@
INCLUDE_libedit = @INCLUDE_libedit@
INCLUDE_libintl = @INCLUDE_libintl@
INCLUDE_openldap = @INCLUDE_openldap@
+INCLUDE_openssl_crypto = @INCLUDE_openssl_crypto@
INCLUDE_readline = @INCLUDE_readline@
INCLUDE_sqlite3 = @INCLUDE_sqlite3@
@@ -196,12 +305,9 @@ LIBOBJS = @LIBOBJS@
-LIB_XauFileName = @LIB_XauFileName@
-LIB_XauReadAuth = @LIB_XauReadAuth@
-LIB_XauWriteAuth = @LIB_XauWriteAuth@
LIB_bswap16 = @LIB_bswap16@
LIB_bswap32 = @LIB_bswap32@
+LIB_bswap64 = @LIB_bswap64@
LIB_com_err = @LIB_com_err@
LIB_com_err_a = @LIB_com_err_a@
LIB_com_err_so = @LIB_com_err_so@
@@ -210,6 +316,7 @@ LIB_db_create = @LIB_db_create@
LIB_dbm_firstkey = @LIB_dbm_firstkey@
LIB_dbopen = @LIB_dbopen@
LIB_dispatch_async_f = @LIB_dispatch_async_f@
+LIB_dladdr = @LIB_dladdr@
LIB_dlopen = @LIB_dlopen@
LIB_dn_expand = @LIB_dn_expand@
LIB_dns_search = @LIB_dns_search@
@@ -226,10 +333,8 @@ LIB_hcrypto = @LIB_hcrypto@
LIB_hcrypto_a = @LIB_hcrypto_a@
LIB_hcrypto_appl = @LIB_hcrypto_appl@
LIB_hcrypto_so = @LIB_hcrypto_so@
-LIB_hesiod = @LIB_hesiod@
LIB_hstrerror = @LIB_hstrerror@
LIB_kdb = @LIB_kdb@
-LIB_krb4 = @LIB_krb4@
LIB_libedit = @LIB_libedit@
LIB_libintl = @LIB_libintl@
LIB_loadquery = @LIB_loadquery@
@@ -237,6 +342,7 @@ LIB_logout = @LIB_logout@
LIB_logwtmp = @LIB_logwtmp@
LIB_openldap = @LIB_openldap@
LIB_openpty = @LIB_openpty@
+LIB_openssl_crypto = @LIB_openssl_crypto@
LIB_otp = @LIB_otp@
LIB_pidfile = @LIB_pidfile@
LIB_readline = @LIB_readline@
@@ -251,12 +357,15 @@ LIB_sqlite3 = @LIB_sqlite3@
LIB_syslog = @LIB_syslog@
LIB_tgetent = @LIB_tgetent@
LN_S = @LN_S@
NM = @NM@
@@ -287,13 +397,7 @@ STRIP = @STRIP@
abs_builddir = @abs_builddir@
@@ -317,6 +421,8 @@ build_vendor = @build_vendor@
builddir = @builddir@
datadir = @datadir@
datarootdir = @datarootdir@
+db_type = @db_type@
+db_type_preference = @db_type_preference@
docdir = @docdir@
dpagaix_cflags = @dpagaix_cflags@
dpagaix_ldadd = @dpagaix_ldadd@
@@ -352,29 +458,37 @@ target_alias = @target_alias@
top_build_prefix = @top_build_prefix@
top_builddir = @top_builddir@
top_srcdir = @top_srcdir@
-SUFFIXES = .et .h .x .z .hx .1 .3 .5 .8 .cat1 .cat3 .cat5 .cat8
+SUFFIXES = .et .h .pc.in .pc .x .z .hx .1 .3 .5 .7 .8 .cat1 .cat3 \
+ .cat5 .cat7 .cat8
DEFAULT_INCLUDES = -I. -I$(srcdir) -I$(top_builddir)/include -I$(top_srcdir)/include
CP = cp
buildinclude = $(top_builddir)/include
+LIB_XauReadAuth = @LIB_XauReadAuth@
LIB_el_init = @LIB_el_init@
LIB_getattr = @LIB_getattr@
LIB_getpwent_r = @LIB_getpwent_r@
LIB_odm_initialize = @LIB_odm_initialize@
LIB_setpcred = @LIB_setpcred@
+INCLUDE_krb4 = @INCLUDE_krb4@
+LIB_krb4 = @LIB_krb4@
libexec_heimdaldir = $(libexecdir)/heimdal
NROFF_MAN = groff -mandoc -Tascii
-LIB_kafs = $(top_builddir)/lib/kafs/libkafs.la $(AIX_EXTRA_KAFS)
+@NO_AFS_FALSE@LIB_kafs = $(top_builddir)/lib/kafs/libkafs.la $(AIX_EXTRA_KAFS)
+@NO_AFS_TRUE@LIB_kafs =
@KRB5_TRUE@LIB_krb5 = $(top_builddir)/lib/krb5/libkrb5.la \
@KRB5_TRUE@ $(top_builddir)/lib/asn1/libasn1.la
@KRB5_TRUE@LIB_gssapi = $(top_builddir)/lib/gssapi/libgssapi.la
-LIB_heimbase = $(top_builddir)/base/libheimbase.la
+LIB_heimbase = $(top_builddir)/lib/base/libheimbase.la
@DCE_TRUE@LIB_kdfs = $(top_builddir)/lib/kdfs/libkdfs.la
+heim_verbose = $(heim_verbose_$(V))
+heim_verbose_ = $(heim_verbose_$(AM_DEFAULT_VERBOSITY))
+heim_verbose_0 = @echo " GEN "$@;
AUTOMAKE_OPTIONS = no-texinfo.tex
MAKEINFOFLAGS = --css-include=$(srcdir)/heimdal.css
TEXI2DVI = true # ARGH, make distcheck can't be disabled to not build dvifiles
@@ -384,9 +498,10 @@ dxy_subst = sed -e 's,[@]srcdir[@],$(srcdir),g' \
texi_subst = sed -e 's,[@]dbdir[@],$(localstatedir),g' \
+ -e 's,[@]dbtype[@],$(db_type),g' \
-PROJECTS = hcrypto hdb hx509 gssapi krb5 ntlm wind
+PROJECTS = base hdb hx509 gssapi krb5 ntlm wind hcrypto
heimdal_TEXINFOS = \
ack.texi \
apps.texi \
@@ -412,6 +527,7 @@ EXTRA_DIST = \
hcrypto.din \
header.html \
heimdal.css \
+ base.din \
hx509.din \
krb5.din \
ntlm.din \
@@ -420,10 +536,14 @@ EXTRA_DIST = \
layman.asc \
doxytmpl.dxy \
wind.din \
+ base.hhp \
+ heimdal.hhp \
+ hx509.hhp \
hcrypto.dxy* \
+ base.dxy* \
hx509.dxy* \
hdb.dxy* \
gssapi.dxy* \
@@ -435,7 +555,7 @@ CLEANFILES = \
all: all-am
-.SUFFIXES: .et .h .x .z .hx .1 .3 .5 .8 .cat1 .cat3 .cat5 .cat8 .c .dvi .html .info .pdf .ps .texi
+.SUFFIXES: .et .h .pc.in .pc .x .z .hx .1 .3 .5 .7 .8 .cat1 .cat3 .cat5 .cat7 .cat8 .c .dvi .html .info .pdf .ps .texi
$(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(top_srcdir)/Makefile.am.common $(top_srcdir)/cf/Makefile.am.common $(am__configure_deps)
@for dep in $?; do \
case '$(am__configure_deps)' in \
@@ -448,7 +568,6 @@ $(srcdir)/Makefile.in: @MAINTAINER_MODE_TRUE@ $(srcdir)/Makefile.am $(top_srcdir
echo ' cd $(top_srcdir) && $(AUTOMAKE) --foreign doc/Makefile'; \
$(am__cd) $(top_srcdir) && \
$(AUTOMAKE) --foreign doc/Makefile
-.PRECIOUS: Makefile
Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
@case '$?' in \
*config.status*) \
@@ -457,6 +576,7 @@ Makefile: $(srcdir)/Makefile.in $(top_builddir)/config.status
echo ' cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe)'; \
cd $(top_builddir) && $(SHELL) ./config.status $(subdir)/$@ $(am__depfiles_maybe);; \
+$(top_srcdir)/Makefile.am.common $(top_srcdir)/cf/Makefile.am.common $(am__empty):
$(top_builddir)/config.status: $(top_srcdir)/configure $(CONFIG_STATUS_DEPENDENCIES)
cd $(top_builddir) && $(MAKE) $(AM_MAKEFLAGS) am--refresh
@@ -474,7 +594,7 @@ clean-libtool:
-rm -rf .libs _libs
- restore=: && backupdir="$(am__leading_dot)am$$$$" && \
+ $(AM_V_MAKEINFO)restore=: && backupdir="$(am__leading_dot)am$$$$" && \
am__cwd=`pwd` && $(am__cd) $(srcdir) && \
rm -rf $$backupdir && mkdir $$backupdir && \
if ($(MAKEINFO) --version) >/dev/null 2>&1; then \
@@ -496,27 +616,25 @@ clean-libtool:
rm -rf $$backupdir; exit $$rc
- $(TEXI2DVI) $<
+ $(TEXI2DVI) $(AM_V_texinfo) --build-dir=$(@:.dvi=.t2d) -o $@ $(AM_V_texidevnull) \
+ $<
- $(TEXI2PDF) $<
+ $(TEXI2PDF) $(AM_V_texinfo) --build-dir=$(@:.pdf=.t2p) -o $@ $(AM_V_texidevnull) \
+ $<
- rm -rf $(@:.html=.htp)
+ $(AM_V_MAKEINFO)rm -rf $(@:.html=.htp)
-o $(@:.html=.htp) $<; \
then \
- rm -rf $@; \
- if test ! -d $(@:.html=.htp) && test -d $(@:.html=); then \
- mv $(@:.html=) $@; else mv $(@:.html=.htp) $@; fi; \
+ rm -rf $@ && mv $(@:.html=.htp) $@; \
else \
- if test ! -d $(@:.html=.htp) && test -d $(@:.html=); then \
- rm -rf $(@:.html=); else rm -Rf $(@:.html=.htp) $@; fi; \
- exit 1; \
+ rm -rf $(@:.html=.htp); exit 1; \
$(srcdir)/heimdal.info: heimdal.texi $(heimdal_TEXINFOS)
heimdal.dvi: heimdal.texi $(heimdal_TEXINFOS)
@@ -527,8 +645,8 @@ hx509.dvi: hx509.texi
hx509.pdf: hx509.texi
hx509.html: hx509.texi
- $(DVIPS) -o $@ $<
+ $(DVIPS) $(AM_V_texinfo) -o $@ $<
@@ -550,9 +668,7 @@ uninstall-html-am:
- @if test -d '$(DESTDIR)$(infodir)' && \
- (install-info --version && \
- install-info --version 2>&1 | sed 1q | grep -i -v debian) >/dev/null 2>&1; then \
+ @if test -d '$(DESTDIR)$(infodir)' && $(am__can_run_installinfo); then \
list='$(INFO_DEPS)'; \
for file in $$list; do \
relfile=`echo "$$file" | sed 's|^.*/||'`; \
@@ -609,12 +725,7 @@ dist-info: $(INFO_DEPS)
- -rm -rf heimdal.aux heimdal.cp heimdal.cps heimdal.fn heimdal.fns \
- heimdal.ky heimdal.kys heimdal.log heimdal.pg heimdal.tmp \
- heimdal.toc heimdal.tp heimdal.tps heimdal.vr heimdal.vrs \
- hx509.aux hx509.cp hx509.cps hx509.fn hx509.fns hx509.ky \
- hx509.kys hx509.log hx509.pg hx509.tmp hx509.toc hx509.tp \
- hx509.tps hx509.vr hx509.vrs
+ -rm -rf heimdal.t2d heimdal.t2p hx509.t2d hx509.t2p
-test -z "heimdal.dvi heimdal.pdf heimdal.ps heimdal.html hx509.dvi hx509.pdf \
@@ -628,11 +739,11 @@ maintainer-clean-aminfo:
echo " rm -f $$i $$i-[0-9] $$i-[0-9][0-9] $$i_i[0-9] $$i_i[0-9][0-9]"; \
rm -f $$i $$i-[0-9] $$i-[0-9][0-9] $$i_i[0-9] $$i_i[0-9][0-9]; \
-tags: TAGS
+tags TAGS:
+ctags CTAGS:
-ctags: CTAGS
+cscope cscopelist:
distdir: $(DISTFILES)
@@ -686,10 +797,15 @@ install-am: all-am
installcheck: installcheck-am
- `test -z '$(STRIP)' || \
+ if test -z '$(STRIP)'; then \
+ install; \
+ else \
+ fi
@@ -729,8 +845,11 @@ install-dvi: install-dvi-am
install-dvi-am: $(DVIS)
- test -z "$(dvidir)" || $(MKDIR_P) "$(DESTDIR)$(dvidir)"
@list='$(DVIS)'; test -n "$(dvidir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(dvidir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(dvidir)" || exit 1; \
+ fi; \
for p in $$list; do \
if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
echo "$$d$$p"; \
@@ -739,25 +858,28 @@ install-dvi-am: $(DVIS)
echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(dvidir)'"; \
$(INSTALL_DATA) $$files "$(DESTDIR)$(dvidir)" || exit $$?; \
- $(MAKE) $(AM_MAKEFLAGS) install-exec-hook
+install-exec-am: install-exec-local
install-html: install-html-am
install-html-am: $(HTMLS)
- test -z "$(htmldir)" || $(MKDIR_P) "$(DESTDIR)$(htmldir)"
@list='$(HTMLS)'; list2=; test -n "$(htmldir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(htmldir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(htmldir)" || exit 1; \
+ fi; \
for p in $$list; do \
if test -f "$$p" || test -d "$$p"; then d=; else d="$(srcdir)/"; fi; \
$(am__strip_dir) \
- if test -d "$$d$$p"; then \
+ d2=$$d$$p; \
+ if test -d "$$d2"; then \
echo " $(MKDIR_P) '$(DESTDIR)$(htmldir)/$$f'"; \
$(MKDIR_P) "$(DESTDIR)$(htmldir)/$$f" || exit 1; \
- echo " $(INSTALL_DATA) '$$d$$p'/* '$(DESTDIR)$(htmldir)/$$f'"; \
- $(INSTALL_DATA) "$$d$$p"/* "$(DESTDIR)$(htmldir)/$$f" || exit $$?; \
+ echo " $(INSTALL_DATA) '$$d2'/* '$(DESTDIR)$(htmldir)/$$f'"; \
+ $(INSTALL_DATA) "$$d2"/* "$(DESTDIR)$(htmldir)/$$f" || exit $$?; \
else \
- list2="$$list2 $$d$$p"; \
+ list2="$$list2 $$d2"; \
fi; \
done; \
test -z "$$list2" || { echo "$$list2" | $(am__base_list) | \
@@ -769,9 +891,12 @@ install-info: install-info-am
install-info-am: $(INFO_DEPS)
- test -z "$(infodir)" || $(MKDIR_P) "$(DESTDIR)$(infodir)"
@srcdirstrip=`echo "$(srcdir)" | sed 's|.|.|g'`; \
list='$(INFO_DEPS)'; test -n "$(infodir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(infodir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(infodir)" || exit 1; \
+ fi; \
for file in $$list; do \
case $$file in \
$(srcdir)/*) file=`echo "$$file" | sed "s|^$$srcdirstrip/||"`;; \
@@ -789,8 +914,7 @@ install-info-am: $(INFO_DEPS)
echo " $(INSTALL_DATA) $$files '$(DESTDIR)$(infodir)'"; \
$(INSTALL_DATA) $$files "$(DESTDIR)$(infodir)" || exit $$?; done
- @if (install-info --version && \
- install-info --version 2>&1 | sed 1q | grep -i -v debian) >/dev/null 2>&1; then \
+ @if $(am__can_run_installinfo); then \
list='$(INFO_DEPS)'; test -n "$(infodir)" || list=; \
for file in $$list; do \
relfile=`echo "$$file" | sed 's|^.*/||'`; \
@@ -804,8 +928,11 @@ install-pdf: install-pdf-am
install-pdf-am: $(PDFS)
- test -z "$(pdfdir)" || $(MKDIR_P) "$(DESTDIR)$(pdfdir)"
@list='$(PDFS)'; test -n "$(pdfdir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(pdfdir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(pdfdir)" || exit 1; \
+ fi; \
for p in $$list; do \
if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
echo "$$d$$p"; \
@@ -817,8 +944,11 @@ install-ps: install-ps-am
install-ps-am: $(PSS)
- test -z "$(psdir)" || $(MKDIR_P) "$(DESTDIR)$(psdir)"
@list='$(PSS)'; test -n "$(psdir)" || list=; \
+ if test -n "$$list"; then \
+ echo " $(MKDIR_P) '$(DESTDIR)$(psdir)'"; \
+ $(MKDIR_P) "$(DESTDIR)$(psdir)" || exit 1; \
+ fi; \
for p in $$list; do \
if test -f "$$p"; then d=; else d="$(srcdir)/"; fi; \
echo "$$d$$p"; \
@@ -850,40 +980,54 @@ uninstall-am: uninstall-dvi-am uninstall-html-am uninstall-info-am \
uninstall-pdf-am uninstall-ps-am
$(MAKE) $(AM_MAKEFLAGS) uninstall-hook
-.MAKE: check-am install-am install-data-am install-exec-am \
- install-strip uninstall-am
+.MAKE: check-am install-am install-data-am install-strip uninstall-am
.PHONY: all all-am all-local check check-am check-local clean \
- clean-aminfo clean-generic clean-libtool dist-hook dist-info \
- distclean distclean-generic distclean-libtool distdir dvi \
- dvi-am html html-am info info-am install install-am \
- install-data install-data-am install-data-hook install-dvi \
- install-dvi-am install-exec install-exec-am install-exec-hook \
- install-html install-html-am install-info install-info-am \
- install-man install-pdf install-pdf-am install-ps \
- install-ps-am install-strip installcheck installcheck-am \
- installdirs maintainer-clean maintainer-clean-aminfo \
+ clean-aminfo clean-generic clean-libtool cscopelist-am \
+ ctags-am dist-hook dist-info distclean distclean-generic \
+ distclean-libtool distdir dvi dvi-am html html-am info info-am \
+ install install-am install-data install-data-am \
+ install-data-hook install-dvi install-dvi-am install-exec \
+ install-exec-am install-exec-local install-html \
+ install-html-am install-info install-info-am install-man \
+ install-pdf install-pdf-am install-ps install-ps-am \
+ install-strip installcheck installcheck-am installdirs \
+ maintainer-clean maintainer-clean-aminfo \
maintainer-clean-generic mostlyclean mostlyclean-aminfo \
mostlyclean-generic mostlyclean-libtool pdf pdf-am ps ps-am \
- uninstall uninstall-am uninstall-dvi-am uninstall-hook \
+ tags-am uninstall uninstall-am uninstall-dvi-am uninstall-hook \
uninstall-html-am uninstall-info-am uninstall-pdf-am \
+.PRECIOUS: Makefile
@foo='$(bin_SUIDS)'; \
for file in $$foo; do \
- x=$(DESTDIR)$(bindir)/$$file; \
- if chown 0:0 $$x && chmod u+s $$x; then :; else \
- echo "*"; \
- echo "* Failed to install $$x setuid root"; \
- echo "*"; \
- fi; done
+ x=$(DESTDIR)$(bindir)/$$file; \
+ if chown 0:0 $$x && chmod u+s $$x; then :; else \
+ echo "*"; \
+ echo "* Failed to install $$x setuid root"; \
+ echo "*"; \
+ fi; \
+ done
+install-exec-local: install-suid-programs
-install-exec-hook: install-suid-programs
+ @if [ X"$$CODE_SIGN_IDENTITY" != X ] ; then \
+ foo='$(bin_PROGRAMS) $(sbin_PROGRAMS) $(libexec_PROGRAMS)' ; \
+ for file in $$foo ; do \
+ echo "CODESIGN $$file" ; \
+ codesign -f -s "$$CODE_SIGN_IDENTITY" $$file || exit 1 ; \
+ done ; \
+ fi
+all-local: codesign-all
-install-build-headers:: $(include_HEADERS) $(dist_include_HEADERS) $(nodist_include_HEADERS) $(build_HEADERZ) $(nobase_include_HEADERS)
- @foo='$(include_HEADERS) $(dist_include_HEADERS) $(nodist_include_HEADERS) $(build_HEADERZ)'; \
+install-build-headers:: $(include_HEADERS) $(dist_include_HEADERS) $(nodist_include_HEADERS) $(build_HEADERZ) $(nobase_include_HEADERS) $(noinst_HEADERS)
+ @foo='$(include_HEADERS) $(dist_include_HEADERS) $(nodist_include_HEADERS) $(build_HEADERZ) $(noinst_HEADERS)'; \
for f in $$foo; do \
f=`basename $$f`; \
if test -f "$(srcdir)/$$f"; then file="$(srcdir)/$$f"; \
@@ -891,7 +1035,7 @@ install-build-headers:: $(include_HEADERS) $(dist_include_HEADERS) $(nodist_incl
if cmp -s $$file $(buildinclude)/$$f 2> /dev/null ; then \
: ; else \
echo " $(CP) $$file $(buildinclude)/$$f"; \
- $(CP) $$file $(buildinclude)/$$f; \
+ $(CP) $$file $(buildinclude)/$$f || true; \
fi ; \
done ; \
foo='$(nobase_include_HEADERS)'; \
@@ -948,6 +1092,8 @@ check-local::
$(NROFF_MAN) $< > $@
$(NROFF_MAN) $< > $@
+ $(NROFF_MAN) $< > $@
$(NROFF_MAN) $< > $@
@@ -990,6 +1136,19 @@ dist-cat5-mans:
$(NROFF_MAN) $(srcdir)/$$i > $(distdir)/$$x; \
+ @foo='$(man7_MANS)'; \
+ bar='$(man_MANS)'; \
+ for i in $$bar; do \
+ case $$i in \
+ *.7) foo="$$foo $$i";; \
+ esac; done ;\
+ for i in $$foo; do \
+ x=`echo $$i | sed 's/\.[^.]*$$/.cat7/'`; \
+ echo "$(NROFF_MAN) $(srcdir)/$$i > $(distdir)/$$x"; \
+ $(NROFF_MAN) $(srcdir)/$$i > $(distdir)/$$x; \
+ done
@foo='$(man8_MANS)'; \
bar='$(man_MANS)'; \
@@ -1003,13 +1162,13 @@ dist-cat8-mans:
$(NROFF_MAN) $(srcdir)/$$i > $(distdir)/$$x; \
-dist-hook: dist-cat1-mans dist-cat3-mans dist-cat5-mans dist-cat8-mans
+dist-hook: dist-cat1-mans dist-cat3-mans dist-cat5-mans dist-cat7-mans dist-cat8-mans
- $(SHELL) $(top_srcdir)/cf/install-catman.sh install "$(INSTALL_DATA)" "$(mkinstalldirs)" "$(srcdir)" "$(DESTDIR)$(mandir)" '$(CATMANEXT)' $(man_MANS) $(man1_MANS) $(man3_MANS) $(man5_MANS) $(man8_MANS)
+ $(SHELL) $(top_srcdir)/cf/install-catman.sh install "$(INSTALL_DATA)" "$(mkinstalldirs)" "$(srcdir)" "$(DESTDIR)$(mandir)" '$(CATMANEXT)' $(man_MANS) $(man1_MANS) $(man3_MANS) $(man5_MANS) $(man7_MANS) $(man8_MANS)
- $(SHELL) $(top_srcdir)/cf/install-catman.sh uninstall "$(INSTALL_DATA)" "$(mkinstalldirs)" "$(srcdir)" "$(DESTDIR)$(mandir)" '$(CATMANEXT)' $(man_MANS) $(man1_MANS) $(man3_MANS) $(man5_MANS) $(man8_MANS)
+ $(SHELL) $(top_srcdir)/cf/install-catman.sh uninstall "$(INSTALL_DATA)" "$(mkinstalldirs)" "$(srcdir)" "$(DESTDIR)$(mandir)" '$(CATMANEXT)' $(man_MANS) $(man1_MANS) $(man3_MANS) $(man5_MANS) $(man7_MANS) $(man8_MANS)
install-data-hook: install-cat-mans
uninstall-hook: uninstall-cat-mans
@@ -1050,6 +1209,11 @@ hdb.dxy: hdb.din Makefile
chmod +x hdb.dxy.tmp
mv hdb.dxy.tmp hdb.dxy
+base.dxy: base.din Makefile
+ $(dxy_subst) < $(srcdir)/base.din > base.dxy.tmp
+ chmod +x base.dxy.tmp
+ mv base.dxy.tmp base.dxy
hx509.dxy: hx509.din Makefile
$(dxy_subst) < $(srcdir)/hx509.din > hx509.dxy.tmp
chmod +x hx509.dxy.tmp
@@ -1080,14 +1244,20 @@ vars.texi: vars.tin Makefile
chmod +x vars.texi.tmp
mv vars.texi.tmp vars.texi
-doxyout doxygen: hdb.dxy hx509.dxy hcrypto.dxy gssapi.dxy krb5.dxy ntlm.dxy wind.dxy
- @find $(srcdir)/doxyout -type d ! -perm -200 -exec chmod u+w {} ';' ; \
+doxyout doxygen: base.dxy hdb.dxy hx509.dxy hcrypto.dxy gssapi.dxy krb5.dxy ntlm.dxy wind.dxy
+ @test -d $(srcdir)/doxyout && \
+ find $(srcdir)/doxyout -type d ! -perm -200 -exec chmod u+w {} ';' ; \
rm -rf $(srcdir)/doxyout ; \
mkdir $(srcdir)/doxyout ; \
for a in $(PROJECTS) ; do \
echo $$a ; \
doxygen $$a.dxy; \
- (cd $(srcdir)/doxyout && find $$a/man -type f > $$a/manpages ) ; \
+ (cd $(srcdir)/doxyout && \
+ find $$a/man -name '_*' -type f -print | \
+ perl -lne unlink && \
+ find $$a/html -name 'dir_*.html' -type f -print | \
+ perl -lne unlink && \
+ find $$a/man -type f > $$a/manpages ) ; \
install-data-hook: install-doxygen-manpage
diff --git a/doc/NTMakefile b/doc/NTMakefile
index 4894983cec50..7567fad4bfd0 100644
--- a/doc/NTMakefile
+++ b/doc/NTMakefile
@@ -57,10 +57,15 @@ hx509_TEXINFOS = \
$(SED) -e "s,[@]dbdir[@],x,g" \
+ -e "s,[@]dbtype[@],sqlite,g" < $** > $@ \
-e "s,[@]PACKAGE_VERSION[@],$(VER_PACKAGE_VERSION),g" < $** > $@
MAKEINFOFLAGS = --css-include=$(SRCDIR)/heimdal.css
+!ifdef APPVEYOR
+MAKEINFO = $(PERL) C:\msys64\usr\bin\makeinfo
# Build heimdal.chm
diff --git a/doc/ack.texi b/doc/ack.texi
index e368d496a4f6..89b83c1b8620 100644
--- a/doc/ack.texi
+++ b/doc/ack.texi
@@ -1,5 +1,3 @@
-@c $Id$
@node Acknowledgments, Copyrights and Licenses, Migration, Top
@comment node-name, next, previous, up
@appendix Acknowledgments
@@ -77,6 +75,7 @@ Bugfixes, documentation, encouragement, and code has been contributed by:
@item Johan Gadsjö
@item Johan Ihrén
@item John Center
+@item Julian Ospald
@item Jun-ichiro itojun Hagino
@item KAMADA Ken'ichi
@item Kamen Mazdrashki
@@ -114,6 +113,7 @@ Bugfixes, documentation, encouragement, and code has been contributed by:
@item Simon Wilkinson
@item Stefan Metzmacher
@item Ted Percival
+@item Timothy Pearson
@item Tom Payerle
@item Victor Guerra
@item Zeqing Xia
diff --git a/doc/base.din b/doc/base.din
new file mode 100644
index 000000000000..3ef6d404a42b
--- /dev/null
+++ b/doc/base.din
@@ -0,0 +1,15 @@
+# Doxyfile 1.5.3
+PROJECT_NAME = Heimdal base library
+OUTPUT_DIRECTORY = @srcdir@/doxyout/base
+INPUT = @srcdir@/../lib/base
+PERL_PATH = /usr/bin/perl
+HTML_HEADER = "@srcdir@/header.html"
+HTML_FOOTER = "@srcdir@/footer.html"
+@INCLUDE = "@srcdir@/doxytmpl.dxy"
diff --git a/doc/base.hhp b/doc/base.hhp
new file mode 100644
index 000000000000..e1a3d3cf5892
--- /dev/null
+++ b/doc/base.hhp
@@ -0,0 +1,8 @@
+Compatibility=1.1 or later
+Compiled file=heimbase.chm
+Contents file=toc.hhc
+Default topic=index.html
+Display compile progress=No
+Language=0x409 English (United States)
+Title=Heimdal Base
diff --git a/doc/copyright.texi b/doc/copyright.texi
index 490abbccee83..d9f1a8c2e197 100644
--- a/doc/copyright.texi
+++ b/doc/copyright.texi
@@ -217,6 +217,9 @@ SUCH DAMAGE.
Copyright (c) 2003-2011, PADL Software Pty Ltd.
+Copyright (c) 2004, Andrew Bartlett.
+Copyright (c) 2003 - 2008, Kungliga Tekniska Högskolan
+Copyright (c) 2015, Timothy Pearson.
All rights reserved.
Redistribution and use in source and binary forms, with or without
@@ -443,7 +446,7 @@ Windows support
-Copyright (c) 2009, Secure Endpoints Inc.
+Copyright (c) 2009-2015, Secure Endpoints Inc.
All rights reserved.
Redistribution and use in source and binary forms, with or without
diff --git a/doc/doxyout/base/html/bc_s.png b/doc/doxyout/base/html/bc_s.png
new file mode 100644
index 000000000000..224b29aa9847
--- /dev/null
+++ b/doc/doxyout/base/html/bc_s.png
Binary files differ
diff --git a/doc/doxyout/base/html/bdwn.png b/doc/doxyout/base/html/bdwn.png
new file mode 100644
index 000000000000..940a0b950443
--- /dev/null
+++ b/doc/doxyout/base/html/bdwn.png
Binary files differ
diff --git a/doc/doxyout/base/html/closed.png b/doc/doxyout/base/html/closed.png
new file mode 100644
index 000000000000..98cc2c909da3
--- /dev/null
+++ b/doc/doxyout/base/html/closed.png
Binary files differ
diff --git a/doc/doxyout/base/html/doc.png b/doc/doxyout/base/html/doc.png
new file mode 100644
index 000000000000..17edabff95f7
--- /dev/null
+++ b/doc/doxyout/base/html/doc.png
Binary files differ
diff --git a/doc/doxyout/base/html/doxygen.css b/doc/doxyout/base/html/doxygen.css
new file mode 100644
index 000000000000..4f1ab9195b44
--- /dev/null
+++ b/doc/doxyout/base/html/doxygen.css
@@ -0,0 +1,1596 @@
+/* The standard CSS for doxygen 1.8.13 */
+body, table, div, p, dl {
+ font: 400 14px/22px Roboto,sans-serif;
+p.reference, p.definition {
+ font: 400 14px/22px Roboto,sans-serif;
+/* @group Heading Levels */
+h1.groupheader {
+ font-size: 150%;
+.title {
+ font: 400 14px/28px Roboto,sans-serif;
+ font-size: 150%;
+ font-weight: bold;
+ margin: 10px 2px;
+h2.groupheader {
+ border-bottom: 1px solid #879ECB;
+ color: #354C7B;
+ font-size: 150%;
+ font-weight: normal;
+ margin-top: 1.75em;
+ padding-top: 8px;
+ padding-bottom: 4px;
+ width: 100%;
+h3.groupheader {
+ font-size: 100%;
+h1, h2, h3, h4, h5, h6 {
+ -webkit-transition: text-shadow 0.5s linear;
+ -moz-transition: text-shadow 0.5s linear;
+ -ms-transition: text-shadow 0.5s linear;
+ -o-transition: text-shadow 0.5s linear;
+ transition: text-shadow 0.5s linear;
+ margin-right: 15px;
+h1.glow, h2.glow, h3.glow, h4.glow, h5.glow, h6.glow {
+ text-shadow: 0 0 15px cyan;
+dt {
+ font-weight: bold;
+div.multicol {
+ -moz-column-gap: 1em;
+ -webkit-column-gap: 1em;
+ -moz-column-count: 3;
+ -webkit-column-count: 3;
+p.startli, p.startdd {
+ margin-top: 2px;
+p.starttd {
+ margin-top: 0px;
+p.endli {
+ margin-bottom: 0px;
+p.enddd {
+ margin-bottom: 4px;
+p.endtd {
+ margin-bottom: 2px;
+/* @end */
+caption {
+ font-weight: bold;
+span.legend {
+ font-size: 70%;
+ text-align: center;
+h3.version {
+ font-size: 90%;
+ text-align: center;
+div.qindex, div.navtab{
+ background-color: #EBEFF6;
+ border: 1px solid #A3B4D7;
+ text-align: center;
+div.qindex, div.navpath {
+ width: 100%;
+ line-height: 140%;
+div.navtab {
+ margin-right: 15px;
+/* @group Link Styling */
+a {
+ color: #3D578C;
+ font-weight: normal;
+ text-decoration: none;
+.contents a:visited {
+ color: #4665A2;
+a:hover {
+ text-decoration: underline;
+a.qindex {
+ font-weight: bold;
+a.qindexHL {
+ font-weight: bold;
+ background-color: #9CAFD4;
+ color: #ffffff;
+ border: 1px double #869DCA;
+.contents a.qindexHL:visited {
+ color: #ffffff;
+a.el {
+ font-weight: bold;
+a.elRef {
+a.code, a.code:visited, a.line, a.line:visited {
+ color: #4665A2;
+a.codeRef, a.codeRef:visited, a.lineRef, a.lineRef:visited {
+ color: #4665A2;
+/* @end */
+dl.el {
+ margin-left: -1cm;
+pre.fragment {
+ border: 1px solid #C4CFE5;
+ background-color: #FBFCFD;
+ padding: 4px 6px;
+ margin: 4px 8px 4px 2px;
+ overflow: auto;
+ word-wrap: break-word;
+ font-size: 9pt;
+ line-height: 125%;
+ font-family: monospace, fixed;
+ font-size: 105%;
+div.fragment {
+ padding: 0px;
+ margin: 4px 8px 4px 2px;
+ background-color: #FBFCFD;
+ border: 1px solid #C4CFE5;
+div.line {
+ font-family: monospace, fixed;
+ font-size: 13px;
+ min-height: 13px;
+ line-height: 1.0;
+ text-wrap: unrestricted;
+ white-space: -moz-pre-wrap; /* Moz */
+ white-space: -pre-wrap; /* Opera 4-6 */
+ white-space: -o-pre-wrap; /* Opera 7 */
+ white-space: pre-wrap; /* CSS3 */
+ word-wrap: break-word; /* IE 5.5+ */
+ text-indent: -53px;
+ padding-left: 53px;
+ padding-bottom: 0px;
+ margin: 0px;
+ -webkit-transition-property: background-color, box-shadow;
+ -webkit-transition-duration: 0.5s;
+ -moz-transition-property: background-color, box-shadow;
+ -moz-transition-duration: 0.5s;
+ -ms-transition-property: background-color, box-shadow;
+ -ms-transition-duration: 0.5s;
+ -o-transition-property: background-color, box-shadow;
+ -o-transition-duration: 0.5s;
+ transition-property: background-color, box-shadow;
+ transition-duration: 0.5s;
+div.line:after {
+ content:"\000A";
+ white-space: pre;
+div.line.glow {
+ background-color: cyan;
+ box-shadow: 0 0 10px cyan;
+span.lineno {
+ padding-right: 4px;
+ text-align: right;
+ border-right: 2px solid #0F0;
+ background-color: #E8E8E8;
+ white-space: pre;
+span.lineno a {
+ background-color: #D8D8D8;
+span.lineno a:hover {
+ background-color: #C8C8C8;
+.lineno {
+ -webkit-touch-callout: none;
+ -webkit-user-select: none;
+ -khtml-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+div.ah, span.ah {
+ background-color: black;
+ font-weight: bold;
+ color: #ffffff;
+ margin-bottom: 3px;
+ margin-top: 3px;
+ padding: 0.2em;
+ border: solid thin #333;
+ border-radius: 0.5em;
+ -webkit-border-radius: .5em;
+ -moz-border-radius: .5em;
+ box-shadow: 2px 2px 3px #999;
+ -webkit-box-shadow: 2px 2px 3px #999;
+ -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#000),color-stop(0.3, #444));
+ background-image: -moz-linear-gradient(center top, #eee 0%, #444 40%, #000 110%);
+div.classindex ul {
+ list-style: none;
+ padding-left: 0;
+div.classindex span.ai {
+ display: inline-block;
+div.groupHeader {
+ margin-left: 16px;
+ margin-top: 12px;
+ font-weight: bold;
+div.groupText {
+ margin-left: 16px;
+ font-style: italic;
+body {
+ background-color: white;
+ color: black;
+ margin: 0;
+div.contents {
+ margin-top: 10px;
+ margin-left: 12px;
+ margin-right: 8px;
+td.indexkey {
+ background-color: #EBEFF6;
+ font-weight: bold;
+ border: 1px solid #C4CFE5;
+ margin: 2px 0px 2px 0;
+ padding: 2px 10px;
+ white-space: nowrap;
+ vertical-align: top;
+td.indexvalue {
+ background-color: #EBEFF6;
+ border: 1px solid #C4CFE5;
+ padding: 2px 10px;
+ margin: 2px 0px;
+tr.memlist {
+ background-color: #EEF1F7;
+p.formulaDsp {
+ text-align: center;
+img.formulaDsp {
+img.formulaInl {
+ vertical-align: middle;
+div.center {
+ text-align: center;
+ margin-top: 0px;
+ margin-bottom: 0px;
+ padding: 0px;
+div.center img {
+ border: 0px;
+address.footer {
+ text-align: right;
+ padding-right: 12px;
+img.footer {
+ border: 0px;
+ vertical-align: middle;
+/* @group Code Colorization */
+span.keyword {
+ color: #008000
+span.keywordtype {
+ color: #604020
+span.keywordflow {
+ color: #e08000
+span.comment {
+ color: #800000
+span.preprocessor {
+ color: #806020
+span.stringliteral {
+ color: #002080
+span.charliteral {
+ color: #008080
+span.vhdldigit {
+ color: #ff00ff
+span.vhdlchar {
+ color: #000000
+span.vhdlkeyword {
+ color: #700070
+span.vhdllogic {
+ color: #ff0000
+blockquote {
+ background-color: #F7F8FB;
+ border-left: 2px solid #9CAFD4;
+ margin: 0 24px 0 4px;
+ padding: 0 12px 0 16px;
+/* @end */
+.search {
+ color: #003399;
+ font-weight: bold;
+form.search {
+ margin-bottom: 0px;
+ margin-top: 0px;
+input.search {
+ font-size: 75%;
+ color: #000080;
+ font-weight: normal;
+ background-color: #e8eef2;
+td.tiny {
+ font-size: 75%;
+.dirtab {
+ padding: 4px;
+ border-collapse: collapse;
+ border: 1px solid #A3B4D7;
+th.dirtab {
+ background: #EBEFF6;
+ font-weight: bold;
+hr {
+ height: 0px;
+ border: none;
+ border-top: 1px solid #4A6AAA;
+hr.footer {
+ height: 1px;
+/* @group Member Descriptions */
+table.memberdecls {
+ border-spacing: 0px;
+ padding: 0px;
+.memberdecls td, .fieldtable tr {
+ -webkit-transition-property: background-color, box-shadow;
+ -webkit-transition-duration: 0.5s;
+ -moz-transition-property: background-color, box-shadow;
+ -moz-transition-duration: 0.5s;
+ -ms-transition-property: background-color, box-shadow;
+ -ms-transition-duration: 0.5s;
+ -o-transition-property: background-color, box-shadow;
+ -o-transition-duration: 0.5s;
+ transition-property: background-color, box-shadow;
+ transition-duration: 0.5s;
+.memberdecls td.glow, .fieldtable tr.glow {
+ background-color: cyan;
+ box-shadow: 0 0 15px cyan;
+.mdescLeft, .mdescRight,
+.memItemLeft, .memItemRight,
+.memTemplItemLeft, .memTemplItemRight, .memTemplParams {
+ background-color: #F9FAFC;
+ border: none;
+ margin: 4px;
+ padding: 1px 0 0 8px;
+.mdescLeft, .mdescRight {
+ padding: 0px 8px 4px 8px;
+ color: #555;
+.memSeparator {
+ border-bottom: 1px solid #DEE4F0;
+ line-height: 1px;
+ margin: 0px;
+ padding: 0px;
+.memItemLeft, .memTemplItemLeft {
+ white-space: nowrap;
+.memItemRight {
+ width: 100%;
+.memTemplParams {
+ color: #4665A2;
+ white-space: nowrap;
+ font-size: 80%;
+/* @end */
+/* @group Member Details */
+/* Styles for detailed member documentation */
+.memtitle {
+ padding: 8px;
+ border-top: 1px solid #A8B8D9;
+ border-left: 1px solid #A8B8D9;
+ border-right: 1px solid #A8B8D9;
+ border-top-right-radius: 4px;
+ border-top-left-radius: 4px;
+ margin-bottom: -1px;
+ background-image: url('nav_f.png');
+ background-repeat: repeat-x;
+ background-color: #E2E8F2;
+ line-height: 1.25;
+ font-weight: 300;
+ float:left;
+ font-size: 65%;
+ display: inline-block;
+ vertical-align: middle;
+.memtemplate {
+ font-size: 80%;
+ color: #4665A2;
+ font-weight: normal;
+ margin-left: 9px;
+.memnav {
+ background-color: #EBEFF6;
+ border: 1px solid #A3B4D7;
+ text-align: center;
+ margin: 2px;
+ margin-right: 15px;
+ padding: 2px;
+.mempage {
+ width: 100%;
+.memitem {
+ padding: 0;
+ margin-bottom: 10px;
+ margin-right: 5px;
+ -webkit-transition: box-shadow 0.5s linear;
+ -moz-transition: box-shadow 0.5s linear;
+ -ms-transition: box-shadow 0.5s linear;
+ -o-transition: box-shadow 0.5s linear;
+ transition: box-shadow 0.5s linear;
+ display: table !important;
+ width: 100%;
+.memitem.glow {
+ box-shadow: 0 0 15px cyan;
+.memname {
+ font-weight: 400;
+ margin-left: 6px;
+.memname td {
+ vertical-align: bottom;
+.memproto, dl.reflist dt {
+ border-top: 1px solid #A8B8D9;
+ border-left: 1px solid #A8B8D9;
+ border-right: 1px solid #A8B8D9;
+ padding: 6px 0px 6px 0px;
+ color: #253555;
+ font-weight: bold;
+ text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9);
+ background-color: #DFE5F1;
+ /* opera specific markup */
+ box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
+ border-top-right-radius: 4px;
+ /* firefox specific markup */
+ -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px;
+ -moz-border-radius-topright: 4px;
+ /* webkit specific markup */
+ -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
+ -webkit-border-top-right-radius: 4px;
+.overload {
+ font-family: "courier new",courier,monospace;
+ font-size: 65%;
+.memdoc, dl.reflist dd {
+ border-bottom: 1px solid #A8B8D9;
+ border-left: 1px solid #A8B8D9;
+ border-right: 1px solid #A8B8D9;
+ padding: 6px 10px 2px 10px;
+ background-color: #FBFCFD;
+ border-top-width: 0;
+ background-image:url('nav_g.png');
+ background-repeat:repeat-x;
+ background-color: #FFFFFF;
+ /* opera specific markup */
+ border-bottom-left-radius: 4px;
+ border-bottom-right-radius: 4px;
+ box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
+ /* firefox specific markup */
+ -moz-border-radius-bottomleft: 4px;
+ -moz-border-radius-bottomright: 4px;
+ -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px;
+ /* webkit specific markup */
+ -webkit-border-bottom-left-radius: 4px;
+ -webkit-border-bottom-right-radius: 4px;
+ -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
+dl.reflist dt {
+ padding: 5px;
+dl.reflist dd {
+ margin: 0px 0px 10px 0px;
+ padding: 5px;
+.paramkey {
+ text-align: right;
+.paramtype {
+ white-space: nowrap;
+.paramname {
+ color: #602020;
+ white-space: nowrap;
+.paramname em {
+ font-style: normal;
+.paramname code {
+ line-height: 14px;
+.params, .retval, .exception, .tparams {
+ margin-left: 0px;
+ padding-left: 0px;
+.params .paramname, .retval .paramname {
+ font-weight: bold;
+ vertical-align: top;
+.params .paramtype {
+ font-style: italic;
+ vertical-align: top;
+.params .paramdir {
+ font-family: "courier new",courier,monospace;
+ vertical-align: top;
+table.mlabels {
+ border-spacing: 0px;
+td.mlabels-left {
+ width: 100%;
+ padding: 0px;
+td.mlabels-right {
+ vertical-align: bottom;
+ padding: 0px;
+ white-space: nowrap;
+span.mlabels {
+ margin-left: 8px;
+span.mlabel {
+ background-color: #728DC1;
+ border-top:1px solid #5373B4;
+ border-left:1px solid #5373B4;
+ border-right:1px solid #C4CFE5;
+ border-bottom:1px solid #C4CFE5;
+ text-shadow: none;
+ color: white;
+ margin-right: 4px;
+ padding: 2px 3px;
+ border-radius: 3px;
+ font-size: 7pt;
+ white-space: nowrap;
+ vertical-align: middle;
+/* @end */
+/* these are for tree view inside a (index) page */
+div.directory {
+ margin: 10px 0px;
+ border-top: 1px solid #9CAFD4;
+ border-bottom: 1px solid #9CAFD4;
+ width: 100%;
+.directory table {
+ border-collapse:collapse;
+.directory td {
+ margin: 0px;
+ padding: 0px;
+ vertical-align: top;
+.directory td.entry {
+ white-space: nowrap;
+ padding-right: 6px;
+ padding-top: 3px;
+.directory td.entry a {
+ outline:none;
+.directory td.entry a img {
+ border: none;
+.directory td.desc {
+ width: 100%;
+ padding-left: 6px;
+ padding-right: 6px;
+ padding-top: 3px;
+ border-left: 1px solid rgba(0,0,0,0.05);
+.directory tr.even {
+ padding-left: 6px;
+ background-color: #F7F8FB;
+.directory img {
+ vertical-align: -30%;
+.directory .levels {
+ white-space: nowrap;
+ width: 100%;
+ text-align: right;
+ font-size: 9pt;
+.directory .levels span {
+ cursor: pointer;
+ padding-left: 2px;
+ padding-right: 2px;
+ color: #3D578C;
+.arrow {
+ color: #9CAFD4;
+ -webkit-user-select: none;
+ -khtml-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+ cursor: pointer;
+ font-size: 80%;
+ display: inline-block;
+ width: 16px;
+ height: 22px;
+.icon {
+ font-family: Arial, Helvetica;
+ font-weight: bold;
+ font-size: 12px;
+ height: 14px;
+ width: 16px;
+ display: inline-block;
+ background-color: #728DC1;
+ color: white;
+ text-align: center;
+ border-radius: 4px;
+ margin-left: 2px;
+ margin-right: 2px;
+.icona {
+ width: 24px;
+ height: 22px;
+ display: inline-block;
+.iconfopen {
+ width: 24px;
+ height: 18px;
+ margin-bottom: 4px;
+ background-image:url('folderopen.png');
+ background-position: 0px -4px;
+ background-repeat: repeat-y;
+ vertical-align:top;
+ display: inline-block;
+.iconfclosed {
+ width: 24px;
+ height: 18px;
+ margin-bottom: 4px;
+ background-image:url('folderclosed.png');
+ background-position: 0px -4px;
+ background-repeat: repeat-y;
+ vertical-align:top;
+ display: inline-block;
+.icondoc {
+ width: 24px;
+ height: 18px;
+ margin-bottom: 4px;
+ background-image:url('doc.png');
+ background-position: 0px -4px;
+ background-repeat: repeat-y;
+ vertical-align:top;
+ display: inline-block;
+table.directory {
+ font: 400 14px Roboto,sans-serif;
+/* @end */
+div.dynheader {
+ margin-top: 8px;
+ -webkit-touch-callout: none;
+ -webkit-user-select: none;
+ -khtml-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+address {
+ font-style: normal;
+ color: #2A3D61;
+table.doxtable caption {
+ caption-side: top;
+table.doxtable {
+ border-collapse:collapse;
+ margin-top: 4px;
+ margin-bottom: 4px;
+table.doxtable td, table.doxtable th {
+ border: 1px solid #2D4068;
+ padding: 3px 7px 2px;
+table.doxtable th {
+ background-color: #374F7F;
+ color: #FFFFFF;
+ font-size: 110%;
+ padding-bottom: 4px;
+ padding-top: 5px;
+table.fieldtable {
+ /*width: 100%;*/
+ margin-bottom: 10px;
+ border: 1px solid #A8B8D9;
+ border-spacing: 0px;
+ -moz-border-radius: 4px;
+ -webkit-border-radius: 4px;
+ border-radius: 4px;
+ -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px;
+ -webkit-box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15);
+ box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15);
+.fieldtable td, .fieldtable th {
+ padding: 3px 7px 2px;
+.fieldtable td.fieldtype, .fieldtable td.fieldname {
+ white-space: nowrap;
+ border-right: 1px solid #A8B8D9;
+ border-bottom: 1px solid #A8B8D9;
+ vertical-align: top;
+.fieldtable td.fieldname {
+ padding-top: 3px;
+.fieldtable td.fielddoc {
+ border-bottom: 1px solid #A8B8D9;
+ /*width: 100%;*/
+.fieldtable td.fielddoc p:first-child {
+ margin-top: 0px;
+.fieldtable td.fielddoc p:last-child {
+ margin-bottom: 2px;
+.fieldtable tr:last-child td {
+ border-bottom: none;
+.fieldtable th {
+ background-image:url('nav_f.png');
+ background-repeat:repeat-x;
+ background-color: #E2E8F2;
+ font-size: 90%;
+ color: #253555;
+ padding-bottom: 4px;
+ padding-top: 5px;
+ text-align:left;
+ font-weight: 400;
+ -moz-border-radius-topleft: 4px;
+ -moz-border-radius-topright: 4px;
+ -webkit-border-top-left-radius: 4px;
+ -webkit-border-top-right-radius: 4px;
+ border-top-left-radius: 4px;
+ border-top-right-radius: 4px;
+ border-bottom: 1px solid #A8B8D9;
+.tabsearch {
+ top: 0px;
+ left: 10px;
+ height: 36px;
+ background-image: url('tab_b.png');
+ z-index: 101;
+ overflow: hidden;
+ font-size: 13px;
+.navpath ul
+ font-size: 11px;
+ background-image:url('tab_b.png');
+ background-repeat:repeat-x;
+ background-position: 0 -5px;
+ height:30px;
+ line-height:30px;
+ color:#8AA0CC;
+ border:solid 1px #C2CDE4;
+ overflow:hidden;
+ margin:0px;
+ padding:0px;
+.navpath li
+ list-style-type:none;
+ float:left;
+ padding-left:10px;
+ padding-right:15px;
+ background-image:url('bc_s.png');
+ background-repeat:no-repeat;
+ background-position:right;
+ color:#364D7C;
+.navpath li.navelem a
+ height:32px;
+ display:block;
+ text-decoration: none;
+ outline: none;
+ color: #283A5D;
+ font-family: 'Lucida Grande',Geneva,Helvetica,Arial,sans-serif;
+ text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9);
+ text-decoration: none;
+.navpath li.navelem a:hover
+ color:#6884BD;
+.navpath li.footer
+ list-style-type:none;
+ float:right;
+ padding-left:10px;
+ padding-right:15px;
+ background-image:none;
+ background-repeat:no-repeat;
+ background-position:right;
+ color:#364D7C;
+ font-size: 8pt;
+ float: right;
+ font-size: 8pt;
+ padding-right: 5px;
+ width: 50%;
+ text-align: right;
+div.summary a
+ white-space: nowrap;
+ margin: 10px;
+ white-space: nowrap;
+ margin-left: 3%;
+ margin-right: 3%;
+ width: 94%;
+ border: 0;
+ border-spacing: 0;
+ padding: 0;
+ font-size: 8pt;
+ width: 50%;
+ text-align: left;
+div.ingroups a
+ white-space: nowrap;
+ background-image:url('nav_h.png');
+ background-repeat:repeat-x;
+ background-color: #F9FAFC;
+ margin: 0px;
+ border-bottom: 1px solid #C4CFE5;
+ padding: 5px 5px 5px 10px;
+ padding: 0 0 0 10px;
+/* dl.note, dl.warning, dl.attention, dl.pre, dl.post, dl.invariant, dl.deprecated, dl.todo, dl.test, dl.bug */
+ margin-left: 0px;
+ padding-left: 0px;
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #D0C000;
+dl.warning, dl.attention
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #FF0000;
+dl.pre, dl.post, dl.invariant
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #00D000;
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #505050;
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #00C0E0;
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #3030E0;
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #C08050;
+dl.section dd {
+ margin-bottom: 6px;
+ text-align: center;
+ vertical-align: bottom;
+ border-collapse: separate;
+#projectlogo img
+ border: 0px none;
+ vertical-align: middle;
+ font: 300% Tahoma, Arial,sans-serif;
+ margin: 0px;
+ padding: 2px 0px;
+ font: 120% Tahoma, Arial,sans-serif;
+ margin: 0px;
+ padding: 0px;
+ font: 50% Tahoma, Arial,sans-serif;
+ margin: 0px;
+ padding: 0px;
+ padding: 0px;
+ margin: 0px;
+ width: 100%;
+ border-bottom: 1px solid #5373B4;
+ text-align: center;
+ text-align: center;
+ text-align: center;
+ text-align: center;
+ text-align: center;
+ font-weight: bold;
+ border: 1px solid #90A5CE;
+dl.citelist {
+ margin-bottom:50px;
+dl.citelist dt {
+ color:#334975;
+ float:left;
+ font-weight:bold;
+ margin-right:10px;
+ padding:5px;
+dl.citelist dd {
+ margin:2px 0;
+ padding:5px 0;
+div.toc {
+ padding: 14px 25px;
+ background-color: #F4F6FA;
+ border: 1px solid #D8DFEE;
+ border-radius: 7px 7px 7px 7px;
+ float: right;
+ height: auto;
+ margin: 0 8px 10px 10px;
+ width: 200px;
+div.toc li {
+ background: url("bdwn.png") no-repeat scroll 0 5px transparent;
+ font: 10px/1.2 Verdana,DejaVu Sans,Geneva,sans-serif;
+ margin-top: 5px;
+ padding-left: 10px;
+ padding-top: 2px;
+div.toc h3 {
+ font: bold 12px/1.2 Arial,FreeSans,sans-serif;
+ color: #4665A2;
+ border-bottom: 0 none;
+ margin: 0;
+div.toc ul {
+ list-style: none outside none;
+ border: medium none;
+ padding: 0px;
+div.toc li.level1 {
+ margin-left: 0px;
+div.toc li.level2 {
+ margin-left: 15px;
+div.toc li.level3 {
+ margin-left: 30px;
+div.toc li.level4 {
+ margin-left: 45px;
+.inherit_header {
+ font-weight: bold;
+ color: gray;
+ cursor: pointer;
+ -webkit-touch-callout: none;
+ -webkit-user-select: none;
+ -khtml-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+.inherit_header td {
+ padding: 6px 0px 2px 5px;
+.inherit {
+ display: none;
+tr.heading h2 {
+ margin-top: 12px;
+ margin-bottom: 4px;
+/* tooltip related style info */
+.ttc {
+ position: absolute;
+ display: none;
+#powerTip {
+ cursor: default;
+ white-space: nowrap;
+ background-color: white;
+ border: 1px solid gray;
+ border-radius: 4px 4px 4px 4px;
+ box-shadow: 1px 1px 7px gray;
+ display: none;
+ font-size: smaller;
+ max-width: 80%;
+ opacity: 0.9;
+ padding: 1ex 1em 1em;
+ position: absolute;
+ z-index: 2147483647;
+#powerTip div.ttdoc {
+ color: grey;
+ font-style: italic;
+#powerTip div.ttname a {
+ font-weight: bold;
+#powerTip div.ttname {
+ font-weight: bold;
+#powerTip div.ttdeci {
+ color: #006318;
+#powerTip div {
+ margin: 0px;
+ padding: 0px;
+ font: 12px/16px Roboto,sans-serif;
+#powerTip:before, #powerTip:after {
+ content: "";
+ position: absolute;
+ margin: 0px;
+#powerTip.n:after, #powerTip.n:before,
+#powerTip.s:after, #powerTip.s:before,
+#powerTip.w:after, #powerTip.w:before,
+#powerTip.e:after, #powerTip.e:before,
+#powerTip.ne:after, #powerTip.ne:before,
+#powerTip.se:after, #powerTip.se:before,
+#powerTip.nw:after, #powerTip.nw:before,
+#powerTip.sw:after, #powerTip.sw:before {
+ border: solid transparent;
+ content: " ";
+ height: 0;
+ width: 0;
+ position: absolute;
+#powerTip.n:after, #powerTip.s:after,
+#powerTip.w:after, #powerTip.e:after,
+#powerTip.nw:after, #powerTip.ne:after,
+#powerTip.sw:after, #powerTip.se:after {
+ border-color: rgba(255, 255, 255, 0);
+#powerTip.n:before, #powerTip.s:before,
+#powerTip.w:before, #powerTip.e:before,
+#powerTip.nw:before, #powerTip.ne:before,
+#powerTip.sw:before, #powerTip.se:before {
+ border-color: rgba(128, 128, 128, 0);
+#powerTip.n:after, #powerTip.n:before,
+#powerTip.ne:after, #powerTip.ne:before,
+#powerTip.nw:after, #powerTip.nw:before {
+ top: 100%;
+#powerTip.n:after, #powerTip.ne:after, #powerTip.nw:after {
+ border-top-color: #ffffff;
+ border-width: 10px;
+ margin: 0px -10px;
+#powerTip.n:before {
+ border-top-color: #808080;
+ border-width: 11px;
+ margin: 0px -11px;
+#powerTip.n:after, #powerTip.n:before {
+ left: 50%;
+#powerTip.nw:after, #powerTip.nw:before {
+ right: 14px;
+#powerTip.ne:after, #powerTip.ne:before {
+ left: 14px;
+#powerTip.s:after, #powerTip.s:before,
+#powerTip.se:after, #powerTip.se:before,
+#powerTip.sw:after, #powerTip.sw:before {
+ bottom: 100%;
+#powerTip.s:after, #powerTip.se:after, #powerTip.sw:after {
+ border-bottom-color: #ffffff;
+ border-width: 10px;
+ margin: 0px -10px;
+#powerTip.s:before, #powerTip.se:before, #powerTip.sw:before {
+ border-bottom-color: #808080;
+ border-width: 11px;
+ margin: 0px -11px;
+#powerTip.s:after, #powerTip.s:before {
+ left: 50%;
+#powerTip.sw:after, #powerTip.sw:before {
+ right: 14px;
+#powerTip.se:after, #powerTip.se:before {
+ left: 14px;
+#powerTip.e:after, #powerTip.e:before {
+ left: 100%;
+#powerTip.e:after {
+ border-left-color: #ffffff;
+ border-width: 10px;
+ top: 50%;
+ margin-top: -10px;
+#powerTip.e:before {
+ border-left-color: #808080;
+ border-width: 11px;
+ top: 50%;
+ margin-top: -11px;
+#powerTip.w:after, #powerTip.w:before {
+ right: 100%;
+#powerTip.w:after {
+ border-right-color: #ffffff;
+ border-width: 10px;
+ top: 50%;
+ margin-top: -10px;
+#powerTip.w:before {
+ border-right-color: #808080;
+ border-width: 11px;
+ top: 50%;
+ margin-top: -11px;
+@media print
+ #top { display: none; }
+ #side-nav { display: none; }
+ #nav-path { display: none; }
+ body { overflow:visible; }
+ h1, h2, h3, h4, h5, h6 { page-break-after: avoid; }
+ .summary { display: none; }
+ .memitem { page-break-inside: avoid; }
+ #doc-content
+ {
+ margin-left:0 !important;
+ height:auto !important;
+ width:auto !important;
+ overflow:inherit;
+ display:inline;
+ }
+/* @group Markdown */
+table.markdownTable {
+ border-collapse:collapse;
+ margin-top: 4px;
+ margin-bottom: 4px;
+table.markdownTable td, table.markdownTable th {
+ border: 1px solid #2D4068;
+ padding: 3px 7px 2px;
+table.markdownTableHead tr {
+table.markdownTableBodyLeft td, table.markdownTable th {
+ border: 1px solid #2D4068;
+ padding: 3px 7px 2px;
+th.markdownTableHeadLeft th.markdownTableHeadRight th.markdownTableHeadCenter th.markdownTableHeadNone {
+ background-color: #374F7F;
+ color: #FFFFFF;
+ font-size: 110%;
+ padding-bottom: 4px;
+ padding-top: 5px;
+th.markdownTableHeadLeft {
+ text-align: left
+th.markdownTableHeadRight {
+ text-align: right
+th.markdownTableHeadCenter {
+ text-align: center
+table.markdownTable {
+ border-collapse:collapse;
+ margin-top: 4px;
+ margin-bottom: 4px;
+table.markdownTable td, table.markdownTable th {
+ border: 1px solid #2D4068;
+ padding: 3px 7px 2px;
+table.markdownTable tr {
+th.markdownTableHeadLeft, th.markdownTableHeadRight, th.markdownTableHeadCenter, th.markdownTableHeadNone {
+ background-color: #374F7F;
+ color: #FFFFFF;
+ font-size: 110%;
+ padding-bottom: 4px;
+ padding-top: 5px;
+th.markdownTableHeadLeft, td.markdownTableBodyLeft {
+ text-align: left
+th.markdownTableHeadRight, td.markdownTableBodyRight {
+ text-align: right
+th.markdownTableHeadCenter, td.markdownTableBodyCenter {
+ text-align: center
+/* @end */
diff --git a/doc/doxyout/base/html/doxygen.png b/doc/doxyout/base/html/doxygen.png
new file mode 100644
index 000000000000..3ff17d807fd8
--- /dev/null
+++ b/doc/doxyout/base/html/doxygen.png
Binary files differ
diff --git a/doc/doxyout/base/html/dynsections.js b/doc/doxyout/base/html/dynsections.js
new file mode 100644
index 000000000000..85e183690954
--- /dev/null
+++ b/doc/doxyout/base/html/dynsections.js
@@ -0,0 +1,97 @@
+function toggleVisibility(linkObj)
+ var base = $(linkObj).attr('id');
+ var summary = $('#'+base+'-summary');
+ var content = $('#'+base+'-content');
+ var trigger = $('#'+base+'-trigger');
+ var src=$(trigger).attr('src');
+ if (content.is(':visible')===true) {
+ content.hide();
+ summary.show();
+ $(linkObj).addClass('closed').removeClass('opened');
+ $(trigger).attr('src',src.substring(0,src.length-8)+'closed.png');
+ } else {
+ content.show();
+ summary.hide();
+ $(linkObj).removeClass('closed').addClass('opened');
+ $(trigger).attr('src',src.substring(0,src.length-10)+'open.png');
+ }
+ return false;
+function updateStripes()
+ $('table.directory tr').
+ removeClass('even').filter(':visible:even').addClass('even');
+function toggleLevel(level)
+ $('table.directory tr').each(function() {
+ var l = this.id.split('_').length-1;
+ var i = $('#img'+this.id.substring(3));
+ var a = $('#arr'+this.id.substring(3));
+ if (l<level+1) {
+ i.removeClass('iconfopen iconfclosed').addClass('iconfopen');
+ a.html('&#9660;');
+ $(this).show();
+ } else if (l==level+1) {
+ i.removeClass('iconfclosed iconfopen').addClass('iconfclosed');
+ a.html('&#9658;');
+ $(this).show();
+ } else {
+ $(this).hide();
+ }
+ });
+ updateStripes();
+function toggleFolder(id)
+ // the clicked row
+ var currentRow = $('#row_'+id);
+ // all rows after the clicked row
+ var rows = currentRow.nextAll("tr");
+ var re = new RegExp('^row_'+id+'\\d+_$', "i"); //only one sub
+ // only match elements AFTER this one (can't hide elements before)
+ var childRows = rows.filter(function() { return this.id.match(re); });
+ // first row is visible we are HIDING
+ if (childRows.filter(':first').is(':visible')===true) {
+ // replace down arrow by right arrow for current row
+ var currentRowSpans = currentRow.find("span");
+ currentRowSpans.filter(".iconfopen").removeClass("iconfopen").addClass("iconfclosed");
+ currentRowSpans.filter(".arrow").html('&#9658;');
+ rows.filter("[id^=row_"+id+"]").hide(); // hide all children
+ } else { // we are SHOWING
+ // replace right arrow by down arrow for current row
+ var currentRowSpans = currentRow.find("span");
+ currentRowSpans.filter(".iconfclosed").removeClass("iconfclosed").addClass("iconfopen");
+ currentRowSpans.filter(".arrow").html('&#9660;');
+ // replace down arrows by right arrows for child rows
+ var childRowsSpans = childRows.find("span");
+ childRowsSpans.filter(".iconfopen").removeClass("iconfopen").addClass("iconfclosed");
+ childRowsSpans.filter(".arrow").html('&#9658;');
+ childRows.show(); //show all children
+ }
+ updateStripes();
+function toggleInherit(id)
+ var rows = $('tr.inherit.'+id);
+ var img = $('tr.inherit_header.'+id+' img');
+ var src = $(img).attr('src');
+ if (rows.filter(':first').is(':visible')===true) {
+ rows.css('display','none');
+ $(img).attr('src',src.substring(0,src.length-8)+'closed.png');
+ } else {
+ rows.css('display','table-row'); // using show() causes jump in firefox
+ $(img).attr('src',src.substring(0,src.length-10)+'open.png');
+ }
diff --git a/doc/doxyout/base/html/folderclosed.png b/doc/doxyout/base/html/folderclosed.png
new file mode 100644
index 000000000000..bb8ab35edce8
--- /dev/null
+++ b/doc/doxyout/base/html/folderclosed.png
Binary files differ
diff --git a/doc/doxyout/base/html/folderopen.png b/doc/doxyout/base/html/folderopen.png
new file mode 100644
index 000000000000..d6c7f676a3b3
--- /dev/null
+++ b/doc/doxyout/base/html/folderopen.png
Binary files differ
diff --git a/doc/doxyout/base/html/graph_legend.html b/doc/doxyout/base/html/graph_legend.html
new file mode 100644
index 000000000000..21148d1fd6ce
--- /dev/null
+++ b/doc/doxyout/base/html/graph_legend.html
@@ -0,0 +1,59 @@
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN">
+<html><head><meta http-equiv="Content-Type" content="text/html;charset=UTF-8">
+<title>Graph Legend</title>
+<link href="doxygen.css" rel="stylesheet" type="text/css">
+<link href="tabs.css" rel="stylesheet" type="text/css">
+<a href="http://www.h5l.org/"><img src="http://www.h5l.org/keyhole-heimdal.png" alt="keyhole logo"/></a>
+<!-- end of header marker -->
+<!-- Generated by Doxygen 1.8.13 -->
+<script type="text/javascript" src="menudata.js"></script>
+<script type="text/javascript" src="menu.js"></script>
+<script type="text/javascript">
+$(function() {
+ initMenu('',false,false,'search.php','Search');
+<div id="main-nav"></div>
+</div><!-- top -->
+<div class="header">
+ <div class="headertitle">
+<div class="title">Graph Legend</div> </div>
+<div class="contents">
+<p>This page explains how to interpret the graphs that are generated by doxygen.</p>
+<p>Consider the following example: </p><div class="fragment"><div class="line">/*! Invisible class because of truncation */</div><div class="line">class Invisible { };</div><div class="line"></div><div class="line">/*! Truncated class, inheritance relation is hidden */</div><div class="line">class Truncated : public Invisible { };</div><div class="line"></div><div class="line">/* Class not documented with doxygen comments */</div><div class="line">class Undocumented { };</div><div class="line"></div><div class="line">/*! Class that is inherited using public inheritance */</div><div class="line">class PublicBase : public Truncated { };</div><div class="line"></div><div class="line">/*! A template class */</div><div class="line">template&lt;class T&gt; class Templ { };</div><div class="line"></div><div class="line">/*! Class that is inherited using protected inheritance */</div><div class="line">class ProtectedBase { };</div><div class="line"></div><div class="line">/*! Class that is inherited using private inheritance */</div><div class="line">class PrivateBase { };</div><div class="line"></div><div class="line">/*! Class that is used by the Inherited class */</div><div class="line">class Used { };</div><div class="line"></div><div class="line">/*! Super class that inherits a number of other classes */</div><div class="line">class Inherited : public PublicBase,</div><div class="line"> protected ProtectedBase,</div><div class="line"> private PrivateBase,</div><div class="line"> public Undocumented,</div><div class="line"> public Templ&lt;int&gt;</div><div class="line">{</div><div class="line"> private:</div><div class="line"> Used *m_usedClass;</div><div class="line">};</div></div><!-- fragment --><p> This will result in the following graph:</p>
+<center><div class="image">
+<img src="graph_legend.png"/>
+</center><p>The boxes in the above graph have the following meaning: </p>
+A filled gray box represents the struct or class for which the graph is generated. </li>
+A box with a black border denotes a documented struct or class. </li>
+A box with a gray border denotes an undocumented struct or class. </li>
+A box with a red border denotes a documented struct or class forwhich not all inheritance/containment relations are shown. A graph is truncated if it does not fit within the specified boundaries. </li>
+<p>The arrows have the following meaning: </p>
+A dark blue arrow is used to visualize a public inheritance relation between two classes. </li>
+A dark green arrow is used for protected inheritance. </li>
+A dark red arrow is used for private inheritance. </li>
+A purple dashed arrow is used if a class is contained or used by another class. The arrow is labelled with the variable(s) through which the pointed class or struct is accessible. </li>
+A yellow dashed arrow denotes a relation between a template instance and the template class it was instantiated from. The arrow is labelled with the template parameters of the instance. </li>
+</div><!-- contents -->
+<hr size="1"><address style="text-align: right;"><small>
+Generated on Fri Dec 8 2017 03:48:57 for Heimdalbaselibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.8.13</small></address>
diff --git a/doc/doxyout/base/html/graph_legend.md5 b/doc/doxyout/base/html/graph_legend.md5
new file mode 100644
index 000000000000..a06ed050cbb5
--- /dev/null
+++ b/doc/doxyout/base/html/graph_legend.md5
@@ -0,0 +1 @@
+387ff8eb65306fa251338d3c9bd7bfff \ No newline at end of file
diff --git a/doc/doxyout/base/html/graph_legend.png b/doc/doxyout/base/html/graph_legend.png
new file mode 100644
index 000000000000..881e40f9c0a2
--- /dev/null
+++ b/doc/doxyout/base/html/graph_legend.png
Binary files differ
diff --git a/doc/doxyout/base/html/group__heimbase.html b/doc/doxyout/base/html/group__heimbase.html
new file mode 100644
index 000000000000..35ed5c54071e
--- /dev/null
+++ b/doc/doxyout/base/html/group__heimbase.html
@@ -0,0 +1,231 @@
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN">
+<html><head><meta http-equiv="Content-Type" content="text/html;charset=UTF-8">
+<link href="doxygen.css" rel="stylesheet" type="text/css">
+<link href="tabs.css" rel="stylesheet" type="text/css">
+<a href="http://www.h5l.org/"><img src="http://www.h5l.org/keyhole-heimdal.png" alt="keyhole logo"/></a>
+<!-- end of header marker -->
+<!-- Generated by Doxygen 1.8.13 -->
+<script type="text/javascript" src="menudata.js"></script>
+<script type="text/javascript" src="menu.js"></script>
+<script type="text/javascript">
+$(function() {
+ initMenu('',false,false,'search.php','Search');
+<div id="main-nav"></div>
+</div><!-- top -->
+<div class="header">
+ <div class="headertitle">
+<div class="title">Heimbase</div> </div>
+<div class="contents">
+<p>Registers a DB type for use with heim_db_create().
+<a href="#details">More...</a></p>
+<p>Registers a DB type for use with heim_db_create(). </p>
+<p>heim_db_register </p><dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">dbtype</td><td>Name of DB type </td></tr>
+ <tr><td class="paramname">data</td><td>Private data argument to the dbtype's openf method </td></tr>
+ <tr><td class="paramname">plugin</td><td>Structure with DB type methods (function pointers)</td></tr>
+ </table>
+ </dd>
+<p>Backends that provide begin/commit/rollback methods must provide ACID semantics.</p>
+<p>The registered DB type will have ACID semantics for backends that do not provide begin/commit/rollback methods but do provide lock/unlock and rdjournal/wrjournal methods (using a replay log journalling scheme).</p>
+<p>If the registered DB type does not natively provide read vs. write transaction isolation but does provide a lock method then the DB will provide read/write transaction isolation.</p>
+<dl class="section return"><dt>Returns</dt><dd>ENOMEM on failure, else 0.</dd></dl>
+<p>Open a database of the given dbtype.</p>
+<p>Database type names can be composed of one or more pseudo-DB types and one concrete DB type joined with a '+' between each. For example: "transaction+bdb" might be a Berkeley DB with a layer above that provides transactions.</p>
+<p>Options may be provided via a dict (an associative array). Existing options include:</p>
+<li>"create", with any value (create if DB doesn't exist)</li>
+<li>"exclusive", with any value (exclusive create)</li>
+<li>"truncate", with any value (truncate the DB)</li>
+<li>"read-only", with any value (disallow writes)</li>
+<li>"sync", with any value (make transactions durable)</li>
+<li>"journal-name", with a string value naming a journal file name</li>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">dbtype</td><td>Name of DB type </td></tr>
+ <tr><td class="paramname">dbname</td><td>Name of DB (likely a file path) </td></tr>
+ <tr><td class="paramname">options</td><td>Options dict </td></tr>
+ <tr><td class="paramname">db</td><td>Output open DB handle </td></tr>
+ <tr><td class="paramname">error</td><td>Output error object</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>a DB handle</dd></dl>
+<p>Clone (duplicate) an open DB handle.</p>
+<p>This is useful for multi-threaded applications. Applications must synchronize access to any given DB handle.</p>
+<p>Returns EBUSY if there is an open transaction for the input db.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">db</td><td>Open DB handle </td></tr>
+ <tr><td class="paramname">error</td><td>Output error object</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>a DB handle</dd></dl>
+<p>Open a transaction on the given db.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">db</td><td>Open DB handle </td></tr>
+ <tr><td class="paramname">error</td><td>Output error object</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>0 on success, system error otherwise</dd></dl>
+<p>Commit an open transaction on the given db.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">db</td><td>Open DB handle </td></tr>
+ <tr><td class="paramname">error</td><td>Output error object</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>0 on success, system error otherwise</dd></dl>
+<p>Rollback an open transaction on the given db.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">db</td><td>Open DB handle </td></tr>
+ <tr><td class="paramname">error</td><td>Output error object</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>0 on success, system error otherwise</dd></dl>
+<p>Get type ID of heim_db_t objects.</p>
+<p>Lookup a key's value in the DB.</p>
+<p>Returns 0 on success, -1 if the key does not exist in the DB, or a system error number on failure.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">db</td><td>Open DB handle </td></tr>
+ <tr><td class="paramname">key</td><td>Key </td></tr>
+ <tr><td class="paramname">error</td><td>Output error object</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>the value (retained), if there is one for the given key</dd></dl>
+<p>Set a key's value in the DB.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">db</td><td>Open DB handle </td></tr>
+ <tr><td class="paramname">key</td><td>Key </td></tr>
+ <tr><td class="paramname">value</td><td>Value (if NULL the key will be deleted, but empty is OK) </td></tr>
+ <tr><td class="paramname">error</td><td>Output error object</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>0 on success, system error otherwise</dd></dl>
+<p>Delete a key and its value from the DB</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">db</td><td>Open DB handle </td></tr>
+ <tr><td class="paramname">key</td><td>Key </td></tr>
+ <tr><td class="paramname">error</td><td>Output error object</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>0 on success, system error otherwise</dd></dl>
+<p>Iterate a callback function over keys and values from a DB.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">db</td><td>Open DB handle </td></tr>
+ <tr><td class="paramname">iter_data</td><td>Callback function's private data </td></tr>
+ <tr><td class="paramname">iter_f</td><td>Callback function, called once per-key/value pair </td></tr>
+ <tr><td class="paramname">error</td><td>Output error object</td></tr>
+ </table>
+ </dd>
+<p>Get a node in a heim_object tree by path</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">ptr</td><td>tree </td></tr>
+ <tr><td class="paramname">error</td><td>error (output) </td></tr>
+ <tr><td class="paramname">ap</td><td>NULL-terminated va_list of heim_object_ts that form a path</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>object (not retained) if found</dd></dl>
+<p>Get a node in a tree by path, with retained reference</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">ptr</td><td>tree </td></tr>
+ <tr><td class="paramname">error</td><td>error (output) </td></tr>
+ <tr><td class="paramname">ap</td><td>NULL-terminated va_list of heim_object_ts that form a path</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>retained object if found</dd></dl>
+<p>Get a node in a tree by path</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">ptr</td><td>tree </td></tr>
+ <tr><td class="paramname">error</td><td>error (output) </td></tr>
+ <tr><td class="paramname">...</td><td>NULL-terminated va_list of heim_object_ts that form a path</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>object (not retained) if found</dd></dl>
+<p>Get a node in a tree by path, with retained reference</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">ptr</td><td>tree </td></tr>
+ <tr><td class="paramname">error</td><td>error (output) </td></tr>
+ <tr><td class="paramname">...</td><td>NULL-terminated va_list of heim_object_ts that form a path</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>retained object if found</dd></dl>
+<p>Create a path in a heim_object_t tree</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">ptr</td><td>the tree </td></tr>
+ <tr><td class="paramname">size</td><td>the size of the heim_dict_t nodes to be created </td></tr>
+ <tr><td class="paramname">leaf</td><td>leaf node to be added, if any </td></tr>
+ <tr><td class="paramname">error</td><td>error (output) </td></tr>
+ <tr><td class="paramname">ap</td><td>NULL-terminated of path component objects</td></tr>
+ </table>
+ </dd>
+<p>Create a path of heim_dict_t interior nodes in a given heim_object_t tree, as necessary, and set/replace a leaf, if given (if leaf is NULL then the leaf is not deleted).</p>
+<dl class="section return"><dt>Returns</dt><dd>0 on success, else a system error</dd></dl>
+<p>Create a path in a heim_object_t tree</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">ptr</td><td>the tree </td></tr>
+ <tr><td class="paramname">size</td><td>the size of the heim_dict_t nodes to be created </td></tr>
+ <tr><td class="paramname">leaf</td><td>leaf node to be added, if any </td></tr>
+ <tr><td class="paramname">error</td><td>error (output) </td></tr>
+ <tr><td class="paramname">...</td><td>NULL-terminated list of path component objects</td></tr>
+ </table>
+ </dd>
+<p>Create a path of heim_dict_t interior nodes in a given heim_object_t tree, as necessary, and set/replace a leaf, if given (if leaf is NULL then the leaf is not deleted).</p>
+<dl class="section return"><dt>Returns</dt><dd>0 on success, else a system error</dd></dl>
+<p>Delete leaf node named by a path in a heim_object_t tree</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">ptr</td><td>the tree </td></tr>
+ <tr><td class="paramname">error</td><td>error (output) </td></tr>
+ <tr><td class="paramname">ap</td><td>NULL-terminated list of path component objects</td></tr>
+ </table>
+ </dd>
+<p>Dump a heimbase object to stderr (useful from the debugger!)</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">obj</td><td>object to dump using JSON or JSON-like format </td></tr>
+ </table>
+ </dd>
+</div><!-- contents -->
+<hr size="1"><address style="text-align: right;"><small>
+Generated on Fri Dec 8 2017 03:48:57 for Heimdalbaselibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.8.13</small></address>
diff --git a/doc/doxyout/base/html/index.html b/doc/doxyout/base/html/index.html
new file mode 100644
index 000000000000..a972416d57ea
--- /dev/null
+++ b/doc/doxyout/base/html/index.html
@@ -0,0 +1,30 @@
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN">
+<html><head><meta http-equiv="Content-Type" content="text/html;charset=UTF-8">
+<title>Main Page</title>
+<link href="doxygen.css" rel="stylesheet" type="text/css">
+<link href="tabs.css" rel="stylesheet" type="text/css">
+<a href="http://www.h5l.org/"><img src="http://www.h5l.org/keyhole-heimdal.png" alt="keyhole logo"/></a>
+<!-- end of header marker -->
+<!-- Generated by Doxygen 1.8.13 -->
+<script type="text/javascript" src="menudata.js"></script>
+<script type="text/javascript" src="menu.js"></script>
+<script type="text/javascript">
+$(function() {
+ initMenu('',false,false,'search.php','Search');
+<div id="main-nav"></div>
+</div><!-- top -->
+<div class="header">
+ <div class="headertitle">
+<div class="title">Heimdalbaselibrary Documentation</div> </div>
+<div class="contents">
+</div><!-- contents -->
+<hr size="1"><address style="text-align: right;"><small>
+Generated on Fri Dec 8 2017 03:48:57 for Heimdalbaselibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.8.13</small></address>
diff --git a/doc/doxyout/base/html/jquery.js b/doc/doxyout/base/html/jquery.js
new file mode 100644
index 000000000000..f5343eda922a
--- /dev/null
+++ b/doc/doxyout/base/html/jquery.js
@@ -0,0 +1,87 @@
+ * jQuery JavaScript Library v1.7.1
+ * http://jquery.com/
+ *
+ * Copyright 2011, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2011, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Mon Nov 21 21:11:03 2011 -0500
+ */
+(function(bb,L){var av=bb.document,bu=bb.navigator,bl=bb.location;var b=(function(){var bF=function(b0,b1){return new bF.fn.init(b0,b1,bD)},bU=bb.jQuery,bH=bb.$,bD,bY=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,bM=/\S/,bI=/^\s+/,bE=/\s+$/,bA=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,bN=/^[\],:{}\s]*$/,bW=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,bP=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,bJ=/(?:^|:|,)(?:\s*\[)+/g,by=/(webkit)[ \/]([\w.]+)/,bR=/(opera)(?:.*version)?[ \/]([\w.]+)/,bQ=/(msie) ([\w.]+)/,bS=/(mozilla)(?:.*? rv:([\w.]+))?/,bB=/-([a-z]|[0-9])/ig,bZ=/^-ms-/,bT=function(b0,b1){return(b1+"").toUpperCase()},bX=bu.userAgent,bV,bC,e,bL=Object.prototype.toString,bG=Object.prototype.hasOwnProperty,bz=Array.prototype.push,bK=Array.prototype.slice,bO=String.prototype.trim,bv=Array.prototype.indexOf,bx={};bF.fn=bF.prototype={constructor:bF,init:function(b0,b4,b3){var b2,b5,b1,b6;if(!b0){return this}if(b0.nodeType){this.context=this[0]=b0;this.length=1;return this}if(b0==="body"&&!b4&&av.body){this.context=av;this[0]=av.body;this.selector=b0;this.length=1;return this}if(typeof b0==="string"){if(b0.charAt(0)==="<"&&b0.charAt(b0.length-1)===">"&&b0.length>=3){b2=[null,b0,null]}else{b2=bY.exec(b0)}if(b2&&(b2[1]||!b4)){if(b2[1]){b4=b4 instanceof bF?b4[0]:b4;b6=(b4?b4.ownerDocument||b4:av);b1=bA.exec(b0);if(b1){if(bF.isPlainObject(b4)){b0=[av.createElement(b1[1])];bF.fn.attr.call(b0,b4,true)}else{b0=[b6.createElement(b1[1])]}}else{b1=bF.buildFragment([b2[1]],[b6]);b0=(b1.cacheable?bF.clone(b1.fragment):b1.fragment).childNodes}return bF.merge(this,b0)}else{b5=av.getElementById(b2[2]);if(b5&&b5.parentNode){if(b5.id!==b2[2]){return b3.find(b0)}this.length=1;this[0]=b5}this.context=av;this.selector=b0;return this}}else{if(!b4||b4.jquery){return(b4||b3).find(b0)}else{return this.constructor(b4).find(b0)}}}else{if(bF.isFunction(b0)){return b3.ready(b0)}}if(b0.selector!==L){this.selector=b0.selector;this.context=b0.context}return bF.makeArray(b0,this)},selector:"",jquery:"1.7.1",length:0,size:function(){return this.length},toArray:function(){return bK.call(this,0)},get:function(b0){return b0==null?this.toArray():(b0<0?this[this.length+b0]:this[b0])},pushStack:function(b1,b3,b0){var b2=this.constructor();if(bF.isArray(b1)){bz.apply(b2,b1)}else{bF.merge(b2,b1)}b2.prevObject=this;b2.context=this.context;if(b3==="find"){b2.selector=this.selector+(this.selector?" ":"")+b0}else{if(b3){b2.selector=this.selector+"."+b3+"("+b0+")"}}return b2},each:function(b1,b0){return bF.each(this,b1,b0)},ready:function(b0){bF.bindReady();bC.add(b0);return this},eq:function(b0){b0=+b0;return b0===-1?this.slice(b0):this.slice(b0,b0+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(bK.apply(this,arguments),"slice",bK.call(arguments).join(","))},map:function(b0){return this.pushStack(bF.map(this,function(b2,b1){return b0.call(b2,b1,b2)}))},end:function(){return this.prevObject||this.constructor(null)},push:bz,sort:[].sort,splice:[].splice};bF.fn.init.prototype=bF.fn;bF.extend=bF.fn.extend=function(){var b9,b2,b0,b1,b6,b7,b5=arguments[0]||{},b4=1,b3=arguments.length,b8=false;if(typeof b5==="boolean"){b8=b5;b5=arguments[1]||{};b4=2}if(typeof b5!=="object"&&!bF.isFunction(b5)){b5={}}if(b3===b4){b5=this;--b4}for(;b4<b3;b4++){if((b9=arguments[b4])!=null){for(b2 in b9){b0=b5[b2];b1=b9[b2];if(b5===b1){continue}if(b8&&b1&&(bF.isPlainObject(b1)||(b6=bF.isArray(b1)))){if(b6){b6=false;b7=b0&&bF.isArray(b0)?b0:[]}else{b7=b0&&bF.isPlainObject(b0)?b0:{}}b5[b2]=bF.extend(b8,b7,b1)}else{if(b1!==L){b5[b2]=b1}}}}}return b5};bF.extend({noConflict:function(b0){if(bb.$===bF){bb.$=bH}if(b0&&bb.jQuery===bF){bb.jQuery=bU}return bF},isReady:false,readyWait:1,holdReady:function(b0){if(b0){bF.readyWait++}else{bF.ready(true)}},ready:function(b0){if((b0===true&&!--bF.readyWait)||(b0!==true&&!bF.isReady)){if(!av.body){return setTimeout(bF.ready,1)}bF.isReady=true;if(b0!==true&&--bF.readyWait>0){return}bC.fireWith(av,[bF]);if(bF.fn.trigger){bF(av).trigger("ready").off("ready")}}},bindReady:function(){if(bC){return}bC=bF.Callbacks("once memory");if(av.readyState==="complete"){return setTimeout(bF.ready,1)}if(av.addEventListener){av.addEventListener("DOMContentLoaded",e,false);bb.addEventListener("load",bF.ready,false)}else{if(av.attachEvent){av.attachEvent("onreadystatechange",e);bb.attachEvent("onload",bF.ready);var b0=false;try{b0=bb.frameElement==null}catch(b1){}if(av.documentElement.doScroll&&b0){bw()}}}},isFunction:function(b0){return bF.type(b0)==="function"},isArray:Array.isArray||function(b0){return bF.type(b0)==="array"},isWindow:function(b0){return b0&&typeof b0==="object"&&"setInterval" in b0},isNumeric:function(b0){return !isNaN(parseFloat(b0))&&isFinite(b0)},type:function(b0){return b0==null?String(b0):bx[bL.call(b0)]||"object"},isPlainObject:function(b2){if(!b2||bF.type(b2)!=="object"||b2.nodeType||bF.isWindow(b2)){return false}try{if(b2.constructor&&!bG.call(b2,"constructor")&&!bG.call(b2.constructor.prototype,"isPrototypeOf")){return false}}catch(b1){return false}var b0;for(b0 in b2){}return b0===L||bG.call(b2,b0)},isEmptyObject:function(b1){for(var b0 in b1){return false}return true},error:function(b0){throw new Error(b0)},parseJSON:function(b0){if(typeof b0!=="string"||!b0){return null}b0=bF.trim(b0);if(bb.JSON&&bb.JSON.parse){return bb.JSON.parse(b0)}if(bN.test(b0.replace(bW,"@").replace(bP,"]").replace(bJ,""))){return(new Function("return "+b0))()}bF.error("Invalid JSON: "+b0)},parseXML:function(b2){var b0,b1;try{if(bb.DOMParser){b1=new DOMParser();b0=b1.parseFromString(b2,"text/xml")}else{b0=new ActiveXObject("Microsoft.XMLDOM");b0.async="false";b0.loadXML(b2)}}catch(b3){b0=L}if(!b0||!b0.documentElement||b0.getElementsByTagName("parsererror").length){bF.error("Invalid XML: "+b2)}return b0},noop:function(){},globalEval:function(b0){if(b0&&bM.test(b0)){(bb.execScript||function(b1){bb["eval"].call(bb,b1)})(b0)}},camelCase:function(b0){return b0.replace(bZ,"ms-").replace(bB,bT)},nodeName:function(b1,b0){return b1.nodeName&&b1.nodeName.toUpperCase()===b0.toUpperCase()},each:function(b3,b6,b2){var b1,b4=0,b5=b3.length,b0=b5===L||bF.isFunction(b3);if(b2){if(b0){for(b1 in b3){if(b6.apply(b3[b1],b2)===false){break}}}else{for(;b4<b5;){if(b6.apply(b3[b4++],b2)===false){break}}}}else{if(b0){for(b1 in b3){if(b6.call(b3[b1],b1,b3[b1])===false){break}}}else{for(;b4<b5;){if(b6.call(b3[b4],b4,b3[b4++])===false){break}}}}return b3},trim:bO?function(b0){return b0==null?"":bO.call(b0)}:function(b0){return b0==null?"":b0.toString().replace(bI,"").replace(bE,"")},makeArray:function(b3,b1){var b0=b1||[];if(b3!=null){var b2=bF.type(b3);if(b3.length==null||b2==="string"||b2==="function"||b2==="regexp"||bF.isWindow(b3)){bz.call(b0,b3)}else{bF.merge(b0,b3)}}return b0},inArray:function(b2,b3,b1){var b0;if(b3){if(bv){return bv.call(b3,b2,b1)}b0=b3.length;b1=b1?b1<0?Math.max(0,b0+b1):b1:0;for(;b1<b0;b1++){if(b1 in b3&&b3[b1]===b2){return b1}}}return -1},merge:function(b4,b2){var b3=b4.length,b1=0;if(typeof b2.length==="number"){for(var b0=b2.length;b1<b0;b1++){b4[b3++]=b2[b1]}}else{while(b2[b1]!==L){b4[b3++]=b2[b1++]}}b4.length=b3;return b4},grep:function(b1,b6,b0){var b2=[],b5;b0=!!b0;for(var b3=0,b4=b1.length;b3<b4;b3++){b5=!!b6(b1[b3],b3);if(b0!==b5){b2.push(b1[b3])}}return b2},map:function(b0,b7,b8){var b5,b6,b4=[],b2=0,b1=b0.length,b3=b0 instanceof bF||b1!==L&&typeof b1==="number"&&((b1>0&&b0[0]&&b0[b1-1])||b1===0||bF.isArray(b0));if(b3){for(;b2<b1;b2++){b5=b7(b0[b2],b2,b8);if(b5!=null){b4[b4.length]=b5}}}else{for(b6 in b0){b5=b7(b0[b6],b6,b8);if(b5!=null){b4[b4.length]=b5}}}return b4.concat.apply([],b4)},guid:1,proxy:function(b4,b3){if(typeof b3==="string"){var b2=b4[b3];b3=b4;b4=b2}if(!bF.isFunction(b4)){return L}var b0=bK.call(arguments,2),b1=function(){return b4.apply(b3,b0.concat(bK.call(arguments)))};b1.guid=b4.guid=b4.guid||b1.guid||bF.guid++;return b1},access:function(b0,b8,b6,b2,b5,b7){var b1=b0.length;if(typeof b8==="object"){for(var b3 in b8){bF.access(b0,b3,b8[b3],b2,b5,b6)}return b0}if(b6!==L){b2=!b7&&b2&&bF.isFunction(b6);for(var b4=0;b4<b1;b4++){b5(b0[b4],b8,b2?b6.call(b0[b4],b4,b5(b0[b4],b8)):b6,b7)}return b0}return b1?b5(b0[0],b8):L},now:function(){return(new Date()).getTime()},uaMatch:function(b1){b1=b1.toLowerCase();var b0=by.exec(b1)||bR.exec(b1)||bQ.exec(b1)||b1.indexOf("compatible")<0&&bS.exec(b1)||[];return{browser:b0[1]||"",version:b0[2]||"0"}},sub:function(){function b0(b3,b4){return new b0.fn.init(b3,b4)}bF.extend(true,b0,this);b0.superclass=this;b0.fn=b0.prototype=this();b0.fn.constructor=b0;b0.sub=this.sub;b0.fn.init=function b2(b3,b4){if(b4&&b4 instanceof bF&&!(b4 instanceof b0)){b4=b0(b4)}return bF.fn.init.call(this,b3,b4,b1)};b0.fn.init.prototype=b0.fn;var b1=b0(av);return b0},browser:{}});bF.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(b1,b0){bx["[object "+b0+"]"]=b0.toLowerCase()});bV=bF.uaMatch(bX);if(bV.browser){bF.browser[bV.browser]=true;bF.browser.version=bV.version}if(bF.browser.webkit){bF.browser.safari=true}if(bM.test("\xA0")){bI=/^[\s\xA0]+/;bE=/[\s\xA0]+$/}bD=bF(av);if(av.addEventListener){e=function(){av.removeEventListener("DOMContentLoaded",e,false);bF.ready()}}else{if(av.attachEvent){e=function(){if(av.readyState==="complete"){av.detachEvent("onreadystatechange",e);bF.ready()}}}}function bw(){if(bF.isReady){return}try{av.documentElement.doScroll("left")}catch(b0){setTimeout(bw,1);return}bF.ready()}return bF})();var a2={};function X(e){var bv=a2[e]={},bw,bx;e=e.split(/\s+/);for(bw=0,bx=e.length;bw<bx;bw++){bv[e[bw]]=true}return bv}b.Callbacks=function(bw){bw=bw?(a2[bw]||X(bw)):{};var bB=[],bC=[],bx,by,bv,bz,bA,bE=function(bF){var bG,bJ,bI,bH,bK;for(bG=0,bJ=bF.length;bG<bJ;bG++){bI=bF[bG];bH=b.type(bI);if(bH==="array"){bE(bI)}else{if(bH==="function"){if(!bw.unique||!bD.has(bI)){bB.push(bI)}}}}},e=function(bG,bF){bF=bF||[];bx=!bw.memory||[bG,bF];by=true;bA=bv||0;bv=0;bz=bB.length;for(;bB&&bA<bz;bA++){if(bB[bA].apply(bG,bF)===false&&bw.stopOnFalse){bx=true;break}}by=false;if(bB){if(!bw.once){if(bC&&bC.length){bx=bC.shift();bD.fireWith(bx[0],bx[1])}}else{if(bx===true){bD.disable()}else{bB=[]}}}},bD={add:function(){if(bB){var bF=bB.length;bE(arguments);if(by){bz=bB.length}else{if(bx&&bx!==true){bv=bF;e(bx[0],bx[1])}}}return this},remove:function(){if(bB){var bF=arguments,bH=0,bI=bF.length;for(;bH<bI;bH++){for(var bG=0;bG<bB.length;bG++){if(bF[bH]===bB[bG]){if(by){if(bG<=bz){bz--;if(bG<=bA){bA--}}}bB.splice(bG--,1);if(bw.unique){break}}}}}return this},has:function(bG){if(bB){var bF=0,bH=bB.length;for(;bF<bH;bF++){if(bG===bB[bF]){return true}}}return false},empty:function(){bB=[];return this},disable:function(){bB=bC=bx=L;return this},disabled:function(){return !bB},lock:function(){bC=L;if(!bx||bx===true){bD.disable()}return this},locked:function(){return !bC},fireWith:function(bG,bF){if(bC){if(by){if(!bw.once){bC.push([bG,bF])}}else{if(!(bw.once&&bx)){e(bG,bF)}}}return this},fire:function(){bD.fireWith(this,arguments);return this},fired:function(){return !!bx}};return bD};var aJ=[].slice;b.extend({Deferred:function(by){var bx=b.Callbacks("once memory"),bw=b.Callbacks("once memory"),bv=b.Callbacks("memory"),e="pending",bA={resolve:bx,reject:bw,notify:bv},bC={done:bx.add,fail:bw.add,progress:bv.add,state:function(){return e},isResolved:bx.fired,isRejected:bw.fired,then:function(bE,bD,bF){bB.done(bE).fail(bD).progress(bF);return this},always:function(){bB.done.apply(bB,arguments).fail.apply(bB,arguments);return this},pipe:function(bF,bE,bD){return b.Deferred(function(bG){b.each({done:[bF,"resolve"],fail:[bE,"reject"],progress:[bD,"notify"]},function(bI,bL){var bH=bL[0],bK=bL[1],bJ;if(b.isFunction(bH)){bB[bI](function(){bJ=bH.apply(this,arguments);if(bJ&&b.isFunction(bJ.promise)){bJ.promise().then(bG.resolve,bG.reject,bG.notify)}else{bG[bK+"With"](this===bB?bG:this,[bJ])}})}else{bB[bI](bG[bK])}})}).promise()},promise:function(bE){if(bE==null){bE=bC}else{for(var bD in bC){bE[bD]=bC[bD]}}return bE}},bB=bC.promise({}),bz;for(bz in bA){bB[bz]=bA[bz].fire;bB[bz+"With"]=bA[bz].fireWith}bB.done(function(){e="resolved"},bw.disable,bv.lock).fail(function(){e="rejected"},bx.disable,bv.lock);if(by){by.call(bB,bB)}return bB},when:function(bA){var bx=aJ.call(arguments,0),bv=0,e=bx.length,bB=new Array(e),bw=e,by=e,bC=e<=1&&bA&&b.isFunction(bA.promise)?bA:b.Deferred(),bE=bC.promise();function bD(bF){return function(bG){bx[bF]=arguments.length>1?aJ.call(arguments,0):bG;if(!(--bw)){bC.resolveWith(bC,bx)}}}function bz(bF){return function(bG){bB[bF]=arguments.length>1?aJ.call(arguments,0):bG;bC.notifyWith(bE,bB)}}if(e>1){for(;bv<e;bv++){if(bx[bv]&&bx[bv].promise&&b.isFunction(bx[bv].promise)){bx[bv].promise().then(bD(bv),bC.reject,bz(bv))}else{--bw}}if(!bw){bC.resolveWith(bC,bx)}}else{if(bC!==bA){bC.resolveWith(bC,e?[bA]:[])}}return bE}});b.support=(function(){var bJ,bI,bF,bG,bx,bE,bA,bD,bz,bK,bB,by,bw,bv=av.createElement("div"),bH=av.documentElement;bv.setAttribute("className","t");bv.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>";bI=bv.getElementsByTagName("*");bF=bv.getElementsByTagName("a")[0];if(!bI||!bI.length||!bF){return{}}bG=av.createElement("select");bx=bG.appendChild(av.createElement("option"));bE=bv.getElementsByTagName("input")[0];bJ={leadingWhitespace:(bv.firstChild.nodeType===3),tbody:!bv.getElementsByTagName("tbody").length,htmlSerialize:!!bv.getElementsByTagName("link").length,style:/top/.test(bF.getAttribute("style")),hrefNormalized:(bF.getAttribute("href")==="/a"),opacity:/^0.55/.test(bF.style.opacity),cssFloat:!!bF.style.cssFloat,checkOn:(bE.value==="on"),optSelected:bx.selected,getSetAttribute:bv.className!=="t",enctype:!!av.createElement("form").enctype,html5Clone:av.createElement("nav").cloneNode(true).outerHTML!=="<:nav></:nav>",submitBubbles:true,changeBubbles:true,focusinBubbles:false,deleteExpando:true,noCloneEvent:true,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableMarginRight:true};bE.checked=true;bJ.noCloneChecked=bE.cloneNode(true).checked;bG.disabled=true;bJ.optDisabled=!bx.disabled;try{delete bv.test}catch(bC){bJ.deleteExpando=false}if(!bv.addEventListener&&bv.attachEvent&&bv.fireEvent){bv.attachEvent("onclick",function(){bJ.noCloneEvent=false});bv.cloneNode(true).fireEvent("onclick")}bE=av.createElement("input");bE.value="t";bE.setAttribute("type","radio");bJ.radioValue=bE.value==="t";bE.setAttribute("checked","checked");bv.appendChild(bE);bD=av.createDocumentFragment();bD.appendChild(bv.lastChild);bJ.checkClone=bD.cloneNode(true).cloneNode(true).lastChild.checked;bJ.appendChecked=bE.checked;bD.removeChild(bE);bD.appendChild(bv);bv.innerHTML="";if(bb.getComputedStyle){bA=av.createElement("div");bA.style.width="0";bA.style.marginRight="0";bv.style.width="2px";bv.appendChild(bA);bJ.reliableMarginRight=(parseInt((bb.getComputedStyle(bA,null)||{marginRight:0}).marginRight,10)||0)===0}if(bv.attachEvent){for(by in {submit:1,change:1,focusin:1}){bB="on"+by;bw=(bB in bv);if(!bw){bv.setAttribute(bB,"return;");bw=(typeof bv[bB]==="function")}bJ[by+"Bubbles"]=bw}}bD.removeChild(bv);bD=bG=bx=bA=bv=bE=null;b(function(){var bM,bU,bV,bT,bN,bO,bL,bS,bR,e,bP,bQ=av.getElementsByTagName("body")[0];if(!bQ){return}bL=1;bS="position:absolute;top:0;left:0;width:1px;height:1px;margin:0;";bR="visibility:hidden;border:0;";e="style='"+bS+"border:5px solid #000;padding:0;'";bP="<div "+e+"><div></div></div><table "+e+" cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";bM=av.createElement("div");bM.style.cssText=bR+"width:0;height:0;position:static;top:0;margin-top:"+bL+"px";bQ.insertBefore(bM,bQ.firstChild);bv=av.createElement("div");bM.appendChild(bv);bv.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";bz=bv.getElementsByTagName("td");bw=(bz[0].offsetHeight===0);bz[0].style.display="";bz[1].style.display="none";bJ.reliableHiddenOffsets=bw&&(bz[0].offsetHeight===0);bv.innerHTML="";bv.style.width=bv.style.paddingLeft="1px";b.boxModel=bJ.boxModel=bv.offsetWidth===2;if(typeof bv.style.zoom!=="undefined"){bv.style.display="inline";bv.style.zoom=1;bJ.inlineBlockNeedsLayout=(bv.offsetWidth===2);bv.style.display="";bv.innerHTML="<div style='width:4px;'></div>";bJ.shrinkWrapBlocks=(bv.offsetWidth!==2)}bv.style.cssText=bS+bR;bv.innerHTML=bP;bU=bv.firstChild;bV=bU.firstChild;bN=bU.nextSibling.firstChild.firstChild;bO={doesNotAddBorder:(bV.offsetTop!==5),doesAddBorderForTableAndCells:(bN.offsetTop===5)};bV.style.position="fixed";bV.style.top="20px";bO.fixedPosition=(bV.offsetTop===20||bV.offsetTop===15);bV.style.position=bV.style.top="";bU.style.overflow="hidden";bU.style.position="relative";bO.subtractsBorderForOverflowNotVisible=(bV.offsetTop===-5);bO.doesNotIncludeMarginInBodyOffset=(bQ.offsetTop!==bL);bQ.removeChild(bM);bv=bM=null;b.extend(bJ,bO)});return bJ})();var aS=/^(?:\{.*\}|\[.*\])$/,aA=/([A-Z])/g;b.extend({cache:{},uuid:0,expando:"jQuery"+(b.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},hasData:function(e){e=e.nodeType?b.cache[e[b.expando]]:e[b.expando];return !!e&&!S(e)},data:function(bx,bv,bz,by){if(!b.acceptData(bx)){return}var bG,bA,bD,bE=b.expando,bC=typeof bv==="string",bF=bx.nodeType,e=bF?b.cache:bx,bw=bF?bx[bE]:bx[bE]&&bE,bB=bv==="events";if((!bw||!e[bw]||(!bB&&!by&&!e[bw].data))&&bC&&bz===L){return}if(!bw){if(bF){bx[bE]=bw=++b.uuid}else{bw=bE}}if(!e[bw]){e[bw]={};if(!bF){e[bw].toJSON=b.noop}}if(typeof bv==="object"||typeof bv==="function"){if(by){e[bw]=b.extend(e[bw],bv)}else{e[bw].data=b.extend(e[bw].data,bv)}}bG=bA=e[bw];if(!by){if(!bA.data){bA.data={}}bA=bA.data}if(bz!==L){bA[b.camelCase(bv)]=bz}if(bB&&!bA[bv]){return bG.events}if(bC){bD=bA[bv];if(bD==null){bD=bA[b.camelCase(bv)]}}else{bD=bA}return bD},removeData:function(bx,bv,by){if(!b.acceptData(bx)){return}var bB,bA,bz,bC=b.expando,bD=bx.nodeType,e=bD?b.cache:bx,bw=bD?bx[bC]:bC;if(!e[bw]){return}if(bv){bB=by?e[bw]:e[bw].data;if(bB){if(!b.isArray(bv)){if(bv in bB){bv=[bv]}else{bv=b.camelCase(bv);if(bv in bB){bv=[bv]}else{bv=bv.split(" ")}}}for(bA=0,bz=bv.length;bA<bz;bA++){delete bB[bv[bA]]}if(!(by?S:b.isEmptyObject)(bB)){return}}}if(!by){delete e[bw].data;if(!S(e[bw])){return}}if(b.support.deleteExpando||!e.setInterval){delete e[bw]}else{e[bw]=null}if(bD){if(b.support.deleteExpando){delete bx[bC]}else{if(bx.removeAttribute){bx.removeAttribute(bC)}else{bx[bC]=null}}}},_data:function(bv,e,bw){return b.data(bv,e,bw,true)},acceptData:function(bv){if(bv.nodeName){var e=b.noData[bv.nodeName.toLowerCase()];if(e){return !(e===true||bv.getAttribute("classid")!==e)}}return true}});b.fn.extend({data:function(by,bA){var bB,e,bw,bz=null;if(typeof by==="undefined"){if(this.length){bz=b.data(this[0]);if(this[0].nodeType===1&&!b._data(this[0],"parsedAttrs")){e=this[0].attributes;for(var bx=0,bv=e.length;bx<bv;bx++){bw=e[bx].name;if(bw.indexOf("data-")===0){bw=b.camelCase(bw.substring(5));a5(this[0],bw,bz[bw])}}b._data(this[0],"parsedAttrs",true)}}return bz}else{if(typeof by==="object"){return this.each(function(){b.data(this,by)})}}bB=by.split(".");bB[1]=bB[1]?"."+bB[1]:"";if(bA===L){bz=this.triggerHandler("getData"+bB[1]+"!",[bB[0]]);if(bz===L&&this.length){bz=b.data(this[0],by);bz=a5(this[0],by,bz)}return bz===L&&bB[1]?this.data(bB[0]):bz}else{return this.each(function(){var bC=b(this),bD=[bB[0],bA];bC.triggerHandler("setData"+bB[1]+"!",bD);b.data(this,by,bA);bC.triggerHandler("changeData"+bB[1]+"!",bD)})}},removeData:function(e){return this.each(function(){b.removeData(this,e)})}});function a5(bx,bw,by){if(by===L&&bx.nodeType===1){var bv="data-"+bw.replace(aA,"-$1").toLowerCase();by=bx.getAttribute(bv);if(typeof by==="string"){try{by=by==="true"?true:by==="false"?false:by==="null"?null:b.isNumeric(by)?parseFloat(by):aS.test(by)?b.parseJSON(by):by}catch(bz){}b.data(bx,bw,by)}else{by=L}}return by}function S(bv){for(var e in bv){if(e==="data"&&b.isEmptyObject(bv[e])){continue}if(e!=="toJSON"){return false}}return true}function bi(by,bx,bA){var bw=bx+"defer",bv=bx+"queue",e=bx+"mark",bz=b._data(by,bw);if(bz&&(bA==="queue"||!b._data(by,bv))&&(bA==="mark"||!b._data(by,e))){setTimeout(function(){if(!b._data(by,bv)&&!b._data(by,e)){b.removeData(by,bw,true);bz.fire()}},0)}}b.extend({_mark:function(bv,e){if(bv){e=(e||"fx")+"mark";b._data(bv,e,(b._data(bv,e)||0)+1)}},_unmark:function(by,bx,bv){if(by!==true){bv=bx;bx=by;by=false}if(bx){bv=bv||"fx";var e=bv+"mark",bw=by?0:((b._data(bx,e)||1)-1);if(bw){b._data(bx,e,bw)}else{b.removeData(bx,e,true);bi(bx,bv,"mark")}}},queue:function(bv,e,bx){var bw;if(bv){e=(e||"fx")+"queue";bw=b._data(bv,e);if(bx){if(!bw||b.isArray(bx)){bw=b._data(bv,e,b.makeArray(bx))}else{bw.push(bx)}}return bw||[]}},dequeue:function(by,bx){bx=bx||"fx";var bv=b.queue(by,bx),bw=bv.shift(),e={};if(bw==="inprogress"){bw=bv.shift()}if(bw){if(bx==="fx"){bv.unshift("inprogress")}b._data(by,bx+".run",e);bw.call(by,function(){b.dequeue(by,bx)},e)}if(!bv.length){b.removeData(by,bx+"queue "+bx+".run",true);bi(by,bx,"queue")}}});b.fn.extend({queue:function(e,bv){if(typeof e!=="string"){bv=e;e="fx"}if(bv===L){return b.queue(this[0],e)}return this.each(function(){var bw=b.queue(this,e,bv);if(e==="fx"&&bw[0]!=="inprogress"){b.dequeue(this,e)}})},dequeue:function(e){return this.each(function(){b.dequeue(this,e)})},delay:function(bv,e){bv=b.fx?b.fx.speeds[bv]||bv:bv;e=e||"fx";return this.queue(e,function(bx,bw){var by=setTimeout(bx,bv);bw.stop=function(){clearTimeout(by)}})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(bD,bw){if(typeof bD!=="string"){bw=bD;bD=L}bD=bD||"fx";var e=b.Deferred(),bv=this,by=bv.length,bB=1,bz=bD+"defer",bA=bD+"queue",bC=bD+"mark",bx;function bE(){if(!(--bB)){e.resolveWith(bv,[bv])}}while(by--){if((bx=b.data(bv[by],bz,L,true)||(b.data(bv[by],bA,L,true)||b.data(bv[by],bC,L,true))&&b.data(bv[by],bz,b.Callbacks("once memory"),true))){bB++;bx.add(bE)}}bE();return e.promise()}});var aP=/[\n\t\r]/g,af=/\s+/,aU=/\r/g,g=/^(?:button|input)$/i,D=/^(?:button|input|object|select|textarea)$/i,l=/^a(?:rea)?$/i,ao=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,F=b.support.getSetAttribute,be,aY,aF;b.fn.extend({attr:function(e,bv){return b.access(this,e,bv,true,b.attr)},removeAttr:function(e){return this.each(function(){b.removeAttr(this,e)})},prop:function(e,bv){return b.access(this,e,bv,true,b.prop)},removeProp:function(e){e=b.propFix[e]||e;return this.each(function(){try{this[e]=L;delete this[e]}catch(bv){}})},addClass:function(by){var bA,bw,bv,bx,bz,bB,e;if(b.isFunction(by)){return this.each(function(bC){b(this).addClass(by.call(this,bC,this.className))})}if(by&&typeof by==="string"){bA=by.split(af);for(bw=0,bv=this.length;bw<bv;bw++){bx=this[bw];if(bx.nodeType===1){if(!bx.className&&bA.length===1){bx.className=by}else{bz=" "+bx.className+" ";for(bB=0,e=bA.length;bB<e;bB++){if(!~bz.indexOf(" "+bA[bB]+" ")){bz+=bA[bB]+" "}}bx.className=b.trim(bz)}}}}return this},removeClass:function(bz){var bA,bw,bv,by,bx,bB,e;if(b.isFunction(bz)){return this.each(function(bC){b(this).removeClass(bz.call(this,bC,this.className))})}if((bz&&typeof bz==="string")||bz===L){bA=(bz||"").split(af);for(bw=0,bv=this.length;bw<bv;bw++){by=this[bw];if(by.nodeType===1&&by.className){if(bz){bx=(" "+by.className+" ").replace(aP," ");for(bB=0,e=bA.length;bB<e;bB++){bx=bx.replace(" "+bA[bB]+" "," ")}by.className=b.trim(bx)}else{by.className=""}}}}return this},toggleClass:function(bx,bv){var bw=typeof bx,e=typeof bv==="boolean";if(b.isFunction(bx)){return this.each(function(by){b(this).toggleClass(bx.call(this,by,this.className,bv),bv)})}return this.each(function(){if(bw==="string"){var bA,bz=0,by=b(this),bB=bv,bC=bx.split(af);while((bA=bC[bz++])){bB=e?bB:!by.hasClass(bA);by[bB?"addClass":"removeClass"](bA)}}else{if(bw==="undefined"||bw==="boolean"){if(this.className){b._data(this,"__className__",this.className)}this.className=this.className||bx===false?"":b._data(this,"__className__")||""}}})},hasClass:function(e){var bx=" "+e+" ",bw=0,bv=this.length;for(;bw<bv;bw++){if(this[bw].nodeType===1&&(" "+this[bw].className+" ").replace(aP," ").indexOf(bx)>-1){return true}}return false},val:function(bx){var e,bv,by,bw=this[0];if(!arguments.length){if(bw){e=b.valHooks[bw.nodeName.toLowerCase()]||b.valHooks[bw.type];if(e&&"get" in e&&(bv=e.get(bw,"value"))!==L){return bv}bv=bw.value;return typeof bv==="string"?bv.replace(aU,""):bv==null?"":bv}return}by=b.isFunction(bx);return this.each(function(bA){var bz=b(this),bB;if(this.nodeType!==1){return}if(by){bB=bx.call(this,bA,bz.val())}else{bB=bx}if(bB==null){bB=""}else{if(typeof bB==="number"){bB+=""}else{if(b.isArray(bB)){bB=b.map(bB,function(bC){return bC==null?"":bC+""})}}}e=b.valHooks[this.nodeName.toLowerCase()]||b.valHooks[this.type];if(!e||!("set" in e)||e.set(this,bB,"value")===L){this.value=bB}})}});b.extend({valHooks:{option:{get:function(e){var bv=e.attributes.value;return !bv||bv.specified?e.value:e.text}},select:{get:function(e){var bA,bv,bz,bx,by=e.selectedIndex,bB=[],bC=e.options,bw=e.type==="select-one";if(by<0){return null}bv=bw?by:0;bz=bw?by+1:bC.length;for(;bv<bz;bv++){bx=bC[bv];if(bx.selected&&(b.support.optDisabled?!bx.disabled:bx.getAttribute("disabled")===null)&&(!bx.parentNode.disabled||!b.nodeName(bx.parentNode,"optgroup"))){bA=b(bx).val();if(bw){return bA}bB.push(bA)}}if(bw&&!bB.length&&bC.length){return b(bC[by]).val()}return bB},set:function(bv,bw){var e=b.makeArray(bw);b(bv).find("option").each(function(){this.selected=b.inArray(b(this).val(),e)>=0});if(!e.length){bv.selectedIndex=-1}return e}}},attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(bA,bx,bB,bz){var bw,e,by,bv=bA.nodeType;if(!bA||bv===3||bv===8||bv===2){return}if(bz&&bx in b.attrFn){return b(bA)[bx](bB)}if(typeof bA.getAttribute==="undefined"){return b.prop(bA,bx,bB)}by=bv!==1||!b.isXMLDoc(bA);if(by){bx=bx.toLowerCase();e=b.attrHooks[bx]||(ao.test(bx)?aY:be)}if(bB!==L){if(bB===null){b.removeAttr(bA,bx);return}else{if(e&&"set" in e&&by&&(bw=e.set(bA,bB,bx))!==L){return bw}else{bA.setAttribute(bx,""+bB);return bB}}}else{if(e&&"get" in e&&by&&(bw=e.get(bA,bx))!==null){return bw}else{bw=bA.getAttribute(bx);return bw===null?L:bw}}},removeAttr:function(bx,bz){var by,bA,bv,e,bw=0;if(bz&&bx.nodeType===1){bA=bz.toLowerCase().split(af);e=bA.length;for(;bw<e;bw++){bv=bA[bw];if(bv){by=b.propFix[bv]||bv;b.attr(bx,bv,"");bx.removeAttribute(F?bv:by);if(ao.test(bv)&&by in bx){bx[by]=false}}}}},attrHooks:{type:{set:function(e,bv){if(g.test(e.nodeName)&&e.parentNode){b.error("type property can't be changed")}else{if(!b.support.radioValue&&bv==="radio"&&b.nodeName(e,"input")){var bw=e.value;e.setAttribute("type",bv);if(bw){e.value=bw}return bv}}}},value:{get:function(bv,e){if(be&&b.nodeName(bv,"button")){return be.get(bv,e)}return e in bv?bv.value:null},set:function(bv,bw,e){if(be&&b.nodeName(bv,"button")){return be.set(bv,bw,e)}bv.value=bw}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(bz,bx,bA){var bw,e,by,bv=bz.nodeType;if(!bz||bv===3||bv===8||bv===2){return}by=bv!==1||!b.isXMLDoc(bz);if(by){bx=b.propFix[bx]||bx;e=b.propHooks[bx]}if(bA!==L){if(e&&"set" in e&&(bw=e.set(bz,bA,bx))!==L){return bw}else{return(bz[bx]=bA)}}else{if(e&&"get" in e&&(bw=e.get(bz,bx))!==null){return bw}else{return bz[bx]}}},propHooks:{tabIndex:{get:function(bv){var e=bv.getAttributeNode("tabindex");return e&&e.specified?parseInt(e.value,10):D.test(bv.nodeName)||l.test(bv.nodeName)&&bv.href?0:L}}}});b.attrHooks.tabindex=b.propHooks.tabIndex;aY={get:function(bv,e){var bx,bw=b.prop(bv,e);return bw===true||typeof bw!=="boolean"&&(bx=bv.getAttributeNode(e))&&bx.nodeValue!==false?e.toLowerCase():L},set:function(bv,bx,e){var bw;if(bx===false){b.removeAttr(bv,e)}else{bw=b.propFix[e]||e;if(bw in bv){bv[bw]=true}bv.setAttribute(e,e.toLowerCase())}return e}};if(!F){aF={name:true,id:true};be=b.valHooks.button={get:function(bw,bv){var e;e=bw.getAttributeNode(bv);return e&&(aF[bv]?e.nodeValue!=="":e.specified)?e.nodeValue:L},set:function(bw,bx,bv){var e=bw.getAttributeNode(bv);if(!e){e=av.createAttribute(bv);bw.setAttributeNode(e)}return(e.nodeValue=bx+"")}};b.attrHooks.tabindex.set=be.set;b.each(["width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{set:function(bw,bx){if(bx===""){bw.setAttribute(e,"auto");return bx}}})});b.attrHooks.contenteditable={get:be.get,set:function(bv,bw,e){if(bw===""){bw="false"}be.set(bv,bw,e)}}}if(!b.support.hrefNormalized){b.each(["href","src","width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{get:function(bx){var bw=bx.getAttribute(e,2);return bw===null?L:bw}})})}if(!b.support.style){b.attrHooks.style={get:function(e){return e.style.cssText.toLowerCase()||L},set:function(e,bv){return(e.style.cssText=""+bv)}}}if(!b.support.optSelected){b.propHooks.selected=b.extend(b.propHooks.selected,{get:function(bv){var e=bv.parentNode;if(e){e.selectedIndex;if(e.parentNode){e.parentNode.selectedIndex}}return null}})}if(!b.support.enctype){b.propFix.enctype="encoding"}if(!b.support.checkOn){b.each(["radio","checkbox"],function(){b.valHooks[this]={get:function(e){return e.getAttribute("value")===null?"on":e.value}}})}b.each(["radio","checkbox"],function(){b.valHooks[this]=b.extend(b.valHooks[this],{set:function(e,bv){if(b.isArray(bv)){return(e.checked=b.inArray(b(e).val(),bv)>=0)}}})});var bd=/^(?:textarea|input|select)$/i,n=/^([^\.]*)?(?:\.(.+))?$/,J=/\bhover(\.\S+)?\b/,aO=/^key/,bf=/^(?:mouse|contextmenu)|click/,T=/^(?:focusinfocus|focusoutblur)$/,U=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,Y=function(e){var bv=U.exec(e);if(bv){bv[1]=(bv[1]||"").toLowerCase();bv[3]=bv[3]&&new RegExp("(?:^|\\s)"+bv[3]+"(?:\\s|$)")}return bv},j=function(bw,e){var bv=bw.attributes||{};return((!e[1]||bw.nodeName.toLowerCase()===e[1])&&(!e[2]||(bv.id||{}).value===e[2])&&(!e[3]||e[3].test((bv["class"]||{}).value)))},bt=function(e){return b.event.special.hover?e:e.replace(J,"mouseenter$1 mouseleave$1")};b.event={add:function(bx,bC,bJ,bA,by){var bD,bB,bK,bI,bH,bF,e,bG,bv,bz,bw,bE;if(bx.nodeType===3||bx.nodeType===8||!bC||!bJ||!(bD=b._data(bx))){return}if(bJ.handler){bv=bJ;bJ=bv.handler}if(!bJ.guid){bJ.guid=b.guid++}bK=bD.events;if(!bK){bD.events=bK={}}bB=bD.handle;if(!bB){bD.handle=bB=function(bL){return typeof b!=="undefined"&&(!bL||b.event.triggered!==bL.type)?b.event.dispatch.apply(bB.elem,arguments):L};bB.elem=bx}bC=b.trim(bt(bC)).split(" ");for(bI=0;bI<bC.length;bI++){bH=n.exec(bC[bI])||[];bF=bH[1];e=(bH[2]||"").split(".").sort();bE=b.event.special[bF]||{};bF=(by?bE.delegateType:bE.bindType)||bF;bE=b.event.special[bF]||{};bG=b.extend({type:bF,origType:bH[1],data:bA,handler:bJ,guid:bJ.guid,selector:by,quick:Y(by),namespace:e.join(".")},bv);bw=bK[bF];if(!bw){bw=bK[bF]=[];bw.delegateCount=0;if(!bE.setup||bE.setup.call(bx,bA,e,bB)===false){if(bx.addEventListener){bx.addEventListener(bF,bB,false)}else{if(bx.attachEvent){bx.attachEvent("on"+bF,bB)}}}}if(bE.add){bE.add.call(bx,bG);if(!bG.handler.guid){bG.handler.guid=bJ.guid}}if(by){bw.splice(bw.delegateCount++,0,bG)}else{bw.push(bG)}b.event.global[bF]=true}bx=null},global:{},remove:function(bJ,bE,bv,bH,bB){var bI=b.hasData(bJ)&&b._data(bJ),bF,bx,bz,bL,bC,bA,bG,bw,by,bK,bD,e;if(!bI||!(bw=bI.events)){return}bE=b.trim(bt(bE||"")).split(" ");for(bF=0;bF<bE.length;bF++){bx=n.exec(bE[bF])||[];bz=bL=bx[1];bC=bx[2];if(!bz){for(bz in bw){b.event.remove(bJ,bz+bE[bF],bv,bH,true)}continue}by=b.event.special[bz]||{};bz=(bH?by.delegateType:by.bindType)||bz;bD=bw[bz]||[];bA=bD.length;bC=bC?new RegExp("(^|\\.)"+bC.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(bG=0;bG<bD.length;bG++){e=bD[bG];if((bB||bL===e.origType)&&(!bv||bv.guid===e.guid)&&(!bC||bC.test(e.namespace))&&(!bH||bH===e.selector||bH==="**"&&e.selector)){bD.splice(bG--,1);if(e.selector){bD.delegateCount--}if(by.remove){by.remove.call(bJ,e)}}}if(bD.length===0&&bA!==bD.length){if(!by.teardown||by.teardown.call(bJ,bC)===false){b.removeEvent(bJ,bz,bI.handle)}delete bw[bz]}}if(b.isEmptyObject(bw)){bK=bI.handle;if(bK){bK.elem=null}b.removeData(bJ,["events","handle"],true)}},customEvent:{getData:true,setData:true,changeData:true},trigger:function(bv,bD,bA,bJ){if(bA&&(bA.nodeType===3||bA.nodeType===8)){return}var bG=bv.type||bv,bx=[],e,bw,bC,bH,bz,by,bF,bE,bB,bI;if(T.test(bG+b.event.triggered)){return}if(bG.indexOf("!")>=0){bG=bG.slice(0,-1);bw=true}if(bG.indexOf(".")>=0){bx=bG.split(".");bG=bx.shift();bx.sort()}if((!bA||b.event.customEvent[bG])&&!b.event.global[bG]){return}bv=typeof bv==="object"?bv[b.expando]?bv:new b.Event(bG,bv):new b.Event(bG);bv.type=bG;bv.isTrigger=true;bv.exclusive=bw;bv.namespace=bx.join(".");bv.namespace_re=bv.namespace?new RegExp("(^|\\.)"+bx.join("\\.(?:.*\\.)?")+"(\\.|$)"):null;by=bG.indexOf(":")<0?"on"+bG:"";if(!bA){e=b.cache;for(bC in e){if(e[bC].events&&e[bC].events[bG]){b.event.trigger(bv,bD,e[bC].handle.elem,true)}}return}bv.result=L;if(!bv.target){bv.target=bA}bD=bD!=null?b.makeArray(bD):[];bD.unshift(bv);bF=b.event.special[bG]||{};if(bF.trigger&&bF.trigger.apply(bA,bD)===false){return}bB=[[bA,bF.bindType||bG]];if(!bJ&&!bF.noBubble&&!b.isWindow(bA)){bI=bF.delegateType||bG;bH=T.test(bI+bG)?bA:bA.parentNode;bz=null;for(;bH;bH=bH.parentNode){bB.push([bH,bI]);bz=bH}if(bz&&bz===bA.ownerDocument){bB.push([bz.defaultView||bz.parentWindow||bb,bI])}}for(bC=0;bC<bB.length&&!bv.isPropagationStopped();bC++){bH=bB[bC][0];bv.type=bB[bC][1];bE=(b._data(bH,"events")||{})[bv.type]&&b._data(bH,"handle");if(bE){bE.apply(bH,bD)}bE=by&&bH[by];if(bE&&b.acceptData(bH)&&bE.apply(bH,bD)===false){bv.preventDefault()}}bv.type=bG;if(!bJ&&!bv.isDefaultPrevented()){if((!bF._default||bF._default.apply(bA.ownerDocument,bD)===false)&&!(bG==="click"&&b.nodeName(bA,"a"))&&b.acceptData(bA)){if(by&&bA[bG]&&((bG!=="focus"&&bG!=="blur")||bv.target.offsetWidth!==0)&&!b.isWindow(bA)){bz=bA[by];if(bz){bA[by]=null}b.event.triggered=bG;bA[bG]();b.event.triggered=L;if(bz){bA[by]=bz}}}}return bv.result},dispatch:function(e){e=b.event.fix(e||bb.event);var bz=((b._data(this,"events")||{})[e.type]||[]),bA=bz.delegateCount,bG=[].slice.call(arguments,0),by=!e.exclusive&&!e.namespace,bH=[],bC,bB,bK,bx,bF,bE,bv,bD,bI,bw,bJ;bG[0]=e;e.delegateTarget=this;if(bA&&!e.target.disabled&&!(e.button&&e.type==="click")){bx=b(this);bx.context=this.ownerDocument||this;for(bK=e.target;bK!=this;bK=bK.parentNode||this){bE={};bD=[];bx[0]=bK;for(bC=0;bC<bA;bC++){bI=bz[bC];bw=bI.selector;if(bE[bw]===L){bE[bw]=(bI.quick?j(bK,bI.quick):bx.is(bw))}if(bE[bw]){bD.push(bI)}}if(bD.length){bH.push({elem:bK,matches:bD})}}}if(bz.length>bA){bH.push({elem:this,matches:bz.slice(bA)})}for(bC=0;bC<bH.length&&!e.isPropagationStopped();bC++){bv=bH[bC];e.currentTarget=bv.elem;for(bB=0;bB<bv.matches.length&&!e.isImmediatePropagationStopped();bB++){bI=bv.matches[bB];if(by||(!e.namespace&&!bI.namespace)||e.namespace_re&&e.namespace_re.test(bI.namespace)){e.data=bI.data;e.handleObj=bI;bF=((b.event.special[bI.origType]||{}).handle||bI.handler).apply(bv.elem,bG);if(bF!==L){e.result=bF;if(bF===false){e.preventDefault();e.stopPropagation()}}}}}return e.result},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(bv,e){if(bv.which==null){bv.which=e.charCode!=null?e.charCode:e.keyCode}return bv}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(bx,bw){var by,bz,e,bv=bw.button,bA=bw.fromElement;if(bx.pageX==null&&bw.clientX!=null){by=bx.target.ownerDocument||av;bz=by.documentElement;e=by.body;bx.pageX=bw.clientX+(bz&&bz.scrollLeft||e&&e.scrollLeft||0)-(bz&&bz.clientLeft||e&&e.clientLeft||0);bx.pageY=bw.clientY+(bz&&bz.scrollTop||e&&e.scrollTop||0)-(bz&&bz.clientTop||e&&e.clientTop||0)}if(!bx.relatedTarget&&bA){bx.relatedTarget=bA===bx.target?bw.toElement:bA}if(!bx.which&&bv!==L){bx.which=(bv&1?1:(bv&2?3:(bv&4?2:0)))}return bx}},fix:function(bw){if(bw[b.expando]){return bw}var bv,bz,e=bw,bx=b.event.fixHooks[bw.type]||{},by=bx.props?this.props.concat(bx.props):this.props;bw=b.Event(e);for(bv=by.length;bv;){bz=by[--bv];bw[bz]=e[bz]}if(!bw.target){bw.target=e.srcElement||av}if(bw.target.nodeType===3){bw.target=bw.target.parentNode}if(bw.metaKey===L){bw.metaKey=bw.ctrlKey}return bx.filter?bx.filter(bw,e):bw},special:{ready:{setup:b.bindReady},load:{noBubble:true},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(bw,bv,e){if(b.isWindow(this)){this.onbeforeunload=e}},teardown:function(bv,e){if(this.onbeforeunload===e){this.onbeforeunload=null}}}},simulate:function(bw,by,bx,bv){var bz=b.extend(new b.Event(),bx,{type:bw,isSimulated:true,originalEvent:{}});if(bv){b.event.trigger(bz,null,by)}else{b.event.dispatch.call(by,bz)}if(bz.isDefaultPrevented()){bx.preventDefault()}}};b.event.handle=b.event.dispatch;b.removeEvent=av.removeEventListener?function(bv,e,bw){if(bv.removeEventListener){bv.removeEventListener(e,bw,false)}}:function(bv,e,bw){if(bv.detachEvent){bv.detachEvent("on"+e,bw)}};b.Event=function(bv,e){if(!(this instanceof b.Event)){return new b.Event(bv,e)}if(bv&&bv.type){this.originalEvent=bv;this.type=bv.type;this.isDefaultPrevented=(bv.defaultPrevented||bv.returnValue===false||bv.getPreventDefault&&bv.getPreventDefault())?i:bk}else{this.type=bv}if(e){b.extend(this,e)}this.timeStamp=bv&&bv.timeStamp||b.now();this[b.expando]=true};function bk(){return false}function i(){return true}b.Event.prototype={preventDefault:function(){this.isDefaultPrevented=i;var bv=this.originalEvent;if(!bv){return}if(bv.preventDefault){bv.preventDefault()}else{bv.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=i;var bv=this.originalEvent;if(!bv){return}if(bv.stopPropagation){bv.stopPropagation()}bv.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=i;this.stopPropagation()},isDefaultPrevented:bk,isPropagationStopped:bk,isImmediatePropagationStopped:bk};b.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(bv,e){b.event.special[bv]={delegateType:e,bindType:e,handle:function(bz){var bB=this,bA=bz.relatedTarget,by=bz.handleObj,bw=by.selector,bx;if(!bA||(bA!==bB&&!b.contains(bB,bA))){bz.type=by.origType;bx=by.handler.apply(this,arguments);bz.type=e}return bx}}});if(!b.support.submitBubbles){b.event.special.submit={setup:function(){if(b.nodeName(this,"form")){return false}b.event.add(this,"click._submit keypress._submit",function(bx){var bw=bx.target,bv=b.nodeName(bw,"input")||b.nodeName(bw,"button")?bw.form:L;if(bv&&!bv._submit_attached){b.event.add(bv,"submit._submit",function(e){if(this.parentNode&&!e.isTrigger){b.event.simulate("submit",this.parentNode,e,true)}});bv._submit_attached=true}})},teardown:function(){if(b.nodeName(this,"form")){return false}b.event.remove(this,"._submit")}}}if(!b.support.changeBubbles){b.event.special.change={setup:function(){if(bd.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio"){b.event.add(this,"propertychange._change",function(e){if(e.originalEvent.propertyName==="checked"){this._just_changed=true}});b.event.add(this,"click._change",function(e){if(this._just_changed&&!e.isTrigger){this._just_changed=false;b.event.simulate("change",this,e,true)}})}return false}b.event.add(this,"beforeactivate._change",function(bw){var bv=bw.target;if(bd.test(bv.nodeName)&&!bv._change_attached){b.event.add(bv,"change._change",function(e){if(this.parentNode&&!e.isSimulated&&!e.isTrigger){b.event.simulate("change",this.parentNode,e,true)}});bv._change_attached=true}})},handle:function(bv){var e=bv.target;if(this!==e||bv.isSimulated||bv.isTrigger||(e.type!=="radio"&&e.type!=="checkbox")){return bv.handleObj.handler.apply(this,arguments)}},teardown:function(){b.event.remove(this,"._change");return bd.test(this.nodeName)}}}if(!b.support.focusinBubbles){b.each({focus:"focusin",blur:"focusout"},function(bx,e){var bv=0,bw=function(by){b.event.simulate(e,by.target,b.event.fix(by),true)};b.event.special[e]={setup:function(){if(bv++===0){av.addEventListener(bx,bw,true)}},teardown:function(){if(--bv===0){av.removeEventListener(bx,bw,true)}}}})}b.fn.extend({on:function(bw,e,bz,by,bv){var bA,bx;if(typeof bw==="object"){if(typeof e!=="string"){bz=e;e=L}for(bx in bw){this.on(bx,e,bz,bw[bx],bv)}return this}if(bz==null&&by==null){by=e;bz=e=L}else{if(by==null){if(typeof e==="string"){by=bz;bz=L}else{by=bz;bz=e;e=L}}}if(by===false){by=bk}else{if(!by){return this}}if(bv===1){bA=by;by=function(bB){b().off(bB);return bA.apply(this,arguments)};by.guid=bA.guid||(bA.guid=b.guid++)}return this.each(function(){b.event.add(this,bw,by,bz,e)})},one:function(bv,e,bx,bw){return this.on.call(this,bv,e,bx,bw,1)},off:function(bw,e,by){if(bw&&bw.preventDefault&&bw.handleObj){var bv=bw.handleObj;b(bw.delegateTarget).off(bv.namespace?bv.type+"."+bv.namespace:bv.type,bv.selector,bv.handler);return this}if(typeof bw==="object"){for(var bx in bw){this.off(bx,e,bw[bx])}return this}if(e===false||typeof e==="function"){by=e;e=L}if(by===false){by=bk}return this.each(function(){b.event.remove(this,bw,by,e)})},bind:function(e,bw,bv){return this.on(e,null,bw,bv)},unbind:function(e,bv){return this.off(e,null,bv)},live:function(e,bw,bv){b(this.context).on(e,this.selector,bw,bv);return this},die:function(e,bv){b(this.context).off(e,this.selector||"**",bv);return this},delegate:function(e,bv,bx,bw){return this.on(bv,e,bx,bw)},undelegate:function(e,bv,bw){return arguments.length==1?this.off(e,"**"):this.off(bv,e,bw)},trigger:function(e,bv){return this.each(function(){b.event.trigger(e,bv,this)})},triggerHandler:function(e,bv){if(this[0]){return b.event.trigger(e,bv,this[0],true)}},toggle:function(bx){var bv=arguments,e=bx.guid||b.guid++,bw=0,by=function(bz){var bA=(b._data(this,"lastToggle"+bx.guid)||0)%bw;b._data(this,"lastToggle"+bx.guid,bA+1);bz.preventDefault();return bv[bA].apply(this,arguments)||false};by.guid=e;while(bw<bv.length){bv[bw++].guid=e}return this.click(by)},hover:function(e,bv){return this.mouseenter(e).mouseleave(bv||e)}});b.each(("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu").split(" "),function(bv,e){b.fn[e]=function(bx,bw){if(bw==null){bw=bx;bx=null}return arguments.length>0?this.on(e,null,bx,bw):this.trigger(e)};if(b.attrFn){b.attrFn[e]=true}if(aO.test(e)){b.event.fixHooks[e]=b.event.keyHooks}if(bf.test(e)){b.event.fixHooks[e]=b.event.mouseHooks}});
+ * Sizzle CSS Selector Engine
+ * Copyright 2011, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ * More information: http://sizzlejs.com/
+ */
+(function(){var bH=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,bC="sizcache"+(Math.random()+"").replace(".",""),bI=0,bL=Object.prototype.toString,bB=false,bA=true,bK=/\\/g,bO=/\r\n/g,bQ=/\W/;[0,0].sort(function(){bA=false;return 0});var by=function(bV,e,bY,bZ){bY=bY||[];e=e||av;var b1=e;if(e.nodeType!==1&&e.nodeType!==9){return[]}if(!bV||typeof bV!=="string"){return bY}var bS,b3,b6,bR,b2,b5,b4,bX,bU=true,bT=by.isXML(e),bW=[],b0=bV;do{bH.exec("");bS=bH.exec(b0);if(bS){b0=bS[3];bW.push(bS[1]);if(bS[2]){bR=bS[3];break}}}while(bS);if(bW.length>1&&bD.exec(bV)){if(bW.length===2&&bE.relative[bW[0]]){b3=bM(bW[0]+bW[1],e,bZ)}else{b3=bE.relative[bW[0]]?[e]:by(bW.shift(),e);while(bW.length){bV=bW.shift();if(bE.relative[bV]){bV+=bW.shift()}b3=bM(bV,b3,bZ)}}}else{if(!bZ&&bW.length>1&&e.nodeType===9&&!bT&&bE.match.ID.test(bW[0])&&!bE.match.ID.test(bW[bW.length-1])){b2=by.find(bW.shift(),e,bT);e=b2.expr?by.filter(b2.expr,b2.set)[0]:b2.set[0]}if(e){b2=bZ?{expr:bW.pop(),set:bF(bZ)}:by.find(bW.pop(),bW.length===1&&(bW[0]==="~"||bW[0]==="+")&&e.parentNode?e.parentNode:e,bT);b3=b2.expr?by.filter(b2.expr,b2.set):b2.set;if(bW.length>0){b6=bF(b3)}else{bU=false}while(bW.length){b5=bW.pop();b4=b5;if(!bE.relative[b5]){b5=""}else{b4=bW.pop()}if(b4==null){b4=e}bE.relative[b5](b6,b4,bT)}}else{b6=bW=[]}}if(!b6){b6=b3}if(!b6){by.error(b5||bV)}if(bL.call(b6)==="[object Array]"){if(!bU){bY.push.apply(bY,b6)}else{if(e&&e.nodeType===1){for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&(b6[bX]===true||b6[bX].nodeType===1&&by.contains(e,b6[bX]))){bY.push(b3[bX])}}}else{for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&b6[bX].nodeType===1){bY.push(b3[bX])}}}}}else{bF(b6,bY)}if(bR){by(bR,b1,bY,bZ);by.uniqueSort(bY)}return bY};by.uniqueSort=function(bR){if(bJ){bB=bA;bR.sort(bJ);if(bB){for(var e=1;e<bR.length;e++){if(bR[e]===bR[e-1]){bR.splice(e--,1)}}}}return bR};by.matches=function(e,bR){return by(e,null,null,bR)};by.matchesSelector=function(e,bR){return by(bR,null,null,[e]).length>0};by.find=function(bX,e,bY){var bW,bS,bU,bT,bV,bR;if(!bX){return[]}for(bS=0,bU=bE.order.length;bS<bU;bS++){bV=bE.order[bS];if((bT=bE.leftMatch[bV].exec(bX))){bR=bT[1];bT.splice(1,1);if(bR.substr(bR.length-1)!=="\\"){bT[1]=(bT[1]||"").replace(bK,"");bW=bE.find[bV](bT,e,bY);if(bW!=null){bX=bX.replace(bE.match[bV],"");break}}}}if(!bW){bW=typeof e.getElementsByTagName!=="undefined"?e.getElementsByTagName("*"):[]}return{set:bW,expr:bX}};by.filter=function(b1,b0,b4,bU){var bW,e,bZ,b6,b3,bR,bT,bV,b2,bS=b1,b5=[],bY=b0,bX=b0&&b0[0]&&by.isXML(b0[0]);while(b1&&b0.length){for(bZ in bE.filter){if((bW=bE.leftMatch[bZ].exec(b1))!=null&&bW[2]){bR=bE.filter[bZ];bT=bW[1];e=false;bW.splice(1,1);if(bT.substr(bT.length-1)==="\\"){continue}if(bY===b5){b5=[]}if(bE.preFilter[bZ]){bW=bE.preFilter[bZ](bW,bY,b4,b5,bU,bX);if(!bW){e=b6=true}else{if(bW===true){continue}}}if(bW){for(bV=0;(b3=bY[bV])!=null;bV++){if(b3){b6=bR(b3,bW,bV,bY);b2=bU^b6;if(b4&&b6!=null){if(b2){e=true}else{bY[bV]=false}}else{if(b2){b5.push(b3);e=true}}}}}if(b6!==L){if(!b4){bY=b5}b1=b1.replace(bE.match[bZ],"");if(!e){return[]}break}}}if(b1===bS){if(e==null){by.error(b1)}else{break}}bS=b1}return bY};by.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)};var bw=by.getText=function(bU){var bS,bT,e=bU.nodeType,bR="";if(e){if(e===1||e===9){if(typeof bU.textContent==="string"){return bU.textContent}else{if(typeof bU.innerText==="string"){return bU.innerText.replace(bO,"")}else{for(bU=bU.firstChild;bU;bU=bU.nextSibling){bR+=bw(bU)}}}}else{if(e===3||e===4){return bU.nodeValue}}}else{for(bS=0;(bT=bU[bS]);bS++){if(bT.nodeType!==8){bR+=bw(bT)}}}return bR};var bE=by.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(e){return e.getAttribute("href")},type:function(e){return e.getAttribute("type")}},relative:{"+":function(bW,bR){var bT=typeof bR==="string",bV=bT&&!bQ.test(bR),bX=bT&&!bV;if(bV){bR=bR.toLowerCase()}for(var bS=0,e=bW.length,bU;bS<e;bS++){if((bU=bW[bS])){while((bU=bU.previousSibling)&&bU.nodeType!==1){}bW[bS]=bX||bU&&bU.nodeName.toLowerCase()===bR?bU||false:bU===bR}}if(bX){by.filter(bR,bW,true)}},">":function(bW,bR){var bV,bU=typeof bR==="string",bS=0,e=bW.length;if(bU&&!bQ.test(bR)){bR=bR.toLowerCase();for(;bS<e;bS++){bV=bW[bS];if(bV){var bT=bV.parentNode;bW[bS]=bT.nodeName.toLowerCase()===bR?bT:false}}}else{for(;bS<e;bS++){bV=bW[bS];if(bV){bW[bS]=bU?bV.parentNode:bV.parentNode===bR}}if(bU){by.filter(bR,bW,true)}}},"":function(bT,bR,bV){var bU,bS=bI++,e=bN;if(typeof bR==="string"&&!bQ.test(bR)){bR=bR.toLowerCase();bU=bR;e=bv}e("parentNode",bR,bS,bT,bU,bV)},"~":function(bT,bR,bV){var bU,bS=bI++,e=bN;if(typeof bR==="string"&&!bQ.test(bR)){bR=bR.toLowerCase();bU=bR;e=bv}e("previousSibling",bR,bS,bT,bU,bV)}},find:{ID:function(bR,bS,bT){if(typeof bS.getElementById!=="undefined"&&!bT){var e=bS.getElementById(bR[1]);return e&&e.parentNode?[e]:[]}},NAME:function(bS,bV){if(typeof bV.getElementsByName!=="undefined"){var bR=[],bU=bV.getElementsByName(bS[1]);for(var bT=0,e=bU.length;bT<e;bT++){if(bU[bT].getAttribute("name")===bS[1]){bR.push(bU[bT])}}return bR.length===0?null:bR}},TAG:function(e,bR){if(typeof bR.getElementsByTagName!=="undefined"){return bR.getElementsByTagName(e[1])}}},preFilter:{CLASS:function(bT,bR,bS,e,bW,bX){bT=" "+bT[1].replace(bK,"")+" ";if(bX){return bT}for(var bU=0,bV;(bV=bR[bU])!=null;bU++){if(bV){if(bW^(bV.className&&(" "+bV.className+" ").replace(/[\t\n\r]/g," ").indexOf(bT)>=0)){if(!bS){e.push(bV)}}else{if(bS){bR[bU]=false}}}}return false},ID:function(e){return e[1].replace(bK,"")},TAG:function(bR,e){return bR[1].replace(bK,"").toLowerCase()},CHILD:function(e){if(e[1]==="nth"){if(!e[2]){by.error(e[0])}e[2]=e[2].replace(/^\+|\s*/g,"");var bR=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(e[2]==="even"&&"2n"||e[2]==="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(bR[1]+(bR[2]||1))-0;e[3]=bR[3]-0}else{if(e[2]){by.error(e[0])}}e[0]=bI++;return e},ATTR:function(bU,bR,bS,e,bV,bW){var bT=bU[1]=bU[1].replace(bK,"");if(!bW&&bE.attrMap[bT]){bU[1]=bE.attrMap[bT]}bU[4]=(bU[4]||bU[5]||"").replace(bK,"");if(bU[2]==="~="){bU[4]=" "+bU[4]+" "}return bU},PSEUDO:function(bU,bR,bS,e,bV){if(bU[1]==="not"){if((bH.exec(bU[3])||"").length>1||/^\w/.test(bU[3])){bU[3]=by(bU[3],null,null,bR)}else{var bT=by.filter(bU[3],bR,bS,true^bV);if(!bS){e.push.apply(e,bT)}return false}}else{if(bE.match.POS.test(bU[0])||bE.match.CHILD.test(bU[0])){return true}}return bU},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){if(e.parentNode){e.parentNode.selectedIndex}return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(bS,bR,e){return !!by(e[3],bS).length},header:function(e){return(/h\d/i).test(e.nodeName)},text:function(bS){var e=bS.getAttribute("type"),bR=bS.type;return bS.nodeName.toLowerCase()==="input"&&"text"===bR&&(e===bR||e===null)},radio:function(e){return e.nodeName.toLowerCase()==="input"&&"radio"===e.type},checkbox:function(e){return e.nodeName.toLowerCase()==="input"&&"checkbox"===e.type},file:function(e){return e.nodeName.toLowerCase()==="input"&&"file"===e.type},password:function(e){return e.nodeName.toLowerCase()==="input"&&"password"===e.type},submit:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"submit"===bR.type},image:function(e){return e.nodeName.toLowerCase()==="input"&&"image"===e.type},reset:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"reset"===bR.type},button:function(bR){var e=bR.nodeName.toLowerCase();return e==="input"&&"button"===bR.type||e==="button"},input:function(e){return(/input|select|textarea|button/i).test(e.nodeName)},focus:function(e){return e===e.ownerDocument.activeElement}},setFilters:{first:function(bR,e){return e===0},last:function(bS,bR,e,bT){return bR===bT.length-1},even:function(bR,e){return e%2===0},odd:function(bR,e){return e%2===1},lt:function(bS,bR,e){return bR<e[3]-0},gt:function(bS,bR,e){return bR>e[3]-0},nth:function(bS,bR,e){return e[3]-0===bR},eq:function(bS,bR,e){return e[3]-0===bR}},filter:{PSEUDO:function(bS,bX,bW,bY){var e=bX[1],bR=bE.filters[e];if(bR){return bR(bS,bW,bX,bY)}else{if(e==="contains"){return(bS.textContent||bS.innerText||bw([bS])||"").indexOf(bX[3])>=0}else{if(e==="not"){var bT=bX[3];for(var bV=0,bU=bT.length;bV<bU;bV++){if(bT[bV]===bS){return false}}return true}else{by.error(e)}}}},CHILD:function(bS,bU){var bT,b0,bW,bZ,e,bV,bY,bX=bU[1],bR=bS;switch(bX){case"only":case"first":while((bR=bR.previousSibling)){if(bR.nodeType===1){return false}}if(bX==="first"){return true}bR=bS;case"last":while((bR=bR.nextSibling)){if(bR.nodeType===1){return false}}return true;case"nth":bT=bU[2];b0=bU[3];if(bT===1&&b0===0){return true}bW=bU[0];bZ=bS.parentNode;if(bZ&&(bZ[bC]!==bW||!bS.nodeIndex)){bV=0;for(bR=bZ.firstChild;bR;bR=bR.nextSibling){if(bR.nodeType===1){bR.nodeIndex=++bV}}bZ[bC]=bW}bY=bS.nodeIndex-b0;if(bT===0){return bY===0}else{return(bY%bT===0&&bY/bT>=0)}}},ID:function(bR,e){return bR.nodeType===1&&bR.getAttribute("id")===e},TAG:function(bR,e){return(e==="*"&&bR.nodeType===1)||!!bR.nodeName&&bR.nodeName.toLowerCase()===e},CLASS:function(bR,e){return(" "+(bR.className||bR.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(bV,bT){var bS=bT[1],e=by.attr?by.attr(bV,bS):bE.attrHandle[bS]?bE.attrHandle[bS](bV):bV[bS]!=null?bV[bS]:bV.getAttribute(bS),bW=e+"",bU=bT[2],bR=bT[4];return e==null?bU==="!=":!bU&&by.attr?e!=null:bU==="="?bW===bR:bU==="*="?bW.indexOf(bR)>=0:bU==="~="?(" "+bW+" ").indexOf(bR)>=0:!bR?bW&&e!==false:bU==="!="?bW!==bR:bU==="^="?bW.indexOf(bR)===0:bU==="$="?bW.substr(bW.length-bR.length)===bR:bU==="|="?bW===bR||bW.substr(0,bR.length+1)===bR+"-":false},POS:function(bU,bR,bS,bV){var e=bR[2],bT=bE.setFilters[e];if(bT){return bT(bU,bS,bR,bV)}}}};var bD=bE.match.POS,bx=function(bR,e){return"\\"+(e-0+1)};for(var bz in bE.match){bE.match[bz]=new RegExp(bE.match[bz].source+(/(?![^\[]*\])(?![^\(]*\))/.source));bE.leftMatch[bz]=new RegExp(/(^(?:.|\r|\n)*?)/.source+bE.match[bz].source.replace(/\\(\d+)/g,bx))}var bF=function(bR,e){bR=Array.prototype.slice.call(bR,0);if(e){e.push.apply(e,bR);return e}return bR};try{Array.prototype.slice.call(av.documentElement.childNodes,0)[0].nodeType}catch(bP){bF=function(bU,bT){var bS=0,bR=bT||[];if(bL.call(bU)==="[object Array]"){Array.prototype.push.apply(bR,bU)}else{if(typeof bU.length==="number"){for(var e=bU.length;bS<e;bS++){bR.push(bU[bS])}}else{for(;bU[bS];bS++){bR.push(bU[bS])}}}return bR}}var bJ,bG;if(av.documentElement.compareDocumentPosition){bJ=function(bR,e){if(bR===e){bB=true;return 0}if(!bR.compareDocumentPosition||!e.compareDocumentPosition){return bR.compareDocumentPosition?-1:1}return bR.compareDocumentPosition(e)&4?-1:1}}else{bJ=function(bY,bX){if(bY===bX){bB=true;return 0}else{if(bY.sourceIndex&&bX.sourceIndex){return bY.sourceIndex-bX.sourceIndex}}var bV,bR,bS=[],e=[],bU=bY.parentNode,bW=bX.parentNode,bZ=bU;if(bU===bW){return bG(bY,bX)}else{if(!bU){return -1}else{if(!bW){return 1}}}while(bZ){bS.unshift(bZ);bZ=bZ.parentNode}bZ=bW;while(bZ){e.unshift(bZ);bZ=bZ.parentNode}bV=bS.length;bR=e.length;for(var bT=0;bT<bV&&bT<bR;bT++){if(bS[bT]!==e[bT]){return bG(bS[bT],e[bT])}}return bT===bV?bG(bY,e[bT],-1):bG(bS[bT],bX,1)};bG=function(bR,e,bS){if(bR===e){return bS}var bT=bR.nextSibling;while(bT){if(bT===e){return -1}bT=bT.nextSibling}return 1}}(function(){var bR=av.createElement("div"),bS="script"+(new Date()).getTime(),e=av.documentElement;bR.innerHTML="<a name='"+bS+"'/>";e.insertBefore(bR,e.firstChild);if(av.getElementById(bS)){bE.find.ID=function(bU,bV,bW){if(typeof bV.getElementById!=="undefined"&&!bW){var bT=bV.getElementById(bU[1]);return bT?bT.id===bU[1]||typeof bT.getAttributeNode!=="undefined"&&bT.getAttributeNode("id").nodeValue===bU[1]?[bT]:L:[]}};bE.filter.ID=function(bV,bT){var bU=typeof bV.getAttributeNode!=="undefined"&&bV.getAttributeNode("id");return bV.nodeType===1&&bU&&bU.nodeValue===bT}}e.removeChild(bR);e=bR=null})();(function(){var e=av.createElement("div");e.appendChild(av.createComment(""));if(e.getElementsByTagName("*").length>0){bE.find.TAG=function(bR,bV){var bU=bV.getElementsByTagName(bR[1]);if(bR[1]==="*"){var bT=[];for(var bS=0;bU[bS];bS++){if(bU[bS].nodeType===1){bT.push(bU[bS])}}bU=bT}return bU}}e.innerHTML="<a href='#'></a>";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){bE.attrHandle.href=function(bR){return bR.getAttribute("href",2)}}e=null})();if(av.querySelectorAll){(function(){var e=by,bT=av.createElement("div"),bS="__sizzle__";bT.innerHTML="<p class='TEST'></p>";if(bT.querySelectorAll&&bT.querySelectorAll(".TEST").length===0){return}by=function(b4,bV,bZ,b3){bV=bV||av;if(!b3&&!by.isXML(bV)){var b2=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b4);if(b2&&(bV.nodeType===1||bV.nodeType===9)){if(b2[1]){return bF(bV.getElementsByTagName(b4),bZ)}else{if(b2[2]&&bE.find.CLASS&&bV.getElementsByClassName){return bF(bV.getElementsByClassName(b2[2]),bZ)}}}if(bV.nodeType===9){if(b4==="body"&&bV.body){return bF([bV.body],bZ)}else{if(b2&&b2[3]){var bY=bV.getElementById(b2[3]);if(bY&&bY.parentNode){if(bY.id===b2[3]){return bF([bY],bZ)}}else{return bF([],bZ)}}}try{return bF(bV.querySelectorAll(b4),bZ)}catch(b0){}}else{if(bV.nodeType===1&&bV.nodeName.toLowerCase()!=="object"){var bW=bV,bX=bV.getAttribute("id"),bU=bX||bS,b6=bV.parentNode,b5=/^\s*[+~]/.test(b4);if(!bX){bV.setAttribute("id",bU)}else{bU=bU.replace(/'/g,"\\$&")}if(b5&&b6){bV=bV.parentNode}try{if(!b5||b6){return bF(bV.querySelectorAll("[id='"+bU+"'] "+b4),bZ)}}catch(b1){}finally{if(!bX){bW.removeAttribute("id")}}}}}return e(b4,bV,bZ,b3)};for(var bR in e){by[bR]=e[bR]}bT=null})()}(function(){var e=av.documentElement,bS=e.matchesSelector||e.mozMatchesSelector||e.webkitMatchesSelector||e.msMatchesSelector;if(bS){var bU=!bS.call(av.createElement("div"),"div"),bR=false;try{bS.call(av.documentElement,"[test!='']:sizzle")}catch(bT){bR=true}by.matchesSelector=function(bW,bY){bY=bY.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!by.isXML(bW)){try{if(bR||!bE.match.PSEUDO.test(bY)&&!/!=/.test(bY)){var bV=bS.call(bW,bY);if(bV||!bU||bW.document&&bW.document.nodeType!==11){return bV}}}catch(bX){}}return by(bY,null,null,[bW]).length>0}}})();(function(){var e=av.createElement("div");e.innerHTML="<div class='test e'></div><div class='test'></div>";if(!e.getElementsByClassName||e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}bE.order.splice(1,0,"CLASS");bE.find.CLASS=function(bR,bS,bT){if(typeof bS.getElementsByClassName!=="undefined"&&!bT){return bS.getElementsByClassName(bR[1])}};e=null})();function bv(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT<bS;bT++){var e=bZ[bT];if(e){var bU=false;e=e[bR];while(e){if(e[bC]===bV){bU=bZ[e.sizset];break}if(e.nodeType===1&&!bY){e[bC]=bV;e.sizset=bT}if(e.nodeName.toLowerCase()===bW){bU=e;break}e=e[bR]}bZ[bT]=bU}}}function bN(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT<bS;bT++){var e=bZ[bT];if(e){var bU=false;e=e[bR];while(e){if(e[bC]===bV){bU=bZ[e.sizset];break}if(e.nodeType===1){if(!bY){e[bC]=bV;e.sizset=bT}if(typeof bW!=="string"){if(e===bW){bU=true;break}}else{if(by.filter(bW,[e]).length>0){bU=e;break}}}e=e[bR]}bZ[bT]=bU}}}if(av.documentElement.contains){by.contains=function(bR,e){return bR!==e&&(bR.contains?bR.contains(e):true)}}else{if(av.documentElement.compareDocumentPosition){by.contains=function(bR,e){return !!(bR.compareDocumentPosition(e)&16)}}else{by.contains=function(){return false}}}by.isXML=function(e){var bR=(e?e.ownerDocument||e:0).documentElement;return bR?bR.nodeName!=="HTML":false};var bM=function(bS,e,bW){var bV,bX=[],bU="",bY=e.nodeType?[e]:e;while((bV=bE.match.PSEUDO.exec(bS))){bU+=bV[0];bS=bS.replace(bE.match.PSEUDO,"")}bS=bE.relative[bS]?bS+"*":bS;for(var bT=0,bR=bY.length;bT<bR;bT++){by(bS,bY[bT],bX,bW)}return by.filter(bU,bX)};by.attr=b.attr;by.selectors.attrMap={};b.find=by;b.expr=by.selectors;b.expr[":"]=b.expr.filters;b.unique=by.uniqueSort;b.text=by.getText;b.isXMLDoc=by.isXML;b.contains=by.contains})();var ab=/Until$/,aq=/^(?:parents|prevUntil|prevAll)/,a9=/,/,bp=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,H=b.expr.match.POS,ay={children:true,contents:true,next:true,prev:true};b.fn.extend({find:function(e){var bw=this,by,bv;if(typeof e!=="string"){return b(e).filter(function(){for(by=0,bv=bw.length;by<bv;by++){if(b.contains(bw[by],this)){return true}}})}var bx=this.pushStack("","find",e),bA,bB,bz;for(by=0,bv=this.length;by<bv;by++){bA=bx.length;b.find(e,this[by],bx);if(by>0){for(bB=bA;bB<bx.length;bB++){for(bz=0;bz<bA;bz++){if(bx[bz]===bx[bB]){bx.splice(bB--,1);break}}}}}return bx},has:function(bv){var e=b(bv);return this.filter(function(){for(var bx=0,bw=e.length;bx<bw;bx++){if(b.contains(this,e[bx])){return true}}})},not:function(e){return this.pushStack(aG(this,e,false),"not",e)},filter:function(e){return this.pushStack(aG(this,e,true),"filter",e)},is:function(e){return !!e&&(typeof e==="string"?H.test(e)?b(e,this.context).index(this[0])>=0:b.filter(e,this).length>0:this.filter(e).length>0)},closest:function(by,bx){var bv=[],bw,e,bz=this[0];if(b.isArray(by)){var bB=1;while(bz&&bz.ownerDocument&&bz!==bx){for(bw=0;bw<by.length;bw++){if(b(bz).is(by[bw])){bv.push({selector:by[bw],elem:bz,level:bB})}}bz=bz.parentNode;bB++}return bv}var bA=H.test(by)||typeof by!=="string"?b(by,bx||this.context):0;for(bw=0,e=this.length;bw<e;bw++){bz=this[bw];while(bz){if(bA?bA.index(bz)>-1:b.find.matchesSelector(bz,by)){bv.push(bz);break}else{bz=bz.parentNode;if(!bz||!bz.ownerDocument||bz===bx||bz.nodeType===11){break}}}}bv=bv.length>1?b.unique(bv):bv;return this.pushStack(bv,"closest",by)},index:function(e){if(!e){return(this[0]&&this[0].parentNode)?this.prevAll().length:-1}if(typeof e==="string"){return b.inArray(this[0],b(e))}return b.inArray(e.jquery?e[0]:e,this)},add:function(e,bv){var bx=typeof e==="string"?b(e,bv):b.makeArray(e&&e.nodeType?[e]:e),bw=b.merge(this.get(),bx);return this.pushStack(C(bx[0])||C(bw[0])?bw:b.unique(bw))},andSelf:function(){return this.add(this.prevObject)}});function C(e){return !e||!e.parentNode||e.parentNode.nodeType===11}b.each({parent:function(bv){var e=bv.parentNode;return e&&e.nodeType!==11?e:null},parents:function(e){return b.dir(e,"parentNode")},parentsUntil:function(bv,e,bw){return b.dir(bv,"parentNode",bw)},next:function(e){return b.nth(e,2,"nextSibling")},prev:function(e){return b.nth(e,2,"previousSibling")},nextAll:function(e){return b.dir(e,"nextSibling")},prevAll:function(e){return b.dir(e,"previousSibling")},nextUntil:function(bv,e,bw){return b.dir(bv,"nextSibling",bw)},prevUntil:function(bv,e,bw){return b.dir(bv,"previousSibling",bw)},siblings:function(e){return b.sibling(e.parentNode.firstChild,e)},children:function(e){return b.sibling(e.firstChild)},contents:function(e){return b.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:b.makeArray(e.childNodes)}},function(e,bv){b.fn[e]=function(by,bw){var bx=b.map(this,bv,by);if(!ab.test(e)){bw=by}if(bw&&typeof bw==="string"){bx=b.filter(bw,bx)}bx=this.length>1&&!ay[e]?b.unique(bx):bx;if((this.length>1||a9.test(bw))&&aq.test(e)){bx=bx.reverse()}return this.pushStack(bx,e,P.call(arguments).join(","))}});b.extend({filter:function(bw,e,bv){if(bv){bw=":not("+bw+")"}return e.length===1?b.find.matchesSelector(e[0],bw)?[e[0]]:[]:b.find.matches(bw,e)},dir:function(bw,bv,by){var e=[],bx=bw[bv];while(bx&&bx.nodeType!==9&&(by===L||bx.nodeType!==1||!b(bx).is(by))){if(bx.nodeType===1){e.push(bx)}bx=bx[bv]}return e},nth:function(by,e,bw,bx){e=e||1;var bv=0;for(;by;by=by[bw]){if(by.nodeType===1&&++bv===e){break}}return by},sibling:function(bw,bv){var e=[];for(;bw;bw=bw.nextSibling){if(bw.nodeType===1&&bw!==bv){e.push(bw)}}return e}});function aG(bx,bw,e){bw=bw||0;if(b.isFunction(bw)){return b.grep(bx,function(bz,by){var bA=!!bw.call(bz,by,bz);return bA===e})}else{if(bw.nodeType){return b.grep(bx,function(bz,by){return(bz===bw)===e})}else{if(typeof bw==="string"){var bv=b.grep(bx,function(by){return by.nodeType===1});if(bp.test(bw)){return b.filter(bw,bv,!e)}else{bw=b.filter(bw,bv)}}}}return b.grep(bx,function(bz,by){return(b.inArray(bz,bw)>=0)===e})}function a(e){var bw=aR.split("|"),bv=e.createDocumentFragment();if(bv.createElement){while(bw.length){bv.createElement(bw.pop())}}return bv}var aR="abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",ag=/ jQuery\d+="(?:\d+|null)"/g,ar=/^\s+/,R=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,d=/<([\w:]+)/,w=/<tbody/i,W=/<|&#?\w+;/,ae=/<(?:script|style)/i,O=/<(?:script|object|embed|option|style)/i,ah=new RegExp("<(?:"+aR+")","i"),o=/checked\s*(?:[^=]|=\s*.checked.)/i,bm=/\/(java|ecma)script/i,aN=/^\s*<!(?:\[CDATA\[|\-\-)/,ax={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},ac=a(av);ax.optgroup=ax.option;ax.tbody=ax.tfoot=ax.colgroup=ax.caption=ax.thead;ax.th=ax.td;if(!b.support.htmlSerialize){ax._default=[1,"div<div>","</div>"]}b.fn.extend({text:function(e){if(b.isFunction(e)){return this.each(function(bw){var bv=b(this);bv.text(e.call(this,bw,bv.text()))})}if(typeof e!=="object"&&e!==L){return this.empty().append((this[0]&&this[0].ownerDocument||av).createTextNode(e))}return b.text(this)},wrapAll:function(e){if(b.isFunction(e)){return this.each(function(bw){b(this).wrapAll(e.call(this,bw))})}if(this[0]){var bv=b(e,this[0].ownerDocument).eq(0).clone(true);if(this[0].parentNode){bv.insertBefore(this[0])}bv.map(function(){var bw=this;while(bw.firstChild&&bw.firstChild.nodeType===1){bw=bw.firstChild}return bw}).append(this)}return this},wrapInner:function(e){if(b.isFunction(e)){return this.each(function(bv){b(this).wrapInner(e.call(this,bv))})}return this.each(function(){var bv=b(this),bw=bv.contents();if(bw.length){bw.wrapAll(e)}else{bv.append(e)}})},wrap:function(e){var bv=b.isFunction(e);return this.each(function(bw){b(this).wrapAll(bv?e.call(this,bw):e)})},unwrap:function(){return this.parent().each(function(){if(!b.nodeName(this,"body")){b(this).replaceWith(this.childNodes)}}).end()},append:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.appendChild(e)}})},prepend:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.insertBefore(e,this.firstChild)}})},before:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this)})}else{if(arguments.length){var e=b.clean(arguments);e.push.apply(e,this.toArray());return this.pushStack(e,"before",arguments)}}},after:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this.nextSibling)})}else{if(arguments.length){var e=this.pushStack(this,"after",arguments);e.push.apply(e,b.clean(arguments));return e}}},remove:function(e,bx){for(var bv=0,bw;(bw=this[bv])!=null;bv++){if(!e||b.filter(e,[bw]).length){if(!bx&&bw.nodeType===1){b.cleanData(bw.getElementsByTagName("*"));b.cleanData([bw])}if(bw.parentNode){bw.parentNode.removeChild(bw)}}}return this},empty:function(){for(var e=0,bv;(bv=this[e])!=null;e++){if(bv.nodeType===1){b.cleanData(bv.getElementsByTagName("*"))}while(bv.firstChild){bv.removeChild(bv.firstChild)}}return this},clone:function(bv,e){bv=bv==null?false:bv;e=e==null?bv:e;return this.map(function(){return b.clone(this,bv,e)})},html:function(bx){if(bx===L){return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(ag,""):null}else{if(typeof bx==="string"&&!ae.test(bx)&&(b.support.leadingWhitespace||!ar.test(bx))&&!ax[(d.exec(bx)||["",""])[1].toLowerCase()]){bx=bx.replace(R,"<$1></$2>");try{for(var bw=0,bv=this.length;bw<bv;bw++){if(this[bw].nodeType===1){b.cleanData(this[bw].getElementsByTagName("*"));this[bw].innerHTML=bx}}}catch(by){this.empty().append(bx)}}else{if(b.isFunction(bx)){this.each(function(bz){var e=b(this);e.html(bx.call(this,bz,e.html()))})}else{this.empty().append(bx)}}}return this},replaceWith:function(e){if(this[0]&&this[0].parentNode){if(b.isFunction(e)){return this.each(function(bx){var bw=b(this),bv=bw.html();bw.replaceWith(e.call(this,bx,bv))})}if(typeof e!=="string"){e=b(e).detach()}return this.each(function(){var bw=this.nextSibling,bv=this.parentNode;b(this).remove();if(bw){b(bw).before(e)}else{b(bv).append(e)}})}else{return this.length?this.pushStack(b(b.isFunction(e)?e():e),"replaceWith",e):this}},detach:function(e){return this.remove(e,true)},domManip:function(bB,bF,bE){var bx,by,bA,bD,bC=bB[0],bv=[];if(!b.support.checkClone&&arguments.length===3&&typeof bC==="string"&&o.test(bC)){return this.each(function(){b(this).domManip(bB,bF,bE,true)})}if(b.isFunction(bC)){return this.each(function(bH){var bG=b(this);bB[0]=bC.call(this,bH,bF?bG.html():L);bG.domManip(bB,bF,bE)})}if(this[0]){bD=bC&&bC.parentNode;if(b.support.parentNode&&bD&&bD.nodeType===11&&bD.childNodes.length===this.length){bx={fragment:bD}}else{bx=b.buildFragment(bB,this,bv)}bA=bx.fragment;if(bA.childNodes.length===1){by=bA=bA.firstChild}else{by=bA.firstChild}if(by){bF=bF&&b.nodeName(by,"tr");for(var bw=0,e=this.length,bz=e-1;bw<e;bw++){bE.call(bF?ba(this[bw],by):this[bw],bx.cacheable||(e>1&&bw<bz)?b.clone(bA,true,true):bA)}}if(bv.length){b.each(bv,bo)}}return this}});function ba(e,bv){return b.nodeName(e,"table")?(e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody"))):e}function t(bB,bv){if(bv.nodeType!==1||!b.hasData(bB)){return}var by,bx,e,bA=b._data(bB),bz=b._data(bv,bA),bw=bA.events;if(bw){delete bz.handle;bz.events={};for(by in bw){for(bx=0,e=bw[by].length;bx<e;bx++){b.event.add(bv,by+(bw[by][bx].namespace?".":"")+bw[by][bx].namespace,bw[by][bx],bw[by][bx].data)}}}if(bz.data){bz.data=b.extend({},bz.data)}}function ai(bv,e){var bw;if(e.nodeType!==1){return}if(e.clearAttributes){e.clearAttributes()}if(e.mergeAttributes){e.mergeAttributes(bv)}bw=e.nodeName.toLowerCase();if(bw==="object"){e.outerHTML=bv.outerHTML}else{if(bw==="input"&&(bv.type==="checkbox"||bv.type==="radio")){if(bv.checked){e.defaultChecked=e.checked=bv.checked}if(e.value!==bv.value){e.value=bv.value}}else{if(bw==="option"){e.selected=bv.defaultSelected}else{if(bw==="input"||bw==="textarea"){e.defaultValue=bv.defaultValue}}}}e.removeAttribute(b.expando)}b.buildFragment=function(bz,bx,bv){var by,e,bw,bA,bB=bz[0];if(bx&&bx[0]){bA=bx[0].ownerDocument||bx[0]}if(!bA.createDocumentFragment){bA=av}if(bz.length===1&&typeof bB==="string"&&bB.length<512&&bA===av&&bB.charAt(0)==="<"&&!O.test(bB)&&(b.support.checkClone||!o.test(bB))&&(b.support.html5Clone||!ah.test(bB))){e=true;bw=b.fragments[bB];if(bw&&bw!==1){by=bw}}if(!by){by=bA.createDocumentFragment();b.clean(bz,bA,by,bv)}if(e){b.fragments[bB]=bw?by:1}return{fragment:by,cacheable:e}};b.fragments={};b.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,bv){b.fn[e]=function(bw){var bz=[],bC=b(bw),bB=this.length===1&&this[0].parentNode;if(bB&&bB.nodeType===11&&bB.childNodes.length===1&&bC.length===1){bC[bv](this[0]);return this}else{for(var bA=0,bx=bC.length;bA<bx;bA++){var by=(bA>0?this.clone(true):this).get();b(bC[bA])[bv](by);bz=bz.concat(by)}return this.pushStack(bz,e,bC.selector)}}});function bg(e){if(typeof e.getElementsByTagName!=="undefined"){return e.getElementsByTagName("*")}else{if(typeof e.querySelectorAll!=="undefined"){return e.querySelectorAll("*")}else{return[]}}}function az(e){if(e.type==="checkbox"||e.type==="radio"){e.defaultChecked=e.checked}}function E(e){var bv=(e.nodeName||"").toLowerCase();if(bv==="input"){az(e)}else{if(bv!=="script"&&typeof e.getElementsByTagName!=="undefined"){b.grep(e.getElementsByTagName("input"),az)}}}function al(e){var bv=av.createElement("div");ac.appendChild(bv);bv.innerHTML=e.outerHTML;return bv.firstChild}b.extend({clone:function(by,bA,bw){var e,bv,bx,bz=b.support.html5Clone||!ah.test("<"+by.nodeName)?by.cloneNode(true):al(by);if((!b.support.noCloneEvent||!b.support.noCloneChecked)&&(by.nodeType===1||by.nodeType===11)&&!b.isXMLDoc(by)){ai(by,bz);e=bg(by);bv=bg(bz);for(bx=0;e[bx];++bx){if(bv[bx]){ai(e[bx],bv[bx])}}}if(bA){t(by,bz);if(bw){e=bg(by);bv=bg(bz);for(bx=0;e[bx];++bx){t(e[bx],bv[bx])}}}e=bv=null;return bz},clean:function(bw,by,bH,bA){var bF;by=by||av;if(typeof by.createElement==="undefined"){by=by.ownerDocument||by[0]&&by[0].ownerDocument||av}var bI=[],bB;for(var bE=0,bz;(bz=bw[bE])!=null;bE++){if(typeof bz==="number"){bz+=""}if(!bz){continue}if(typeof bz==="string"){if(!W.test(bz)){bz=by.createTextNode(bz)}else{bz=bz.replace(R,"<$1></$2>");var bK=(d.exec(bz)||["",""])[1].toLowerCase(),bx=ax[bK]||ax._default,bD=bx[0],bv=by.createElement("div");if(by===av){ac.appendChild(bv)}else{a(by).appendChild(bv)}bv.innerHTML=bx[1]+bz+bx[2];while(bD--){bv=bv.lastChild}if(!b.support.tbody){var e=w.test(bz),bC=bK==="table"&&!e?bv.firstChild&&bv.firstChild.childNodes:bx[1]==="<table>"&&!e?bv.childNodes:[];for(bB=bC.length-1;bB>=0;--bB){if(b.nodeName(bC[bB],"tbody")&&!bC[bB].childNodes.length){bC[bB].parentNode.removeChild(bC[bB])}}}if(!b.support.leadingWhitespace&&ar.test(bz)){bv.insertBefore(by.createTextNode(ar.exec(bz)[0]),bv.firstChild)}bz=bv.childNodes}}var bG;if(!b.support.appendChecked){if(bz[0]&&typeof(bG=bz.length)==="number"){for(bB=0;bB<bG;bB++){E(bz[bB])}}else{E(bz)}}if(bz.nodeType){bI.push(bz)}else{bI=b.merge(bI,bz)}}if(bH){bF=function(bL){return !bL.type||bm.test(bL.type)};for(bE=0;bI[bE];bE++){if(bA&&b.nodeName(bI[bE],"script")&&(!bI[bE].type||bI[bE].type.toLowerCase()==="text/javascript")){bA.push(bI[bE].parentNode?bI[bE].parentNode.removeChild(bI[bE]):bI[bE])}else{if(bI[bE].nodeType===1){var bJ=b.grep(bI[bE].getElementsByTagName("script"),bF);bI.splice.apply(bI,[bE+1,0].concat(bJ))}bH.appendChild(bI[bE])}}}return bI},cleanData:function(bv){var by,bw,e=b.cache,bB=b.event.special,bA=b.support.deleteExpando;for(var bz=0,bx;(bx=bv[bz])!=null;bz++){if(bx.nodeName&&b.noData[bx.nodeName.toLowerCase()]){continue}bw=bx[b.expando];if(bw){by=e[bw];if(by&&by.events){for(var bC in by.events){if(bB[bC]){b.event.remove(bx,bC)}else{b.removeEvent(bx,bC,by.handle)}}if(by.handle){by.handle.elem=null}}if(bA){delete bx[b.expando]}else{if(bx.removeAttribute){bx.removeAttribute(b.expando)}}delete e[bw]}}}});function bo(e,bv){if(bv.src){b.ajax({url:bv.src,async:false,dataType:"script"})}else{b.globalEval((bv.text||bv.textContent||bv.innerHTML||"").replace(aN,"/*$0*/"))}if(bv.parentNode){bv.parentNode.removeChild(bv)}}var ak=/alpha\([^)]*\)/i,au=/opacity=([^)]*)/,z=/([A-Z]|^ms)/g,bc=/^-?\d+(?:px)?$/i,bn=/^-?\d/,I=/^([\-+])=([\-+.\de]+)/,a7={position:"absolute",visibility:"hidden",display:"block"},an=["Left","Right"],a1=["Top","Bottom"],Z,aI,aX;b.fn.css=function(e,bv){if(arguments.length===2&&bv===L){return this}return b.access(this,e,bv,true,function(bx,bw,by){return by!==L?b.style(bx,bw,by):b.css(bx,bw)})};b.extend({cssHooks:{opacity:{get:function(bw,bv){if(bv){var e=Z(bw,"opacity","opacity");return e===""?"1":e}else{return bw.style.opacity}}}},cssNumber:{fillOpacity:true,fontWeight:true,lineHeight:true,opacity:true,orphans:true,widows:true,zIndex:true,zoom:true},cssProps:{"float":b.support.cssFloat?"cssFloat":"styleFloat"},style:function(bx,bw,bD,by){if(!bx||bx.nodeType===3||bx.nodeType===8||!bx.style){return}var bB,bC,bz=b.camelCase(bw),bv=bx.style,bE=b.cssHooks[bz];bw=b.cssProps[bz]||bz;if(bD!==L){bC=typeof bD;if(bC==="string"&&(bB=I.exec(bD))){bD=(+(bB[1]+1)*+bB[2])+parseFloat(b.css(bx,bw));bC="number"}if(bD==null||bC==="number"&&isNaN(bD)){return}if(bC==="number"&&!b.cssNumber[bz]){bD+="px"}if(!bE||!("set" in bE)||(bD=bE.set(bx,bD))!==L){try{bv[bw]=bD}catch(bA){}}}else{if(bE&&"get" in bE&&(bB=bE.get(bx,false,by))!==L){return bB}return bv[bw]}},css:function(by,bx,bv){var bw,e;bx=b.camelCase(bx);e=b.cssHooks[bx];bx=b.cssProps[bx]||bx;if(bx==="cssFloat"){bx="float"}if(e&&"get" in e&&(bw=e.get(by,true,bv))!==L){return bw}else{if(Z){return Z(by,bx)}}},swap:function(bx,bw,by){var e={};for(var bv in bw){e[bv]=bx.style[bv];bx.style[bv]=bw[bv]}by.call(bx);for(bv in bw){bx.style[bv]=e[bv]}}});b.curCSS=b.css;b.each(["height","width"],function(bv,e){b.cssHooks[e]={get:function(by,bx,bw){var bz;if(bx){if(by.offsetWidth!==0){return p(by,e,bw)}else{b.swap(by,a7,function(){bz=p(by,e,bw)})}return bz}},set:function(bw,bx){if(bc.test(bx)){bx=parseFloat(bx);if(bx>=0){return bx+"px"}}else{return bx}}}});if(!b.support.opacity){b.cssHooks.opacity={get:function(bv,e){return au.test((e&&bv.currentStyle?bv.currentStyle.filter:bv.style.filter)||"")?(parseFloat(RegExp.$1)/100)+"":e?"1":""},set:function(by,bz){var bx=by.style,bv=by.currentStyle,e=b.isNumeric(bz)?"alpha(opacity="+bz*100+")":"",bw=bv&&bv.filter||bx.filter||"";bx.zoom=1;if(bz>=1&&b.trim(bw.replace(ak,""))===""){bx.removeAttribute("filter");if(bv&&!bv.filter){return}}bx.filter=ak.test(bw)?bw.replace(ak,e):bw+" "+e}}}b(function(){if(!b.support.reliableMarginRight){b.cssHooks.marginRight={get:function(bw,bv){var e;b.swap(bw,{display:"inline-block"},function(){if(bv){e=Z(bw,"margin-right","marginRight")}else{e=bw.style.marginRight}});return e}}}});if(av.defaultView&&av.defaultView.getComputedStyle){aI=function(by,bw){var bv,bx,e;bw=bw.replace(z,"-$1").toLowerCase();if((bx=by.ownerDocument.defaultView)&&(e=bx.getComputedStyle(by,null))){bv=e.getPropertyValue(bw);if(bv===""&&!b.contains(by.ownerDocument.documentElement,by)){bv=b.style(by,bw)}}return bv}}if(av.documentElement.currentStyle){aX=function(bz,bw){var bA,e,by,bv=bz.currentStyle&&bz.currentStyle[bw],bx=bz.style;if(bv===null&&bx&&(by=bx[bw])){bv=by}if(!bc.test(bv)&&bn.test(bv)){bA=bx.left;e=bz.runtimeStyle&&bz.runtimeStyle.left;if(e){bz.runtimeStyle.left=bz.currentStyle.left}bx.left=bw==="fontSize"?"1em":(bv||0);bv=bx.pixelLeft+"px";bx.left=bA;if(e){bz.runtimeStyle.left=e}}return bv===""?"auto":bv}}Z=aI||aX;function p(by,bw,bv){var bA=bw==="width"?by.offsetWidth:by.offsetHeight,bz=bw==="width"?an:a1,bx=0,e=bz.length;if(bA>0){if(bv!=="border"){for(;bx<e;bx++){if(!bv){bA-=parseFloat(b.css(by,"padding"+bz[bx]))||0}if(bv==="margin"){bA+=parseFloat(b.css(by,bv+bz[bx]))||0}else{bA-=parseFloat(b.css(by,"border"+bz[bx]+"Width"))||0}}}return bA+"px"}bA=Z(by,bw,bw);if(bA<0||bA==null){bA=by.style[bw]||0}bA=parseFloat(bA)||0;if(bv){for(;bx<e;bx++){bA+=parseFloat(b.css(by,"padding"+bz[bx]))||0;if(bv!=="padding"){bA+=parseFloat(b.css(by,"border"+bz[bx]+"Width"))||0}if(bv==="margin"){bA+=parseFloat(b.css(by,bv+bz[bx]))||0}}}return bA+"px"}if(b.expr&&b.expr.filters){b.expr.filters.hidden=function(bw){var bv=bw.offsetWidth,e=bw.offsetHeight;return(bv===0&&e===0)||(!b.support.reliableHiddenOffsets&&((bw.style&&bw.style.display)||b.css(bw,"display"))==="none")};b.expr.filters.visible=function(e){return !b.expr.filters.hidden(e)}}var k=/%20/g,ap=/\[\]$/,bs=/\r?\n/g,bq=/#.*$/,aD=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,aZ=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,aM=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,aQ=/^(?:GET|HEAD)$/,c=/^\/\//,M=/\?/,a6=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,q=/^(?:select|textarea)/i,h=/\s+/,br=/([?&])_=[^&]*/,K=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,A=b.fn.load,aa={},r={},aE,s,aV=["*/"]+["*"];try{aE=bl.href}catch(aw){aE=av.createElement("a");aE.href="";aE=aE.href}s=K.exec(aE.toLowerCase())||[];function f(e){return function(by,bA){if(typeof by!=="string"){bA=by;by="*"}if(b.isFunction(bA)){var bx=by.toLowerCase().split(h),bw=0,bz=bx.length,bv,bB,bC;for(;bw<bz;bw++){bv=bx[bw];bC=/^\+/.test(bv);if(bC){bv=bv.substr(1)||"*"}bB=e[bv]=e[bv]||[];bB[bC?"unshift":"push"](bA)}}}}function aW(bv,bE,bz,bD,bB,bx){bB=bB||bE.dataTypes[0];bx=bx||{};bx[bB]=true;var bA=bv[bB],bw=0,e=bA?bA.length:0,by=(bv===aa),bC;for(;bw<e&&(by||!bC);bw++){bC=bA[bw](bE,bz,bD);if(typeof bC==="string"){if(!by||bx[bC]){bC=L}else{bE.dataTypes.unshift(bC);bC=aW(bv,bE,bz,bD,bC,bx)}}}if((by||!bC)&&!bx["*"]){bC=aW(bv,bE,bz,bD,"*",bx)}return bC}function am(bw,bx){var bv,e,by=b.ajaxSettings.flatOptions||{};for(bv in bx){if(bx[bv]!==L){(by[bv]?bw:(e||(e={})))[bv]=bx[bv]}}if(e){b.extend(true,bw,e)}}b.fn.extend({load:function(bw,bz,bA){if(typeof bw!=="string"&&A){return A.apply(this,arguments)}else{if(!this.length){return this}}var by=bw.indexOf(" ");if(by>=0){var e=bw.slice(by,bw.length);bw=bw.slice(0,by)}var bx="GET";if(bz){if(b.isFunction(bz)){bA=bz;bz=L}else{if(typeof bz==="object"){bz=b.param(bz,b.ajaxSettings.traditional);bx="POST"}}}var bv=this;b.ajax({url:bw,type:bx,dataType:"html",data:bz,complete:function(bC,bB,bD){bD=bC.responseText;if(bC.isResolved()){bC.done(function(bE){bD=bE});bv.html(e?b("<div>").append(bD.replace(a6,"")).find(e):bD)}if(bA){bv.each(bA,[bD,bB,bC])}}});return this},serialize:function(){return b.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?b.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||q.test(this.nodeName)||aZ.test(this.type))}).map(function(e,bv){var bw=b(this).val();return bw==null?null:b.isArray(bw)?b.map(bw,function(by,bx){return{name:bv.name,value:by.replace(bs,"\r\n")}}):{name:bv.name,value:bw.replace(bs,"\r\n")}}).get()}});b.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,bv){b.fn[bv]=function(bw){return this.on(bv,bw)}});b.each(["get","post"],function(e,bv){b[bv]=function(bw,by,bz,bx){if(b.isFunction(by)){bx=bx||bz;bz=by;by=L}return b.ajax({type:bv,url:bw,data:by,success:bz,dataType:bx})}});b.extend({getScript:function(e,bv){return b.get(e,L,bv,"script")},getJSON:function(e,bv,bw){return b.get(e,bv,bw,"json")},ajaxSetup:function(bv,e){if(e){am(bv,b.ajaxSettings)}else{e=bv;bv=b.ajaxSettings}am(bv,e);return bv},ajaxSettings:{url:aE,isLocal:aM.test(s[1]),global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":aV},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":bb.String,"text html":true,"text json":b.parseJSON,"text xml":b.parseXML},flatOptions:{context:true,url:true}},ajaxPrefilter:f(aa),ajaxTransport:f(r),ajax:function(bz,bx){if(typeof bz==="object"){bx=bz;bz=L}bx=bx||{};var bD=b.ajaxSetup({},bx),bS=bD.context||bD,bG=bS!==bD&&(bS.nodeType||bS instanceof b)?b(bS):b.event,bR=b.Deferred(),bN=b.Callbacks("once memory"),bB=bD.statusCode||{},bC,bH={},bO={},bQ,by,bL,bE,bI,bA=0,bw,bK,bJ={readyState:0,setRequestHeader:function(bT,bU){if(!bA){var e=bT.toLowerCase();bT=bO[e]=bO[e]||bT;bH[bT]=bU}return this},getAllResponseHeaders:function(){return bA===2?bQ:null},getResponseHeader:function(bT){var e;if(bA===2){if(!by){by={};while((e=aD.exec(bQ))){by[e[1].toLowerCase()]=e[2]}}e=by[bT.toLowerCase()]}return e===L?null:e},overrideMimeType:function(e){if(!bA){bD.mimeType=e}return this},abort:function(e){e=e||"abort";if(bL){bL.abort(e)}bF(0,e);return this}};function bF(bZ,bU,b0,bW){if(bA===2){return}bA=2;if(bE){clearTimeout(bE)}bL=L;bQ=bW||"";bJ.readyState=bZ>0?4:0;var bT,b4,b3,bX=bU,bY=b0?bj(bD,bJ,b0):L,bV,b2;if(bZ>=200&&bZ<300||bZ===304){if(bD.ifModified){if((bV=bJ.getResponseHeader("Last-Modified"))){b.lastModified[bC]=bV}if((b2=bJ.getResponseHeader("Etag"))){b.etag[bC]=b2}}if(bZ===304){bX="notmodified";bT=true}else{try{b4=G(bD,bY);bX="success";bT=true}catch(b1){bX="parsererror";b3=b1}}}else{b3=bX;if(!bX||bZ){bX="error";if(bZ<0){bZ=0}}}bJ.status=bZ;bJ.statusText=""+(bU||bX);if(bT){bR.resolveWith(bS,[b4,bX,bJ])}else{bR.rejectWith(bS,[bJ,bX,b3])}bJ.statusCode(bB);bB=L;if(bw){bG.trigger("ajax"+(bT?"Success":"Error"),[bJ,bD,bT?b4:b3])}bN.fireWith(bS,[bJ,bX]);if(bw){bG.trigger("ajaxComplete",[bJ,bD]);if(!(--b.active)){b.event.trigger("ajaxStop")}}}bR.promise(bJ);bJ.success=bJ.done;bJ.error=bJ.fail;bJ.complete=bN.add;bJ.statusCode=function(bT){if(bT){var e;if(bA<2){for(e in bT){bB[e]=[bB[e],bT[e]]}}else{e=bT[bJ.status];bJ.then(e,e)}}return this};bD.url=((bz||bD.url)+"").replace(bq,"").replace(c,s[1]+"//");bD.dataTypes=b.trim(bD.dataType||"*").toLowerCase().split(h);if(bD.crossDomain==null){bI=K.exec(bD.url.toLowerCase());bD.crossDomain=!!(bI&&(bI[1]!=s[1]||bI[2]!=s[2]||(bI[3]||(bI[1]==="http:"?80:443))!=(s[3]||(s[1]==="http:"?80:443))))}if(bD.data&&bD.processData&&typeof bD.data!=="string"){bD.data=b.param(bD.data,bD.traditional)}aW(aa,bD,bx,bJ);if(bA===2){return false}bw=bD.global;bD.type=bD.type.toUpperCase();bD.hasContent=!aQ.test(bD.type);if(bw&&b.active++===0){b.event.trigger("ajaxStart")}if(!bD.hasContent){if(bD.data){bD.url+=(M.test(bD.url)?"&":"?")+bD.data;delete bD.data}bC=bD.url;if(bD.cache===false){var bv=b.now(),bP=bD.url.replace(br,"$1_="+bv);bD.url=bP+((bP===bD.url)?(M.test(bD.url)?"&":"?")+"_="+bv:"")}}if(bD.data&&bD.hasContent&&bD.contentType!==false||bx.contentType){bJ.setRequestHeader("Content-Type",bD.contentType)}if(bD.ifModified){bC=bC||bD.url;if(b.lastModified[bC]){bJ.setRequestHeader("If-Modified-Since",b.lastModified[bC])}if(b.etag[bC]){bJ.setRequestHeader("If-None-Match",b.etag[bC])}}bJ.setRequestHeader("Accept",bD.dataTypes[0]&&bD.accepts[bD.dataTypes[0]]?bD.accepts[bD.dataTypes[0]]+(bD.dataTypes[0]!=="*"?", "+aV+"; q=0.01":""):bD.accepts["*"]);for(bK in bD.headers){bJ.setRequestHeader(bK,bD.headers[bK])}if(bD.beforeSend&&(bD.beforeSend.call(bS,bJ,bD)===false||bA===2)){bJ.abort();return false}for(bK in {success:1,error:1,complete:1}){bJ[bK](bD[bK])}bL=aW(r,bD,bx,bJ);if(!bL){bF(-1,"No Transport")}else{bJ.readyState=1;if(bw){bG.trigger("ajaxSend",[bJ,bD])}if(bD.async&&bD.timeout>0){bE=setTimeout(function(){bJ.abort("timeout")},bD.timeout)}try{bA=1;bL.send(bH,bF)}catch(bM){if(bA<2){bF(-1,bM)}else{throw bM}}}return bJ},param:function(e,bw){var bv=[],by=function(bz,bA){bA=b.isFunction(bA)?bA():bA;bv[bv.length]=encodeURIComponent(bz)+"="+encodeURIComponent(bA)};if(bw===L){bw=b.ajaxSettings.traditional}if(b.isArray(e)||(e.jquery&&!b.isPlainObject(e))){b.each(e,function(){by(this.name,this.value)})}else{for(var bx in e){v(bx,e[bx],bw,by)}}return bv.join("&").replace(k,"+")}});function v(bw,by,bv,bx){if(b.isArray(by)){b.each(by,function(bA,bz){if(bv||ap.test(bw)){bx(bw,bz)}else{v(bw+"["+(typeof bz==="object"||b.isArray(bz)?bA:"")+"]",bz,bv,bx)}})}else{if(!bv&&by!=null&&typeof by==="object"){for(var e in by){v(bw+"["+e+"]",by[e],bv,bx)}}else{bx(bw,by)}}}b.extend({active:0,lastModified:{},etag:{}});function bj(bD,bC,bz){var bv=bD.contents,bB=bD.dataTypes,bw=bD.responseFields,by,bA,bx,e;for(bA in bw){if(bA in bz){bC[bw[bA]]=bz[bA]}}while(bB[0]==="*"){bB.shift();if(by===L){by=bD.mimeType||bC.getResponseHeader("content-type")}}if(by){for(bA in bv){if(bv[bA]&&bv[bA].test(by)){bB.unshift(bA);break}}}if(bB[0] in bz){bx=bB[0]}else{for(bA in bz){if(!bB[0]||bD.converters[bA+" "+bB[0]]){bx=bA;break}if(!e){e=bA}}bx=bx||e}if(bx){if(bx!==bB[0]){bB.unshift(bx)}return bz[bx]}}function G(bH,bz){if(bH.dataFilter){bz=bH.dataFilter(bz,bH.dataType)}var bD=bH.dataTypes,bG={},bA,bE,bw=bD.length,bB,bC=bD[0],bx,by,bF,bv,e;for(bA=1;bA<bw;bA++){if(bA===1){for(bE in bH.converters){if(typeof bE==="string"){bG[bE.toLowerCase()]=bH.converters[bE]}}}bx=bC;bC=bD[bA];if(bC==="*"){bC=bx}else{if(bx!=="*"&&bx!==bC){by=bx+" "+bC;bF=bG[by]||bG["* "+bC];if(!bF){e=L;for(bv in bG){bB=bv.split(" ");if(bB[0]===bx||bB[0]==="*"){e=bG[bB[1]+" "+bC];if(e){bv=bG[bv];if(bv===true){bF=e}else{if(e===true){bF=bv}}break}}}}if(!(bF||e)){b.error("No conversion from "+by.replace(" "," to "))}if(bF!==true){bz=bF?bF(bz):e(bv(bz))}}}}return bz}var aC=b.now(),u=/(\=)\?(&|$)|\?\?/i;b.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return b.expando+"_"+(aC++)}});b.ajaxPrefilter("json jsonp",function(bD,bA,bC){var bx=bD.contentType==="application/x-www-form-urlencoded"&&(typeof bD.data==="string");if(bD.dataTypes[0]==="jsonp"||bD.jsonp!==false&&(u.test(bD.url)||bx&&u.test(bD.data))){var bB,bw=bD.jsonpCallback=b.isFunction(bD.jsonpCallback)?bD.jsonpCallback():bD.jsonpCallback,bz=bb[bw],e=bD.url,by=bD.data,bv="$1"+bw+"$2";if(bD.jsonp!==false){e=e.replace(u,bv);if(bD.url===e){if(bx){by=by.replace(u,bv)}if(bD.data===by){e+=(/\?/.test(e)?"&":"?")+bD.jsonp+"="+bw}}}bD.url=e;bD.data=by;bb[bw]=function(bE){bB=[bE]};bC.always(function(){bb[bw]=bz;if(bB&&b.isFunction(bz)){bb[bw](bB[0])}});bD.converters["script json"]=function(){if(!bB){b.error(bw+" was not called")}return bB[0]};bD.dataTypes[0]="json";return"script"}});b.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(e){b.globalEval(e);return e}}});b.ajaxPrefilter("script",function(e){if(e.cache===L){e.cache=false}if(e.crossDomain){e.type="GET";e.global=false}});b.ajaxTransport("script",function(bw){if(bw.crossDomain){var e,bv=av.head||av.getElementsByTagName("head")[0]||av.documentElement;return{send:function(bx,by){e=av.createElement("script");e.async="async";if(bw.scriptCharset){e.charset=bw.scriptCharset}e.src=bw.url;e.onload=e.onreadystatechange=function(bA,bz){if(bz||!e.readyState||/loaded|complete/.test(e.readyState)){e.onload=e.onreadystatechange=null;if(bv&&e.parentNode){bv.removeChild(e)}e=L;if(!bz){by(200,"success")}}};bv.insertBefore(e,bv.firstChild)},abort:function(){if(e){e.onload(0,1)}}}}});var B=bb.ActiveXObject?function(){for(var e in N){N[e](0,1)}}:false,y=0,N;function aL(){try{return new bb.XMLHttpRequest()}catch(bv){}}function aj(){try{return new bb.ActiveXObject("Microsoft.XMLHTTP")}catch(bv){}}b.ajaxSettings.xhr=bb.ActiveXObject?function(){return !this.isLocal&&aL()||aj()}:aL;(function(e){b.extend(b.support,{ajax:!!e,cors:!!e&&("withCredentials" in e)})})(b.ajaxSettings.xhr());if(b.support.ajax){b.ajaxTransport(function(e){if(!e.crossDomain||b.support.cors){var bv;return{send:function(bB,bw){var bA=e.xhr(),bz,by;if(e.username){bA.open(e.type,e.url,e.async,e.username,e.password)}else{bA.open(e.type,e.url,e.async)}if(e.xhrFields){for(by in e.xhrFields){bA[by]=e.xhrFields[by]}}if(e.mimeType&&bA.overrideMimeType){bA.overrideMimeType(e.mimeType)}if(!e.crossDomain&&!bB["X-Requested-With"]){bB["X-Requested-With"]="XMLHttpRequest"}try{for(by in bB){bA.setRequestHeader(by,bB[by])}}catch(bx){}bA.send((e.hasContent&&e.data)||null);bv=function(bK,bE){var bF,bD,bC,bI,bH;try{if(bv&&(bE||bA.readyState===4)){bv=L;if(bz){bA.onreadystatechange=b.noop;if(B){delete N[bz]}}if(bE){if(bA.readyState!==4){bA.abort()}}else{bF=bA.status;bC=bA.getAllResponseHeaders();bI={};bH=bA.responseXML;if(bH&&bH.documentElement){bI.xml=bH}bI.text=bA.responseText;try{bD=bA.statusText}catch(bJ){bD=""}if(!bF&&e.isLocal&&!e.crossDomain){bF=bI.text?200:404}else{if(bF===1223){bF=204}}}}}catch(bG){if(!bE){bw(-1,bG)}}if(bI){bw(bF,bD,bI,bC)}};if(!e.async||bA.readyState===4){bv()}else{bz=++y;if(B){if(!N){N={};b(bb).unload(B)}N[bz]=bv}bA.onreadystatechange=bv}},abort:function(){if(bv){bv(0,1)}}}}})}var Q={},a8,m,aB=/^(?:toggle|show|hide)$/,aT=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,a3,aH=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],a4;b.fn.extend({show:function(bx,bA,bz){var bw,by;if(bx||bx===0){return this.animate(a0("show",3),bx,bA,bz)}else{for(var bv=0,e=this.length;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(!b._data(bw,"olddisplay")&&by==="none"){by=bw.style.display=""}if(by===""&&b.css(bw,"display")==="none"){b._data(bw,"olddisplay",x(bw.nodeName))}}}for(bv=0;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(by===""||by==="none"){bw.style.display=b._data(bw,"olddisplay")||""}}}return this}},hide:function(bx,bA,bz){if(bx||bx===0){return this.animate(a0("hide",3),bx,bA,bz)}else{var bw,by,bv=0,e=this.length;for(;bv<e;bv++){bw=this[bv];if(bw.style){by=b.css(bw,"display");if(by!=="none"&&!b._data(bw,"olddisplay")){b._data(bw,"olddisplay",by)}}}for(bv=0;bv<e;bv++){if(this[bv].style){this[bv].style.display="none"}}return this}},_toggle:b.fn.toggle,toggle:function(bw,bv,bx){var e=typeof bw==="boolean";if(b.isFunction(bw)&&b.isFunction(bv)){this._toggle.apply(this,arguments)}else{if(bw==null||e){this.each(function(){var by=e?bw:b(this).is(":hidden");b(this)[by?"show":"hide"]()})}else{this.animate(a0("toggle",3),bw,bv,bx)}}return this},fadeTo:function(e,bx,bw,bv){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:bx},e,bw,bv)},animate:function(bz,bw,by,bx){var e=b.speed(bw,by,bx);if(b.isEmptyObject(bz)){return this.each(e.complete,[false])}bz=b.extend({},bz);function bv(){if(e.queue===false){b._mark(this)}var bE=b.extend({},e),bK=this.nodeType===1,bI=bK&&b(this).is(":hidden"),bB,bF,bD,bJ,bH,bC,bG,bL,bA;bE.animatedProperties={};for(bD in bz){bB=b.camelCase(bD);if(bD!==bB){bz[bB]=bz[bD];delete bz[bD]}bF=bz[bB];if(b.isArray(bF)){bE.animatedProperties[bB]=bF[1];bF=bz[bB]=bF[0]}else{bE.animatedProperties[bB]=bE.specialEasing&&bE.specialEasing[bB]||bE.easing||"swing"}if(bF==="hide"&&bI||bF==="show"&&!bI){return bE.complete.call(this)}if(bK&&(bB==="height"||bB==="width")){bE.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(b.css(this,"display")==="inline"&&b.css(this,"float")==="none"){if(!b.support.inlineBlockNeedsLayout||x(this.nodeName)==="inline"){this.style.display="inline-block"}else{this.style.zoom=1}}}}if(bE.overflow!=null){this.style.overflow="hidden"}for(bD in bz){bJ=new b.fx(this,bE,bD);bF=bz[bD];if(aB.test(bF)){bA=b._data(this,"toggle"+bD)||(bF==="toggle"?bI?"show":"hide":0);if(bA){b._data(this,"toggle"+bD,bA==="show"?"hide":"show");bJ[bA]()}else{bJ[bF]()}}else{bH=aT.exec(bF);bC=bJ.cur();if(bH){bG=parseFloat(bH[2]);bL=bH[3]||(b.cssNumber[bD]?"":"px");if(bL!=="px"){b.style(this,bD,(bG||1)+bL);bC=((bG||1)/bJ.cur())*bC;b.style(this,bD,bC+bL)}if(bH[1]){bG=((bH[1]==="-="?-1:1)*bG)+bC}bJ.custom(bC,bG,bL)}else{bJ.custom(bC,bF,"")}}}return true}return e.queue===false?this.each(bv):this.queue(e.queue,bv)},stop:function(bw,bv,e){if(typeof bw!=="string"){e=bv;bv=bw;bw=L}if(bv&&bw!==false){this.queue(bw||"fx",[])}return this.each(function(){var bx,by=false,bA=b.timers,bz=b._data(this);if(!e){b._unmark(true,this)}function bB(bE,bF,bD){var bC=bF[bD];b.removeData(bE,bD,true);bC.stop(e)}if(bw==null){for(bx in bz){if(bz[bx]&&bz[bx].stop&&bx.indexOf(".run")===bx.length-4){bB(this,bz,bx)}}}else{if(bz[bx=bw+".run"]&&bz[bx].stop){bB(this,bz,bx)}}for(bx=bA.length;bx--;){if(bA[bx].elem===this&&(bw==null||bA[bx].queue===bw)){if(e){bA[bx](true)}else{bA[bx].saveState()}by=true;bA.splice(bx,1)}}if(!(e&&by)){b.dequeue(this,bw)}})}});function bh(){setTimeout(at,0);return(a4=b.now())}function at(){a4=L}function a0(bv,e){var bw={};b.each(aH.concat.apply([],aH.slice(0,e)),function(){bw[this]=bv});return bw}b.each({slideDown:a0("show",1),slideUp:a0("hide",1),slideToggle:a0("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,bv){b.fn[e]=function(bw,by,bx){return this.animate(bv,bw,by,bx)}});b.extend({speed:function(bw,bx,bv){var e=bw&&typeof bw==="object"?b.extend({},bw):{complete:bv||!bv&&bx||b.isFunction(bw)&&bw,duration:bw,easing:bv&&bx||bx&&!b.isFunction(bx)&&bx};e.duration=b.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in b.fx.speeds?b.fx.speeds[e.duration]:b.fx.speeds._default;if(e.queue==null||e.queue===true){e.queue="fx"}e.old=e.complete;e.complete=function(by){if(b.isFunction(e.old)){e.old.call(this)}if(e.queue){b.dequeue(this,e.queue)}else{if(by!==false){b._unmark(this)}}};return e},easing:{linear:function(bw,bx,e,bv){return e+bv*bw},swing:function(bw,bx,e,bv){return((-Math.cos(bw*Math.PI)/2)+0.5)*bv+e}},timers:[],fx:function(bv,e,bw){this.options=e;this.elem=bv;this.prop=bw;e.orig=e.orig||{}}});b.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(b.fx.step[this.prop]||b.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var e,bv=b.css(this.elem,this.prop);return isNaN(e=parseFloat(bv))?!bv||bv==="auto"?0:bv:e},custom:function(bz,by,bx){var e=this,bw=b.fx;this.startTime=a4||bh();this.end=by;this.now=this.start=bz;this.pos=this.state=0;this.unit=bx||this.unit||(b.cssNumber[this.prop]?"":"px");function bv(bA){return e.step(bA)}bv.queue=this.options.queue;bv.elem=this.elem;bv.saveState=function(){if(e.options.hide&&b._data(e.elem,"fxshow"+e.prop)===L){b._data(e.elem,"fxshow"+e.prop,e.start)}};if(bv()&&b.timers.push(bv)&&!a3){a3=setInterval(bw.tick,bw.interval)}},show:function(){var e=b._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=e||b.style(this.elem,this.prop);this.options.show=true;if(e!==L){this.custom(this.cur(),e)}else{this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur())}b(this.elem).show()},hide:function(){this.options.orig[this.prop]=b._data(this.elem,"fxshow"+this.prop)||b.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(by){var bA,bB,bv,bx=a4||bh(),e=true,bz=this.elem,bw=this.options;if(by||bx>=bw.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();bw.animatedProperties[this.prop]=true;for(bA in bw.animatedProperties){if(bw.animatedProperties[bA]!==true){e=false}}if(e){if(bw.overflow!=null&&!b.support.shrinkWrapBlocks){b.each(["","X","Y"],function(bC,bD){bz.style["overflow"+bD]=bw.overflow[bC]})}if(bw.hide){b(bz).hide()}if(bw.hide||bw.show){for(bA in bw.animatedProperties){b.style(bz,bA,bw.orig[bA]);b.removeData(bz,"fxshow"+bA,true);b.removeData(bz,"toggle"+bA,true)}}bv=bw.complete;if(bv){bw.complete=false;bv.call(bz)}}return false}else{if(bw.duration==Infinity){this.now=bx}else{bB=bx-this.startTime;this.state=bB/bw.duration;this.pos=b.easing[bw.animatedProperties[this.prop]](this.state,bB,0,1,bw.duration);this.now=this.start+((this.end-this.start)*this.pos)}this.update()}return true}};b.extend(b.fx,{tick:function(){var bw,bv=b.timers,e=0;for(;e<bv.length;e++){bw=bv[e];if(!bw()&&bv[e]===bw){bv.splice(e--,1)}}if(!bv.length){b.fx.stop()}},interval:13,stop:function(){clearInterval(a3);a3=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(e){b.style(e.elem,"opacity",e.now)},_default:function(e){if(e.elem.style&&e.elem.style[e.prop]!=null){e.elem.style[e.prop]=e.now+e.unit}else{e.elem[e.prop]=e.now}}}});b.each(["width","height"],function(e,bv){b.fx.step[bv]=function(bw){b.style(bw.elem,bv,Math.max(0,bw.now)+bw.unit)}});if(b.expr&&b.expr.filters){b.expr.filters.animated=function(e){return b.grep(b.timers,function(bv){return e===bv.elem}).length}}function x(bx){if(!Q[bx]){var e=av.body,bv=b("<"+bx+">").appendTo(e),bw=bv.css("display");bv.remove();if(bw==="none"||bw===""){if(!a8){a8=av.createElement("iframe");a8.frameBorder=a8.width=a8.height=0}e.appendChild(a8);if(!m||!a8.createElement){m=(a8.contentWindow||a8.contentDocument).document;m.write((av.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>");m.close()}bv=m.createElement(bx);m.body.appendChild(bv);bw=b.css(bv,"display");e.removeChild(a8)}Q[bx]=bw}return Q[bx]}var V=/^t(?:able|d|h)$/i,ad=/^(?:body|html)$/i;if("getBoundingClientRect" in av.documentElement){b.fn.offset=function(bI){var by=this[0],bB;if(bI){return this.each(function(e){b.offset.setOffset(this,bI,e)})}if(!by||!by.ownerDocument){return null}if(by===by.ownerDocument.body){return b.offset.bodyOffset(by)}try{bB=by.getBoundingClientRect()}catch(bF){}var bH=by.ownerDocument,bw=bH.documentElement;if(!bB||!b.contains(bw,by)){return bB?{top:bB.top,left:bB.left}:{top:0,left:0}}var bC=bH.body,bD=aK(bH),bA=bw.clientTop||bC.clientTop||0,bE=bw.clientLeft||bC.clientLeft||0,bv=bD.pageYOffset||b.support.boxModel&&bw.scrollTop||bC.scrollTop,bz=bD.pageXOffset||b.support.boxModel&&bw.scrollLeft||bC.scrollLeft,bG=bB.top+bv-bA,bx=bB.left+bz-bE;return{top:bG,left:bx}}}else{b.fn.offset=function(bF){var bz=this[0];if(bF){return this.each(function(bG){b.offset.setOffset(this,bF,bG)})}if(!bz||!bz.ownerDocument){return null}if(bz===bz.ownerDocument.body){return b.offset.bodyOffset(bz)}var bC,bw=bz.offsetParent,bv=bz,bE=bz.ownerDocument,bx=bE.documentElement,bA=bE.body,bB=bE.defaultView,e=bB?bB.getComputedStyle(bz,null):bz.currentStyle,bD=bz.offsetTop,by=bz.offsetLeft;while((bz=bz.parentNode)&&bz!==bA&&bz!==bx){if(b.support.fixedPosition&&e.position==="fixed"){break}bC=bB?bB.getComputedStyle(bz,null):bz.currentStyle;bD-=bz.scrollTop;by-=bz.scrollLeft;if(bz===bw){bD+=bz.offsetTop;by+=bz.offsetLeft;if(b.support.doesNotAddBorder&&!(b.support.doesAddBorderForTableAndCells&&V.test(bz.nodeName))){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}bv=bw;bw=bz.offsetParent}if(b.support.subtractsBorderForOverflowNotVisible&&bC.overflow!=="visible"){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}e=bC}if(e.position==="relative"||e.position==="static"){bD+=bA.offsetTop;by+=bA.offsetLeft}if(b.support.fixedPosition&&e.position==="fixed"){bD+=Math.max(bx.scrollTop,bA.scrollTop);by+=Math.max(bx.scrollLeft,bA.scrollLeft)}return{top:bD,left:by}}}b.offset={bodyOffset:function(e){var bw=e.offsetTop,bv=e.offsetLeft;if(b.support.doesNotIncludeMarginInBodyOffset){bw+=parseFloat(b.css(e,"marginTop"))||0;bv+=parseFloat(b.css(e,"marginLeft"))||0}return{top:bw,left:bv}},setOffset:function(bx,bG,bA){var bB=b.css(bx,"position");if(bB==="static"){bx.style.position="relative"}var bz=b(bx),bv=bz.offset(),e=b.css(bx,"top"),bE=b.css(bx,"left"),bF=(bB==="absolute"||bB==="fixed")&&b.inArray("auto",[e,bE])>-1,bD={},bC={},bw,by;if(bF){bC=bz.position();bw=bC.top;by=bC.left}else{bw=parseFloat(e)||0;by=parseFloat(bE)||0}if(b.isFunction(bG)){bG=bG.call(bx,bA,bv)}if(bG.top!=null){bD.top=(bG.top-bv.top)+bw}if(bG.left!=null){bD.left=(bG.left-bv.left)+by}if("using" in bG){bG.using.call(bx,bD)}else{bz.css(bD)}}};b.fn.extend({position:function(){if(!this[0]){return null}var bw=this[0],bv=this.offsetParent(),bx=this.offset(),e=ad.test(bv[0].nodeName)?{top:0,left:0}:bv.offset();bx.top-=parseFloat(b.css(bw,"marginTop"))||0;bx.left-=parseFloat(b.css(bw,"marginLeft"))||0;e.top+=parseFloat(b.css(bv[0],"borderTopWidth"))||0;e.left+=parseFloat(b.css(bv[0],"borderLeftWidth"))||0;return{top:bx.top-e.top,left:bx.left-e.left}},offsetParent:function(){return this.map(function(){var e=this.offsetParent||av.body;while(e&&(!ad.test(e.nodeName)&&b.css(e,"position")==="static")){e=e.offsetParent}return e})}});b.each(["Left","Top"],function(bv,e){var bw="scroll"+e;b.fn[bw]=function(bz){var bx,by;if(bz===L){bx=this[0];if(!bx){return null}by=aK(bx);return by?("pageXOffset" in by)?by[bv?"pageYOffset":"pageXOffset"]:b.support.boxModel&&by.document.documentElement[bw]||by.document.body[bw]:bx[bw]}return this.each(function(){by=aK(this);if(by){by.scrollTo(!bv?bz:b(by).scrollLeft(),bv?bz:b(by).scrollTop())}else{this[bw]=bz}})}});function aK(e){return b.isWindow(e)?e:e.nodeType===9?e.defaultView||e.parentWindow:false}b.each(["Height","Width"],function(bv,e){var bw=e.toLowerCase();b.fn["inner"+e]=function(){var bx=this[0];return bx?bx.style?parseFloat(b.css(bx,bw,"padding")):this[bw]():null};b.fn["outer"+e]=function(by){var bx=this[0];return bx?bx.style?parseFloat(b.css(bx,bw,by?"margin":"border")):this[bw]():null};b.fn[bw]=function(bz){var bA=this[0];if(!bA){return bz==null?null:this}if(b.isFunction(bz)){return this.each(function(bE){var bD=b(this);bD[bw](bz.call(this,bE,bD[bw]()))})}if(b.isWindow(bA)){var bB=bA.document.documentElement["client"+e],bx=bA.document.body;return bA.document.compatMode==="CSS1Compat"&&bB||bx&&bx["client"+e]||bB}else{if(bA.nodeType===9){return Math.max(bA.documentElement["client"+e],bA.body["scroll"+e],bA.documentElement["scroll"+e],bA.body["offset"+e],bA.documentElement["offset"+e])}else{if(bz===L){var bC=b.css(bA,bw),by=parseFloat(bC);return b.isNumeric(by)?by:bC}else{return this.css(bw,typeof bz==="string"?bz:bz+"px")}}}}});bb.jQuery=bb.$=b;if(typeof define==="function"&&define.amd&&define.amd.jQuery){define("jquery",[],function(){return b})}})(window);/*!
+ * jQuery UI 1.8.18
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(a,d){a.ui=a.ui||{};if(a.ui.version){return}a.extend(a.ui,{version:"1.8.18",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(e,f){return typeof e==="number"?this.each(function(){var g=this;setTimeout(function(){a(g).focus();if(f){f.call(g)}},e)}):this._focus.apply(this,arguments)},scrollParent:function(){var e;if((a.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){e=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(a.curCSS(this,"position",1))&&(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}else{e=this.parents().filter(function(){return(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!e.length?a(document):e},zIndex:function(h){if(h!==d){return this.css("zIndex",h)}if(this.length){var f=a(this[0]),e,g;while(f.length&&f[0]!==document){e=f.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){g=parseInt(f.css("zIndex"),10);if(!isNaN(g)&&g!==0){return g}}f=f.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(e){e.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(g,e){var f=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),k={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};function j(m,l,i,n){a.each(f,function(){l-=parseFloat(a.curCSS(m,"padding"+this,true))||0;if(i){l-=parseFloat(a.curCSS(m,"border"+this+"Width",true))||0}if(n){l-=parseFloat(a.curCSS(m,"margin"+this,true))||0}});return l}a.fn["inner"+e]=function(i){if(i===d){return k["inner"+e].call(this)}return this.each(function(){a(this).css(h,j(this,i)+"px")})};a.fn["outer"+e]=function(i,l){if(typeof i!=="number"){return k["outer"+e].call(this,i)}return this.each(function(){a(this).css(h,j(this,i,true,l)+"px")})}});function c(g,e){var j=g.nodeName.toLowerCase();if("area"===j){var i=g.parentNode,h=i.name,f;if(!g.href||!h||i.nodeName.toLowerCase()!=="map"){return false}f=a("img[usemap=#"+h+"]")[0];return !!f&&b(f)}return(/input|select|textarea|button|object/.test(j)?!g.disabled:"a"==j?g.href||e:e)&&b(g)}function b(e){return !a(e).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.extend(a.expr[":"],{data:function(g,f,e){return !!a.data(g,e[3])},focusable:function(e){return c(e,!isNaN(a.attr(e,"tabindex")))},tabbable:function(g){var e=a.attr(g,"tabindex"),f=isNaN(e);return(f||e>=0)&&c(g,!f)}});a(function(){var e=document.body,f=e.appendChild(f=document.createElement("div"));f.offsetHeight;a.extend(f.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=f.offsetHeight===100;a.support.selectstart="onselectstart" in f;e.removeChild(f).style.display="none"});a.extend(a.ui,{plugin:{add:function(f,g,j){var h=a.ui[f].prototype;for(var e in j){h.plugins[e]=h.plugins[e]||[];h.plugins[e].push([g,j[e]])}},call:function(e,g,f){var j=e.plugins[g];if(!j||!e.element[0].parentNode){return}for(var h=0;h<j.length;h++){if(e.options[j[h][0]]){j[h][1].apply(e.element,f)}}}},contains:function(f,e){return document.compareDocumentPosition?f.compareDocumentPosition(e)&16:f!==e&&f.contains(e)},hasScroll:function(h,f){if(a(h).css("overflow")==="hidden"){return false}var e=(f&&f==="left")?"scrollLeft":"scrollTop",g=false;if(h[e]>0){return true}h[e]=1;g=(h[e]>0);h[e]=0;return g},isOverAxis:function(f,e,g){return(f>e)&&(f<(e+g))},isOver:function(j,f,i,h,e,g){return a.ui.isOverAxis(j,i,e)&&a.ui.isOverAxis(f,h,g)}})})(jQuery);/*!
+ * jQuery UI Widget 1.8.18
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b,d){if(b.cleanData){var c=b.cleanData;b.cleanData=function(f){for(var g=0,h;(h=f[g])!=null;g++){try{b(h).triggerHandler("remove")}catch(j){}}c(f)}}else{var a=b.fn.remove;b.fn.remove=function(e,f){return this.each(function(){if(!f){if(!e||b.filter(e,[this]).length){b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(g){}})}}return a.call(b(this),e,f)})}}b.widget=function(f,h,e){var g=f.split(".")[0],j;f=f.split(".")[1];j=g+"-"+f;if(!e){e=h;h=b.Widget}b.expr[":"][j]=function(k){return !!b.data(k,f)};b[g]=b[g]||{};b[g][f]=function(k,l){if(arguments.length){this._createWidget(k,l)}};var i=new h();i.options=b.extend(true,{},i.options);b[g][f].prototype=b.extend(true,i,{namespace:g,widgetName:f,widgetEventPrefix:b[g][f].prototype.widgetEventPrefix||f,widgetBaseClass:j},e);b.widget.bridge(f,b[g][f])};b.widget.bridge=function(f,e){b.fn[f]=function(i){var g=typeof i==="string",h=Array.prototype.slice.call(arguments,1),j=this;i=!g&&h.length?b.extend.apply(null,[true,i].concat(h)):i;if(g&&i.charAt(0)==="_"){return j}if(g){this.each(function(){var k=b.data(this,f),l=k&&b.isFunction(k[i])?k[i].apply(k,h):k;if(l!==k&&l!==d){j=l;return false}})}else{this.each(function(){var k=b.data(this,f);if(k){k.option(i||{})._init()}else{b.data(this,f,new e(i,this))}})}return j}};b.Widget=function(e,f){if(arguments.length){this._createWidget(e,f)}};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(f,g){b.data(g,this.widgetName,this);this.element=b(g);this.options=b.extend(true,{},this.options,this._getCreateOptions(),f);var e=this;this.element.bind("remove."+this.widgetName,function(){e.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(f,g){var e=f;if(arguments.length===0){return b.extend({},this.options)}if(typeof f==="string"){if(g===d){return this.options[f]}e={};e[f]=g}this._setOptions(e);return this},_setOptions:function(f){var e=this;b.each(f,function(g,h){e._setOption(g,h)});return this},_setOption:function(e,f){this.options[e]=f;if(e==="disabled"){this.widget()[f?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",f)}return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(e,f,g){var j,i,h=this.options[e];g=g||{};f=b.Event(f);f.type=(e===this.widgetEventPrefix?e:this.widgetEventPrefix+e).toLowerCase();f.target=this.element[0];i=f.originalEvent;if(i){for(j in i){if(!(j in f)){f[j]=i[j]}}}this.element.trigger(f,g);return !(b.isFunction(h)&&h.call(this.element[0],f,g)===false||f.isDefaultPrevented())}}})(jQuery);/*!
+ * jQuery UI Mouse 1.8.18
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function(b,c){var a=false;b(document).mouseup(function(d){a=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var d=this;this.element.bind("mousedown."+this.widgetName,function(e){return d._mouseDown(e)}).bind("click."+this.widgetName,function(e){if(true===b.data(e.target,d.widgetName+".preventClickEvent")){b.removeData(e.target,d.widgetName+".preventClickEvent");e.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(f){if(a){return}(this._mouseStarted&&this._mouseUp(f));this._mouseDownEvent=f;var e=this,g=(f.which==1),d=(typeof this.options.cancel=="string"&&f.target.nodeName?b(f.target).closest(this.options.cancel).length:false);if(!g||d||!this._mouseCapture(f)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){e.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(f)&&this._mouseDelayMet(f)){this._mouseStarted=(this._mouseStart(f)!==false);if(!this._mouseStarted){f.preventDefault();return true}}if(true===b.data(f.target,this.widgetName+".preventClickEvent")){b.removeData(f.target,this.widgetName+".preventClickEvent")}this._mouseMoveDelegate=function(h){return e._mouseMove(h)};this._mouseUpDelegate=function(h){return e._mouseUp(h)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);f.preventDefault();a=true;return true},_mouseMove:function(d){if(b.browser.msie&&!(document.documentMode>=9)&&!d.button){return this._mouseUp(d)}if(this._mouseStarted){this._mouseDrag(d);return d.preventDefault()}if(this._mouseDistanceMet(d)&&this._mouseDelayMet(d)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,d)!==false);(this._mouseStarted?this._mouseDrag(d):this._mouseUp(d))}return !this._mouseStarted},_mouseUp:function(d){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;if(d.target==this._mouseDownEvent.target){b.data(d.target,this.widgetName+".preventClickEvent",true)}this._mouseStop(d)}return false},_mouseDistanceMet:function(d){return(Math.max(Math.abs(this._mouseDownEvent.pageX-d.pageX),Math.abs(this._mouseDownEvent.pageY-d.pageY))>=this.options.distance)},_mouseDelayMet:function(d){return this.mouseDelayMet},_mouseStart:function(d){},_mouseDrag:function(d){},_mouseStop:function(d){},_mouseCapture:function(d){return true}})})(jQuery);(function(c,d){c.widget("ui.resizable",c.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000},_create:function(){var f=this,k=this.options;this.element.addClass("ui-resizable");c.extend(this,{_aspectRatio:!!(k.aspectRatio),aspectRatio:k.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:k.helper||k.ghost||k.animate?k.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){this.element.wrap(c('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=k.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var l=this.handles.split(",");this.handles={};for(var g=0;g<l.length;g++){var j=c.trim(l[g]),e="ui-resizable-"+j;var h=c('<div class="ui-resizable-handle '+e+'"></div>');if(/sw|se|ne|nw/.test(j)){h.css({zIndex:++k.zIndex})}if("se"==j){h.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[j]=".ui-resizable-"+j;this.element.append(h)}}this._renderAxis=function(q){q=q||this.element;for(var n in this.handles){if(this.handles[n].constructor==String){this.handles[n]=c(this.handles[n],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=c(this.handles[n],this.element),p=0;p=/sw|ne|nw|se|n|s/.test(n)?o.outerHeight():o.outerWidth();var m=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");q.css(m,p);this._proportionallyResize()}if(!c(this.handles[n]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!f.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}f.axis=i&&i[1]?i[1]:"se"}});if(k.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){if(k.disabled){return}c(this).removeClass("ui-resizable-autohide");f._handles.show()},function(){if(k.disabled){return}if(!f.resizing){c(this).addClass("ui-resizable-autohide");f._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var e=function(g){c(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var f=this.element;f.after(this.originalElement.css({position:f.css("position"),width:f.outerWidth(),height:f.outerHeight(),top:f.css("top"),left:f.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(f){var g=false;for(var e in this.handles){if(c(this.handles[e])[0]==f.target){g=true}}return !this.options.disabled&&g},_mouseStart:function(g){var j=this.options,f=this.element.position(),e=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(e.is(".ui-draggable")||(/absolute/).test(e.css("position"))){e.css({position:"absolute",top:f.top,left:f.left})}this._renderProxy();var k=b(this.helper.css("left")),h=b(this.helper.css("top"));if(j.containment){k+=c(j.containment).scrollLeft()||0;h+=c(j.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:k,top:h};this.size=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalSize=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalPosition={left:k,top:h};this.sizeDiff={width:e.outerWidth()-e.width(),height:e.outerHeight()-e.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=(typeof j.aspectRatio=="number")?j.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var i=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",i=="auto"?this.axis+"-resize":i);e.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(e){var h=this.helper,g=this.options,m={},q=this,j=this.originalMousePosition,n=this.axis;var r=(e.pageX-j.left)||0,p=(e.pageY-j.top)||0;var i=this._change[n];if(!i){return false}var l=i.apply(this,[e,r,p]),k=c.browser.msie&&c.browser.version<7,f=this.sizeDiff;this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey){l=this._updateRatio(l,e)}l=this._respectSize(l,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(l);this._trigger("resize",e,this.ui());return false},_mouseStop:function(h){this.resizing=false;var i=this.options,m=this;if(this._helper){var g=this._proportionallyResizeElements,e=g.length&&(/textarea/i).test(g[0].nodeName),f=e&&c.ui.hasScroll(g[0],"left")?0:m.sizeDiff.height,k=e?0:m.sizeDiff.width;var n={width:(m.helper.width()-k),height:(m.helper.height()-f)},j=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,l=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;if(!i.animate){this.element.css(c.extend(n,{top:l,left:j}))}m.helper.height(m.size.height);m.helper.width(m.size.width);if(this._helper&&!i.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",h);if(this._helper){this.helper.remove()}return false},_updateVirtualBoundaries:function(g){var j=this.options,i,h,f,k,e;e={minWidth:a(j.minWidth)?j.minWidth:0,maxWidth:a(j.maxWidth)?j.maxWidth:Infinity,minHeight:a(j.minHeight)?j.minHeight:0,maxHeight:a(j.maxHeight)?j.maxHeight:Infinity};if(this._aspectRatio||g){i=e.minHeight*this.aspectRatio;f=e.minWidth/this.aspectRatio;h=e.maxHeight*this.aspectRatio;k=e.maxWidth/this.aspectRatio;if(i>e.minWidth){e.minWidth=i}if(f>e.minHeight){e.minHeight=f}if(h<e.maxWidth){e.maxWidth=h}if(k<e.maxHeight){e.maxHeight=k}}this._vBoundaries=e},_updateCache:function(e){var f=this.options;this.offset=this.helper.offset();if(a(e.left)){this.position.left=e.left}if(a(e.top)){this.position.top=e.top}if(a(e.height)){this.size.height=e.height}if(a(e.width)){this.size.width=e.width}},_updateRatio:function(h,g){var i=this.options,j=this.position,f=this.size,e=this.axis;if(a(h.height)){h.width=(h.height*this.aspectRatio)}else{if(a(h.width)){h.height=(h.width/this.aspectRatio)}}if(e=="sw"){h.left=j.left+(f.width-h.width);h.top=null}if(e=="nw"){h.top=j.top+(f.height-h.height);h.left=j.left+(f.width-h.width)}return h},_respectSize:function(l,g){var j=this.helper,i=this._vBoundaries,r=this._aspectRatio||g.shiftKey,q=this.axis,t=a(l.width)&&i.maxWidth&&(i.maxWidth<l.width),m=a(l.height)&&i.maxHeight&&(i.maxHeight<l.height),h=a(l.width)&&i.minWidth&&(i.minWidth>l.width),s=a(l.height)&&i.minHeight&&(i.minHeight>l.height);if(h){l.width=i.minWidth}if(s){l.height=i.minHeight}if(t){l.width=i.maxWidth}if(m){l.height=i.maxHeight}var f=this.originalPosition.left+this.originalSize.width,p=this.position.top+this.size.height;var k=/sw|nw|w/.test(q),e=/nw|ne|n/.test(q);if(h&&k){l.left=f-i.minWidth}if(t&&k){l.left=f-i.maxWidth}if(s&&e){l.top=p-i.minHeight}if(m&&e){l.top=p-i.maxHeight}var n=!l.width&&!l.height;if(n&&!l.left&&l.top){l.top=null}else{if(n&&!l.top&&l.left){l.left=null}}return l},_proportionallyResize:function(){var k=this.options;if(!this._proportionallyResizeElements.length){return}var g=this.helper||this.element;for(var f=0;f<this._proportionallyResizeElements.length;f++){var h=this._proportionallyResizeElements[f];if(!this.borderDif){var e=[h.css("borderTopWidth"),h.css("borderRightWidth"),h.css("borderBottomWidth"),h.css("borderLeftWidth")],j=[h.css("paddingTop"),h.css("paddingRight"),h.css("paddingBottom"),h.css("paddingLeft")];this.borderDif=c.map(e,function(l,n){var m=parseInt(l,10)||0,o=parseInt(j[n],10)||0;return m+o})}if(c.browser.msie&&!(!(c(g).is(":hidden")||c(g).parents(":hidden").length))){continue}h.css({height:(g.height()-this.borderDif[0]-this.borderDif[2])||0,width:(g.width()-this.borderDif[1]-this.borderDif[3])||0})}},_renderProxy:function(){var f=this.element,i=this.options;this.elementOffset=f.offset();if(this._helper){this.helper=this.helper||c('<div style="overflow:hidden;"></div>');var e=c.browser.msie&&c.browser.version<7,g=(e?1:0),h=(e?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++i.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(g,f,e){return{width:this.originalSize.width+f}},w:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{left:i.left+f,width:g.width-f}},n:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{top:i.top+e,height:g.height-e}},s:function(g,f,e){return{height:this.originalSize.height+e}},se:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},sw:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,f,e]))},ne:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},nw:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,f,e]))}},_propagate:function(f,e){c.ui.plugin.call(this,f,[e,this.ui()]);(f!="resize"&&this._trigger(f,e,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});c.extend(c.ui.resizable,{version:"1.8.18"});c.ui.plugin.add("resizable","alsoResize",{start:function(f,g){var e=c(this).data("resizable"),i=e.options;var h=function(j){c(j).each(function(){var k=c(this);k.data("resizable-alsoresize",{width:parseInt(k.width(),10),height:parseInt(k.height(),10),left:parseInt(k.css("left"),10),top:parseInt(k.css("top"),10)})})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.parentNode){if(i.alsoResize.length){i.alsoResize=i.alsoResize[0];h(i.alsoResize)}else{c.each(i.alsoResize,function(j){h(j)})}}else{h(i.alsoResize)}},resize:function(g,i){var f=c(this).data("resizable"),j=f.options,h=f.originalSize,l=f.originalPosition;var k={height:(f.size.height-h.height)||0,width:(f.size.width-h.width)||0,top:(f.position.top-l.top)||0,left:(f.position.left-l.left)||0},e=function(m,n){c(m).each(function(){var q=c(this),r=c(this).data("resizable-alsoresize"),p={},o=n&&n.length?n:q.parents(i.originalElement[0]).length?["width","height"]:["width","height","top","left"];c.each(o,function(s,u){var t=(r[u]||0)+(k[u]||0);if(t&&t>=0){p[u]=t||null}});q.css(p)})};if(typeof(j.alsoResize)=="object"&&!j.alsoResize.nodeType){c.each(j.alsoResize,function(m,n){e(m,n)})}else{e(j.alsoResize)}},stop:function(e,f){c(this).removeData("resizable-alsoresize")}});c.ui.plugin.add("resizable","animate",{stop:function(i,n){var p=c(this).data("resizable"),j=p.options;var h=p._proportionallyResizeElements,e=h.length&&(/textarea/i).test(h[0].nodeName),f=e&&c.ui.hasScroll(h[0],"left")?0:p.sizeDiff.height,l=e?0:p.sizeDiff.width;var g={width:(p.size.width-l),height:(p.size.height-f)},k=(parseInt(p.element.css("left"),10)+(p.position.left-p.originalPosition.left))||null,m=(parseInt(p.element.css("top"),10)+(p.position.top-p.originalPosition.top))||null;p.element.animate(c.extend(g,m&&k?{top:m,left:k}:{}),{duration:j.animateDuration,easing:j.animateEasing,step:function(){var o={width:parseInt(p.element.css("width"),10),height:parseInt(p.element.css("height"),10),top:parseInt(p.element.css("top"),10),left:parseInt(p.element.css("left"),10)};if(h&&h.length){c(h[0]).css({width:o.width,height:o.height})}p._updateCache(o);p._propagate("resize",i)}})}});c.ui.plugin.add("resizable","containment",{start:function(f,r){var t=c(this).data("resizable"),j=t.options,l=t.element;var g=j.containment,k=(g instanceof c)?g.get(0):(/parent/.test(g))?l.parent().get(0):g;if(!k){return}t.containerElement=c(k);if(/document/.test(g)||g==document){t.containerOffset={left:0,top:0};t.containerPosition={left:0,top:0};t.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var n=c(k),i=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){i[p]=b(n.css("padding"+o))});t.containerOffset=n.offset();t.containerPosition=n.position();t.containerSize={height:(n.innerHeight()-i[3]),width:(n.innerWidth()-i[1])};var q=t.containerOffset,e=t.containerSize.height,m=t.containerSize.width,h=(c.ui.hasScroll(k,"left")?k.scrollWidth:m),s=(c.ui.hasScroll(k)?k.scrollHeight:e);t.parentData={element:k,left:q.left,top:q.top,width:h,height:s}}},resize:function(g,q){var t=c(this).data("resizable"),i=t.options,f=t.containerSize,p=t.containerOffset,m=t.size,n=t.position,r=t._aspectRatio||g.shiftKey,e={top:0,left:0},h=t.containerElement;if(h[0]!=document&&(/static/).test(h.css("position"))){e=p}if(n.left<(t._helper?p.left:0)){t.size.width=t.size.width+(t._helper?(t.position.left-p.left):(t.position.left-e.left));if(r){t.size.height=t.size.width/i.aspectRatio}t.position.left=i.helper?p.left:0}if(n.top<(t._helper?p.top:0)){t.size.height=t.size.height+(t._helper?(t.position.top-p.top):t.position.top);if(r){t.size.width=t.size.height*i.aspectRatio}t.position.top=t._helper?p.top:0}t.offset.left=t.parentData.left+t.position.left;t.offset.top=t.parentData.top+t.position.top;var l=Math.abs((t._helper?t.offset.left-e.left:(t.offset.left-e.left))+t.sizeDiff.width),s=Math.abs((t._helper?t.offset.top-e.top:(t.offset.top-p.top))+t.sizeDiff.height);var k=t.containerElement.get(0)==t.element.parent().get(0),j=/relative|absolute/.test(t.containerElement.css("position"));if(k&&j){l-=t.parentData.left}if(l+t.size.width>=t.parentData.width){t.size.width=t.parentData.width-l;if(r){t.size.height=t.size.width/t.aspectRatio}}if(s+t.size.height>=t.parentData.height){t.size.height=t.parentData.height-s;if(r){t.size.width=t.size.height*t.aspectRatio}}},stop:function(f,n){var q=c(this).data("resizable"),g=q.options,l=q.position,m=q.containerOffset,e=q.containerPosition,i=q.containerElement;var j=c(q.helper),r=j.offset(),p=j.outerWidth()-q.sizeDiff.width,k=j.outerHeight()-q.sizeDiff.height;if(q._helper&&!g.animate&&(/relative/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}if(q._helper&&!g.animate&&(/static/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}}});c.ui.plugin.add("resizable","ghost",{start:function(g,h){var e=c(this).data("resizable"),i=e.options,f=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:"");e.ghost.appendTo(e.helper)},resize:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost){e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})}},stop:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost&&e.helper){e.helper.get(0).removeChild(e.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(e,m){var p=c(this).data("resizable"),h=p.options,k=p.size,i=p.originalSize,j=p.originalPosition,n=p.axis,l=h._aspectRatio||e.shiftKey;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var g=Math.round((k.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1),f=Math.round((k.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f}else{if(/^(ne)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f}else{if(/^(sw)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.left=j.left-g}else{p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f;p.position.left=j.left-g}}}}});var b=function(e){return parseInt(e,10)||0};var a=function(e){return !isNaN(parseInt(e,10))}})(jQuery);/*!
+ * jQuery hashchange event - v1.3 - 7/21/2010
+ * http://benalman.com/projects/jquery-hashchange-plugin/
+ *
+ * Copyright (c) 2010 "Cowboy" Ben Alman
+ * Dual licensed under the MIT and GPL licenses.
+ * http://benalman.com/about/license/
+ */
+(function($,e,b){var c="hashchange",h=document,f,g=$.event.special,i=h.documentMode,d="on"+c in e&&(i===b||i>7);function a(j){j=j||location.href;return"#"+j.replace(/^[^#]*#?(.*)$/,"$1")}$.fn[c]=function(j){return j?this.bind(c,j):this.trigger(c)};$.fn[c].delay=50;g[c]=$.extend(g[c],{setup:function(){if(d){return false}$(f.start)},teardown:function(){if(d){return false}$(f.stop)}});f=(function(){var j={},p,m=a(),k=function(q){return q},l=k,o=k;j.start=function(){p||n()};j.stop=function(){p&&clearTimeout(p);p=b};function n(){var r=a(),q=o(m);if(r!==m){l(m=r,q);$(e).trigger(c)}else{if(q!==m){location.href=location.href.replace(/#.*/,"")+q}}p=setTimeout(n,$.fn[c].delay)}$.browser.msie&&!d&&(function(){var q,r;j.start=function(){if(!q){r=$.fn[c].src;r=r&&r+a();q=$('<iframe tabindex="-1" title="empty"/>').hide().one("load",function(){r||l(a());n()}).attr("src",r||"javascript:0").insertAfter("body")[0].contentWindow;h.onpropertychange=function(){try{if(event.propertyName==="title"){q.document.title=h.title}}catch(s){}}}};j.stop=k;o=function(){return a(q.location.href)};l=function(v,s){var u=q.document,t=$.fn[c].domain;if(v!==s){u.title=h.title;u.open();t&&u.write('<script>document.domain="'+t+'"<\/script>');u.close();q.location.hash=v}}})();return j})()})(jQuery,this);(function(c){var a=c.scrollTo=function(f,e,d){c(window).scrollTo(f,e,d)};a.defaults={axis:"xy",duration:parseFloat(c.fn.jquery)>=1.3?0:1};a.window=function(d){return c(window)._scrollable()};c.fn._scrollable=function(){return this.map(function(){var e=this,d=!e.nodeName||c.inArray(e.nodeName.toLowerCase(),["iframe","#document","html","body"])!=-1;if(!d){return e}var f=(e.contentWindow||e).document||e.ownerDocument||e;return c.browser.safari||f.compatMode=="BackCompat"?f.body:f.documentElement})};c.fn.scrollTo=function(f,e,d){if(typeof e=="object"){d=e;e=0}if(typeof d=="function"){d={onAfter:d}}if(f=="max"){f=9000000000}d=c.extend({},a.defaults,d);e=e||d.speed||d.duration;d.queue=d.queue&&d.axis.length>1;if(d.queue){e/=2}d.offset=b(d.offset);d.over=b(d.over);return this._scrollable().each(function(){var l=this,j=c(l),k=f,i,g={},m=j.is("html,body");switch(typeof k){case"number":case"string":if(/^([+-]=)?\d+(\.\d+)?(px|%)?$/.test(k)){k=b(k);break}k=c(k,this);case"object":if(k.is||k.style){i=(k=c(k)).offset()}}c.each(d.axis.split(""),function(q,r){var s=r=="x"?"Left":"Top",u=s.toLowerCase(),p="scroll"+s,o=l[p],n=a.max(l,r);if(i){g[p]=i[u]+(m?0:o-j.offset()[u]);if(d.margin){g[p]-=parseInt(k.css("margin"+s))||0;g[p]-=parseInt(k.css("border"+s+"Width"))||0}g[p]+=d.offset[u]||0;if(d.over[u]){g[p]+=k[r=="x"?"width":"height"]()*d.over[u]}}else{var t=k[u];g[p]=t.slice&&t.slice(-1)=="%"?parseFloat(t)/100*n:t}if(/^\d+$/.test(g[p])){g[p]=g[p]<=0?0:Math.min(g[p],n)}if(!q&&d.queue){if(o!=g[p]){h(d.onAfterFirst)}delete g[p]}});h(d.onAfter);function h(n){j.animate(g,e,d.easing,n&&function(){n.call(this,f,d)})}}).end()};a.max=function(j,i){var h=i=="x"?"Width":"Height",e="scroll"+h;if(!c(j).is("html,body")){return j[e]-c(j)[h.toLowerCase()]()}var g="client"+h,f=j.ownerDocument.documentElement,d=j.ownerDocument.body;return Math.max(f[e],d[e])-Math.min(f[g],d[g])};function b(d){return typeof d=="object"?d:{top:d,left:d}}})(jQuery);/*!
+ PowerTip - v1.2.0 - 2013-04-03
+ http://stevenbenner.github.com/jquery-powertip/
+ Copyright (c) 2013 Steven Benner (http://stevenbenner.com/).
+ Released under MIT license.
+ https://raw.github.com/stevenbenner/jquery-powertip/master/LICENSE.txt
+(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{a(jQuery)}}(function(k){var A=k(document),s=k(window),w=k("body");var n="displayController",e="hasActiveHover",d="forcedOpen",u="hasMouseMove",f="mouseOnToPopup",g="originalTitle",y="powertip",o="powertipjq",l="powertiptarget",E=180/Math.PI;var c={isTipOpen:false,isFixedTipOpen:false,isClosing:false,tipOpenImminent:false,activeHover:null,currentX:0,currentY:0,previousX:0,previousY:0,desyncTimeout:null,mouseTrackingActive:false,delayInProgress:false,windowWidth:0,windowHeight:0,scrollTop:0,scrollLeft:0};var p={none:0,top:1,bottom:2,left:4,right:8};k.fn.powerTip=function(F,N){if(!this.length){return this}if(k.type(F)==="string"&&k.powerTip[F]){return k.powerTip[F].call(this,this,N)}var O=k.extend({},k.fn.powerTip.defaults,F),G=new x(O);h();this.each(function M(){var R=k(this),Q=R.data(y),P=R.data(o),T=R.data(l),S;if(R.data(n)){k.powerTip.destroy(R)}S=R.attr("title");if(!Q&&!T&&!P&&S){R.data(y,S);R.data(g,S);R.removeAttr("title")}R.data(n,new t(R,O,G))});if(!O.manual){this.on({"mouseenter.powertip":function J(P){k.powerTip.show(this,P)},"mouseleave.powertip":function L(){k.powerTip.hide(this)},"focus.powertip":function K(){k.powerTip.show(this)},"blur.powertip":function H(){k.powerTip.hide(this,true)},"keydown.powertip":function I(P){if(P.keyCode===27){k.powerTip.hide(this,true)}}})}return this};k.fn.powerTip.defaults={fadeInTime:200,fadeOutTime:100,followMouse:false,popupId:"powerTip",intentSensitivity:7,intentPollInterval:100,closeDelay:100,placement:"n",smartPlacement:false,offset:10,mouseOnToPopup:false,manual:false};k.fn.powerTip.smartPlacementLists={n:["n","ne","nw","s"],e:["e","ne","se","w","nw","sw","n","s","e"],s:["s","se","sw","n"],w:["w","nw","sw","e","ne","se","n","s","w"],nw:["nw","w","sw","n","s","se","nw"],ne:["ne","e","se","n","s","sw","ne"],sw:["sw","w","nw","s","n","ne","sw"],se:["se","e","ne","s","n","nw","se"],"nw-alt":["nw-alt","n","ne-alt","sw-alt","s","se-alt","w","e"],"ne-alt":["ne-alt","n","nw-alt","se-alt","s","sw-alt","e","w"],"sw-alt":["sw-alt","s","se-alt","nw-alt","n","ne-alt","w","e"],"se-alt":["se-alt","s","sw-alt","ne-alt","n","nw-alt","e","w"]};k.powerTip={show:function z(F,G){if(G){i(G);c.previousX=G.pageX;c.previousY=G.pageY;k(F).data(n).show()}else{k(F).first().data(n).show(true,true)}return F},reposition:function r(F){k(F).first().data(n).resetPosition();return F},hide:function D(G,F){if(G){k(G).first().data(n).hide(F)}else{if(c.activeHover){c.activeHover.data(n).hide(true)}}return G},destroy:function C(G){k(G).off(".powertip").each(function F(){var I=k(this),H=[g,n,e,d];if(I.data(g)){I.attr("title",I.data(g));H.push(y)}I.removeData(H)});return G}};k.powerTip.showTip=k.powerTip.show;k.powerTip.closeTip=k.powerTip.hide;function b(){var F=this;F.top="auto";F.left="auto";F.right="auto";F.bottom="auto";F.set=function(H,G){if(k.isNumeric(G)){F[H]=Math.round(G)}}}function t(K,N,F){var J=null;function L(P,Q){M();if(!K.data(e)){if(!P){c.tipOpenImminent=true;J=setTimeout(function O(){J=null;I()},N.intentPollInterval)}else{if(Q){K.data(d,true)}F.showTip(K)}}}function G(P){M();c.tipOpenImminent=false;if(K.data(e)){K.data(d,false);if(!P){c.delayInProgress=true;J=setTimeout(function O(){J=null;F.hideTip(K);c.delayInProgress=false},N.closeDelay)}else{F.hideTip(K)}}}function I(){var Q=Math.abs(c.previousX-c.currentX),O=Math.abs(c.previousY-c.currentY),P=Q+O;if(P<N.intentSensitivity){F.showTip(K)}else{c.previousX=c.currentX;c.previousY=c.currentY;L()}}function M(){J=clearTimeout(J);c.delayInProgress=false}function H(){F.resetPosition(K)}this.show=L;this.hide=G;this.cancel=M;this.resetPosition=H}function j(){function G(M,L,J,O,P){var K=L.split("-")[0],N=new b(),I;if(q(M)){I=H(M,K)}else{I=F(M,K)}switch(L){case"n":N.set("left",I.left-(J/2));N.set("bottom",c.windowHeight-I.top+P);break;case"e":N.set("left",I.left+P);N.set("top",I.top-(O/2));break;case"s":N.set("left",I.left-(J/2));N.set("top",I.top+P);break;case"w":N.set("top",I.top-(O/2));N.set("right",c.windowWidth-I.left+P);break;case"nw":N.set("bottom",c.windowHeight-I.top+P);N.set("right",c.windowWidth-I.left-20);break;case"nw-alt":N.set("left",I.left);N.set("bottom",c.windowHeight-I.top+P);break;case"ne":N.set("left",I.left-20);N.set("bottom",c.windowHeight-I.top+P);break;case"ne-alt":N.set("bottom",c.windowHeight-I.top+P);N.set("right",c.windowWidth-I.left);break;case"sw":N.set("top",I.top+P);N.set("right",c.windowWidth-I.left-20);break;case"sw-alt":N.set("left",I.left);N.set("top",I.top+P);break;case"se":N.set("left",I.left-20);N.set("top",I.top+P);break;case"se-alt":N.set("top",I.top+P);N.set("right",c.windowWidth-I.left);break}return N}function F(K,J){var O=K.offset(),N=K.outerWidth(),I=K.outerHeight(),M,L;switch(J){case"n":M=O.left+N/2;L=O.top;break;case"e":M=O.left+N;L=O.top+I/2;break;case"s":M=O.left+N/2;L=O.top+I;break;case"w":M=O.left;L=O.top+I/2;break;case"nw":M=O.left;L=O.top;break;case"ne":M=O.left+N;L=O.top;break;case"sw":M=O.left;L=O.top+I;break;case"se":M=O.left+N;L=O.top+I;break}return{top:L,left:M}}function H(O,K){var S=O.closest("svg")[0],N=O[0],W=S.createSVGPoint(),L=N.getBBox(),V=N.getScreenCTM(),M=L.width/2,Q=L.height/2,P=[],I=["nw","n","ne","e","se","s","sw","w"],U,X,R,T;function J(){P.push(W.matrixTransform(V))}W.x=L.x;W.y=L.y;J();W.x+=M;J();W.x+=M;J();W.y+=Q;J();W.y+=Q;J();W.x-=M;J();W.x-=M;J();W.y-=Q;J();if(P[0].y!==P[1].y||P[0].x!==P[7].x){X=Math.atan2(V.b,V.a)*E;R=Math.ceil(((X%360)-22.5)/45);if(R<1){R+=8}while(R--){I.push(I.shift())}}for(T=0;T<P.length;T++){if(I[T]===K){U=P[T];break}}return{top:U.y+c.scrollTop,left:U.x+c.scrollLeft}}this.compute=G}function x(Q){var P=new j(),O=k("#"+Q.popupId);if(O.length===0){O=k("<div/>",{id:Q.popupId});if(w.length===0){w=k("body")}w.append(O)}if(Q.followMouse){if(!O.data(u)){A.on("mousemove",M);s.on("scroll",M);O.data(u,true)}}if(Q.mouseOnToPopup){O.on({mouseenter:function L(){if(O.data(f)){if(c.activeHover){c.activeHover.data(n).cancel()}}},mouseleave:function N(){if(c.activeHover){c.activeHover.data(n).hide()}}})}function I(S){S.data(e,true);O.queue(function R(T){H(S);T()})}function H(S){var U;if(!S.data(e)){return}if(c.isTipOpen){if(!c.isClosing){K(c.activeHover)}O.delay(100).queue(function R(V){H(S);V()});return}S.trigger("powerTipPreRender");U=B(S);if(U){O.empty().append(U)}else{return}S.trigger("powerTipRender");c.activeHover=S;c.isTipOpen=true;O.data(f,Q.mouseOnToPopup);if(!Q.followMouse){G(S);c.isFixedTipOpen=true}else{M()}O.fadeIn(Q.fadeInTime,function T(){if(!c.desyncTimeout){c.desyncTimeout=setInterval(J,500)}S.trigger("powerTipOpen")})}function K(R){c.isClosing=true;c.activeHover=null;c.isTipOpen=false;c.desyncTimeout=clearInterval(c.desyncTimeout);R.data(e,false);R.data(d,false);O.fadeOut(Q.fadeOutTime,function S(){var T=new b();c.isClosing=false;c.isFixedTipOpen=false;O.removeClass();T.set("top",c.currentY+Q.offset);T.set("left",c.currentX+Q.offset);O.css(T);R.trigger("powerTipClose")})}function M(){if(!c.isFixedTipOpen&&(c.isTipOpen||(c.tipOpenImminent&&O.data(u)))){var R=O.outerWidth(),V=O.outerHeight(),U=new b(),S,T;U.set("top",c.currentY+Q.offset);U.set("left",c.currentX+Q.offset);S=m(U,R,V);if(S!==p.none){T=a(S);if(T===1){if(S===p.right){U.set("left",c.windowWidth-R)}else{if(S===p.bottom){U.set("top",c.scrollTop+c.windowHeight-V)}}}else{U.set("left",c.currentX-R-Q.offset);U.set("top",c.currentY-V-Q.offset)}}O.css(U)}}function G(S){var R,T;if(Q.smartPlacement){R=k.fn.powerTip.smartPlacementLists[Q.placement];k.each(R,function(U,W){var V=m(F(S,W),O.outerWidth(),O.outerHeight());T=W;if(V===p.none){return false}})}else{F(S,Q.placement);T=Q.placement}O.addClass(T)}function F(U,T){var R=0,S,W,V=new b();V.set("top",0);V.set("left",0);O.css(V);do{S=O.outerWidth();W=O.outerHeight();V=P.compute(U,T,S,W,Q.offset);O.css(V)}while(++R<=5&&(S!==O.outerWidth()||W!==O.outerHeight()));return V}function J(){var R=false;if(c.isTipOpen&&!c.isClosing&&!c.delayInProgress){if(c.activeHover.data(e)===false||c.activeHover.is(":disabled")){R=true}else{if(!v(c.activeHover)&&!c.activeHover.is(":focus")&&!c.activeHover.data(d)){if(O.data(f)){if(!v(O)){R=true}}else{R=true}}}if(R){K(c.activeHover)}}}this.showTip=I;this.hideTip=K;this.resetPosition=G}function q(F){return window.SVGElement&&F[0] instanceof SVGElement}function h(){if(!c.mouseTrackingActive){c.mouseTrackingActive=true;k(function H(){c.scrollLeft=s.scrollLeft();c.scrollTop=s.scrollTop();c.windowWidth=s.width();c.windowHeight=s.height()});A.on("mousemove",i);s.on({resize:function G(){c.windowWidth=s.width();c.windowHeight=s.height()},scroll:function F(){var I=s.scrollLeft(),J=s.scrollTop();if(I!==c.scrollLeft){c.currentX+=I-c.scrollLeft;c.scrollLeft=I}if(J!==c.scrollTop){c.currentY+=J-c.scrollTop;c.scrollTop=J}}})}}function i(F){c.currentX=F.pageX;c.currentY=F.pageY}function v(F){var H=F.offset(),J=F[0].getBoundingClientRect(),I=J.right-J.left,G=J.bottom-J.top;return c.currentX>=H.left&&c.currentX<=H.left+I&&c.currentY>=H.top&&c.currentY<=H.top+G}function B(I){var G=I.data(y),F=I.data(o),K=I.data(l),H,J;if(G){if(k.isFunction(G)){G=G.call(I[0])}J=G}else{if(F){if(k.isFunction(F)){F=F.call(I[0])}if(F.length>0){J=F.clone(true,true)}}else{if(K){H=k("#"+K);if(H.length>0){J=H.html()}}}}return J}function m(M,L,K){var G=c.scrollTop,J=c.scrollLeft,I=G+c.windowHeight,F=J+c.windowWidth,H=p.none;if(M.top<G||Math.abs(M.bottom-c.windowHeight)-K<G){H|=p.top}if(M.top+K>I||Math.abs(M.bottom-c.windowHeight)>I){H|=p.bottom}if(M.left<J||M.right+L>F){H|=p.left}if(M.left+L>F||M.right<J){H|=p.right}return H}function a(G){var F=0;while(G){G&=G-1;F++}return F}}));/*!
+ * jQuery UI Touch Punch 0.2.3
+ *
+ * Copyright 2011–2014, Dave Furfero
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ */
+(function(b){b.support.touch="ontouchend" in document;if(!b.support.touch){return}var d=b.ui.mouse.prototype,f=d._mouseInit,c=d._mouseDestroy,a;function e(h,i){if(h.originalEvent.touches.length>1){return}h.preventDefault();var j=h.originalEvent.changedTouches[0],g=document.createEvent("MouseEvents");g.initMouseEvent(i,true,true,window,1,j.screenX,j.screenY,j.clientX,j.clientY,false,false,false,false,0,null);h.target.dispatchEvent(g)}d._touchStart=function(h){var g=this;if(a||!g._mouseCapture(h.originalEvent.changedTouches[0])){return}a=true;g._touchMoved=false;e(h,"mouseover");e(h,"mousemove");e(h,"mousedown")};d._touchMove=function(g){if(!a){return}this._touchMoved=true;e(g,"mousemove")};d._touchEnd=function(g){if(!a){return}e(g,"mouseup");e(g,"mouseout");if(!this._touchMoved){e(g,"click")}a=false};d._mouseInit=function(){var g=this;g.element.bind({touchstart:b.proxy(g,"_touchStart"),touchmove:b.proxy(g,"_touchMove"),touchend:b.proxy(g,"_touchEnd")});f.call(g)};d._mouseDestroy=function(){var g=this;g.element.unbind({touchstart:b.proxy(g,"_touchStart"),touchmove:b.proxy(g,"_touchMove"),touchend:b.proxy(g,"_touchEnd")});c.call(g)}})(jQuery);/*!
+ * SmartMenus jQuery Plugin - v1.0.0 - January 27, 2016
+ * http://www.smartmenus.org/
+ *
+ * Copyright Vasil Dinkov, Vadikom Web Ltd.
+ * http://vadikom.com
+ *
+ * Licensed MIT
+ */
+(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{if(typeof module==="object"&&typeof module.exports==="object"){module.exports=a(require("jquery"))}else{a(jQuery)}}}(function(a){var b=[],e=!!window.createPopup,f=false,d="ontouchstart" in window,h=false,g=window.requestAnimationFrame||function(l){return setTimeout(l,1000/60)},c=window.cancelAnimationFrame||function(l){clearTimeout(l)};function k(m){var n=".smartmenus_mouse";if(!h&&!m){var o=true,l=null;a(document).bind(i([["mousemove",function(s){var t={x:s.pageX,y:s.pageY,timeStamp:new Date().getTime()};if(l){var q=Math.abs(l.x-t.x),p=Math.abs(l.y-t.y);if((q>0||p>0)&&q<=2&&p<=2&&t.timeStamp-l.timeStamp<=300){f=true;if(o){var r=a(s.target).closest("a");if(r.is("a")){a.each(b,function(){if(a.contains(this.$root[0],r[0])){this.itemEnter({currentTarget:r[0]});return false}})}o=false}}}l=t}],[d?"touchstart":"pointerover pointermove pointerout MSPointerOver MSPointerMove MSPointerOut",function(p){if(j(p.originalEvent)){f=false}}]],n));h=true}else{if(h&&m){a(document).unbind(n);h=false}}}function j(l){return !/^(4|mouse)$/.test(l.pointerType)}function i(l,n){if(!n){n=""}var m={};a.each(l,function(o,p){m[p[0].split(" ").join(n+" ")+n]=p[1]});return m}a.SmartMenus=function(m,l){this.$root=a(m);this.opts=l;this.rootId="";this.accessIdPrefix="";this.$subArrow=null;this.activatedItems=[];this.visibleSubMenus=[];this.showTimeout=0;this.hideTimeout=0;this.scrollTimeout=0;this.clickActivated=false;this.focusActivated=false;this.zIndexInc=0;this.idInc=0;this.$firstLink=null;this.$firstSub=null;this.disabled=false;this.$disableOverlay=null;this.$touchScrollingSub=null;this.cssTransforms3d="perspective" in m.style||"webkitPerspective" in m.style;this.wasCollapsible=false;this.init()};a.extend(a.SmartMenus,{hideAll:function(){a.each(b,function(){this.menuHideAll()})},destroy:function(){while(b.length){b[0].destroy()}k(true)},prototype:{init:function(n){var l=this;if(!n){b.push(this);this.rootId=(new Date().getTime()+Math.random()+"").replace(/\D/g,"");this.accessIdPrefix="sm-"+this.rootId+"-";if(this.$root.hasClass("sm-rtl")){this.opts.rightToLeftSubMenus=true}var r=".smartmenus";this.$root.data("smartmenus",this).attr("data-smartmenus-id",this.rootId).dataSM("level",1).bind(i([["mouseover focusin",a.proxy(this.rootOver,this)],["mouseout focusout",a.proxy(this.rootOut,this)],["keydown",a.proxy(this.rootKeyDown,this)]],r)).delegate("a",i([["mouseenter",a.proxy(this.itemEnter,this)],["mouseleave",a.proxy(this.itemLeave,this)],["mousedown",a.proxy(this.itemDown,this)],["focus",a.proxy(this.itemFocus,this)],["blur",a.proxy(this.itemBlur,this)],["click",a.proxy(this.itemClick,this)]],r));r+=this.rootId;if(this.opts.hideOnClick){a(document).bind(i([["touchstart",a.proxy(this.docTouchStart,this)],["touchmove",a.proxy(this.docTouchMove,this)],["touchend",a.proxy(this.docTouchEnd,this)],["click",a.proxy(this.docClick,this)]],r))}a(window).bind(i([["resize orientationchange",a.proxy(this.winResize,this)]],r));if(this.opts.subIndicators){this.$subArrow=a("<span/>").addClass("sub-arrow");if(this.opts.subIndicatorsText){this.$subArrow.html(this.opts.subIndicatorsText)}}k()}this.$firstSub=this.$root.find("ul").each(function(){l.menuInit(a(this))}).eq(0);this.$firstLink=this.$root.find("a").eq(0);if(this.opts.markCurrentItem){var p=/(index|default)\.[^#\?\/]*/i,m=/#.*/,q=window.location.href.replace(p,""),o=q.replace(m,"");this.$root.find("a").each(function(){var s=this.href.replace(p,""),t=a(this);if(s==q||s==o){t.addClass("current");if(l.opts.markCurrentTree){t.parentsUntil("[data-smartmenus-id]","ul").each(function(){a(this).dataSM("parent-a").addClass("current")})}}})}this.wasCollapsible=this.isCollapsible()},destroy:function(m){if(!m){var n=".smartmenus";this.$root.removeData("smartmenus").removeAttr("data-smartmenus-id").removeDataSM("level").unbind(n).undelegate(n);n+=this.rootId;a(document).unbind(n);a(window).unbind(n);if(this.opts.subIndicators){this.$subArrow=null}}this.menuHideAll();var l=this;this.$root.find("ul").each(function(){var o=a(this);if(o.dataSM("scroll-arrows")){o.dataSM("scroll-arrows").remove()}if(o.dataSM("shown-before")){if(l.opts.subMenusMinWidth||l.opts.subMenusMaxWidth){o.css({width:"",minWidth:"",maxWidth:""}).removeClass("sm-nowrap")}if(o.dataSM("scroll-arrows")){o.dataSM("scroll-arrows").remove()}o.css({zIndex:"",top:"",left:"",marginLeft:"",marginTop:"",display:""})}if((o.attr("id")||"").indexOf(l.accessIdPrefix)==0){o.removeAttr("id")}}).removeDataSM("in-mega").removeDataSM("shown-before").removeDataSM("ie-shim").removeDataSM("scroll-arrows").removeDataSM("parent-a").removeDataSM("level").removeDataSM("beforefirstshowfired").removeAttr("role").removeAttr("aria-hidden").removeAttr("aria-labelledby").removeAttr("aria-expanded");this.$root.find("a.has-submenu").each(function(){var o=a(this);if(o.attr("id").indexOf(l.accessIdPrefix)==0){o.removeAttr("id")}}).removeClass("has-submenu").removeDataSM("sub").removeAttr("aria-haspopup").removeAttr("aria-controls").removeAttr("aria-expanded").closest("li").removeDataSM("sub");if(this.opts.subIndicators){this.$root.find("span.sub-arrow").remove()}if(this.opts.markCurrentItem){this.$root.find("a.current").removeClass("current")}if(!m){this.$root=null;this.$firstLink=null;this.$firstSub=null;if(this.$disableOverlay){this.$disableOverlay.remove();this.$disableOverlay=null}b.splice(a.inArray(this,b),1)}},disable:function(l){if(!this.disabled){this.menuHideAll();if(!l&&!this.opts.isPopup&&this.$root.is(":visible")){var m=this.$root.offset();this.$disableOverlay=a('<div class="sm-jquery-disable-overlay"/>').css({position:"absolute",top:m.top,left:m.left,width:this.$root.outerWidth(),height:this.$root.outerHeight(),zIndex:this.getStartZIndex(true),opacity:0}).appendTo(document.body)}this.disabled=true}},docClick:function(l){if(this.$touchScrollingSub){this.$touchScrollingSub=null;return}if(this.visibleSubMenus.length&&!a.contains(this.$root[0],l.target)||a(l.target).is("a")){this.menuHideAll()}},docTouchEnd:function(m){if(!this.lastTouch){return}if(this.visibleSubMenus.length&&(this.lastTouch.x2===undefined||this.lastTouch.x1==this.lastTouch.x2)&&(this.lastTouch.y2===undefined||this.lastTouch.y1==this.lastTouch.y2)&&(!this.lastTouch.target||!a.contains(this.$root[0],this.lastTouch.target))){if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}var l=this;this.hideTimeout=setTimeout(function(){l.menuHideAll()},350)}this.lastTouch=null},docTouchMove:function(m){if(!this.lastTouch){return}var l=m.originalEvent.touches[0];this.lastTouch.x2=l.pageX;this.lastTouch.y2=l.pageY},docTouchStart:function(m){var l=m.originalEvent.touches[0];this.lastTouch={x1:l.pageX,y1:l.pageY,target:l.target}},enable:function(){if(this.disabled){if(this.$disableOverlay){this.$disableOverlay.remove();this.$disableOverlay=null}this.disabled=false}},getClosestMenu:function(m){var l=a(m).closest("ul");while(l.dataSM("in-mega")){l=l.parent().closest("ul")}return l[0]||null},getHeight:function(l){return this.getOffset(l,true)},getOffset:function(n,l){var m;if(n.css("display")=="none"){m={position:n[0].style.position,visibility:n[0].style.visibility};n.css({position:"absolute",visibility:"hidden"}).show()}var o=n[0].getBoundingClientRect&&n[0].getBoundingClientRect(),p=o&&(l?o.height||o.bottom-o.top:o.width||o.right-o.left);if(!p&&p!==0){p=l?n[0].offsetHeight:n[0].offsetWidth}if(m){n.hide().css(m)}return p},getStartZIndex:function(l){var m=parseInt(this[l?"$root":"$firstSub"].css("z-index"));if(!l&&isNaN(m)){m=parseInt(this.$root.css("z-index"))}return !isNaN(m)?m:1},getTouchPoint:function(l){return l.touches&&l.touches[0]||l.changedTouches&&l.changedTouches[0]||l},getViewport:function(l){var m=l?"Height":"Width",o=document.documentElement["client"+m],n=window["inner"+m];if(n){o=Math.min(o,n)}return o},getViewportHeight:function(){return this.getViewport(true)},getViewportWidth:function(){return this.getViewport()},getWidth:function(l){return this.getOffset(l)},handleEvents:function(){return !this.disabled&&this.isCSSOn()},handleItemEvents:function(l){return this.handleEvents()&&!this.isLinkInMegaMenu(l)},isCollapsible:function(){return this.$firstSub.css("position")=="static"},isCSSOn:function(){return this.$firstLink.css("display")=="block"},isFixed:function(){var l=this.$root.css("position")=="fixed";if(!l){this.$root.parentsUntil("body").each(function(){if(a(this).css("position")=="fixed"){l=true;return false}})}return l},isLinkInMegaMenu:function(l){return a(this.getClosestMenu(l[0])).hasClass("mega-menu")},isTouchMode:function(){return !f||this.opts.noMouseOver||this.isCollapsible()},itemActivate:function(p,l){var n=p.closest("ul"),q=n.dataSM("level");if(q>1&&(!this.activatedItems[q-2]||this.activatedItems[q-2][0]!=n.dataSM("parent-a")[0])){var m=this;a(n.parentsUntil("[data-smartmenus-id]","ul").get().reverse()).add(n).each(function(){m.itemActivate(a(this).dataSM("parent-a"))})}if(!this.isCollapsible()||l){this.menuHideSubMenus(!this.activatedItems[q-1]||this.activatedItems[q-1][0]!=p[0]?q-1:q)}this.activatedItems[q-1]=p;if(this.$root.triggerHandler("activate.smapi",p[0])===false){return}var o=p.dataSM("sub");if(o&&(this.isTouchMode()||(!this.opts.showOnClick||this.clickActivated))){this.menuShow(o)}},itemBlur:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}this.$root.triggerHandler("blur.smapi",l[0])},itemClick:function(o){var n=a(o.currentTarget);if(!this.handleItemEvents(n)){return}if(this.$touchScrollingSub&&this.$touchScrollingSub[0]==n.closest("ul")[0]){this.$touchScrollingSub=null;o.stopPropagation();return false}if(this.$root.triggerHandler("click.smapi",n[0])===false){return false}var p=a(o.target).is("span.sub-arrow"),m=n.dataSM("sub"),l=m?m.dataSM("level")==2:false;if(m&&!m.is(":visible")){if(this.opts.showOnClick&&l){this.clickActivated=true}this.itemActivate(n);if(m.is(":visible")){this.focusActivated=true;return false}}else{if(this.isCollapsible()&&p){this.itemActivate(n);this.menuHide(m);return false}}if(this.opts.showOnClick&&l||n.hasClass("disabled")||this.$root.triggerHandler("select.smapi",n[0])===false){return false}},itemDown:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}l.dataSM("mousedown",true)},itemEnter:function(n){var m=a(n.currentTarget);if(!this.handleItemEvents(m)){return}if(!this.isTouchMode()){if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}var l=this;this.showTimeout=setTimeout(function(){l.itemActivate(m)},this.opts.showOnClick&&m.closest("ul").dataSM("level")==1?1:this.opts.showTimeout)}this.$root.triggerHandler("mouseenter.smapi",m[0])},itemFocus:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}if(this.focusActivated&&(!this.isTouchMode()||!l.dataSM("mousedown"))&&(!this.activatedItems.length||this.activatedItems[this.activatedItems.length-1][0]!=l[0])){this.itemActivate(l,true)}this.$root.triggerHandler("focus.smapi",l[0])},itemLeave:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}if(!this.isTouchMode()){l[0].blur();if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}}l.removeDataSM("mousedown");this.$root.triggerHandler("mouseleave.smapi",l[0])},menuHide:function(m){if(this.$root.triggerHandler("beforehide.smapi",m[0])===false){return}m.stop(true,true);if(m.css("display")!="none"){var l=function(){m.css("z-index","")};if(this.isCollapsible()){if(this.opts.collapsibleHideFunction){this.opts.collapsibleHideFunction.call(this,m,l)}else{m.hide(this.opts.collapsibleHideDuration,l)}}else{if(this.opts.hideFunction){this.opts.hideFunction.call(this,m,l)}else{m.hide(this.opts.hideDuration,l)}}if(m.dataSM("ie-shim")){m.dataSM("ie-shim").remove().css({"-webkit-transform":"",transform:""})}if(m.dataSM("scroll")){this.menuScrollStop(m);m.css({"touch-action":"","-ms-touch-action":"","-webkit-transform":"",transform:""}).unbind(".smartmenus_scroll").removeDataSM("scroll").dataSM("scroll-arrows").hide()}m.dataSM("parent-a").removeClass("highlighted").attr("aria-expanded","false");m.attr({"aria-expanded":"false","aria-hidden":"true"});var n=m.dataSM("level");this.activatedItems.splice(n-1,1);this.visibleSubMenus.splice(a.inArray(m,this.visibleSubMenus),1);this.$root.triggerHandler("hide.smapi",m[0])}},menuHideAll:function(){if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}var m=this.opts.isPopup?1:0;for(var l=this.visibleSubMenus.length-1;l>=m;l--){this.menuHide(this.visibleSubMenus[l])}if(this.opts.isPopup){this.$root.stop(true,true);if(this.$root.is(":visible")){if(this.opts.hideFunction){this.opts.hideFunction.call(this,this.$root)}else{this.$root.hide(this.opts.hideDuration)}if(this.$root.dataSM("ie-shim")){this.$root.dataSM("ie-shim").remove()}}}this.activatedItems=[];this.visibleSubMenus=[];this.clickActivated=false;this.focusActivated=false;this.zIndexInc=0;this.$root.triggerHandler("hideAll.smapi")},menuHideSubMenus:function(n){for(var l=this.activatedItems.length-1;l>=n;l--){var m=this.activatedItems[l].dataSM("sub");if(m){this.menuHide(m)}}},menuIframeShim:function(l){if(e&&this.opts.overlapControlsInIE&&!l.dataSM("ie-shim")){l.dataSM("ie-shim",a("<iframe/>").attr({src:"javascript:0",tabindex:-9}).css({position:"absolute",top:"auto",left:"0",opacity:0,border:"0"}))}},menuInit:function(l){if(!l.dataSM("in-mega")){if(l.hasClass("mega-menu")){l.find("ul").dataSM("in-mega",true)}var q=2,m=l[0];while((m=m.parentNode.parentNode)!=this.$root[0]){q++}var n=l.prevAll("a").eq(-1);if(!n.length){n=l.prevAll().find("a").eq(-1)}n.addClass("has-submenu").dataSM("sub",l);l.dataSM("parent-a",n).dataSM("level",q).parent().dataSM("sub",l);var o=n.attr("id")||this.accessIdPrefix+(++this.idInc),p=l.attr("id")||this.accessIdPrefix+(++this.idInc);n.attr({id:o,"aria-haspopup":"true","aria-controls":p,"aria-expanded":"false"});l.attr({id:p,role:"group","aria-hidden":"true","aria-labelledby":o,"aria-expanded":"false"});if(this.opts.subIndicators){n[this.opts.subIndicatorsPos](this.$subArrow.clone())}}},menuPosition:function(K){var r=K.dataSM("parent-a"),D=r.closest("li"),E=D.parent(),l=K.dataSM("level"),t=this.getWidth(K),J=this.getHeight(K),u=r.offset(),o=u.left,m=u.top,q=this.getWidth(r),F=this.getHeight(r),H=a(window),v=H.scrollLeft(),s=H.scrollTop(),z=this.getViewportWidth(),L=this.getViewportHeight(),w=E.parent().is("[data-sm-horizontal-sub]")||l==2&&!E.hasClass("sm-vertical"),B=this.opts.rightToLeftSubMenus&&!D.is("[data-sm-reverse]")||!this.opts.rightToLeftSubMenus&&D.is("[data-sm-reverse]"),p=l==2?this.opts.mainMenuSubOffsetX:this.opts.subMenusSubOffsetX,n=l==2?this.opts.mainMenuSubOffsetY:this.opts.subMenusSubOffsetY,C,A;if(w){C=B?q-t-p:p;A=this.opts.bottomToTopSubMenus?-J-n:F+n}else{C=B?p-t:q-p;A=this.opts.bottomToTopSubMenus?F-n-J:n}if(this.opts.keepInViewport){var N=o+C,M=m+A;if(B&&N<v){C=w?v-N+C:q-p}else{if(!B&&N+t>v+z){C=w?v+z-t-N+C:p-t}}if(!w){if(J<L&&M+J>s+L){A+=s+L-J-M}else{if(J>=L||M<s){A+=s-M}}}if(w&&(M+J>s+L+0.49||M<s)||!w&&J>L+0.49){var G=this;if(!K.dataSM("scroll-arrows")){K.dataSM("scroll-arrows",a([a('<span class="scroll-up"><span class="scroll-up-arrow"></span></span>')[0],a('<span class="scroll-down"><span class="scroll-down-arrow"></span></span>')[0]]).bind({mouseenter:function(){K.dataSM("scroll").up=a(this).hasClass("scroll-up");G.menuScroll(K)},mouseleave:function(x){G.menuScrollStop(K);G.menuScrollOut(K,x)},"mousewheel DOMMouseScroll":function(x){x.preventDefault()}}).insertAfter(K))}var I=".smartmenus_scroll";K.dataSM("scroll",{y:this.cssTransforms3d?0:A-F,step:1,itemH:F,subH:J,arrowDownH:this.getHeight(K.dataSM("scroll-arrows").eq(1))}).bind(i([["mouseover",function(x){G.menuScrollOver(K,x)}],["mouseout",function(x){G.menuScrollOut(K,x)}],["mousewheel DOMMouseScroll",function(x){G.menuScrollMousewheel(K,x)}]],I)).dataSM("scroll-arrows").css({top:"auto",left:"0",marginLeft:C+(parseInt(K.css("border-left-width"))||0),width:t-(parseInt(K.css("border-left-width"))||0)-(parseInt(K.css("border-right-width"))||0),zIndex:K.css("z-index")}).eq(w&&this.opts.bottomToTopSubMenus?0:1).show();if(this.isFixed()){K.css({"touch-action":"none","-ms-touch-action":"none"}).bind(i([[d?"touchstart touchmove touchend":"pointerdown pointermove pointerup MSPointerDown MSPointerMove MSPointerUp",function(x){G.menuScrollTouch(K,x)}]],I))}}}K.css({top:"auto",left:"0",marginLeft:C,marginTop:A-F});this.menuIframeShim(K);if(K.dataSM("ie-shim")){K.dataSM("ie-shim").css({zIndex:K.css("z-index"),width:t,height:J,marginLeft:C,marginTop:A-F})}},menuScroll:function(r,m,n){var p=r.dataSM("scroll"),q=r.dataSM("scroll-arrows"),o=p.up?p.upEnd:p.downEnd,s;if(!m&&p.momentum){p.momentum*=0.92;s=p.momentum;if(s<0.5){this.menuScrollStop(r);return}}else{s=n||(m||!this.opts.scrollAccelerate?this.opts.scrollStep:Math.floor(p.step))}var l=r.dataSM("level");if(this.activatedItems[l-1]&&this.activatedItems[l-1].dataSM("sub")&&this.activatedItems[l-1].dataSM("sub").is(":visible")){this.menuHideSubMenus(l-1)}p.y=p.up&&o<=p.y||!p.up&&o>=p.y?p.y:(Math.abs(o-p.y)>s?p.y+(p.up?s:-s):o);r.add(r.dataSM("ie-shim")).css(this.cssTransforms3d?{"-webkit-transform":"translate3d(0, "+p.y+"px, 0)",transform:"translate3d(0, "+p.y+"px, 0)"}:{marginTop:p.y});if(f&&(p.up&&p.y>p.downEnd||!p.up&&p.y<p.upEnd)){q.eq(p.up?1:0).show()}if(p.y==o){if(f){q.eq(p.up?0:1).hide()}this.menuScrollStop(r)}else{if(!m){if(this.opts.scrollAccelerate&&p.step<this.opts.scrollStep){p.step+=0.2}var t=this;this.scrollTimeout=g(function(){t.menuScroll(r)})}}},menuScrollMousewheel:function(m,n){if(this.getClosestMenu(n.target)==m[0]){n=n.originalEvent;var l=(n.wheelDelta||-n.detail)>0;if(m.dataSM("scroll-arrows").eq(l?0:1).is(":visible")){m.dataSM("scroll").up=l;this.menuScroll(m,true)}}n.preventDefault()},menuScrollOut:function(l,m){if(f){if(!/^scroll-(up|down)/.test((m.relatedTarget||"").className)&&(l[0]!=m.relatedTarget&&!a.contains(l[0],m.relatedTarget)||this.getClosestMenu(m.relatedTarget)!=l[0])){l.dataSM("scroll-arrows").css("visibility","hidden")}}},menuScrollOver:function(n,o){if(f){if(!/^scroll-(up|down)/.test(o.target.className)&&this.getClosestMenu(o.target)==n[0]){this.menuScrollRefreshData(n);var m=n.dataSM("scroll"),l=a(window).scrollTop()-n.dataSM("parent-a").offset().top-m.itemH;n.dataSM("scroll-arrows").eq(0).css("margin-top",l).end().eq(1).css("margin-top",l+this.getViewportHeight()-m.arrowDownH).end().css("visibility","visible")}}},menuScrollRefreshData:function(n){var m=n.dataSM("scroll"),l=a(window).scrollTop()-n.dataSM("parent-a").offset().top-m.itemH;if(this.cssTransforms3d){l=-(parseFloat(n.css("margin-top"))-l)}a.extend(m,{upEnd:l,downEnd:l+this.getViewportHeight()-m.subH})},menuScrollStop:function(l){if(this.scrollTimeout){c(this.scrollTimeout);this.scrollTimeout=0;l.dataSM("scroll").step=1;return true}},menuScrollTouch:function(p,q){q=q.originalEvent;if(j(q)){var m=this.getTouchPoint(q);if(this.getClosestMenu(m.target)==p[0]){var o=p.dataSM("scroll");if(/(start|down)$/i.test(q.type)){if(this.menuScrollStop(p)){q.preventDefault();this.$touchScrollingSub=p}else{this.$touchScrollingSub=null}this.menuScrollRefreshData(p);a.extend(o,{touchStartY:m.pageY,touchStartTime:q.timeStamp})}else{if(/move$/i.test(q.type)){var n=o.touchY!==undefined?o.touchY:o.touchStartY;if(n!==undefined&&n!=m.pageY){this.$touchScrollingSub=p;var l=n<m.pageY;if(o.up!==undefined&&o.up!=l){a.extend(o,{touchStartY:m.pageY,touchStartTime:q.timeStamp})}a.extend(o,{up:l,touchY:m.pageY});this.menuScroll(p,true,Math.abs(m.pageY-n))}q.preventDefault()}else{if(o.touchY!==undefined){if(o.momentum=Math.pow(Math.abs(m.pageY-o.touchStartY)/(q.timeStamp-o.touchStartTime),2)*15){this.menuScrollStop(p);this.menuScroll(p);q.preventDefault()}delete o.touchY}}}}}},menuShow:function(n){if(!n.dataSM("beforefirstshowfired")){n.dataSM("beforefirstshowfired",true);if(this.$root.triggerHandler("beforefirstshow.smapi",n[0])===false){return}}if(this.$root.triggerHandler("beforeshow.smapi",n[0])===false){return}n.dataSM("shown-before",true).stop(true,true);if(!n.is(":visible")){var m=n.dataSM("parent-a");if(this.opts.keepHighlighted||this.isCollapsible()){m.addClass("highlighted")}if(this.isCollapsible()){n.removeClass("sm-nowrap").css({zIndex:"",width:"auto",minWidth:"",maxWidth:"",top:"",left:"",marginLeft:"",marginTop:""})}else{n.css("z-index",this.zIndexInc=(this.zIndexInc||this.getStartZIndex())+1);if(this.opts.subMenusMinWidth||this.opts.subMenusMaxWidth){n.css({width:"auto",minWidth:"",maxWidth:""}).addClass("sm-nowrap");if(this.opts.subMenusMinWidth){n.css("min-width",this.opts.subMenusMinWidth)}if(this.opts.subMenusMaxWidth){var o=this.getWidth(n);n.css("max-width",this.opts.subMenusMaxWidth);if(o>this.getWidth(n)){n.removeClass("sm-nowrap").css("width",this.opts.subMenusMaxWidth)}}}this.menuPosition(n);if(n.dataSM("ie-shim")){n.dataSM("ie-shim").insertBefore(n)}}var l=function(){n.css("overflow","")};if(this.isCollapsible()){if(this.opts.collapsibleShowFunction){this.opts.collapsibleShowFunction.call(this,n,l)}else{n.show(this.opts.collapsibleShowDuration,l)}}else{if(this.opts.showFunction){this.opts.showFunction.call(this,n,l)}else{n.show(this.opts.showDuration,l)}}m.attr("aria-expanded","true");n.attr({"aria-expanded":"true","aria-hidden":"false"});this.visibleSubMenus.push(n);this.$root.triggerHandler("show.smapi",n[0])}},popupHide:function(l){if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}var m=this;this.hideTimeout=setTimeout(function(){m.menuHideAll()},l?1:this.opts.hideTimeout)},popupShow:function(o,n){if(!this.opts.isPopup){alert('SmartMenus jQuery Error:\n\nIf you want to show this menu via the "popupShow" method, set the isPopup:true option.');return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}this.$root.dataSM("shown-before",true).stop(true,true);if(!this.$root.is(":visible")){this.$root.css({left:o,top:n});this.menuIframeShim(this.$root);if(this.$root.dataSM("ie-shim")){this.$root.dataSM("ie-shim").css({zIndex:this.$root.css("z-index"),width:this.getWidth(this.$root),height:this.getHeight(this.$root),left:o,top:n}).insertBefore(this.$root)}var m=this,l=function(){m.$root.css("overflow","")};if(this.opts.showFunction){this.opts.showFunction.call(this,this.$root,l)}else{this.$root.show(this.opts.showDuration,l)}this.visibleSubMenus[0]=this.$root}},refresh:function(){this.destroy(true);this.init(true)},rootKeyDown:function(o){if(!this.handleEvents()){return}switch(o.keyCode){case 27:var m=this.activatedItems[0];if(m){this.menuHideAll();m[0].focus();var n=m.dataSM("sub");if(n){this.menuHide(n)}}break;case 32:var l=a(o.target);if(l.is("a")&&this.handleItemEvents(l)){var n=l.dataSM("sub");if(n&&!n.is(":visible")){this.itemClick({currentTarget:o.target});o.preventDefault()}}break}},rootOut:function(m){if(!this.handleEvents()||this.isTouchMode()||m.target==this.$root[0]){return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}if(!this.opts.showOnClick||!this.opts.hideOnClick){var l=this;this.hideTimeout=setTimeout(function(){l.menuHideAll()},this.opts.hideTimeout)}},rootOver:function(l){if(!this.handleEvents()||this.isTouchMode()||l.target==this.$root[0]){return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}},winResize:function(m){if(!this.handleEvents()){if(this.$disableOverlay){var n=this.$root.offset();this.$disableOverlay.css({top:n.top,left:n.left,width:this.$root.outerWidth(),height:this.$root.outerHeight()})}return}if(!("onorientationchange" in window)||m.type=="orientationchange"){var l=this.isCollapsible();if(!(this.wasCollapsible&&l)){if(this.activatedItems.length){this.activatedItems[this.activatedItems.length-1][0].blur()}this.menuHideAll()}this.wasCollapsible=l}}}});a.fn.dataSM=function(l,m){if(m){return this.data(l+"_smartmenus",m)}return this.data(l+"_smartmenus")};a.fn.removeDataSM=function(l){return this.removeData(l+"_smartmenus")};a.fn.smartmenus=function(m){if(typeof m=="string"){var l=arguments,o=m;Array.prototype.shift.call(l);return this.each(function(){var p=a(this).data("smartmenus");if(p&&p[o]){p[o].apply(p,l)}})}var n=a.extend({},a.fn.smartmenus.defaults,m);return this.each(function(){new a.SmartMenus(this,n)})};a.fn.smartmenus.defaults={isPopup:false,mainMenuSubOffsetX:0,mainMenuSubOffsetY:0,subMenusSubOffsetX:0,subMenusSubOffsetY:0,subMenusMinWidth:"10em",subMenusMaxWidth:"20em",subIndicators:true,subIndicatorsPos:"prepend",subIndicatorsText:"+",scrollStep:30,scrollAccelerate:true,showTimeout:250,hideTimeout:500,showDuration:0,showFunction:null,hideDuration:0,hideFunction:function(m,l){m.fadeOut(200,l)},collapsibleShowDuration:0,collapsibleShowFunction:function(m,l){m.slideDown(200,l)},collapsibleHideDuration:0,collapsibleHideFunction:function(m,l){m.slideUp(200,l)},showOnClick:false,hideOnClick:true,noMouseOver:false,keepInViewport:true,keepHighlighted:true,markCurrentItem:false,markCurrentTree:true,rightToLeftSubMenus:false,bottomToTopSubMenus:false,overlapControlsInIE:true};return a})); \ No newline at end of file
diff --git a/doc/doxyout/base/html/menu.js b/doc/doxyout/base/html/menu.js
new file mode 100644
index 000000000000..97db4c239227
--- /dev/null
+++ b/doc/doxyout/base/html/menu.js
@@ -0,0 +1,26 @@
+function initMenu(relPath,searchEnabled,serverSide,searchPage,search) {
+ function makeTree(data,relPath) {
+ var result='';
+ if ('children' in data) {
+ result+='<ul>';
+ for (var i in data.children) {
+ result+='<li><a href="'+relPath+data.children[i].url+'">'+
+ data.children[i].text+'</a>'+
+ makeTree(data.children[i],relPath)+'</li>';
+ }
+ result+='</ul>';
+ }
+ return result;
+ }
+ $('#main-nav').append(makeTree(menudata,relPath));
+ $('#main-nav').children(':first').addClass('sm sm-dox').attr('id','main-menu');
+ if (searchEnabled) {
+ if (serverSide) {
+ $('#main-menu').append('<li style="float:right"><div id="MSearchBox" class="MSearchBoxInactive"><div class="left"><form id="FSearchBox" action="'+searchPage+'" method="get"><img id="MSearchSelect" src="'+relPath+'search/mag.png" alt=""/><input type="text" id="MSearchField" name="query" value="'+search+'" size="20" accesskey="S" onfocus="searchBox.OnSearchFieldFocus(true)" onblur="searchBox.OnSearchFieldFocus(false)"></form></div><div class="right"></div></div></li>');
+ } else {
+ $('#main-menu').append('<li style="float:right"><div id="MSearchBox" class="MSearchBoxInactive"><span class="left"><img id="MSearchSelect" src="'+relPath+'search/mag_sel.png" onmouseover="return searchBox.OnSearchSelectShow()" onmouseout="return searchBox.OnSearchSelectHide()" alt=""/><input type="text" id="MSearchField" value="'+search+'" accesskey="S" onfocus="searchBox.OnSearchFieldFocus(true)" onblur="searchBox.OnSearchFieldFocus(false)" onkeyup="searchBox.OnSearchFieldChange(event)"/></span><span class="right"><a id="MSearchClose" href="javascript:searchBox.CloseResultsWindow()"><img id="MSearchCloseImg" border="0" src="'+relPath+'search/close.png" alt=""/></a></span></div></li>');
+ }
+ }
+ $('#main-menu').smartmenus();
diff --git a/doc/doxyout/base/html/menudata.js b/doc/doxyout/base/html/menudata.js
new file mode 100644
index 000000000000..6c0b11fc14d4
--- /dev/null
+++ b/doc/doxyout/base/html/menudata.js
@@ -0,0 +1,3 @@
+var menudata={children:[
+{text:"Main Page",url:"index.html"},
diff --git a/doc/doxyout/base/html/modules.html b/doc/doxyout/base/html/modules.html
new file mode 100644
index 000000000000..b144695e1cf6
--- /dev/null
+++ b/doc/doxyout/base/html/modules.html
@@ -0,0 +1,35 @@
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN">
+<html><head><meta http-equiv="Content-Type" content="text/html;charset=UTF-8">
+<link href="doxygen.css" rel="stylesheet" type="text/css">
+<link href="tabs.css" rel="stylesheet" type="text/css">
+<a href="http://www.h5l.org/"><img src="http://www.h5l.org/keyhole-heimdal.png" alt="keyhole logo"/></a>
+<!-- end of header marker -->
+<!-- Generated by Doxygen 1.8.13 -->
+<script type="text/javascript" src="menudata.js"></script>
+<script type="text/javascript" src="menu.js"></script>
+<script type="text/javascript">
+$(function() {
+ initMenu('',false,false,'search.php','Search');
+<div id="main-nav"></div>
+</div><!-- top -->
+<div class="header">
+ <div class="headertitle">
+<div class="title">Modules</div> </div>
+<div class="contents">
+<div class="textblock">Here is a list of all modules:</div><div class="directory">
+<table class="directory">
+<tr id="row_0_" class="even"><td class="entry"><span style="width:16px;display:inline-block;">&#160;</span><a class="el" href="group__heimbase.html" target="_self">Heimbase</a></td><td class="desc">Registers a DB type for use with heim_db_create() </td></tr>
+</div><!-- directory -->
+</div><!-- contents -->
+<hr size="1"><address style="text-align: right;"><small>
+Generated on Fri Dec 8 2017 03:48:57 for Heimdalbaselibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.8.13</small></address>
diff --git a/doc/doxyout/base/html/nav_f.png b/doc/doxyout/base/html/nav_f.png
new file mode 100644
index 000000000000..72a58a529ed3
--- /dev/null
+++ b/doc/doxyout/base/html/nav_f.png
Binary files differ
diff --git a/doc/doxyout/base/html/nav_g.png b/doc/doxyout/base/html/nav_g.png
new file mode 100644
index 000000000000..2093a237a94f
--- /dev/null
+++ b/doc/doxyout/base/html/nav_g.png
Binary files differ
diff --git a/doc/doxyout/base/html/nav_h.png b/doc/doxyout/base/html/nav_h.png
new file mode 100644
index 000000000000..33389b101d9c
--- /dev/null
+++ b/doc/doxyout/base/html/nav_h.png
Binary files differ
diff --git a/doc/doxyout/base/html/open.png b/doc/doxyout/base/html/open.png
new file mode 100644
index 000000000000..30f75c7efe2d
--- /dev/null
+++ b/doc/doxyout/base/html/open.png
Binary files differ
diff --git a/doc/doxyout/base/html/splitbar.png b/doc/doxyout/base/html/splitbar.png
new file mode 100644
index 000000000000..fe895f2c5817
--- /dev/null
+++ b/doc/doxyout/base/html/splitbar.png
Binary files differ
diff --git a/doc/doxyout/base/html/sync_off.png b/doc/doxyout/base/html/sync_off.png
new file mode 100644
index 000000000000..3b443fc62892
--- /dev/null
+++ b/doc/doxyout/base/html/sync_off.png
Binary files differ
diff --git a/doc/doxyout/base/html/sync_on.png b/doc/doxyout/base/html/sync_on.png
new file mode 100644
index 000000000000..e08320fb64e6
--- /dev/null
+++ b/doc/doxyout/base/html/sync_on.png
Binary files differ
diff --git a/doc/doxyout/base/html/tab_a.png b/doc/doxyout/base/html/tab_a.png
new file mode 100644
index 000000000000..3b725c41c5a5
--- /dev/null
+++ b/doc/doxyout/base/html/tab_a.png
Binary files differ
diff --git a/doc/doxyout/base/html/tab_b.png b/doc/doxyout/base/html/tab_b.png
new file mode 100644
index 000000000000..e2b4a8638cb3
--- /dev/null
+++ b/doc/doxyout/base/html/tab_b.png
Binary files differ
diff --git a/doc/doxyout/base/html/tab_h.png b/doc/doxyout/base/html/tab_h.png
new file mode 100644
index 000000000000..fd5cb705488e
--- /dev/null
+++ b/doc/doxyout/base/html/tab_h.png
Binary files differ
diff --git a/doc/doxyout/base/html/tab_s.png b/doc/doxyout/base/html/tab_s.png
new file mode 100644
index 000000000000..ab478c95b673
--- /dev/null
+++ b/doc/doxyout/base/html/tab_s.png
Binary files differ
diff --git a/doc/doxyout/base/html/tabs.css b/doc/doxyout/base/html/tabs.css
new file mode 100644
index 000000000000..a28614b8e3d0
--- /dev/null
+++ b/doc/doxyout/base/html/tabs.css
@@ -0,0 +1 @@
+.sm{position:relative;z-index:9999}.sm,.sm ul,.sm li{display:block;list-style:none;margin:0;padding:0;line-height:normal;direction:ltr;text-align:left;-webkit-tap-highlight-color:rgba(0,0,0,0)}.sm-rtl,.sm-rtl ul,.sm-rtl li{direction:rtl;text-align:right}.sm>li>h1,.sm>li>h2,.sm>li>h3,.sm>li>h4,.sm>li>h5,.sm>li>h6{margin:0;padding:0}.sm ul{display:none}.sm li,.sm a{position:relative}.sm a{display:block}.sm a.disabled{cursor:not-allowed}.sm:after{content:"\00a0";display:block;height:0;font:0/0 serif;clear:both;visibility:hidden;overflow:hidden}.sm,.sm *,.sm *:before,.sm *:after{-moz-box-sizing:border-box;-webkit-box-sizing:border-box;box-sizing:border-box}#doc-content{overflow:auto;display:block;padding:0;margin:0;-webkit-overflow-scrolling:touch}.sm-dox{background-image:url("tab_b.png")}.sm-dox a,.sm-dox a:focus,.sm-dox a:hover,.sm-dox a:active{padding:0 12px;padding-right:43px;font-family:"Lucida Grande","Geneva","Helvetica",Arial,sans-serif;font-size:13px;font-weight:bold;line-height:36px;text-decoration:none;text-shadow:0 1px 1px rgba(255,255,255,0.9);color:#283a5d;outline:0}.sm-dox a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox a.current{color:#d23600}.sm-dox a.disabled{color:#bbb}.sm-dox a span.sub-arrow{position:absolute;top:50%;margin-top:-14px;left:auto;right:3px;width:28px;height:28px;overflow:hidden;font:bold 12px/28px monospace!important;text-align:center;text-shadow:none;background:rgba(255,255,255,0.5);-moz-border-radius:5px;-webkit-border-radius:5px;border-radius:5px}.sm-dox a.highlighted span.sub-arrow:before{display:block;content:'-'}.sm-dox>li:first-child>a,.sm-dox>li:first-child>:not(ul) a{-moz-border-radius:5px 5px 0 0;-webkit-border-radius:5px;border-radius:5px 5px 0 0}.sm-dox>li:last-child>a,.sm-dox>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul{-moz-border-radius:0 0 5px 5px;-webkit-border-radius:0;border-radius:0 0 5px 5px}.sm-dox>li:last-child>a.highlighted,.sm-dox>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>a.highlighted,.sm-dox>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>ul>li:last-child>*:not(ul) a.highlighted{-moz-border-radius:0;-webkit-border-radius:0;border-radius:0}.sm-dox ul{background:rgba(162,162,162,0.1)}.sm-dox ul a,.sm-dox ul a:focus,.sm-dox ul a:hover,.sm-dox ul a:active{font-size:12px;border-left:8px solid transparent;line-height:36px;text-shadow:none;background-color:white;background-image:none}.sm-dox ul a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox ul ul a,.sm-dox ul ul a:hover,.sm-dox ul ul a:focus,.sm-dox ul ul a:active{border-left:16px solid transparent}.sm-dox ul ul ul a,.sm-dox ul ul ul a:hover,.sm-dox ul ul ul a:focus,.sm-dox ul ul ul a:active{border-left:24px solid transparent}.sm-dox ul ul ul ul a,.sm-dox ul ul ul ul a:hover,.sm-dox ul ul ul ul a:focus,.sm-dox ul ul ul ul a:active{border-left:32px solid transparent}.sm-dox ul ul ul ul ul a,.sm-dox ul ul ul ul ul a:hover,.sm-dox ul ul ul ul ul a:focus,.sm-dox ul ul ul ul ul a:active{border-left:40px solid transparent}@media(min-width:768px){.sm-dox ul{position:absolute;width:12em}.sm-dox li{float:left}.sm-dox.sm-rtl li{float:right}.sm-dox ul li,.sm-dox.sm-rtl ul li,.sm-dox.sm-vertical li{float:none}.sm-dox a{white-space:nowrap}.sm-dox ul a,.sm-dox.sm-vertical a{white-space:normal}.sm-dox .sm-nowrap>li>a,.sm-dox .sm-nowrap>li>:not(ul) a{white-space:nowrap}.sm-dox{padding:0 10px;background-image:url("tab_b.png");line-height:36px}.sm-dox a span.sub-arrow{top:50%;margin-top:-2px;right:12px;width:0;height:0;border-width:4px;border-style:solid dashed dashed dashed;border-color:#283a5d transparent transparent transparent;background:transparent;-moz-border-radius:0;-webkit-border-radius:0;border-radius:0}.sm-dox a,.sm-dox a:focus,.sm-dox a:active,.sm-dox a:hover,.sm-dox a.highlighted{padding:0 12px;background-image:url("tab_s.png");background-repeat:no-repeat;background-position:right;-moz-border-radius:0!important;-webkit-border-radius:0;border-radius:0!important}.sm-dox a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox a:hover span.sub-arrow{border-color:white transparent transparent transparent}.sm-dox a.has-submenu{padding-right:24px}.sm-dox li{border-top:0}.sm-dox>li>ul:before,.sm-dox>li>ul:after{content:'';position:absolute;top:-18px;left:30px;width:0;height:0;overflow:hidden;border-width:9px;border-style:dashed dashed solid dashed;border-color:transparent transparent #bbb transparent}.sm-dox>li>ul:after{top:-16px;left:31px;border-width:8px;border-color:transparent transparent #fff transparent}.sm-dox ul{border:1px solid #bbb;padding:5px 0;background:#fff;-moz-border-radius:5px!important;-webkit-border-radius:5px;border-radius:5px!important;-moz-box-shadow:0 5px 9px rgba(0,0,0,0.2);-webkit-box-shadow:0 5px 9px rgba(0,0,0,0.2);box-shadow:0 5px 9px rgba(0,0,0,0.2)}.sm-dox ul a span.sub-arrow{right:8px;top:50%;margin-top:-5px;border-width:5px;border-color:transparent transparent transparent #555;border-style:dashed dashed dashed solid}.sm-dox ul a,.sm-dox ul a:hover,.sm-dox ul a:focus,.sm-dox ul a:active,.sm-dox ul a.highlighted{color:#555;background-image:none;border:0!important;color:#555;background-image:none}.sm-dox ul a:hover{background-image:url("tab_a.png");background-repeat:repeat-x;color:white;text-shadow:0 1px 1px black}.sm-dox ul a:hover span.sub-arrow{border-color:transparent transparent transparent white}.sm-dox span.scroll-up,.sm-dox span.scroll-down{position:absolute;display:none;visibility:hidden;overflow:hidden;background:#fff;height:36px}.sm-dox span.scroll-up:hover,.sm-dox span.scroll-down:hover{background:#eee}.sm-dox span.scroll-up:hover span.scroll-up-arrow,.sm-dox span.scroll-up:hover span.scroll-down-arrow{border-color:transparent transparent #d23600 transparent}.sm-dox span.scroll-down:hover span.scroll-down-arrow{border-color:#d23600 transparent transparent transparent}.sm-dox span.scroll-up-arrow,.sm-dox span.scroll-down-arrow{position:absolute;top:0;left:50%;margin-left:-6px;width:0;height:0;overflow:hidden;border-width:6px;border-style:dashed dashed solid dashed;border-color:transparent transparent #555 transparent}.sm-dox span.scroll-down-arrow{top:8px;border-style:solid dashed dashed dashed;border-color:#555 transparent transparent transparent}.sm-dox.sm-rtl a.has-submenu{padding-right:12px;padding-left:24px}.sm-dox.sm-rtl a span.sub-arrow{right:auto;left:12px}.sm-dox.sm-rtl.sm-vertical a.has-submenu{padding:10px 20px}.sm-dox.sm-rtl.sm-vertical a span.sub-arrow{right:auto;left:8px;border-style:dashed solid dashed dashed;border-color:transparent #555 transparent transparent}.sm-dox.sm-rtl>li>ul:before{left:auto;right:30px}.sm-dox.sm-rtl>li>ul:after{left:auto;right:31px}.sm-dox.sm-rtl ul a.has-submenu{padding:10px 20px!important}.sm-dox.sm-rtl ul a span.sub-arrow{right:auto;left:8px;border-style:dashed solid dashed dashed;border-color:transparent #555 transparent transparent}.sm-dox.sm-vertical{padding:10px 0;-moz-border-radius:5px;-webkit-border-radius:5px;border-radius:5px}.sm-dox.sm-vertical a{padding:10px 20px}.sm-dox.sm-vertical a:hover,.sm-dox.sm-vertical a:focus,.sm-dox.sm-vertical a:active,.sm-dox.sm-vertical a.highlighted{background:#fff}.sm-dox.sm-vertical a.disabled{background-image:url("tab_b.png")}.sm-dox.sm-vertical a span.sub-arrow{right:8px;top:50%;margin-top:-5px;border-width:5px;border-style:dashed dashed dashed solid;border-color:transparent transparent transparent #555}.sm-dox.sm-vertical>li>ul:before,.sm-dox.sm-vertical>li>ul:after{display:none}.sm-dox.sm-vertical ul a{padding:10px 20px}.sm-dox.sm-vertical ul a:hover,.sm-dox.sm-vertical ul a:focus,.sm-dox.sm-vertical ul a:active,.sm-dox.sm-vertical ul a.highlighted{background:#eee}.sm-dox.sm-vertical ul a.disabled{background:#fff}} \ No newline at end of file
diff --git a/doc/doxyout/base/man/man3/heimbase.3 b/doc/doxyout/base/man/man3/heimbase.3
new file mode 100644
index 000000000000..ebb63a535b68
--- /dev/null
+++ b/doc/doxyout/base/man/man3/heimbase.3
@@ -0,0 +1,330 @@
+.TH "heimbase" 3 "Fri Dec 8 2017" "Version 7.5.0" "Heimdalbaselibrary" \" -*- nroff -*-
+.ad l
+heimbase \- Registers a DB type for use with heim_db_create()\&.
+.SH "Detailed Description"
+Registers a DB type for use with heim_db_create()\&.
+.RS 4
+\fIdbtype\fP Name of DB type
+\fIdata\fP Private data argument to the dbtype's openf method
+\fIplugin\fP Structure with DB type methods (function pointers)
+Backends that provide begin/commit/rollback methods must provide ACID semantics\&.
+The registered DB type will have ACID semantics for backends that do not provide begin/commit/rollback methods but do provide lock/unlock and rdjournal/wrjournal methods (using a replay log journalling scheme)\&.
+If the registered DB type does not natively provide read vs\&. write transaction isolation but does provide a lock method then the DB will provide read/write transaction isolation\&.
+.RS 4
+ENOMEM on failure, else 0\&.
+Open a database of the given dbtype\&.
+Database type names can be composed of one or more pseudo-DB types and one concrete DB type joined with a '+' between each\&. For example: 'transaction+bdb' might be a Berkeley DB with a layer above that provides transactions\&.
+Options may be provided via a dict (an associative array)\&. Existing options include:
+.IP "\(bu" 2
+'create', with any value (create if DB doesn't exist)
+.IP "\(bu" 2
+'exclusive', with any value (exclusive create)
+.IP "\(bu" 2
+'truncate', with any value (truncate the DB)
+.IP "\(bu" 2
+'read-only', with any value (disallow writes)
+.IP "\(bu" 2
+'sync', with any value (make transactions durable)
+.IP "\(bu" 2
+'journal-name', with a string value naming a journal file name
+.RS 4
+\fIdbtype\fP Name of DB type
+\fIdbname\fP Name of DB (likely a file path)
+\fIoptions\fP Options dict
+\fIdb\fP Output open DB handle
+\fIerror\fP Output error object
+.RS 4
+a DB handle
+Clone (duplicate) an open DB handle\&.
+This is useful for multi-threaded applications\&. Applications must synchronize access to any given DB handle\&.
+Returns EBUSY if there is an open transaction for the input db\&.
+.RS 4
+\fIdb\fP Open DB handle
+\fIerror\fP Output error object
+.RS 4
+a DB handle
+Open a transaction on the given db\&.
+.RS 4
+\fIdb\fP Open DB handle
+\fIerror\fP Output error object
+.RS 4
+0 on success, system error otherwise
+Commit an open transaction on the given db\&.
+.RS 4
+\fIdb\fP Open DB handle
+\fIerror\fP Output error object
+.RS 4
+0 on success, system error otherwise
+Rollback an open transaction on the given db\&.
+.RS 4
+\fIdb\fP Open DB handle
+\fIerror\fP Output error object
+.RS 4
+0 on success, system error otherwise
+Get type ID of heim_db_t objects\&.
+Lookup a key's value in the DB\&.
+Returns 0 on success, -1 if the key does not exist in the DB, or a system error number on failure\&.
+.RS 4
+\fIdb\fP Open DB handle
+\fIkey\fP Key
+\fIerror\fP Output error object
+.RS 4
+the value (retained), if there is one for the given key
+Set a key's value in the DB\&.
+.RS 4
+\fIdb\fP Open DB handle
+\fIkey\fP Key
+\fIvalue\fP Value (if NULL the key will be deleted, but empty is OK)
+\fIerror\fP Output error object
+.RS 4
+0 on success, system error otherwise
+Delete a key and its value from the DB
+.RS 4
+\fIdb\fP Open DB handle
+\fIkey\fP Key
+\fIerror\fP Output error object
+.RS 4
+0 on success, system error otherwise
+Iterate a callback function over keys and values from a DB\&.
+.RS 4
+\fIdb\fP Open DB handle
+\fIiter_data\fP Callback function's private data
+\fIiter_f\fP Callback function, called once per-key/value pair
+\fIerror\fP Output error object
+Get a node in a heim_object tree by path
+.RS 4
+\fIptr\fP tree
+\fIerror\fP error (output)
+\fIap\fP NULL-terminated va_list of heim_object_ts that form a path
+.RS 4
+object (not retained) if found
+Get a node in a tree by path, with retained reference
+.RS 4
+\fIptr\fP tree
+\fIerror\fP error (output)
+\fIap\fP NULL-terminated va_list of heim_object_ts that form a path
+.RS 4
+retained object if found
+Get a node in a tree by path
+.RS 4
+\fIptr\fP tree
+\fIerror\fP error (output)
+\fI\&.\&.\&.\fP NULL-terminated va_list of heim_object_ts that form a path
+.RS 4
+object (not retained) if found
+Get a node in a tree by path, with retained reference
+.RS 4
+\fIptr\fP tree
+\fIerror\fP error (output)
+\fI\&.\&.\&.\fP NULL-terminated va_list of heim_object_ts that form a path
+.RS 4
+retained object if found
+Create a path in a heim_object_t tree
+.RS 4
+\fIptr\fP the tree
+\fIsize\fP the size of the heim_dict_t nodes to be created
+\fIleaf\fP leaf node to be added, if any
+\fIerror\fP error (output)
+\fIap\fP NULL-terminated of path component objects
+Create a path of heim_dict_t interior nodes in a given heim_object_t tree, as necessary, and set/replace a leaf, if given (if leaf is NULL then the leaf is not deleted)\&.
+.RS 4
+0 on success, else a system error
+Create a path in a heim_object_t tree
+.RS 4
+\fIptr\fP the tree
+\fIsize\fP the size of the heim_dict_t nodes to be created
+\fIleaf\fP leaf node to be added, if any
+\fIerror\fP error (output)
+\fI\&.\&.\&.\fP NULL-terminated list of path component objects
+Create a path of heim_dict_t interior nodes in a given heim_object_t tree, as necessary, and set/replace a leaf, if given (if leaf is NULL then the leaf is not deleted)\&.
+.RS 4
+0 on success, else a system error
+Delete leaf node named by a path in a heim_object_t tree
+.RS 4
+\fIptr\fP the tree
+\fIerror\fP error (output)
+\fIap\fP NULL-terminated list of path component objects
+Dump a heimbase object to stderr (useful from the debugger!)
+.RS 4
+\fIobj\fP object to dump using JSON or JSON-like format
+.SH "Author"
+Generated automatically by Doxygen for Heimdalbaselibrary from the source code\&.
diff --git a/doc/doxyout/base/manpages b/doc/doxyout/base/manpages
new file mode 100644
index 000000000000..5bd73788d05f
--- /dev/null
+++ b/doc/doxyout/base/manpages
@@ -0,0 +1 @@
diff --git a/doc/doxyout/gssapi/html/bc_s.png b/doc/doxyout/gssapi/html/bc_s.png
new file mode 100644
index 000000000000..224b29aa9847
--- /dev/null
+++ b/doc/doxyout/gssapi/html/bc_s.png
Binary files differ
diff --git a/doc/doxyout/gssapi/html/bdwn.png b/doc/doxyout/gssapi/html/bdwn.png
new file mode 100644
index 000000000000..940a0b950443
--- /dev/null
+++ b/doc/doxyout/gssapi/html/bdwn.png
Binary files differ
diff --git a/doc/doxyout/gssapi/html/closed.png b/doc/doxyout/gssapi/html/closed.png
new file mode 100644
index 000000000000..98cc2c909da3
--- /dev/null
+++ b/doc/doxyout/gssapi/html/closed.png
Binary files differ
diff --git a/doc/doxyout/gssapi/html/doc.png b/doc/doxyout/gssapi/html/doc.png
new file mode 100644
index 000000000000..17edabff95f7
--- /dev/null
+++ b/doc/doxyout/gssapi/html/doc.png
Binary files differ
diff --git a/doc/doxyout/gssapi/html/doxygen.css b/doc/doxyout/gssapi/html/doxygen.css
index 22c484301dd1..4f1ab9195b44 100644
--- a/doc/doxyout/gssapi/html/doxygen.css
+++ b/doc/doxyout/gssapi/html/doxygen.css
@@ -1,473 +1,1596 @@
- font-family: Geneva, Arial, Helvetica, sans-serif;
+/* The standard CSS for doxygen 1.8.13 */
+body, table, div, p, dl {
+ font: 400 14px/22px Roboto,sans-serif;
- font-size: 90%;
+p.reference, p.definition {
+ font: 400 14px/22px Roboto,sans-serif;
-H1 {
- text-align: center;
- font-size: 160%;
+/* @group Heading Levels */
+h1.groupheader {
+ font-size: 150%;
-H2 {
- font-size: 120%;
+.title {
+ font: 400 14px/28px Roboto,sans-serif;
+ font-size: 150%;
+ font-weight: bold;
+ margin: 10px 2px;
-H3 {
+h2.groupheader {
+ border-bottom: 1px solid #879ECB;
+ color: #354C7B;
+ font-size: 150%;
+ font-weight: normal;
+ margin-top: 1.75em;
+ padding-top: 8px;
+ padding-bottom: 4px;
+ width: 100%;
+h3.groupheader {
font-size: 100%;
- font-weight: bold
+h1, h2, h3, h4, h5, h6 {
+ -webkit-transition: text-shadow 0.5s linear;
+ -moz-transition: text-shadow 0.5s linear;
+ -ms-transition: text-shadow 0.5s linear;
+ -o-transition: text-shadow 0.5s linear;
+ transition: text-shadow 0.5s linear;
+ margin-right: 15px;
-DIV.qindex {
- width: 100%;
- background-color: #e8eef2;
- border: 1px solid #84b0c7;
+h1.glow, h2.glow, h3.glow, h4.glow, h5.glow, h6.glow {
+ text-shadow: 0 0 15px cyan;
+dt {
+ font-weight: bold;
+div.multicol {
+ -moz-column-gap: 1em;
+ -webkit-column-gap: 1em;
+ -moz-column-count: 3;
+ -webkit-column-count: 3;
+p.startli, p.startdd {
+ margin-top: 2px;
+p.starttd {
+ margin-top: 0px;
+p.endli {
+ margin-bottom: 0px;
+p.enddd {
+ margin-bottom: 4px;
+p.endtd {
+ margin-bottom: 2px;
+/* @end */
+caption {
+ font-weight: bold;
+span.legend {
+ font-size: 70%;
+ text-align: center;
+h3.version {
+ font-size: 90%;
+ text-align: center;
+div.qindex, div.navtab{
+ background-color: #EBEFF6;
+ border: 1px solid #A3B4D7;
text-align: center;
- margin: 2px;
- padding: 2px;
- line-height: 140%;
-DIV.navpath {
+div.qindex, div.navpath {
width: 100%;
- background-color: #e8eef2;
- border: 1px solid #84b0c7;
- text-align: center;
- margin: 2px;
- padding: 2px;
line-height: 140%;
-DIV.navtab {
- background-color: #e8eef2;
- border: 1px solid #84b0c7;
- text-align: center;
- margin: 2px;
- margin-right: 15px;
- padding: 2px;
+div.navtab {
+ margin-right: 15px;
-TD.navtab {
- font-size: 70%;
+/* @group Link Styling */
+a {
+ color: #3D578C;
+ font-weight: normal;
+ text-decoration: none;
-A.qindex {
- text-decoration: none;
- font-weight: bold;
- color: #1A419D;
+.contents a:visited {
+ color: #4665A2;
-A.qindex:visited {
- text-decoration: none;
- font-weight: bold;
- color: #1A419D
+a:hover {
+ text-decoration: underline;
-A.qindex:hover {
- text-decoration: none;
- background-color: #ddddff;
+a.qindex {
+ font-weight: bold;
-A.qindexHL {
- text-decoration: none;
+a.qindexHL {
font-weight: bold;
- background-color: #6666cc;
+ background-color: #9CAFD4;
color: #ffffff;
- border: 1px double #9295C2;
+ border: 1px double #869DCA;
-A.qindexHL:hover {
- text-decoration: none;
- background-color: #6666cc;
- color: #ffffff;
+.contents a.qindexHL:visited {
+ color: #ffffff;
-A.qindexHL:visited {
- text-decoration: none;
- background-color: #6666cc;
- color: #ffffff
+a.el {
+ font-weight: bold;
-A.el {
- text-decoration: none;
- font-weight: bold
+a.elRef {
-A.elRef {
- font-weight: bold
+a.code, a.code:visited, a.line, a.line:visited {
+ color: #4665A2;
-A.code:link {
- text-decoration: none;
- font-weight: normal;
- color: #0000FF
+a.codeRef, a.codeRef:visited, a.lineRef, a.lineRef:visited {
+ color: #4665A2;
-A.code:visited {
- text-decoration: none;
- font-weight: normal;
- color: #0000FF
+/* @end */
+dl.el {
+ margin-left: -1cm;
-A.codeRef:link {
- font-weight: normal;
- color: #0000FF
+pre.fragment {
+ border: 1px solid #C4CFE5;
+ background-color: #FBFCFD;
+ padding: 4px 6px;
+ margin: 4px 8px 4px 2px;
+ overflow: auto;
+ word-wrap: break-word;
+ font-size: 9pt;
+ line-height: 125%;
+ font-family: monospace, fixed;
+ font-size: 105%;
-A.codeRef:visited {
- font-weight: normal;
- color: #0000FF
+div.fragment {
+ padding: 0px;
+ margin: 4px 8px 4px 2px;
+ background-color: #FBFCFD;
+ border: 1px solid #C4CFE5;
-A:hover {
- text-decoration: none;
- background-color: #f2f2ff
+div.line {
+ font-family: monospace, fixed;
+ font-size: 13px;
+ min-height: 13px;
+ line-height: 1.0;
+ text-wrap: unrestricted;
+ white-space: -moz-pre-wrap; /* Moz */
+ white-space: -pre-wrap; /* Opera 4-6 */
+ white-space: -o-pre-wrap; /* Opera 7 */
+ white-space: pre-wrap; /* CSS3 */
+ word-wrap: break-word; /* IE 5.5+ */
+ text-indent: -53px;
+ padding-left: 53px;
+ padding-bottom: 0px;
+ margin: 0px;
+ -webkit-transition-property: background-color, box-shadow;
+ -webkit-transition-duration: 0.5s;
+ -moz-transition-property: background-color, box-shadow;
+ -moz-transition-duration: 0.5s;
+ -ms-transition-property: background-color, box-shadow;
+ -ms-transition-duration: 0.5s;
+ -o-transition-property: background-color, box-shadow;
+ -o-transition-duration: 0.5s;
+ transition-property: background-color, box-shadow;
+ transition-duration: 0.5s;
-DL.el {
- margin-left: -1cm
+div.line:after {
+ content:"\000A";
+ white-space: pre;
-.fragment {
- font-family: monospace, fixed;
- font-size: 95%;
+div.line.glow {
+ background-color: cyan;
+ box-shadow: 0 0 10px cyan;
-PRE.fragment {
- border: 1px solid #CCCCCC;
- background-color: #f5f5f5;
- margin-top: 4px;
- margin-bottom: 4px;
- margin-left: 2px;
- margin-right: 8px;
- padding-left: 6px;
- padding-right: 6px;
- padding-top: 4px;
- padding-bottom: 4px;
+span.lineno {
+ padding-right: 4px;
+ text-align: right;
+ border-right: 2px solid #0F0;
+ background-color: #E8E8E8;
+ white-space: pre;
-DIV.ah {
- background-color: black;
- font-weight: bold;
- color: #ffffff;
- margin-bottom: 3px;
- margin-top: 3px
+span.lineno a {
+ background-color: #D8D8D8;
-DIV.groupHeader {
- margin-left: 16px;
- margin-top: 12px;
- margin-bottom: 6px;
- font-weight: bold;
+span.lineno a:hover {
+ background-color: #C8C8C8;
-DIV.groupText {
- margin-left: 16px;
- font-style: italic;
- font-size: 90%
+.lineno {
+ -webkit-touch-callout: none;
+ -webkit-user-select: none;
+ -khtml-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
- background: white;
- color: black;
- margin-right: 20px;
- margin-left: 20px;
+div.ah, span.ah {
+ background-color: black;
+ font-weight: bold;
+ color: #ffffff;
+ margin-bottom: 3px;
+ margin-top: 3px;
+ padding: 0.2em;
+ border: solid thin #333;
+ border-radius: 0.5em;
+ -webkit-border-radius: .5em;
+ -moz-border-radius: .5em;
+ box-shadow: 2px 2px 3px #999;
+ -webkit-box-shadow: 2px 2px 3px #999;
+ -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px;
+ background-image: -webkit-gradient(linear, left top, left bottom, from(#eee), to(#000),color-stop(0.3, #444));
+ background-image: -moz-linear-gradient(center top, #eee 0%, #444 40%, #000 110%);
-TD.indexkey {
- background-color: #e8eef2;
+div.classindex ul {
+ list-style: none;
+ padding-left: 0;
+div.classindex span.ai {
+ display: inline-block;
+div.groupHeader {
+ margin-left: 16px;
+ margin-top: 12px;
font-weight: bold;
- padding-right : 10px;
- padding-top : 2px;
- padding-left : 10px;
- padding-bottom : 2px;
- margin-left : 0px;
- margin-right : 0px;
- margin-top : 2px;
- margin-bottom : 2px;
- border: 1px solid #CCCCCC;
-TD.indexvalue {
- background-color: #e8eef2;
- font-style: italic;
- padding-right : 10px;
- padding-top : 2px;
- padding-left : 10px;
- padding-bottom : 2px;
- margin-left : 0px;
- margin-right : 0px;
- margin-top : 2px;
- margin-bottom : 2px;
- border: 1px solid #CCCCCC;
-TR.memlist {
- background-color: #f0f0f0;
-P.formulaDsp {
- text-align: center;
-IMG.formulaDsp {
-IMG.formulaInl {
- vertical-align: middle;
-SPAN.keyword { color: #008000 }
-SPAN.keywordtype { color: #604020 }
-SPAN.keywordflow { color: #e08000 }
-SPAN.comment { color: #800000 }
-SPAN.preprocessor { color: #806020 }
-SPAN.stringliteral { color: #002080 }
-SPAN.charliteral { color: #008080 }
-SPAN.vhdldigit { color: #ff00ff }
-SPAN.vhdlchar { color: #000000 }
-SPAN.vhdlkeyword { color: #700070 }
-SPAN.vhdllogic { color: #ff0000 }
-.mdescLeft {
- padding: 0px 8px 4px 8px;
- font-size: 80%;
- font-style: italic;
- background-color: #FAFAFA;
- border-top: 1px none #E0E0E0;
- border-right: 1px none #E0E0E0;
- border-bottom: 1px none #E0E0E0;
- border-left: 1px none #E0E0E0;
- margin: 0px;
-.mdescRight {
- padding: 0px 8px 4px 8px;
- font-size: 80%;
+div.groupText {
+ margin-left: 16px;
font-style: italic;
- background-color: #FAFAFA;
- border-top: 1px none #E0E0E0;
- border-right: 1px none #E0E0E0;
- border-bottom: 1px none #E0E0E0;
- border-left: 1px none #E0E0E0;
- margin: 0px;
-.memItemLeft {
- padding: 1px 0px 0px 8px;
- margin: 4px;
- border-top-width: 1px;
- border-right-width: 1px;
- border-bottom-width: 1px;
- border-left-width: 1px;
- border-top-color: #E0E0E0;
- border-right-color: #E0E0E0;
- border-bottom-color: #E0E0E0;
- border-left-color: #E0E0E0;
- border-top-style: solid;
- border-right-style: none;
- border-bottom-style: none;
- border-left-style: none;
- background-color: #FAFAFA;
- font-size: 80%;
+body {
+ background-color: white;
+ color: black;
+ margin: 0;
-.memItemRight {
- padding: 1px 8px 0px 8px;
- margin: 4px;
- border-top-width: 1px;
- border-right-width: 1px;
- border-bottom-width: 1px;
- border-left-width: 1px;
- border-top-color: #E0E0E0;
- border-right-color: #E0E0E0;
- border-bottom-color: #E0E0E0;
- border-left-color: #E0E0E0;
- border-top-style: solid;
- border-right-style: none;
- border-bottom-style: none;
- border-left-style: none;
- background-color: #FAFAFA;
- font-size: 80%;
+div.contents {
+ margin-top: 10px;
+ margin-left: 12px;
+ margin-right: 8px;
-.memTemplItemLeft {
- padding: 1px 0px 0px 8px;
- margin: 4px;
- border-top-width: 1px;
- border-right-width: 1px;
- border-bottom-width: 1px;
- border-left-width: 1px;
- border-top-color: #E0E0E0;
- border-right-color: #E0E0E0;
- border-bottom-color: #E0E0E0;
- border-left-color: #E0E0E0;
- border-top-style: none;
- border-right-style: none;
- border-bottom-style: none;
- border-left-style: none;
- background-color: #FAFAFA;
- font-size: 80%;
+td.indexkey {
+ background-color: #EBEFF6;
+ font-weight: bold;
+ border: 1px solid #C4CFE5;
+ margin: 2px 0px 2px 0;
+ padding: 2px 10px;
+ white-space: nowrap;
+ vertical-align: top;
-.memTemplItemRight {
- padding: 1px 8px 0px 8px;
- margin: 4px;
- border-top-width: 1px;
- border-right-width: 1px;
- border-bottom-width: 1px;
- border-left-width: 1px;
- border-top-color: #E0E0E0;
- border-right-color: #E0E0E0;
- border-bottom-color: #E0E0E0;
- border-left-color: #E0E0E0;
- border-top-style: none;
- border-right-style: none;
- border-bottom-style: none;
- border-left-style: none;
- background-color: #FAFAFA;
- font-size: 80%;
+td.indexvalue {
+ background-color: #EBEFF6;
+ border: 1px solid #C4CFE5;
+ padding: 2px 10px;
+ margin: 2px 0px;
-.memTemplParams {
- padding: 1px 0px 0px 8px;
- margin: 4px;
- border-top-width: 1px;
- border-right-width: 1px;
- border-bottom-width: 1px;
- border-left-width: 1px;
- border-top-color: #E0E0E0;
- border-right-color: #E0E0E0;
- border-bottom-color: #E0E0E0;
- border-left-color: #E0E0E0;
- border-top-style: solid;
- border-right-style: none;
- border-bottom-style: none;
- border-left-style: none;
- color: #606060;
- background-color: #FAFAFA;
- font-size: 80%;
+tr.memlist {
+ background-color: #EEF1F7;
-.search {
+p.formulaDsp {
+ text-align: center;
+img.formulaDsp {
+img.formulaInl {
+ vertical-align: middle;
+div.center {
+ text-align: center;
+ margin-top: 0px;
+ margin-bottom: 0px;
+ padding: 0px;
+div.center img {
+ border: 0px;
+address.footer {
+ text-align: right;
+ padding-right: 12px;
+img.footer {
+ border: 0px;
+ vertical-align: middle;
+/* @group Code Colorization */
+span.keyword {
+ color: #008000
+span.keywordtype {
+ color: #604020
+span.keywordflow {
+ color: #e08000
+span.comment {
+ color: #800000
+span.preprocessor {
+ color: #806020
+span.stringliteral {
+ color: #002080
+span.charliteral {
+ color: #008080
+span.vhdldigit {
+ color: #ff00ff
+span.vhdlchar {
+ color: #000000
+span.vhdlkeyword {
+ color: #700070
+span.vhdllogic {
+ color: #ff0000
+blockquote {
+ background-color: #F7F8FB;
+ border-left: 2px solid #9CAFD4;
+ margin: 0 24px 0 4px;
+ padding: 0 12px 0 16px;
+/* @end */
+.search {
color: #003399;
font-weight: bold;
-FORM.search {
+form.search {
margin-bottom: 0px;
margin-top: 0px;
-INPUT.search {
+input.search {
font-size: 75%;
color: #000080;
font-weight: normal;
background-color: #e8eef2;
-TD.tiny {
+td.tiny {
font-size: 75%;
-a {
- color: #1A41A8;
-a:visited {
- color: #2A3798;
-.dirtab {
+.dirtab {
padding: 4px;
border-collapse: collapse;
- border: 1px solid #84b0c7;
+ border: 1px solid #A3B4D7;
-TH.dirtab {
- background: #e8eef2;
+th.dirtab {
+ background: #EBEFF6;
font-weight: bold;
-HR {
+hr {
+ height: 0px;
+ border: none;
+ border-top: 1px solid #4A6AAA;
+hr.footer {
height: 1px;
+/* @group Member Descriptions */
+table.memberdecls {
+ border-spacing: 0px;
+ padding: 0px;
+.memberdecls td, .fieldtable tr {
+ -webkit-transition-property: background-color, box-shadow;
+ -webkit-transition-duration: 0.5s;
+ -moz-transition-property: background-color, box-shadow;
+ -moz-transition-duration: 0.5s;
+ -ms-transition-property: background-color, box-shadow;
+ -ms-transition-duration: 0.5s;
+ -o-transition-property: background-color, box-shadow;
+ -o-transition-duration: 0.5s;
+ transition-property: background-color, box-shadow;
+ transition-duration: 0.5s;
+.memberdecls td.glow, .fieldtable tr.glow {
+ background-color: cyan;
+ box-shadow: 0 0 15px cyan;
+.mdescLeft, .mdescRight,
+.memItemLeft, .memItemRight,
+.memTemplItemLeft, .memTemplItemRight, .memTemplParams {
+ background-color: #F9FAFC;
border: none;
- border-top: 1px solid black;
+ margin: 4px;
+ padding: 1px 0 0 8px;
+.mdescLeft, .mdescRight {
+ padding: 0px 8px 4px 8px;
+ color: #555;
+.memSeparator {
+ border-bottom: 1px solid #DEE4F0;
+ line-height: 1px;
+ margin: 0px;
+ padding: 0px;
+.memItemLeft, .memTemplItemLeft {
+ white-space: nowrap;
+.memItemRight {
+ width: 100%;
+.memTemplParams {
+ color: #4665A2;
+ white-space: nowrap;
+ font-size: 80%;
+/* @end */
+/* @group Member Details */
+/* Styles for detailed member documentation */
+.memtitle {
+ padding: 8px;
+ border-top: 1px solid #A8B8D9;
+ border-left: 1px solid #A8B8D9;
+ border-right: 1px solid #A8B8D9;
+ border-top-right-radius: 4px;
+ border-top-left-radius: 4px;
+ margin-bottom: -1px;
+ background-image: url('nav_f.png');
+ background-repeat: repeat-x;
+ background-color: #E2E8F2;
+ line-height: 1.25;
+ font-weight: 300;
+ float:left;
+ font-size: 65%;
+ display: inline-block;
+ vertical-align: middle;
-/* Style for detailed member documentation */
.memtemplate {
font-size: 80%;
- color: #606060;
+ color: #4665A2;
font-weight: normal;
- margin-left: 3px;
-.memnav {
- background-color: #e8eef2;
- border: 1px solid #84b0c7;
+ margin-left: 9px;
+.memnav {
+ background-color: #EBEFF6;
+ border: 1px solid #A3B4D7;
text-align: center;
margin: 2px;
margin-right: 15px;
padding: 2px;
+.mempage {
+ width: 100%;
.memitem {
- padding: 4px;
- background-color: #eef3f5;
- border-width: 1px;
- border-style: solid;
- border-color: #dedeee;
- -moz-border-radius: 8px 8px 8px 8px;
+ padding: 0;
+ margin-bottom: 10px;
+ margin-right: 5px;
+ -webkit-transition: box-shadow 0.5s linear;
+ -moz-transition: box-shadow 0.5s linear;
+ -ms-transition: box-shadow 0.5s linear;
+ -o-transition: box-shadow 0.5s linear;
+ transition: box-shadow 0.5s linear;
+ display: table !important;
+ width: 100%;
+.memitem.glow {
+ box-shadow: 0 0 15px cyan;
.memname {
- white-space: nowrap;
- font-weight: bold;
+ font-weight: 400;
+ margin-left: 6px;
- padding-left: 10px;
+.memname td {
+ vertical-align: bottom;
-.memproto {
- background-color: #d5e1e8;
- width: 100%;
- border-width: 1px;
- border-style: solid;
- border-color: #84b0c7;
- font-weight: bold;
- -moz-border-radius: 8px 8px 8px 8px;
+.memproto, dl.reflist dt {
+ border-top: 1px solid #A8B8D9;
+ border-left: 1px solid #A8B8D9;
+ border-right: 1px solid #A8B8D9;
+ padding: 6px 0px 6px 0px;
+ color: #253555;
+ font-weight: bold;
+ text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9);
+ background-color: #DFE5F1;
+ /* opera specific markup */
+ box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
+ border-top-right-radius: 4px;
+ /* firefox specific markup */
+ -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px;
+ -moz-border-radius-topright: 4px;
+ /* webkit specific markup */
+ -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
+ -webkit-border-top-right-radius: 4px;
+.overload {
+ font-family: "courier new",courier,monospace;
+ font-size: 65%;
+.memdoc, dl.reflist dd {
+ border-bottom: 1px solid #A8B8D9;
+ border-left: 1px solid #A8B8D9;
+ border-right: 1px solid #A8B8D9;
+ padding: 6px 10px 2px 10px;
+ background-color: #FBFCFD;
+ border-top-width: 0;
+ background-image:url('nav_g.png');
+ background-repeat:repeat-x;
+ background-color: #FFFFFF;
+ /* opera specific markup */
+ border-bottom-left-radius: 4px;
+ border-bottom-right-radius: 4px;
+ box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
+ /* firefox specific markup */
+ -moz-border-radius-bottomleft: 4px;
+ -moz-border-radius-bottomright: 4px;
+ -moz-box-shadow: rgba(0, 0, 0, 0.15) 5px 5px 5px;
+ /* webkit specific markup */
+ -webkit-border-bottom-left-radius: 4px;
+ -webkit-border-bottom-right-radius: 4px;
+ -webkit-box-shadow: 5px 5px 5px rgba(0, 0, 0, 0.15);
+dl.reflist dt {
+ padding: 5px;
+dl.reflist dd {
+ margin: 0px 0px 10px 0px;
+ padding: 5px;
.paramkey {
text-align: right;
.paramtype {
white-space: nowrap;
.paramname {
color: #602020;
- font-style: italic;
white-space: nowrap;
-/* End Styling for detailed member documentation */
+.paramname em {
+ font-style: normal;
+.paramname code {
+ line-height: 14px;
+.params, .retval, .exception, .tparams {
+ margin-left: 0px;
+ padding-left: 0px;
+.params .paramname, .retval .paramname {
+ font-weight: bold;
+ vertical-align: top;
+.params .paramtype {
+ font-style: italic;
+ vertical-align: top;
+.params .paramdir {
+ font-family: "courier new",courier,monospace;
+ vertical-align: top;
+table.mlabels {
+ border-spacing: 0px;
+td.mlabels-left {
+ width: 100%;
+ padding: 0px;
+td.mlabels-right {
+ vertical-align: bottom;
+ padding: 0px;
+ white-space: nowrap;
+span.mlabels {
+ margin-left: 8px;
+span.mlabel {
+ background-color: #728DC1;
+ border-top:1px solid #5373B4;
+ border-left:1px solid #5373B4;
+ border-right:1px solid #C4CFE5;
+ border-bottom:1px solid #C4CFE5;
+ text-shadow: none;
+ color: white;
+ margin-right: 4px;
+ padding: 2px 3px;
+ border-radius: 3px;
+ font-size: 7pt;
+ white-space: nowrap;
+ vertical-align: middle;
+/* @end */
+/* these are for tree view inside a (index) page */
+div.directory {
+ margin: 10px 0px;
+ border-top: 1px solid #9CAFD4;
+ border-bottom: 1px solid #9CAFD4;
+ width: 100%;
+.directory table {
+ border-collapse:collapse;
+.directory td {
+ margin: 0px;
+ padding: 0px;
+ vertical-align: top;
+.directory td.entry {
+ white-space: nowrap;
+ padding-right: 6px;
+ padding-top: 3px;
+.directory td.entry a {
+ outline:none;
+.directory td.entry a img {
+ border: none;
+.directory td.desc {
+ width: 100%;
+ padding-left: 6px;
+ padding-right: 6px;
+ padding-top: 3px;
+ border-left: 1px solid rgba(0,0,0,0.05);
+.directory tr.even {
+ padding-left: 6px;
+ background-color: #F7F8FB;
+.directory img {
+ vertical-align: -30%;
+.directory .levels {
+ white-space: nowrap;
+ width: 100%;
+ text-align: right;
+ font-size: 9pt;
+.directory .levels span {
+ cursor: pointer;
+ padding-left: 2px;
+ padding-right: 2px;
+ color: #3D578C;
+.arrow {
+ color: #9CAFD4;
+ -webkit-user-select: none;
+ -khtml-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+ cursor: pointer;
+ font-size: 80%;
+ display: inline-block;
+ width: 16px;
+ height: 22px;
+.icon {
+ font-family: Arial, Helvetica;
+ font-weight: bold;
+ font-size: 12px;
+ height: 14px;
+ width: 16px;
+ display: inline-block;
+ background-color: #728DC1;
+ color: white;
+ text-align: center;
+ border-radius: 4px;
+ margin-left: 2px;
+ margin-right: 2px;
+.icona {
+ width: 24px;
+ height: 22px;
+ display: inline-block;
+.iconfopen {
+ width: 24px;
+ height: 18px;
+ margin-bottom: 4px;
+ background-image:url('folderopen.png');
+ background-position: 0px -4px;
+ background-repeat: repeat-y;
+ vertical-align:top;
+ display: inline-block;
+.iconfclosed {
+ width: 24px;
+ height: 18px;
+ margin-bottom: 4px;
+ background-image:url('folderclosed.png');
+ background-position: 0px -4px;
+ background-repeat: repeat-y;
+ vertical-align:top;
+ display: inline-block;
+.icondoc {
+ width: 24px;
+ height: 18px;
+ margin-bottom: 4px;
+ background-image:url('doc.png');
+ background-position: 0px -4px;
+ background-repeat: repeat-y;
+ vertical-align:top;
+ display: inline-block;
+table.directory {
+ font: 400 14px Roboto,sans-serif;
+/* @end */
+div.dynheader {
+ margin-top: 8px;
+ -webkit-touch-callout: none;
+ -webkit-user-select: none;
+ -khtml-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+address {
+ font-style: normal;
+ color: #2A3D61;
+table.doxtable caption {
+ caption-side: top;
+table.doxtable {
+ border-collapse:collapse;
+ margin-top: 4px;
+ margin-bottom: 4px;
+table.doxtable td, table.doxtable th {
+ border: 1px solid #2D4068;
+ padding: 3px 7px 2px;
+table.doxtable th {
+ background-color: #374F7F;
+ color: #FFFFFF;
+ font-size: 110%;
+ padding-bottom: 4px;
+ padding-top: 5px;
+table.fieldtable {
+ /*width: 100%;*/
+ margin-bottom: 10px;
+ border: 1px solid #A8B8D9;
+ border-spacing: 0px;
+ -moz-border-radius: 4px;
+ -webkit-border-radius: 4px;
+ border-radius: 4px;
+ -moz-box-shadow: rgba(0, 0, 0, 0.15) 2px 2px 2px;
+ -webkit-box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15);
+ box-shadow: 2px 2px 2px rgba(0, 0, 0, 0.15);
+.fieldtable td, .fieldtable th {
+ padding: 3px 7px 2px;
+.fieldtable td.fieldtype, .fieldtable td.fieldname {
+ white-space: nowrap;
+ border-right: 1px solid #A8B8D9;
+ border-bottom: 1px solid #A8B8D9;
+ vertical-align: top;
+.fieldtable td.fieldname {
+ padding-top: 3px;
+.fieldtable td.fielddoc {
+ border-bottom: 1px solid #A8B8D9;
+ /*width: 100%;*/
+.fieldtable td.fielddoc p:first-child {
+ margin-top: 0px;
+.fieldtable td.fielddoc p:last-child {
+ margin-bottom: 2px;
+.fieldtable tr:last-child td {
+ border-bottom: none;
+.fieldtable th {
+ background-image:url('nav_f.png');
+ background-repeat:repeat-x;
+ background-color: #E2E8F2;
+ font-size: 90%;
+ color: #253555;
+ padding-bottom: 4px;
+ padding-top: 5px;
+ text-align:left;
+ font-weight: 400;
+ -moz-border-radius-topleft: 4px;
+ -moz-border-radius-topright: 4px;
+ -webkit-border-top-left-radius: 4px;
+ -webkit-border-top-right-radius: 4px;
+ border-top-left-radius: 4px;
+ border-top-right-radius: 4px;
+ border-bottom: 1px solid #A8B8D9;
+.tabsearch {
+ top: 0px;
+ left: 10px;
+ height: 36px;
+ background-image: url('tab_b.png');
+ z-index: 101;
+ overflow: hidden;
+ font-size: 13px;
+.navpath ul
+ font-size: 11px;
+ background-image:url('tab_b.png');
+ background-repeat:repeat-x;
+ background-position: 0 -5px;
+ height:30px;
+ line-height:30px;
+ color:#8AA0CC;
+ border:solid 1px #C2CDE4;
+ overflow:hidden;
+ margin:0px;
+ padding:0px;
+.navpath li
+ list-style-type:none;
+ float:left;
+ padding-left:10px;
+ padding-right:15px;
+ background-image:url('bc_s.png');
+ background-repeat:no-repeat;
+ background-position:right;
+ color:#364D7C;
+.navpath li.navelem a
+ height:32px;
+ display:block;
+ text-decoration: none;
+ outline: none;
+ color: #283A5D;
+ font-family: 'Lucida Grande',Geneva,Helvetica,Arial,sans-serif;
+ text-shadow: 0px 1px 1px rgba(255, 255, 255, 0.9);
+ text-decoration: none;
+.navpath li.navelem a:hover
+ color:#6884BD;
+.navpath li.footer
+ list-style-type:none;
+ float:right;
+ padding-left:10px;
+ padding-right:15px;
+ background-image:none;
+ background-repeat:no-repeat;
+ background-position:right;
+ color:#364D7C;
+ font-size: 8pt;
+ float: right;
+ font-size: 8pt;
+ padding-right: 5px;
+ width: 50%;
+ text-align: right;
+div.summary a
+ white-space: nowrap;
+ margin: 10px;
+ white-space: nowrap;
+ margin-left: 3%;
+ margin-right: 3%;
+ width: 94%;
+ border: 0;
+ border-spacing: 0;
+ padding: 0;
+ font-size: 8pt;
+ width: 50%;
+ text-align: left;
+div.ingroups a
+ white-space: nowrap;
+ background-image:url('nav_h.png');
+ background-repeat:repeat-x;
+ background-color: #F9FAFC;
+ margin: 0px;
+ border-bottom: 1px solid #C4CFE5;
+ padding: 5px 5px 5px 10px;
+ padding: 0 0 0 10px;
+/* dl.note, dl.warning, dl.attention, dl.pre, dl.post, dl.invariant, dl.deprecated, dl.todo, dl.test, dl.bug */
+ margin-left: 0px;
+ padding-left: 0px;
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #D0C000;
+dl.warning, dl.attention
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #FF0000;
+dl.pre, dl.post, dl.invariant
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #00D000;
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #505050;
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #00C0E0;
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #3030E0;
+ margin-left:-7px;
+ padding-left: 3px;
+ border-left:4px solid;
+ border-color: #C08050;
+dl.section dd {
+ margin-bottom: 6px;
+ text-align: center;
+ vertical-align: bottom;
+ border-collapse: separate;
+#projectlogo img
+ border: 0px none;
+ vertical-align: middle;
+ font: 300% Tahoma, Arial,sans-serif;
+ margin: 0px;
+ padding: 2px 0px;
+ font: 120% Tahoma, Arial,sans-serif;
+ margin: 0px;
+ padding: 0px;
+ font: 50% Tahoma, Arial,sans-serif;
+ margin: 0px;
+ padding: 0px;
+ padding: 0px;
+ margin: 0px;
+ width: 100%;
+ border-bottom: 1px solid #5373B4;
+ text-align: center;
+ text-align: center;
+ text-align: center;
+ text-align: center;
+ text-align: center;
+ font-weight: bold;
+ border: 1px solid #90A5CE;
+dl.citelist {
+ margin-bottom:50px;
+dl.citelist dt {
+ color:#334975;
+ float:left;
+ font-weight:bold;
+ margin-right:10px;
+ padding:5px;
+dl.citelist dd {
+ margin:2px 0;
+ padding:5px 0;
+div.toc {
+ padding: 14px 25px;
+ background-color: #F4F6FA;
+ border: 1px solid #D8DFEE;
+ border-radius: 7px 7px 7px 7px;
+ float: right;
+ height: auto;
+ margin: 0 8px 10px 10px;
+ width: 200px;
+div.toc li {
+ background: url("bdwn.png") no-repeat scroll 0 5px transparent;
+ font: 10px/1.2 Verdana,DejaVu Sans,Geneva,sans-serif;
+ margin-top: 5px;
+ padding-left: 10px;
+ padding-top: 2px;
+div.toc h3 {
+ font: bold 12px/1.2 Arial,FreeSans,sans-serif;
+ color: #4665A2;
+ border-bottom: 0 none;
+ margin: 0;
+div.toc ul {
+ list-style: none outside none;
+ border: medium none;
+ padding: 0px;
+div.toc li.level1 {
+ margin-left: 0px;
+div.toc li.level2 {
+ margin-left: 15px;
+div.toc li.level3 {
+ margin-left: 30px;
+div.toc li.level4 {
+ margin-left: 45px;
+.inherit_header {
+ font-weight: bold;
+ color: gray;
+ cursor: pointer;
+ -webkit-touch-callout: none;
+ -webkit-user-select: none;
+ -khtml-user-select: none;
+ -moz-user-select: none;
+ -ms-user-select: none;
+ user-select: none;
+.inherit_header td {
+ padding: 6px 0px 2px 5px;
+.inherit {
+ display: none;
+tr.heading h2 {
+ margin-top: 12px;
+ margin-bottom: 4px;
+/* tooltip related style info */
+.ttc {
+ position: absolute;
+ display: none;
+#powerTip {
+ cursor: default;
+ white-space: nowrap;
+ background-color: white;
+ border: 1px solid gray;
+ border-radius: 4px 4px 4px 4px;
+ box-shadow: 1px 1px 7px gray;
+ display: none;
+ font-size: smaller;
+ max-width: 80%;
+ opacity: 0.9;
+ padding: 1ex 1em 1em;
+ position: absolute;
+ z-index: 2147483647;
+#powerTip div.ttdoc {
+ color: grey;
+ font-style: italic;
-/* for the tree view */
-.ftvtree {
- font-family: sans-serif;
- margin:0.5em;
+#powerTip div.ttname a {
+ font-weight: bold;
-/* these are for tree view when used as main index */
-.directory {
- font-size: 9pt;
- font-weight: bold;
+#powerTip div.ttname {
+ font-weight: bold;
+#powerTip div.ttdeci {
+ color: #006318;
+#powerTip div {
+ margin: 0px;
+ padding: 0px;
+ font: 12px/16px Roboto,sans-serif;
+#powerTip:before, #powerTip:after {
+ content: "";
+ position: absolute;
+ margin: 0px;
+#powerTip.n:after, #powerTip.n:before,
+#powerTip.s:after, #powerTip.s:before,
+#powerTip.w:after, #powerTip.w:before,
+#powerTip.e:after, #powerTip.e:before,
+#powerTip.ne:after, #powerTip.ne:before,
+#powerTip.se:after, #powerTip.se:before,
+#powerTip.nw:after, #powerTip.nw:before,
+#powerTip.sw:after, #powerTip.sw:before {
+ border: solid transparent;
+ content: " ";
+ height: 0;
+ width: 0;
+ position: absolute;
+#powerTip.n:after, #powerTip.s:after,
+#powerTip.w:after, #powerTip.e:after,
+#powerTip.nw:after, #powerTip.ne:after,
+#powerTip.sw:after, #powerTip.se:after {
+ border-color: rgba(255, 255, 255, 0);
+#powerTip.n:before, #powerTip.s:before,
+#powerTip.w:before, #powerTip.e:before,
+#powerTip.nw:before, #powerTip.ne:before,
+#powerTip.sw:before, #powerTip.se:before {
+ border-color: rgba(128, 128, 128, 0);
+#powerTip.n:after, #powerTip.n:before,
+#powerTip.ne:after, #powerTip.ne:before,
+#powerTip.nw:after, #powerTip.nw:before {
+ top: 100%;
+#powerTip.n:after, #powerTip.ne:after, #powerTip.nw:after {
+ border-top-color: #ffffff;
+ border-width: 10px;
+ margin: 0px -10px;
+#powerTip.n:before {
+ border-top-color: #808080;
+ border-width: 11px;
+ margin: 0px -11px;
+#powerTip.n:after, #powerTip.n:before {
+ left: 50%;
+#powerTip.nw:after, #powerTip.nw:before {
+ right: 14px;
+#powerTip.ne:after, #powerTip.ne:before {
+ left: 14px;
+#powerTip.s:after, #powerTip.s:before,
+#powerTip.se:after, #powerTip.se:before,
+#powerTip.sw:after, #powerTip.sw:before {
+ bottom: 100%;
+#powerTip.s:after, #powerTip.se:after, #powerTip.sw:after {
+ border-bottom-color: #ffffff;
+ border-width: 10px;
+ margin: 0px -10px;
+#powerTip.s:before, #powerTip.se:before, #powerTip.sw:before {
+ border-bottom-color: #808080;
+ border-width: 11px;
+ margin: 0px -11px;
+#powerTip.s:after, #powerTip.s:before {
+ left: 50%;
+#powerTip.sw:after, #powerTip.sw:before {
+ right: 14px;
-.directory h3 {
- margin: 0px;
- margin-top: 1em;
- font-size: 11pt;
+#powerTip.se:after, #powerTip.se:before {
+ left: 14px;
-/* The following two styles can be used to replace the root node title */
-/* with an image of your choice. Simply uncomment the next two styles, */
-/* specify the name of your image and be sure to set 'height' to the */
-/* proper pixel height of your image. */
+#powerTip.e:after, #powerTip.e:before {
+ left: 100%;
+#powerTip.e:after {
+ border-left-color: #ffffff;
+ border-width: 10px;
+ top: 50%;
+ margin-top: -10px;
+#powerTip.e:before {
+ border-left-color: #808080;
+ border-width: 11px;
+ top: 50%;
+ margin-top: -11px;
-/* .directory h3.swap { */
-/* height: 61px; */
-/* background-repeat: no-repeat; */
-/* background-image: url("yourimage.gif"); */
-/* } */
-/* .directory h3.swap span { */
-/* display: none; */
-/* } */
+#powerTip.w:after, #powerTip.w:before {
+ right: 100%;
+#powerTip.w:after {
+ border-right-color: #ffffff;
+ border-width: 10px;
+ top: 50%;
+ margin-top: -10px;
+#powerTip.w:before {
+ border-right-color: #808080;
+ border-width: 11px;
+ top: 50%;
+ margin-top: -11px;
-.directory > h3 {
- margin-top: 0;
+@media print
+ #top { display: none; }
+ #side-nav { display: none; }
+ #nav-path { display: none; }
+ body { overflow:visible; }
+ h1, h2, h3, h4, h5, h6 { page-break-after: avoid; }
+ .summary { display: none; }
+ .memitem { page-break-inside: avoid; }
+ #doc-content
+ {
+ margin-left:0 !important;
+ height:auto !important;
+ width:auto !important;
+ overflow:inherit;
+ display:inline;
+ }
-.directory p {
- margin: 0px;
- white-space: nowrap;
+/* @group Markdown */
+table.markdownTable {
+ border-collapse:collapse;
+ margin-top: 4px;
+ margin-bottom: 4px;
-.directory div {
- display: none;
- margin: 0px;
+table.markdownTable td, table.markdownTable th {
+ border: 1px solid #2D4068;
+ padding: 3px 7px 2px;
-.directory img {
- vertical-align: -30%;
+table.markdownTableHead tr {
-/* these are for tree view when not used as main index */
-.directory-alt {
- font-size: 100%;
- font-weight: bold;
+table.markdownTableBodyLeft td, table.markdownTable th {
+ border: 1px solid #2D4068;
+ padding: 3px 7px 2px;
-.directory-alt h3 {
- margin: 0px;
- margin-top: 1em;
- font-size: 11pt;
+th.markdownTableHeadLeft th.markdownTableHeadRight th.markdownTableHeadCenter th.markdownTableHeadNone {
+ background-color: #374F7F;
+ color: #FFFFFF;
+ font-size: 110%;
+ padding-bottom: 4px;
+ padding-top: 5px;
-.directory-alt > h3 {
- margin-top: 0;
+th.markdownTableHeadLeft {
+ text-align: left
-.directory-alt p {
- margin: 0px;
- white-space: nowrap;
+th.markdownTableHeadRight {
+ text-align: right
-.directory-alt div {
- display: none;
- margin: 0px;
+th.markdownTableHeadCenter {
+ text-align: center
+table.markdownTable {
+ border-collapse:collapse;
+ margin-top: 4px;
+ margin-bottom: 4px;
+table.markdownTable td, table.markdownTable th {
+ border: 1px solid #2D4068;
+ padding: 3px 7px 2px;
+table.markdownTable tr {
+th.markdownTableHeadLeft, th.markdownTableHeadRight, th.markdownTableHeadCenter, th.markdownTableHeadNone {
+ background-color: #374F7F;
+ color: #FFFFFF;
+ font-size: 110%;
+ padding-bottom: 4px;
+ padding-top: 5px;
+th.markdownTableHeadLeft, td.markdownTableBodyLeft {
+ text-align: left
-.directory-alt img {
- vertical-align: -30%;
+th.markdownTableHeadRight, td.markdownTableBodyRight {
+ text-align: right
+th.markdownTableHeadCenter, td.markdownTableBodyCenter {
+ text-align: center
+/* @end */
diff --git a/doc/doxyout/gssapi/html/doxygen.png b/doc/doxyout/gssapi/html/doxygen.png
index f0a274bbaffd..3ff17d807fd8 100644
--- a/doc/doxyout/gssapi/html/doxygen.png
+++ b/doc/doxyout/gssapi/html/doxygen.png
Binary files differ
diff --git a/doc/doxyout/gssapi/html/dynsections.js b/doc/doxyout/gssapi/html/dynsections.js
new file mode 100644
index 000000000000..85e183690954
--- /dev/null
+++ b/doc/doxyout/gssapi/html/dynsections.js
@@ -0,0 +1,97 @@
+function toggleVisibility(linkObj)
+ var base = $(linkObj).attr('id');
+ var summary = $('#'+base+'-summary');
+ var content = $('#'+base+'-content');
+ var trigger = $('#'+base+'-trigger');
+ var src=$(trigger).attr('src');
+ if (content.is(':visible')===true) {
+ content.hide();
+ summary.show();
+ $(linkObj).addClass('closed').removeClass('opened');
+ $(trigger).attr('src',src.substring(0,src.length-8)+'closed.png');
+ } else {
+ content.show();
+ summary.hide();
+ $(linkObj).removeClass('closed').addClass('opened');
+ $(trigger).attr('src',src.substring(0,src.length-10)+'open.png');
+ }
+ return false;
+function updateStripes()
+ $('table.directory tr').
+ removeClass('even').filter(':visible:even').addClass('even');
+function toggleLevel(level)
+ $('table.directory tr').each(function() {
+ var l = this.id.split('_').length-1;
+ var i = $('#img'+this.id.substring(3));
+ var a = $('#arr'+this.id.substring(3));
+ if (l<level+1) {
+ i.removeClass('iconfopen iconfclosed').addClass('iconfopen');
+ a.html('&#9660;');
+ $(this).show();
+ } else if (l==level+1) {
+ i.removeClass('iconfclosed iconfopen').addClass('iconfclosed');
+ a.html('&#9658;');
+ $(this).show();
+ } else {
+ $(this).hide();
+ }
+ });
+ updateStripes();
+function toggleFolder(id)
+ // the clicked row
+ var currentRow = $('#row_'+id);
+ // all rows after the clicked row
+ var rows = currentRow.nextAll("tr");
+ var re = new RegExp('^row_'+id+'\\d+_$', "i"); //only one sub
+ // only match elements AFTER this one (can't hide elements before)
+ var childRows = rows.filter(function() { return this.id.match(re); });
+ // first row is visible we are HIDING
+ if (childRows.filter(':first').is(':visible')===true) {
+ // replace down arrow by right arrow for current row
+ var currentRowSpans = currentRow.find("span");
+ currentRowSpans.filter(".iconfopen").removeClass("iconfopen").addClass("iconfclosed");
+ currentRowSpans.filter(".arrow").html('&#9658;');
+ rows.filter("[id^=row_"+id+"]").hide(); // hide all children
+ } else { // we are SHOWING
+ // replace right arrow by down arrow for current row
+ var currentRowSpans = currentRow.find("span");
+ currentRowSpans.filter(".iconfclosed").removeClass("iconfclosed").addClass("iconfopen");
+ currentRowSpans.filter(".arrow").html('&#9660;');
+ // replace down arrows by right arrows for child rows
+ var childRowsSpans = childRows.find("span");
+ childRowsSpans.filter(".iconfopen").removeClass("iconfopen").addClass("iconfclosed");
+ childRowsSpans.filter(".arrow").html('&#9658;');
+ childRows.show(); //show all children
+ }
+ updateStripes();
+function toggleInherit(id)
+ var rows = $('tr.inherit.'+id);
+ var img = $('tr.inherit_header.'+id+' img');
+ var src = $(img).attr('src');
+ if (rows.filter(':first').is(':visible')===true) {
+ rows.css('display','none');
+ $(img).attr('src',src.substring(0,src.length-8)+'closed.png');
+ } else {
+ rows.css('display','table-row'); // using show() causes jump in firefox
+ $(img).attr('src',src.substring(0,src.length-10)+'open.png');
+ }
diff --git a/doc/doxyout/gssapi/html/folderclosed.png b/doc/doxyout/gssapi/html/folderclosed.png
new file mode 100644
index 000000000000..bb8ab35edce8
--- /dev/null
+++ b/doc/doxyout/gssapi/html/folderclosed.png
Binary files differ
diff --git a/doc/doxyout/gssapi/html/folderopen.png b/doc/doxyout/gssapi/html/folderopen.png
new file mode 100644
index 000000000000..d6c7f676a3b3
--- /dev/null
+++ b/doc/doxyout/gssapi/html/folderopen.png
Binary files differ
diff --git a/doc/doxyout/gssapi/html/graph_legend.dot b/doc/doxyout/gssapi/html/graph_legend.dot
deleted file mode 100644
index 4df0f1aa4864..000000000000
--- a/doc/doxyout/gssapi/html/graph_legend.dot
+++ /dev/null
@@ -1,22 +0,0 @@
-digraph G
- edge [fontname="FreeSans",fontsize=10,labelfontname="FreeSans",labelfontsize=10];
- node [fontname="FreeSans",fontsize=10,shape=record];
- Node9 [shape="box",label="Inherited",fontsize=10,height=0.2,width=0.4,fontname="FreeSans",fillcolor="grey75",style="filled" fontcolor="black"];
- Node10 -> Node9 [dir=back,color="midnightblue",fontsize=10,style="solid",fontname="FreeSans"];
- Node10 [shape="box",label="PublicBase",fontsize=10,height=0.2,width=0.4,fontname="FreeSans",color="black",URL="$classPublicBase.html"];
- Node11 -> Node10 [dir=back,color="midnightblue",fontsize=10,style="solid",fontname="FreeSans"];
- Node11 [shape="box",label="Truncated",fontsize=10,height=0.2,width=0.4,fontname="FreeSans",color="red",URL="$classTruncated.html"];
- Node13 -> Node9 [dir=back,color="darkgreen",fontsize=10,style="solid",fontname="FreeSans"];
- Node13 [shape="box",label="ProtectedBase",fontsize=10,height=0.2,width=0.4,fontname="FreeSans",color="black",URL="$classProtectedBase.html"];
- Node14 -> Node9 [dir=back,color="firebrick4",fontsize=10,style="solid",fontname="FreeSans"];
- Node14 [shape="box",label="PrivateBase",fontsize=10,height=0.2,width=0.4,fontname="FreeSans",color="black",URL="$classPrivateBase.html"];
- Node15 -> Node9 [dir=back,color="midnightblue",fontsize=10,style="solid",fontname="FreeSans"];
- Node15 [shape="box",label="Undocumented",fontsize=10,height=0.2,width=0.4,fontname="FreeSans",color="grey75"];
- Node16 -> Node9 [dir=back,color="midnightblue",fontsize=10,style="solid",fontname="FreeSans"];
- Node16 [shape="box",label="Templ< int >",fontsize=10,height=0.2,width=0.4,fontname="FreeSans",color="black",URL="$classTempl.html"];
- Node17 -> Node16 [dir=back,color="orange",fontsize=10,style="dashed",label="< int >",fontname="FreeSans"];
- Node17 [shape="box",label="Templ< T >",fontsize=10,height=0.2,width=0.4,fontname="FreeSans",color="black",URL="$classTempl.html"];
- Node18 -> Node9 [dir=back,color="darkorchid3",fontsize=10,style="dashed",label="m_usedClass",fontname="FreeSans"];
- Node18 [shape="box",label="Used",fontsize=10,height=0.2,width=0.4,fontname="FreeSans",color="black",URL="$classUsed.html"];
diff --git a/doc/doxyout/gssapi/html/graph_legend.html b/doc/doxyout/gssapi/html/graph_legend.html
index cc3fb247876a..0b316149c379 100644
--- a/doc/doxyout/gssapi/html/graph_legend.html
+++ b/doc/doxyout/gssapi/html/graph_legend.html
@@ -1,6 +1,6 @@
<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN">
<html><head><meta http-equiv="Content-Type" content="text/html;charset=UTF-8">
-<title>HeimdalGSS-APIlibrary: Graph Legend</title>
+<title>Graph Legend</title>
<link href="doxygen.css" rel="stylesheet" type="text/css">
<link href="tabs.css" rel="stylesheet" type="text/css">
@@ -8,68 +8,39 @@
<a href="http://www.h5l.org/"><img src="http://www.h5l.org/keyhole-heimdal.png" alt="keyhole logo"/></a>
<!-- end of header marker -->
-<!-- Generated by Doxygen 1.5.6 -->
-<div class="navigation" id="top">
- <div class="tabs">
- <ul>
- <li><a href="index.html"><span>Main&nbsp;Page</span></a></li>
- <li><a href="pages.html"><span>Related&nbsp;Pages</span></a></li>
- <li><a href="modules.html"><span>Modules</span></a></li>
- </ul>
- </div>
+<!-- Generated by Doxygen 1.8.13 -->
+<script type="text/javascript" src="menudata.js"></script>
+<script type="text/javascript" src="menu.js"></script>
+<script type="text/javascript">
+$(function() {
+ initMenu('',false,false,'search.php','Search');
+<div id="main-nav"></div>
+</div><!-- top -->
+<div class="header">
+ <div class="headertitle">
+<div class="title">Graph Legend</div> </div>
<div class="contents">
-<h1>Graph Legend</h1>This page explains how to interpret the graphs that are generated by doxygen.<p>
-Consider the following example: <div class="fragment"><pre class="fragment"><span class="comment">/*! Invisible class because of truncation */</span>
-<span class="keyword">class </span>Invisible { };
-<span class="comment"></span>
-<span class="comment">/*! Truncated class, inheritance relation is hidden */</span>
-<span class="keyword">class </span>Truncated : <span class="keyword">public</span> Invisible { };
-<span class="comment">/* Class not documented with doxygen comments */</span>
-<span class="keyword">class </span>Undocumented { };
-<span class="comment"></span>
-<span class="comment">/*! Class that is inherited using public inheritance */</span>
-<span class="keyword">class </span>PublicBase : <span class="keyword">public</span> Truncated { };
-<span class="comment"></span>
-<span class="comment">/*! A template class */</span>
-<span class="keyword">template</span>&lt;<span class="keyword">class</span> T&gt; <span class="keyword">class </span>Templ { };
-<span class="comment"></span>
-<span class="comment">/*! Class that is inherited using protected inheritance */</span>
-<span class="keyword">class </span>ProtectedBase { };
-<span class="comment"></span>
-<span class="comment">/*! Class that is inherited using private inheritance */</span>
-<span class="keyword">class </span>PrivateBase { };
-<span class="comment"></span>
-<span class="comment">/*! Class that is used by the Inherited class */</span>
-<span class="keyword">class </span>Used { };
-<span class="comment"></span>
-<span class="comment">/*! Super class that inherits a number of other classes */</span>
-<span class="keyword">class </span>Inherited : <span class="keyword">public</span> PublicBase,
- <span class="keyword">protected</span> ProtectedBase,
- <span class="keyword">private</span> PrivateBase,
- <span class="keyword">public</span> Undocumented,
- <span class="keyword">public</span> Templ&lt;int&gt;
- <span class="keyword">private</span>:
- Used *m_usedClass;
-</pre></div> If the <code>MAX_DOT_GRAPH_HEIGHT</code> tag in the configuration file is set to 240 this will result in the following graph:<p>
-<center><div align="center">
-<img src="graph_legend.png" alt="graph_legend.png">
+<p>This page explains how to interpret the graphs that are generated by doxygen.</p>
+<p>Consider the following example: </p><div class="fragment"><div class="line">/*! Invisible class because of truncation */</div><div class="line">class Invisible { };</div><div class="line"></div><div class="line">/*! Truncated class, inheritance relation is hidden */</div><div class="line">class Truncated : public Invisible { };</div><div class="line"></div><div class="line">/* Class not documented with doxygen comments */</div><div class="line">class Undocumented { };</div><div class="line"></div><div class="line">/*! Class that is inherited using public inheritance */</div><div class="line">class PublicBase : public Truncated { };</div><div class="line"></div><div class="line">/*! A template class */</div><div class="line">template&lt;class T&gt; class Templ { };</div><div class="line"></div><div class="line">/*! Class that is inherited using protected inheritance */</div><div class="line">class ProtectedBase { };</div><div class="line"></div><div class="line">/*! Class that is inherited using private inheritance */</div><div class="line">class PrivateBase { };</div><div class="line"></div><div class="line">/*! Class that is used by the Inherited class */</div><div class="line">class Used { };</div><div class="line"></div><div class="line">/*! Super class that inherits a number of other classes */</div><div class="line">class Inherited : public PublicBase,</div><div class="line"> protected ProtectedBase,</div><div class="line"> private PrivateBase,</div><div class="line"> public Undocumented,</div><div class="line"> public Templ&lt;int&gt;</div><div class="line">{</div><div class="line"> private:</div><div class="line"> Used *m_usedClass;</div><div class="line">};</div></div><!-- fragment --><p> This will result in the following graph:</p>
+<center><div class="image">
+<img src="graph_legend.png"/>
-</center> <p>
-The boxes in the above graph have the following meaning: <ul>
+</center><p>The boxes in the above graph have the following meaning: </p>
A filled gray box represents the struct or class for which the graph is generated. </li>
A box with a black border denotes a documented struct or class. </li>
-A box with a grey border denotes an undocumented struct or class. </li>
+A box with a gray border denotes an undocumented struct or class. </li>
A box with a red border denotes a documented struct or class forwhich not all inheritance/containment relations are shown. A graph is truncated if it does not fit within the specified boundaries. </li>
-The arrows have the following meaning: <ul>
+<p>The arrows have the following meaning: </p>
A dark blue arrow is used to visualize a public inheritance relation between two classes. </li>
@@ -77,12 +48,12 @@ A dark green arrow is used for protected inheritance. </li>
A dark red arrow is used for private inheritance. </li>
-A purple dashed arrow is used if a class is contained or used by another class. The arrow is labeled with the variable(s) through which the pointed class or struct is accessible. </li>
+A purple dashed arrow is used if a class is contained or used by another class. The arrow is labelled with the variable(s) through which the pointed class or struct is accessible. </li>
-A yellow dashed arrow denotes a relation between a template instance and the template class it was instantiated from. The arrow is labeled with the template parameters of the instance. </li>
+A yellow dashed arrow denotes a relation between a template instance and the template class it was instantiated from. The arrow is labelled with the template parameters of the instance. </li>
+</div><!-- contents -->
<hr size="1"><address style="text-align: right;"><small>
-Generated on Wed Jan 11 14:07:44 2012 for HeimdalGSS-APIlibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.5.6</small></address>
+Generated on Fri Dec 8 2017 03:48:58 for HeimdalGSS-APIlibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.8.13</small></address>
diff --git a/doc/doxyout/gssapi/html/graph_legend.md5 b/doc/doxyout/gssapi/html/graph_legend.md5
new file mode 100644
index 000000000000..a06ed050cbb5
--- /dev/null
+++ b/doc/doxyout/gssapi/html/graph_legend.md5
@@ -0,0 +1 @@
+387ff8eb65306fa251338d3c9bd7bfff \ No newline at end of file
diff --git a/doc/doxyout/gssapi/html/graph_legend.png b/doc/doxyout/gssapi/html/graph_legend.png
index 9b96937bfd5f..881e40f9c0a2 100644
--- a/doc/doxyout/gssapi/html/graph_legend.png
+++ b/doc/doxyout/gssapi/html/graph_legend.png
Binary files differ
diff --git a/doc/doxyout/gssapi/html/group__gssapi.html b/doc/doxyout/gssapi/html/group__gssapi.html
index e063b51429f9..3ba73bf37136 100644
--- a/doc/doxyout/gssapi/html/group__gssapi.html
+++ b/doc/doxyout/gssapi/html/group__gssapi.html
@@ -1,6 +1,6 @@
<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN">
<html><head><meta http-equiv="Content-Type" content="text/html;charset=UTF-8">
-<title>HeimdalGSS-APIlibrary: Heimdal GSS-API functions</title>
+<title>Heimdal GSS-API functions</title>
<link href="doxygen.css" rel="stylesheet" type="text/css">
<link href="tabs.css" rel="stylesheet" type="text/css">
@@ -8,885 +8,996 @@
<a href="http://www.h5l.org/"><img src="http://www.h5l.org/keyhole-heimdal.png" alt="keyhole logo"/></a>
<!-- end of header marker -->
-<!-- Generated by Doxygen 1.5.6 -->
-<div class="navigation" id="top">
- <div class="tabs">
- <ul>
- <li><a href="index.html"><span>Main&nbsp;Page</span></a></li>
- <li><a href="pages.html"><span>Related&nbsp;Pages</span></a></li>
- <li><a href="modules.html"><span>Modules</span></a></li>
- </ul>
- </div>
+<!-- Generated by Doxygen 1.8.13 -->
+<script type="text/javascript" src="menudata.js"></script>
+<script type="text/javascript" src="menu.js"></script>
+<script type="text/javascript">
+$(function() {
+ initMenu('',false,false,'search.php','Search');
+<div id="main-nav"></div>
+</div><!-- top -->
+<div class="header">
+ <div class="summary">
+<a href="#func-members">Functions</a> &#124;
+<a href="#var-members">Variables</a> </div>
+ <div class="headertitle">
+<div class="title">Heimdal GSS-API functions</div> </div>
<div class="contents">
-<h1>Heimdal GSS-API functions</h1><table border="0" cellpadding="0" cellspacing="0">
-<tr><td colspan="2"><br><h2>Functions</h2></td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#g233373d4e0baa31615eb4d4f0ccb9683">gss_add_oid_set_member</a> (OM_uint32 *minor_status, const gss_OID member_oid, gss_OID_set *oid_set)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#gb02ec963066cc8e5e6682799457208e9">gss_wrap_iov</a> (OM_uint32 *minor_status, gss_ctx_id_t context_handle, int conf_req_flag, gss_qop_t qop_req, int *conf_state, gss_iov_buffer_desc *iov, int iov_count)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#g399bb326e47574aca7b28d6886d29fd0">gss_unwrap_iov</a> (OM_uint32 *minor_status, gss_ctx_id_t context_handle, int *conf_state, gss_qop_t *qop_state, gss_iov_buffer_desc *iov, int iov_count)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#g6216cfcb1ba8dc2d1a1d680d21752f26">gss_wrap_iov_length</a> (OM_uint32 *minor_status, gss_ctx_id_t context_handle, int conf_req_flag, gss_qop_t qop_req, int *conf_state, gss_iov_buffer_desc *iov, int iov_count)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#g2dbb20a4c9a3cf5072ef081cd37e54b4">gss_release_iov_buffer</a> (OM_uint32 *minor_status, gss_iov_buffer_desc *iov, int iov_count)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#g06e9814b830ed2fc4a756775a5bfd943">gss_canonicalize_name</a> (OM_uint32 *minor_status, const gss_name_t input_name, const gss_OID mech_type, gss_name_t *output_name)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#g0afe06fd5264ebfb93ecca4bcc70895b">gss_import_name</a> (OM_uint32 *minor_status, const gss_buffer_t input_name_buffer, const gss_OID input_name_type, gss_name_t *output_name)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#g8eb94eab14874226b748710f833474eb">gss_init_sec_context</a> (OM_uint32 *minor_status, const gss_cred_id_t initiator_cred_handle, gss_ctx_id_t *context_handle, const gss_name_t target_name, const gss_OID input_mech_type, OM_uint32 req_flags, OM_uint32 time_req, const gss_channel_bindings_t input_chan_bindings, const gss_buffer_t input_token, gss_OID *actual_mech_type, gss_buffer_t output_token, OM_uint32 *ret_flags, OM_uint32 *time_rec)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#gdc725eaf82322d8cf50812fc26442893">gss_inquire_saslname_for_mech</a> (OM_uint32 *minor_status, const gss_OID desired_mech, gss_buffer_t sasl_mech_name, gss_buffer_t mech_name, gss_buffer_t mech_description)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#gf472671a43512495de04ca0c69079e5d">gss_inquire_attrs_for_mech</a> (OM_uint32 *minor_status, gss_const_OID mech, gss_OID_set *mech_attr, gss_OID_set *known_mech_attrs)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION int <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#gc98677df7ae9bbc387cd68002a97ad15">gss_oid_equal</a> (gss_const_OID a, gss_const_OID b)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#gd2990721c56fe83e06d45648874680d7">gss_release_cred</a> (OM_uint32 *minor_status, gss_cred_id_t *cred_handle)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#g0691190338f1f24170bd5f695ff1e721">gss_release_name</a> (OM_uint32 *minor_status, gss_name_t *input_name)</td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 <br>
-GSSAPI_LIB_CALL&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#g89a6d98056b75a8a25152de268833f51">gss_wrap</a> (OM_uint32 *minor_status, const gss_ctx_id_t context_handle, int conf_req_flag, gss_qop_t qop_req, const gss_buffer_t input_message_buffer, int *conf_state, gss_buffer_t output_message_buffer)</td></tr>
-<tr><td colspan="2"><br><h2>Variables</h2></td></tr>
-<tr><td class="memItemLeft" nowrap align="right" valign="top">gss_OID_desc GSSAPI_LIB_FUNCTION&nbsp;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#g961f7a7f9f92e06b91c6d503e524a672">__gss_c_attr_stream_sizes_oid_desc</a></td></tr>
+<table class="memberdecls">
+<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="func-members"></a>
+<tr class="memitem:ga233373d4e0baa31615eb4d4f0ccb9683"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#ga233373d4e0baa31615eb4d4f0ccb9683">gss_add_oid_set_member</a> (OM_uint32 *minor_status, const gss_OID member_oid, gss_OID_set *oid_set)</td></tr>
+<tr class="separator:ga233373d4e0baa31615eb4d4f0ccb9683"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:gab02ec963066cc8e5e6682799457208e9"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#gab02ec963066cc8e5e6682799457208e9">gss_wrap_iov</a> (OM_uint32 *minor_status, gss_ctx_id_t context_handle, int conf_req_flag, gss_qop_t qop_req, int *conf_state, gss_iov_buffer_desc *iov, int iov_count)</td></tr>
+<tr class="separator:gab02ec963066cc8e5e6682799457208e9"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:ga399bb326e47574aca7b28d6886d29fd0"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#ga399bb326e47574aca7b28d6886d29fd0">gss_unwrap_iov</a> (OM_uint32 *minor_status, gss_ctx_id_t context_handle, int *conf_state, gss_qop_t *qop_state, gss_iov_buffer_desc *iov, int iov_count)</td></tr>
+<tr class="separator:ga399bb326e47574aca7b28d6886d29fd0"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:ga6216cfcb1ba8dc2d1a1d680d21752f26"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#ga6216cfcb1ba8dc2d1a1d680d21752f26">gss_wrap_iov_length</a> (OM_uint32 *minor_status, gss_ctx_id_t context_handle, int conf_req_flag, gss_qop_t qop_req, int *conf_state, gss_iov_buffer_desc *iov, int iov_count)</td></tr>
+<tr class="separator:ga6216cfcb1ba8dc2d1a1d680d21752f26"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:ga2dbb20a4c9a3cf5072ef081cd37e54b4"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#ga2dbb20a4c9a3cf5072ef081cd37e54b4">gss_release_iov_buffer</a> (OM_uint32 *minor_status, gss_iov_buffer_desc *iov, int iov_count)</td></tr>
+<tr class="separator:ga2dbb20a4c9a3cf5072ef081cd37e54b4"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:gae00fe4a91f13d61172361a30fb24a06e"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#gae00fe4a91f13d61172361a30fb24a06e">gss_canonicalize_name</a> (OM_uint32 *minor_status, gss_const_name_t input_name, const gss_OID mech_type, gss_name_t *output_name)</td></tr>
+<tr class="separator:gae00fe4a91f13d61172361a30fb24a06e"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:ga770d87c1b80a58e91ec3a9ed70468122"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#ga770d87c1b80a58e91ec3a9ed70468122">gss_display_status</a> (OM_uint32 *minor_status, OM_uint32 status_value, int status_type, const gss_OID mech_type, OM_uint32 *message_context, gss_buffer_t status_string)</td></tr>
+<tr class="separator:ga770d87c1b80a58e91ec3a9ed70468122"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:ga353814c7de38c9e2894ca66f0c15c8eb"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#ga353814c7de38c9e2894ca66f0c15c8eb">gss_export_name</a> (OM_uint32 *minor_status, gss_const_name_t input_name, gss_buffer_t exported_name)</td></tr>
+<tr class="separator:ga353814c7de38c9e2894ca66f0c15c8eb"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:ga0afe06fd5264ebfb93ecca4bcc70895b"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#ga0afe06fd5264ebfb93ecca4bcc70895b">gss_import_name</a> (OM_uint32 *minor_status, const gss_buffer_t input_name_buffer, const gss_OID input_name_type, gss_name_t *output_name)</td></tr>
+<tr class="separator:ga0afe06fd5264ebfb93ecca4bcc70895b"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:ga890d690b8598288f33e31370bcfd3127"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#ga890d690b8598288f33e31370bcfd3127">gss_init_sec_context</a> (OM_uint32 *minor_status, gss_const_cred_id_t initiator_cred_handle, gss_ctx_id_t *context_handle, gss_const_name_t target_name, const gss_OID input_mech_type, OM_uint32 req_flags, OM_uint32 time_req, const gss_channel_bindings_t input_chan_bindings, const gss_buffer_t input_token, gss_OID *actual_mech_type, gss_buffer_t output_token, OM_uint32 *ret_flags, OM_uint32 *time_rec)</td></tr>
+<tr class="separator:ga890d690b8598288f33e31370bcfd3127"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:gadc725eaf82322d8cf50812fc26442893"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#gadc725eaf82322d8cf50812fc26442893">gss_inquire_saslname_for_mech</a> (OM_uint32 *minor_status, const gss_OID desired_mech, gss_buffer_t sasl_mech_name, gss_buffer_t mech_name, gss_buffer_t mech_description)</td></tr>
+<tr class="separator:gadc725eaf82322d8cf50812fc26442893"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:gaf472671a43512495de04ca0c69079e5d"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#gaf472671a43512495de04ca0c69079e5d">gss_inquire_attrs_for_mech</a> (OM_uint32 *minor_status, gss_const_OID mech, gss_OID_set *mech_attr, gss_OID_set *known_mech_attrs)</td></tr>
+<tr class="separator:gaf472671a43512495de04ca0c69079e5d"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:gac98677df7ae9bbc387cd68002a97ad15"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION int GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#gac98677df7ae9bbc387cd68002a97ad15">gss_oid_equal</a> (gss_const_OID a, gss_const_OID b)</td></tr>
+<tr class="separator:gac98677df7ae9bbc387cd68002a97ad15"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:gad2990721c56fe83e06d45648874680d7"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#gad2990721c56fe83e06d45648874680d7">gss_release_cred</a> (OM_uint32 *minor_status, gss_cred_id_t *cred_handle)</td></tr>
+<tr class="separator:gad2990721c56fe83e06d45648874680d7"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:ga0691190338f1f24170bd5f695ff1e721"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#ga0691190338f1f24170bd5f695ff1e721">gss_release_name</a> (OM_uint32 *minor_status, gss_name_t *input_name)</td></tr>
+<tr class="separator:ga0691190338f1f24170bd5f695ff1e721"><td class="memSeparator" colspan="2">&#160;</td></tr>
+<tr class="memitem:ga4058cf5c3b04fd25f8339c71dd5e964c"><td class="memItemLeft" align="right" valign="top">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#ga4058cf5c3b04fd25f8339c71dd5e964c">gss_wrap</a> (OM_uint32 *minor_status, gss_const_ctx_id_t context_handle, int conf_req_flag, gss_qop_t qop_req, const gss_buffer_t input_message_buffer, int *conf_state, gss_buffer_t output_message_buffer)</td></tr>
+<tr class="separator:ga4058cf5c3b04fd25f8339c71dd5e964c"><td class="memSeparator" colspan="2">&#160;</td></tr>
+</table><table class="memberdecls">
+<tr class="heading"><td colspan="2"><h2 class="groupheader"><a name="var-members"></a>
+<tr class="memitem:ga961f7a7f9f92e06b91c6d503e524a672"><td class="memItemLeft" align="right" valign="top">gss_OID_desc GSSAPI_LIB_FUNCTION&#160;</td><td class="memItemRight" valign="bottom"><a class="el" href="group__gssapi.html#ga961f7a7f9f92e06b91c6d503e524a672">__gss_c_attr_stream_sizes_oid_desc</a></td></tr>
+<tr class="separator:ga961f7a7f9f92e06b91c6d503e524a672"><td class="memSeparator" colspan="2">&#160;</td></tr>
-<hr><a name="_details"></a><h2>Detailed Description</h2>
-<hr><h2>Function Documentation</h2>
-<a class="anchor" name="g233373d4e0baa31615eb4d4f0ccb9683"></a><!-- doxytag: member="gss_add_oid_set_member.c::gss_add_oid_set_member" ref="g233373d4e0baa31615eb4d4f0ccb9683" args="(OM_uint32 *minor_status, const gss_OID member_oid, gss_OID_set *oid_set)" -->
+<a name="details" id="details"></a><h2 class="groupheader">Detailed Description</h2>
+<h2 class="groupheader">Function Documentation</h2>
+<a id="ga233373d4e0baa31615eb4d4f0ccb9683"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#ga233373d4e0baa31615eb4d4f0ccb9683">&#9670;&nbsp;</a></span>gss_add_oid_set_member()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_add_oid_set_member </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_add_oid_set_member </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_OID&nbsp;</td>
- <td class="paramname"> <em>member_oid</em>, </td>
+ <td class="paramtype">const gss_OID&#160;</td>
+ <td class="paramname"><em>member_oid</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_OID_set *&nbsp;</td>
- <td class="paramname"> <em>oid_set</em></td><td>&nbsp;</td>
+ <td class="paramtype">gss_OID_set *&#160;</td>
+ <td class="paramname"><em>oid_set</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
+</div><div class="memdoc">
+<p>Add a oid to the oid set, function does not make a copy of the oid, so the pointer to member_oid needs to be stable for the whole time oid_set is used.</p>
+<p>If there is a duplicate member of the oid, the new member is not added to to the set.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">minor_status</td><td>minor status code. </td></tr>
+ <tr><td class="paramname">member_oid</td><td>member to add to the oid set </td></tr>
+ <tr><td class="paramname">oid_set</td><td>oid set to add the member too</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>a gss_error code, see <a class="el" href="group__gssapi.html#ga770d87c1b80a58e91ec3a9ed70468122">gss_display_status()</a> about printing the error code. </dd></dl>
-<div class="memdoc">
+<a id="gae00fe4a91f13d61172361a30fb24a06e"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#gae00fe4a91f13d61172361a30fb24a06e">&#9670;&nbsp;</a></span>gss_canonicalize_name()</h2>
-Add a oid to the oid set, function does not make a copy of the oid, so the pointer to member_oid needs to be stable for the whole time oid_set is used.<p>
-If there is a duplicate member of the oid, the new member is not added to to the set.<p>
-<dl compact><dt><b>Parameters:</b></dt><dd>
- <table border="0" cellspacing="2" cellpadding="0">
- <tr><td valign="top"></td><td valign="top"><em>minor_status</em>&nbsp;</td><td>minor status code. </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>member_oid</em>&nbsp;</td><td>member to add to the oid set </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>oid_set</em>&nbsp;</td><td>oid set to add the member too</td></tr>
+<div class="memitem">
+<div class="memproto">
+ <table class="memname">
+ <tr>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_canonicalize_name </td>
+ <td>(</td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
+ </tr>
+ <tr>
+ <td class="paramkey"></td>
+ <td></td>
+ <td class="paramtype">gss_const_name_t&#160;</td>
+ <td class="paramname"><em>input_name</em>, </td>
+ </tr>
+ <tr>
+ <td class="paramkey"></td>
+ <td></td>
+ <td class="paramtype">const gss_OID&#160;</td>
+ <td class="paramname"><em>mech_type</em>, </td>
+ </tr>
+ <tr>
+ <td class="paramkey"></td>
+ <td></td>
+ <td class="paramtype">gss_name_t *&#160;</td>
+ <td class="paramname"><em>output_name</em>&#160;</td>
+ </tr>
+ <tr>
+ <td></td>
+ <td>)</td>
+ <td></td><td></td>
+ </tr>
+ </table>
+</div><div class="memdoc">
+<p>gss_canonicalize_name takes a Internal Name (IN) and converts in into a mechanism specific Mechanism Name (MN).</p>
+<p>The input name may multiple name, or generic name types.</p>
+<p>If the input_name if of the GSS_C_NT_USER_NAME, and the Kerberos mechanism is specified, the resulting MN type is a GSS_KRB5_NT_PRINCIPAL_NAME.</p>
+<p>For more information about <a class="el" href="internal_v_smechname.html">Internal names and mechanism names</a>.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">minor_status</td><td>minor status code. </td></tr>
+ <tr><td class="paramname">input_name</td><td>name to covert, unchanged by <a class="el" href="group__gssapi.html#gae00fe4a91f13d61172361a30fb24a06e">gss_canonicalize_name()</a>. </td></tr>
+ <tr><td class="paramname">mech_type</td><td>the type to convert Name too. </td></tr>
+ <tr><td class="paramname">output_name</td><td>the resulting type, release with <a class="el" href="group__gssapi.html#ga0691190338f1f24170bd5f695ff1e721">gss_release_name()</a>, independent of input_name.</td></tr>
+ </dd>
-<dl class="return" compact><dt><b>Returns:</b></dt><dd>a gss_error code, see gss_display_status() about printing the error code. </dd></dl>
+<dl class="section return"><dt>Returns</dt><dd>a gss_error code, see <a class="el" href="group__gssapi.html#ga770d87c1b80a58e91ec3a9ed70468122">gss_display_status()</a> about printing the error code. </dd></dl>
-<a class="anchor" name="g06e9814b830ed2fc4a756775a5bfd943"></a><!-- doxytag: member="gss_canonicalize_name.c::gss_canonicalize_name" ref="g06e9814b830ed2fc4a756775a5bfd943" args="(OM_uint32 *minor_status, const gss_name_t input_name, const gss_OID mech_type, gss_name_t *output_name)" -->
+<a id="ga770d87c1b80a58e91ec3a9ed70468122"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#ga770d87c1b80a58e91ec3a9ed70468122">&#9670;&nbsp;</a></span>gss_display_status()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_canonicalize_name </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_display_status </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_name_t&nbsp;</td>
- <td class="paramname"> <em>input_name</em>, </td>
+ <td class="paramtype">OM_uint32&#160;</td>
+ <td class="paramname"><em>status_value</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_OID&nbsp;</td>
- <td class="paramname"> <em>mech_type</em>, </td>
+ <td class="paramtype">int&#160;</td>
+ <td class="paramname"><em>status_type</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_name_t *&nbsp;</td>
- <td class="paramname"> <em>output_name</em></td><td>&nbsp;</td>
+ <td class="paramtype">const gss_OID&#160;</td>
+ <td class="paramname"><em>mech_type</em>, </td>
+ </tr>
+ <tr>
+ <td class="paramkey"></td>
+ <td></td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>message_context</em>, </td>
+ </tr>
+ <tr>
+ <td class="paramkey"></td>
+ <td></td>
+ <td class="paramtype">gss_buffer_t&#160;</td>
+ <td class="paramname"><em>status_string</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
+</div><div class="memdoc">
+<p>Convert a GSS-API status code to text</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">minor_status</td><td>minor status code </td></tr>
+ <tr><td class="paramname">status_value</td><td>status value to convert </td></tr>
+ <tr><td class="paramname">status_type</td><td>One of: GSS_C_GSS_CODE - status_value is a GSS status code, GSS_C_MECH_CODE - status_value is a mechanism status code </td></tr>
+ <tr><td class="paramname">mech_type</td><td>underlying mechanism. Use GSS_C_NO_OID to obtain the system default. </td></tr>
+ <tr><td class="paramname">message_context</td><td>state information to extract further messages from the status_value </td></tr>
+ <tr><td class="paramname">status_string</td><td>the allocated text representation. Release with gss_release_buffer()</td></tr>
+ </table>
+ </dd>
+<dl class="section return"><dt>Returns</dt><dd>a gss_error code. </dd></dl>
-<div class="memdoc">
+<a id="ga353814c7de38c9e2894ca66f0c15c8eb"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#ga353814c7de38c9e2894ca66f0c15c8eb">&#9670;&nbsp;</a></span>gss_export_name()</h2>
-gss_canonicalize_name takes a Internal Name (IN) and converts in into a mechanism specific Mechanism Name (MN).<p>
-The input name may multiple name, or generic name types.<p>
-If the input_name if of the GSS_C_NT_USER_NAME, and the Kerberos mechanism is specified, the resulting MN type is a GSS_KRB5_NT_PRINCIPAL_NAME.<p>
-For more information about <a class="el" href="internalvsmechname.html">internalVSmechname</a>.<p>
-<dl compact><dt><b>Parameters:</b></dt><dd>
- <table border="0" cellspacing="2" cellpadding="0">
- <tr><td valign="top"></td><td valign="top"><em>minor_status</em>&nbsp;</td><td>minor status code. </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>input_name</em>&nbsp;</td><td>name to covert, unchanged by <a class="el" href="group__gssapi.html#g06e9814b830ed2fc4a756775a5bfd943">gss_canonicalize_name()</a>. </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>mech_type</em>&nbsp;</td><td>the type to convert Name too. </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>output_name</em>&nbsp;</td><td>the resulting type, release with <a class="el" href="group__gssapi.html#g0691190338f1f24170bd5f695ff1e721">gss_release_name()</a>, independent of input_name.</td></tr>
+<div class="memitem">
+<div class="memproto">
+ <table class="memname">
+ <tr>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_export_name </td>
+ <td>(</td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
+ </tr>
+ <tr>
+ <td class="paramkey"></td>
+ <td></td>
+ <td class="paramtype">gss_const_name_t&#160;</td>
+ <td class="paramname"><em>input_name</em>, </td>
+ </tr>
+ <tr>
+ <td class="paramkey"></td>
+ <td></td>
+ <td class="paramtype">gss_buffer_t&#160;</td>
+ <td class="paramname"><em>exported_name</em>&#160;</td>
+ </tr>
+ <tr>
+ <td></td>
+ <td>)</td>
+ <td></td><td></td>
+ </tr>
+ </table>
+</div><div class="memdoc">
+<p>Convert a GGS-API name from internal form to contiguous string.</p>
+<dl class="section see"><dt>See also</dt><dd><a class="el" href="group__gssapi.html#ga0afe06fd5264ebfb93ecca4bcc70895b">gss_import_name()</a>, <a class="el" href="internal_v_smechname.html">Internal names and mechanism names</a>.</dd></dl>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">minor_status</td><td>minor status code </td></tr>
+ <tr><td class="paramname">input_name</td><td>input name in internal name form </td></tr>
+ <tr><td class="paramname">exported_name</td><td>output name in contiguos string form</td></tr>
+ </dd>
-<dl class="return" compact><dt><b>Returns:</b></dt><dd>a gss_error code, see gss_display_status() about printing the error code. </dd></dl>
+<dl class="section return"><dt>Returns</dt><dd>a gss_error code, see <a class="el" href="group__gssapi.html#ga770d87c1b80a58e91ec3a9ed70468122">gss_display_status()</a> about printing the error code. </dd></dl>
-<a class="anchor" name="g0afe06fd5264ebfb93ecca4bcc70895b"></a><!-- doxytag: member="gss_import_name.c::gss_import_name" ref="g0afe06fd5264ebfb93ecca4bcc70895b" args="(OM_uint32 *minor_status, const gss_buffer_t input_name_buffer, const gss_OID input_name_type, gss_name_t *output_name)" -->
+<a id="ga0afe06fd5264ebfb93ecca4bcc70895b"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#ga0afe06fd5264ebfb93ecca4bcc70895b">&#9670;&nbsp;</a></span>gss_import_name()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_import_name </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_import_name </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_buffer_t&nbsp;</td>
- <td class="paramname"> <em>input_name_buffer</em>, </td>
+ <td class="paramtype">const gss_buffer_t&#160;</td>
+ <td class="paramname"><em>input_name_buffer</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_OID&nbsp;</td>
- <td class="paramname"> <em>input_name_type</em>, </td>
+ <td class="paramtype">const gss_OID&#160;</td>
+ <td class="paramname"><em>input_name_type</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_name_t *&nbsp;</td>
- <td class="paramname"> <em>output_name</em></td><td>&nbsp;</td>
+ <td class="paramtype">gss_name_t *&#160;</td>
+ <td class="paramname"><em>output_name</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
-<div class="memdoc">
-Import a name internal or mechanism name<p>
-Type of name and their format:<ul>
-For more information about <a class="el" href="internalvsmechname.html">internalVSmechname</a>.<p>
-<dl compact><dt><b>Parameters:</b></dt><dd>
- <table border="0" cellspacing="2" cellpadding="0">
- <tr><td valign="top"></td><td valign="top"><em>minor_status</em>&nbsp;</td><td>minor status code </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>input_name_buffer</em>&nbsp;</td><td>import name buffer </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>input_name_type</em>&nbsp;</td><td>type of the import name buffer </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>output_name</em>&nbsp;</td><td>the resulting type, release with <a class="el" href="group__gssapi.html#g0691190338f1f24170bd5f695ff1e721">gss_release_name()</a>, independent of input_name</td></tr>
+</div><div class="memdoc">
+<p>Convert a GGS-API name from contiguous string to internal form.</p>
+<p>Type of name and their format:</p><ul>
+<dl class="section see"><dt>See also</dt><dd><a class="el" href="group__gssapi.html#ga353814c7de38c9e2894ca66f0c15c8eb">gss_export_name()</a>, <a class="el" href="internal_v_smechname.html">Internal names and mechanism names</a>.</dd></dl>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">minor_status</td><td>minor status code </td></tr>
+ <tr><td class="paramname">input_name_buffer</td><td>import name buffer </td></tr>
+ <tr><td class="paramname">input_name_type</td><td>type of the import name buffer </td></tr>
+ <tr><td class="paramname">output_name</td><td>the resulting type, release with <a class="el" href="group__gssapi.html#ga0691190338f1f24170bd5f695ff1e721">gss_release_name()</a>, independent of input_name</td></tr>
+ </dd>
-<dl class="return" compact><dt><b>Returns:</b></dt><dd>a gss_error code, see gss_display_status() about printing the error code. </dd></dl>
+<dl class="section return"><dt>Returns</dt><dd>a gss_error code, see <a class="el" href="group__gssapi.html#ga770d87c1b80a58e91ec3a9ed70468122">gss_display_status()</a> about printing the error code. </dd></dl>
-<a class="anchor" name="g8eb94eab14874226b748710f833474eb"></a><!-- doxytag: member="gss_init_sec_context.c::gss_init_sec_context" ref="g8eb94eab14874226b748710f833474eb" args="(OM_uint32 *minor_status, const gss_cred_id_t initiator_cred_handle, gss_ctx_id_t *context_handle, const gss_name_t target_name, const gss_OID input_mech_type, OM_uint32 req_flags, OM_uint32 time_req, const gss_channel_bindings_t input_chan_bindings, const gss_buffer_t input_token, gss_OID *actual_mech_type, gss_buffer_t output_token, OM_uint32 *ret_flags, OM_uint32 *time_rec)" -->
+<a id="ga890d690b8598288f33e31370bcfd3127"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#ga890d690b8598288f33e31370bcfd3127">&#9670;&nbsp;</a></span>gss_init_sec_context()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_init_sec_context </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_init_sec_context </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_cred_id_t&nbsp;</td>
- <td class="paramname"> <em>initiator_cred_handle</em>, </td>
+ <td class="paramtype">gss_const_cred_id_t&#160;</td>
+ <td class="paramname"><em>initiator_cred_handle</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_ctx_id_t *&nbsp;</td>
- <td class="paramname"> <em>context_handle</em>, </td>
+ <td class="paramtype">gss_ctx_id_t *&#160;</td>
+ <td class="paramname"><em>context_handle</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_name_t&nbsp;</td>
- <td class="paramname"> <em>target_name</em>, </td>
+ <td class="paramtype">gss_const_name_t&#160;</td>
+ <td class="paramname"><em>target_name</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_OID&nbsp;</td>
- <td class="paramname"> <em>input_mech_type</em>, </td>
+ <td class="paramtype">const gss_OID&#160;</td>
+ <td class="paramname"><em>input_mech_type</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">OM_uint32&nbsp;</td>
- <td class="paramname"> <em>req_flags</em>, </td>
+ <td class="paramtype">OM_uint32&#160;</td>
+ <td class="paramname"><em>req_flags</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">OM_uint32&nbsp;</td>
- <td class="paramname"> <em>time_req</em>, </td>
+ <td class="paramtype">OM_uint32&#160;</td>
+ <td class="paramname"><em>time_req</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_channel_bindings_t&nbsp;</td>
- <td class="paramname"> <em>input_chan_bindings</em>, </td>
+ <td class="paramtype">const gss_channel_bindings_t&#160;</td>
+ <td class="paramname"><em>input_chan_bindings</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_buffer_t&nbsp;</td>
- <td class="paramname"> <em>input_token</em>, </td>
+ <td class="paramtype">const gss_buffer_t&#160;</td>
+ <td class="paramname"><em>input_token</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_OID *&nbsp;</td>
- <td class="paramname"> <em>actual_mech_type</em>, </td>
+ <td class="paramtype">gss_OID *&#160;</td>
+ <td class="paramname"><em>actual_mech_type</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_buffer_t&nbsp;</td>
- <td class="paramname"> <em>output_token</em>, </td>
+ <td class="paramtype">gss_buffer_t&#160;</td>
+ <td class="paramname"><em>output_token</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>ret_flags</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>ret_flags</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>time_rec</em></td><td>&nbsp;</td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>time_rec</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
-<div class="memdoc">
-As the initiator build a context with an acceptor.<p>
-Returns in the major<ul>
-<li>GSS_S_COMPLETE - if the context if build</li><li>GSS_S_CONTINUE_NEEDED - if the caller needs to continue another round of gss_i nit_sec_context</li><li>error code - any other error code</li></ul>
-<dl compact><dt><b>Parameters:</b></dt><dd>
- <table border="0" cellspacing="2" cellpadding="0">
- <tr><td valign="top"></td><td valign="top"><em>minor_status</em>&nbsp;</td><td>minor status code.</td></tr>
- <tr><td valign="top"></td><td valign="top"><em>initiator_cred_handle</em>&nbsp;</td><td>the credential to use when building the context, if GSS_C_NO_CREDENTIAL is passed, the default credential for the mechanism will be used.</td></tr>
- <tr><td valign="top"></td><td valign="top"><em>context_handle</em>&nbsp;</td><td>a pointer to a context handle, will be returned as long as there is not an error.</td></tr>
- <tr><td valign="top"></td><td valign="top"><em>target_name</em>&nbsp;</td><td>the target name of acceptor, created using <a class="el" href="group__gssapi.html#g0afe06fd5264ebfb93ecca4bcc70895b">gss_import_name()</a>. The name is can be of any name types the mechanism supports, check supported name types with gss_inquire_names_for_mech().</td></tr>
- <tr><td valign="top"></td><td valign="top"><em>input_mech_type</em>&nbsp;</td><td>mechanism type to use, if GSS_C_NO_OID is used, Kerberos (GSS_KRB5_MECHANISM) will be tried. Other available mechanism are listed in the <a class="el" href="gssapi_mechs_intro.html">GSS-API mechanisms</a> section.</td></tr>
- <tr><td valign="top"></td><td valign="top"><em>req_flags</em>&nbsp;</td><td>flags using when building the context, see <a class="el" href="gssapi_services_intro.html#gssapi_context_flags">Context creation flags</a></td></tr>
- <tr><td valign="top"></td><td valign="top"><em>time_req</em>&nbsp;</td><td>time requested this context should be valid in seconds, common used value is GSS_C_INDEFINITE</td></tr>
- <tr><td valign="top"></td><td valign="top"><em>input_chan_bindings</em>&nbsp;</td><td>Channel bindings used, if not exepected otherwise, used GSS_C_NO_CHANNEL_BINDINGS</td></tr>
- <tr><td valign="top"></td><td valign="top"><em>input_token</em>&nbsp;</td><td>input token sent from the acceptor, for the initial packet the buffer of { NULL, 0 } should be used.</td></tr>
- <tr><td valign="top"></td><td valign="top"><em>actual_mech_type</em>&nbsp;</td><td>the actual mech used, MUST NOT be freed since it pointing to static memory.</td></tr>
- <tr><td valign="top"></td><td valign="top"><em>output_token</em>&nbsp;</td><td>if there is an output token, regardless of complete, continue_needed, or error it should be sent to the acceptor</td></tr>
- <tr><td valign="top"></td><td valign="top"><em>ret_flags</em>&nbsp;</td><td>return what flags was negotitated, caller should check if they are accetable. For example, if GSS_C_MUTUAL_FLAG was negotiated with the acceptor or not.</td></tr>
- <tr><td valign="top"></td><td valign="top"><em>time_rec</em>&nbsp;</td><td>amount of time this context is valid for</td></tr>
+</div><div class="memdoc">
+<p>As the initiator build a context with an acceptor.</p>
+<p>Returns in the major</p><ul>
+<li>GSS_S_COMPLETE - if the context if build</li>
+<li>GSS_S_CONTINUE_NEEDED - if the caller needs to continue another round of gss_i nit_sec_context</li>
+<li>error code - any other error code</li>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">minor_status</td><td>minor status code.</td></tr>
+ <tr><td class="paramname">initiator_cred_handle</td><td>the credential to use when building the context, if GSS_C_NO_CREDENTIAL is passed, the default credential for the mechanism will be used.</td></tr>
+ <tr><td class="paramname">context_handle</td><td>a pointer to a context handle, will be returned as long as there is not an error.</td></tr>
+ <tr><td class="paramname">target_name</td><td>the target name of acceptor, created using <a class="el" href="group__gssapi.html#ga0afe06fd5264ebfb93ecca4bcc70895b">gss_import_name()</a>. The name is can be of any name types the mechanism supports, check supported name types with gss_inquire_names_for_mech().</td></tr>
+ <tr><td class="paramname">input_mech_type</td><td>mechanism type to use, if GSS_C_NO_OID is used, Kerberos (GSS_KRB5_MECHANISM) will be tried. Other available mechanism are listed in the <a class="el" href="gssapi_mechs_intro.html">GSS-API mechanisms</a> section.</td></tr>
+ <tr><td class="paramname">req_flags</td><td>flags using when building the context, see <a class="el" href="gssapi_services_intro.html#gssapi_context_flags">Context creation flags</a></td></tr>
+ <tr><td class="paramname">time_req</td><td>time requested this context should be valid in seconds, common used value is GSS_C_INDEFINITE</td></tr>
+ <tr><td class="paramname">input_chan_bindings</td><td>Channel bindings used, if not exepected otherwise, used GSS_C_NO_CHANNEL_BINDINGS</td></tr>
+ <tr><td class="paramname">input_token</td><td>input token sent from the acceptor, for the initial packet the buffer of { NULL, 0 } should be used.</td></tr>
+ <tr><td class="paramname">actual_mech_type</td><td>the actual mech used, MUST NOT be freed since it pointing to static memory.</td></tr>
+ <tr><td class="paramname">output_token</td><td>if there is an output token, regardless of complete, continue_needed, or error it should be sent to the acceptor</td></tr>
+ <tr><td class="paramname">ret_flags</td><td>return what flags was negotitated, caller should check if they are accetable. For example, if GSS_C_MUTUAL_FLAG was negotiated with the acceptor or not.</td></tr>
+ <tr><td class="paramname">time_rec</td><td>amount of time this context is valid for</td></tr>
+ </dd>
-<dl class="return" compact><dt><b>Returns:</b></dt><dd>a gss_error code, see gss_display_status() about printing the error code. </dd></dl>
+<dl class="section return"><dt>Returns</dt><dd>a gss_error code, see <a class="el" href="group__gssapi.html#ga770d87c1b80a58e91ec3a9ed70468122">gss_display_status()</a> about printing the error code. </dd></dl>
-<a class="anchor" name="gf472671a43512495de04ca0c69079e5d"></a><!-- doxytag: member="gss_mo.c::gss_inquire_attrs_for_mech" ref="gf472671a43512495de04ca0c69079e5d" args="(OM_uint32 *minor_status, gss_const_OID mech, gss_OID_set *mech_attr, gss_OID_set *known_mech_attrs)" -->
+<a id="gaf472671a43512495de04ca0c69079e5d"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#gaf472671a43512495de04ca0c69079e5d">&#9670;&nbsp;</a></span>gss_inquire_attrs_for_mech()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_inquire_attrs_for_mech </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_inquire_attrs_for_mech </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_const_OID&nbsp;</td>
- <td class="paramname"> <em>mech</em>, </td>
+ <td class="paramtype">gss_const_OID&#160;</td>
+ <td class="paramname"><em>mech</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_OID_set *&nbsp;</td>
- <td class="paramname"> <em>mech_attr</em>, </td>
+ <td class="paramtype">gss_OID_set *&#160;</td>
+ <td class="paramname"><em>mech_attr</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_OID_set *&nbsp;</td>
- <td class="paramname"> <em>known_mech_attrs</em></td><td>&nbsp;</td>
+ <td class="paramtype">gss_OID_set *&#160;</td>
+ <td class="paramname"><em>known_mech_attrs</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
-<div class="memdoc">
-List support attributes for a mech and/or all mechanisms.<p>
-<dl compact><dt><b>Parameters:</b></dt><dd>
- <table border="0" cellspacing="2" cellpadding="0">
- <tr><td valign="top"></td><td valign="top"><em>minor_status</em>&nbsp;</td><td>minor status code </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>mech</em>&nbsp;</td><td>given together with mech_attr will return the list of attributes for mechanism, can optionally be GSS_C_NO_OID. </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>mech_attr</em>&nbsp;</td><td>see mech parameter, can optionally be NULL, release with gss_release_oid_set(). </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>known_mech_attrs</em>&nbsp;</td><td>all attributes for mechanisms supported, release with gss_release_oid_set(). </td></tr>
+</div><div class="memdoc">
+<p>List support attributes for a mech and/or all mechanisms.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">minor_status</td><td>minor status code </td></tr>
+ <tr><td class="paramname">mech</td><td>given together with mech_attr will return the list of attributes for mechanism, can optionally be GSS_C_NO_OID. </td></tr>
+ <tr><td class="paramname">mech_attr</td><td>see mech parameter, can optionally be NULL, release with gss_release_oid_set(). </td></tr>
+ <tr><td class="paramname">known_mech_attrs</td><td>all attributes for mechanisms supported, release with gss_release_oid_set(). </td></tr>
+ </dd>
-<a class="anchor" name="gdc725eaf82322d8cf50812fc26442893"></a><!-- doxytag: member="gss_mo.c::gss_inquire_saslname_for_mech" ref="gdc725eaf82322d8cf50812fc26442893" args="(OM_uint32 *minor_status, const gss_OID desired_mech, gss_buffer_t sasl_mech_name, gss_buffer_t mech_name, gss_buffer_t mech_description)" -->
+<a id="gadc725eaf82322d8cf50812fc26442893"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#gadc725eaf82322d8cf50812fc26442893">&#9670;&nbsp;</a></span>gss_inquire_saslname_for_mech()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_inquire_saslname_for_mech </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_inquire_saslname_for_mech </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_OID&nbsp;</td>
- <td class="paramname"> <em>desired_mech</em>, </td>
+ <td class="paramtype">const gss_OID&#160;</td>
+ <td class="paramname"><em>desired_mech</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_buffer_t&nbsp;</td>
- <td class="paramname"> <em>sasl_mech_name</em>, </td>
+ <td class="paramtype">gss_buffer_t&#160;</td>
+ <td class="paramname"><em>sasl_mech_name</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_buffer_t&nbsp;</td>
- <td class="paramname"> <em>mech_name</em>, </td>
+ <td class="paramtype">gss_buffer_t&#160;</td>
+ <td class="paramname"><em>mech_name</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_buffer_t&nbsp;</td>
- <td class="paramname"> <em>mech_description</em></td><td>&nbsp;</td>
+ <td class="paramtype">gss_buffer_t&#160;</td>
+ <td class="paramname"><em>mech_description</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
-<div class="memdoc">
-Returns different protocol names and description of the mechanism.<p>
-<dl compact><dt><b>Parameters:</b></dt><dd>
- <table border="0" cellspacing="2" cellpadding="0">
- <tr><td valign="top"></td><td valign="top"><em>minor_status</em>&nbsp;</td><td>minor status code </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>desired_mech</em>&nbsp;</td><td>mech list query </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>sasl_mech_name</em>&nbsp;</td><td>SASL GS2 protocol name </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>mech_name</em>&nbsp;</td><td>gssapi protocol name </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>mech_description</em>&nbsp;</td><td>description of gssapi mech</td></tr>
+</div><div class="memdoc">
+<p>Returns different protocol names and description of the mechanism.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">minor_status</td><td>minor status code </td></tr>
+ <tr><td class="paramname">desired_mech</td><td>mech list query </td></tr>
+ <tr><td class="paramname">sasl_mech_name</td><td>SASL GS2 protocol name </td></tr>
+ <tr><td class="paramname">mech_name</td><td>gssapi protocol name </td></tr>
+ <tr><td class="paramname">mech_description</td><td>description of gssapi mech</td></tr>
+ </dd>
-<dl class="return" compact><dt><b>Returns:</b></dt><dd>returns GSS_S_COMPLETE or a error code. </dd></dl>
+<dl class="section return"><dt>Returns</dt><dd>returns GSS_S_COMPLETE or a error code. </dd></dl>
-<a class="anchor" name="gc98677df7ae9bbc387cd68002a97ad15"></a><!-- doxytag: member="gss_oid_equal.c::gss_oid_equal" ref="gc98677df7ae9bbc387cd68002a97ad15" args="(gss_const_OID a, gss_const_OID b)" -->
+<a id="gac98677df7ae9bbc387cd68002a97ad15"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#gac98677df7ae9bbc387cd68002a97ad15">&#9670;&nbsp;</a></span>gss_oid_equal()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION int GSSAPI_LIB_CALL gss_oid_equal </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION int GSSAPI_LIB_CALL gss_oid_equal </td>
- <td class="paramtype">gss_const_OID&nbsp;</td>
- <td class="paramname"> <em>a</em>, </td>
+ <td class="paramtype">gss_const_OID&#160;</td>
+ <td class="paramname"><em>a</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_const_OID&nbsp;</td>
- <td class="paramname"> <em>b</em></td><td>&nbsp;</td>
+ <td class="paramtype">gss_const_OID&#160;</td>
+ <td class="paramname"><em>b</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
-<div class="memdoc">
-Compare two GSS-API OIDs with each other.<p>
-GSS_C_NO_OID matches nothing, not even it-self.<p>
-<dl compact><dt><b>Parameters:</b></dt><dd>
- <table border="0" cellspacing="2" cellpadding="0">
- <tr><td valign="top"></td><td valign="top"><em>a</em>&nbsp;</td><td>first oid to compare </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>b</em>&nbsp;</td><td>second oid to compare</td></tr>
+</div><div class="memdoc">
+<p>Compare two GSS-API OIDs with each other.</p>
+<p>GSS_C_NO_OID matches nothing, not even it-self.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">a</td><td>first oid to compare </td></tr>
+ <tr><td class="paramname">b</td><td>second oid to compare</td></tr>
+ </dd>
-<dl class="return" compact><dt><b>Returns:</b></dt><dd>non-zero when both oid are the same OID, zero when they are not the same. </dd></dl>
+<dl class="section return"><dt>Returns</dt><dd>non-zero when both oid are the same OID, zero when they are not the same. </dd></dl>
-<a class="anchor" name="gd2990721c56fe83e06d45648874680d7"></a><!-- doxytag: member="gss_release_cred.c::gss_release_cred" ref="gd2990721c56fe83e06d45648874680d7" args="(OM_uint32 *minor_status, gss_cred_id_t *cred_handle)" -->
+<a id="gad2990721c56fe83e06d45648874680d7"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#gad2990721c56fe83e06d45648874680d7">&#9670;&nbsp;</a></span>gss_release_cred()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_release_cred </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_release_cred </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_cred_id_t *&nbsp;</td>
- <td class="paramname"> <em>cred_handle</em></td><td>&nbsp;</td>
+ <td class="paramtype">gss_cred_id_t *&#160;</td>
+ <td class="paramname"><em>cred_handle</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
-<div class="memdoc">
-Release a credentials<p>
-Its ok to release the GSS_C_NO_CREDENTIAL/NULL credential, it will return a GSS_S_COMPLETE error code. On return cred_handle is set ot GSS_C_NO_CREDENTIAL.<p>
-<div class="fragment"><pre class="fragment"> gss_cred_id_t cred = GSS_C_NO_CREDENTIAL;
- major = <a class="code" href="group__gssapi.html#gd2990721c56fe83e06d45648874680d7">gss_release_cred</a>(&amp;minor, &amp;cred);
-<dl compact><dt><b>Parameters:</b></dt><dd>
- <table border="0" cellspacing="2" cellpadding="0">
- <tr><td valign="top"></td><td valign="top"><em>minor_status</em>&nbsp;</td><td>minor status return code, mech specific </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>cred_handle</em>&nbsp;</td><td>a pointer to the credential too release</td></tr>
+</div><div class="memdoc">
+<p>Release a credentials</p>
+<p>Its ok to release the GSS_C_NO_CREDENTIAL/NULL credential, it will return a GSS_S_COMPLETE error code. On return cred_handle is set ot GSS_C_NO_CREDENTIAL.</p>
+<div class="fragment"><div class="line">gss_cred_id_t cred = GSS_C_NO_CREDENTIAL;</div><div class="line">major = <a class="code" href="group__gssapi.html#gad2990721c56fe83e06d45648874680d7">gss_release_cred</a>(&amp;minor, &amp;cred);</div></div><!-- fragment --><dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">minor_status</td><td>minor status return code, mech specific </td></tr>
+ <tr><td class="paramname">cred_handle</td><td>a pointer to the credential too release</td></tr>
+ </dd>
-<dl class="return" compact><dt><b>Returns:</b></dt><dd>an gssapi error code </dd></dl>
+<dl class="section return"><dt>Returns</dt><dd>an gssapi error code </dd></dl>
-<a class="anchor" name="g2dbb20a4c9a3cf5072ef081cd37e54b4"></a><!-- doxytag: member="gss_aeap.c::gss_release_iov_buffer" ref="g2dbb20a4c9a3cf5072ef081cd37e54b4" args="(OM_uint32 *minor_status, gss_iov_buffer_desc *iov, int iov_count)" -->
+<a id="ga2dbb20a4c9a3cf5072ef081cd37e54b4"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#ga2dbb20a4c9a3cf5072ef081cd37e54b4">&#9670;&nbsp;</a></span>gss_release_iov_buffer()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_release_iov_buffer </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_release_iov_buffer </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_iov_buffer_desc *&nbsp;</td>
- <td class="paramname"> <em>iov</em>, </td>
+ <td class="paramtype">gss_iov_buffer_desc *&#160;</td>
+ <td class="paramname"><em>iov</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">int&nbsp;</td>
- <td class="paramname"> <em>iov_count</em></td><td>&nbsp;</td>
+ <td class="paramtype">int&#160;</td>
+ <td class="paramname"><em>iov_count</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
-<div class="memdoc">
+</div><div class="memdoc">
+<p>Free all buffer allocated by <a class="el" href="group__gssapi.html#gab02ec963066cc8e5e6682799457208e9">gss_wrap_iov()</a> or <a class="el" href="group__gssapi.html#ga399bb326e47574aca7b28d6886d29fd0">gss_unwrap_iov()</a> by looking at the GSS_IOV_BUFFER_FLAG_ALLOCATED flag. </p>
-Free all buffer allocated by <a class="el" href="group__gssapi.html#gb02ec963066cc8e5e6682799457208e9">gss_wrap_iov()</a> or <a class="el" href="group__gssapi.html#g399bb326e47574aca7b28d6886d29fd0">gss_unwrap_iov()</a> by looking at the GSS_IOV_BUFFER_FLAG_ALLOCATED flag.
-<a class="anchor" name="g0691190338f1f24170bd5f695ff1e721"></a><!-- doxytag: member="gss_release_name.c::gss_release_name" ref="g0691190338f1f24170bd5f695ff1e721" args="(OM_uint32 *minor_status, gss_name_t *input_name)" -->
+<a id="ga0691190338f1f24170bd5f695ff1e721"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#ga0691190338f1f24170bd5f695ff1e721">&#9670;&nbsp;</a></span>gss_release_name()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_release_name </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_release_name </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_name_t *&nbsp;</td>
- <td class="paramname"> <em>input_name</em></td><td>&nbsp;</td>
+ <td class="paramtype">gss_name_t *&#160;</td>
+ <td class="paramname"><em>input_name</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
-<div class="memdoc">
-Free a name<p>
-import_name can point to NULL or be NULL, or a pointer to a gss_name_t structure. If it was a pointer to gss_name_t, the pointer will be set to NULL on success and failure.<p>
-<dl compact><dt><b>Parameters:</b></dt><dd>
- <table border="0" cellspacing="2" cellpadding="0">
- <tr><td valign="top"></td><td valign="top"><em>minor_status</em>&nbsp;</td><td>minor status code </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>input_name</em>&nbsp;</td><td>name to free</td></tr>
+</div><div class="memdoc">
+<p>Free a name</p>
+<p>import_name can point to NULL or be NULL, or a pointer to a gss_name_t structure. If it was a pointer to gss_name_t, the pointer will be set to NULL on success and failure.</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">minor_status</td><td>minor status code </td></tr>
+ <tr><td class="paramname">input_name</td><td>name to free</td></tr>
+ </dd>
-<dl class="return" compact><dt><b>Returns:</b></dt><dd>a gss_error code, see gss_display_status() about printing the error code. </dd></dl>
+<dl class="section return"><dt>Returns</dt><dd>a gss_error code, see <a class="el" href="group__gssapi.html#ga770d87c1b80a58e91ec3a9ed70468122">gss_display_status()</a> about printing the error code. </dd></dl>
-<a class="anchor" name="g399bb326e47574aca7b28d6886d29fd0"></a><!-- doxytag: member="gss_aeap.c::gss_unwrap_iov" ref="g399bb326e47574aca7b28d6886d29fd0" args="(OM_uint32 *minor_status, gss_ctx_id_t context_handle, int *conf_state, gss_qop_t *qop_state, gss_iov_buffer_desc *iov, int iov_count)" -->
+<a id="ga399bb326e47574aca7b28d6886d29fd0"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#ga399bb326e47574aca7b28d6886d29fd0">&#9670;&nbsp;</a></span>gss_unwrap_iov()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_unwrap_iov </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_unwrap_iov </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_ctx_id_t&nbsp;</td>
- <td class="paramname"> <em>context_handle</em>, </td>
+ <td class="paramtype">gss_ctx_id_t&#160;</td>
+ <td class="paramname"><em>context_handle</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">int *&nbsp;</td>
- <td class="paramname"> <em>conf_state</em>, </td>
+ <td class="paramtype">int *&#160;</td>
+ <td class="paramname"><em>conf_state</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_qop_t *&nbsp;</td>
- <td class="paramname"> <em>qop_state</em>, </td>
+ <td class="paramtype">gss_qop_t *&#160;</td>
+ <td class="paramname"><em>qop_state</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_iov_buffer_desc *&nbsp;</td>
- <td class="paramname"> <em>iov</em>, </td>
+ <td class="paramtype">gss_iov_buffer_desc *&#160;</td>
+ <td class="paramname"><em>iov</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">int&nbsp;</td>
- <td class="paramname"> <em>iov_count</em></td><td>&nbsp;</td>
+ <td class="paramtype">int&#160;</td>
+ <td class="paramname"><em>iov_count</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
-<div class="memdoc">
+</div><div class="memdoc">
+<p>Decrypt or verifies the signature on the data. </p>
-Decrypt or verifies the signature on the data.
-<a class="anchor" name="g89a6d98056b75a8a25152de268833f51"></a><!-- doxytag: member="gss_wrap.c::gss_wrap" ref="g89a6d98056b75a8a25152de268833f51" args="(OM_uint32 *minor_status, const gss_ctx_id_t context_handle, int conf_req_flag, gss_qop_t qop_req, const gss_buffer_t input_message_buffer, int *conf_state, gss_buffer_t output_message_buffer)" -->
+<a id="ga4058cf5c3b04fd25f8339c71dd5e964c"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#ga4058cf5c3b04fd25f8339c71dd5e964c">&#9670;&nbsp;</a></span>gss_wrap()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_wrap </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_wrap </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_ctx_id_t&nbsp;</td>
- <td class="paramname"> <em>context_handle</em>, </td>
+ <td class="paramtype">gss_const_ctx_id_t&#160;</td>
+ <td class="paramname"><em>context_handle</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">int&nbsp;</td>
- <td class="paramname"> <em>conf_req_flag</em>, </td>
+ <td class="paramtype">int&#160;</td>
+ <td class="paramname"><em>conf_req_flag</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_qop_t&nbsp;</td>
- <td class="paramname"> <em>qop_req</em>, </td>
+ <td class="paramtype">gss_qop_t&#160;</td>
+ <td class="paramname"><em>qop_req</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">const gss_buffer_t&nbsp;</td>
- <td class="paramname"> <em>input_message_buffer</em>, </td>
+ <td class="paramtype">const gss_buffer_t&#160;</td>
+ <td class="paramname"><em>input_message_buffer</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">int *&nbsp;</td>
- <td class="paramname"> <em>conf_state</em>, </td>
+ <td class="paramtype">int *&#160;</td>
+ <td class="paramname"><em>conf_state</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_buffer_t&nbsp;</td>
- <td class="paramname"> <em>output_message_buffer</em></td><td>&nbsp;</td>
+ <td class="paramtype">gss_buffer_t&#160;</td>
+ <td class="paramname"><em>output_message_buffer</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
-<div class="memdoc">
-Wrap a message using either confidentiality (encryption + signature) or sealing (signature).<p>
-<dl compact><dt><b>Parameters:</b></dt><dd>
- <table border="0" cellspacing="2" cellpadding="0">
- <tr><td valign="top"></td><td valign="top"><em>minor_status</em>&nbsp;</td><td>minor status code. </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>context_handle</em>&nbsp;</td><td>context handle. </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>conf_req_flag</em>&nbsp;</td><td>if non zero, confidentiality is requestd. </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>qop_req</em>&nbsp;</td><td>type of protection needed, in most cases it GSS_C_QOP_DEFAULT should be passed in. </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>input_message_buffer</em>&nbsp;</td><td>messages to wrap </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>conf_state</em>&nbsp;</td><td>returns non zero if confidentiality was honoured. </td></tr>
- <tr><td valign="top"></td><td valign="top"><em>output_message_buffer</em>&nbsp;</td><td>the resulting buffer, release with gss_release_buffer(). </td></tr>
+</div><div class="memdoc">
+<p>Wrap a message using either confidentiality (encryption + signature) or sealing (signature).</p>
+<dl class="params"><dt>Parameters</dt><dd>
+ <table class="params">
+ <tr><td class="paramname">minor_status</td><td>minor status code. </td></tr>
+ <tr><td class="paramname">context_handle</td><td>context handle. </td></tr>
+ <tr><td class="paramname">conf_req_flag</td><td>if non zero, confidentiality is requestd. </td></tr>
+ <tr><td class="paramname">qop_req</td><td>type of protection needed, in most cases it GSS_C_QOP_DEFAULT should be passed in. </td></tr>
+ <tr><td class="paramname">input_message_buffer</td><td>messages to wrap </td></tr>
+ <tr><td class="paramname">conf_state</td><td>returns non zero if confidentiality was honoured. </td></tr>
+ <tr><td class="paramname">output_message_buffer</td><td>the resulting buffer, release with gss_release_buffer(). </td></tr>
+ </dd>
-<a class="anchor" name="gb02ec963066cc8e5e6682799457208e9"></a><!-- doxytag: member="gss_aeap.c::gss_wrap_iov" ref="gb02ec963066cc8e5e6682799457208e9" args="(OM_uint32 *minor_status, gss_ctx_id_t context_handle, int conf_req_flag, gss_qop_t qop_req, int *conf_state, gss_iov_buffer_desc *iov, int iov_count)" -->
+<a id="gab02ec963066cc8e5e6682799457208e9"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#gab02ec963066cc8e5e6682799457208e9">&#9670;&nbsp;</a></span>gss_wrap_iov()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_wrap_iov </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_wrap_iov </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_ctx_id_t&nbsp;</td>
- <td class="paramname"> <em>context_handle</em>, </td>
+ <td class="paramtype">gss_ctx_id_t&#160;</td>
+ <td class="paramname"><em>context_handle</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">int&nbsp;</td>
- <td class="paramname"> <em>conf_req_flag</em>, </td>
+ <td class="paramtype">int&#160;</td>
+ <td class="paramname"><em>conf_req_flag</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_qop_t&nbsp;</td>
- <td class="paramname"> <em>qop_req</em>, </td>
+ <td class="paramtype">gss_qop_t&#160;</td>
+ <td class="paramname"><em>qop_req</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">int *&nbsp;</td>
- <td class="paramname"> <em>conf_state</em>, </td>
+ <td class="paramtype">int *&#160;</td>
+ <td class="paramname"><em>conf_state</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_iov_buffer_desc *&nbsp;</td>
- <td class="paramname"> <em>iov</em>, </td>
+ <td class="paramtype">gss_iov_buffer_desc *&#160;</td>
+ <td class="paramname"><em>iov</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">int&nbsp;</td>
- <td class="paramname"> <em>iov_count</em></td><td>&nbsp;</td>
+ <td class="paramtype">int&#160;</td>
+ <td class="paramname"><em>iov_count</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
-<div class="memdoc">
-Encrypts or sign the data.<p>
-This is a more complicated version of <a class="el" href="group__gssapi.html#g89a6d98056b75a8a25152de268833f51">gss_wrap()</a>, it allows the caller to use AEAD data (signed header/trailer) and allow greater controll over where the encrypted data is placed.<p>
-The maximum packet size is gss_context_stream_sizes.max_msg_size.<p>
-The caller needs provide the folloing buffers when using in conf_req_flag=1 mode:<p>
+</div><div class="memdoc">
+<p>Encrypts or sign the data.</p>
+<p>This is a more complicated version of <a class="el" href="group__gssapi.html#ga4058cf5c3b04fd25f8339c71dd5e964c">gss_wrap()</a>, it allows the caller to use AEAD data (signed header/trailer) and allow greater controll over where the encrypted data is placed.</p>
+<p>The maximum packet size is gss_context_stream_sizes.max_msg_size.</p>
+<p>The caller needs provide the folloing buffers when using in conf_req_flag=1 mode:</p>
-<li>HEADER (of size gss_context_stream_sizes.header) { DATA or SIGN_ONLY } (optional, zero or more) PADDING (of size gss_context_stream_sizes.blocksize, if zero padding is zero, can be omitted) TRAILER (of size gss_context_stream_sizes.trailer)</li></ul>
+<li>HEADER (of size gss_context_stream_sizes.header) { DATA or SIGN_ONLY } (optional, zero or more) PADDING (of size gss_context_stream_sizes.blocksize, if zero padding is zero, can be omitted) TRAILER (of size gss_context_stream_sizes.trailer)</li>
+<li>on DCE-RPC mode, the caller can skip PADDING and TRAILER if the DATA elements is padded to a block bountry and header is of at least size gss_context_stream_sizes.header + gss_context_stream_sizes.trailer.</li>
+<p>HEADER, PADDING, TRAILER will be shrunken to the size required to transmit any of them too large.</p>
+<p>To generate <a class="el" href="group__gssapi.html#ga4058cf5c3b04fd25f8339c71dd5e964c">gss_wrap()</a> compatible packets, use: HEADER | DATA | PADDING | TRAILER</p>
+<p>When used in conf_req_flag=0,</p>
-<li>on DCE-RPC mode, the caller can skip PADDING and TRAILER if the DATA elements is padded to a block bountry and header is of at least size gss_context_stream_sizes.header + gss_context_stream_sizes.trailer.</li></ul>
-HEADER, PADDING, TRAILER will be shrunken to the size required to transmit any of them too large.<p>
-To generate <a class="el" href="group__gssapi.html#g89a6d98056b75a8a25152de268833f51">gss_wrap()</a> compatible packets, use: HEADER | DATA | PADDING | TRAILER<p>
-When used in conf_req_flag=0,<p>
-<li>HEADER (of size gss_context_stream_sizes.header) { DATA or SIGN_ONLY } (optional, zero or more) PADDING (of size gss_context_stream_sizes.blocksize, if zero padding is zero, can be omitted) TRAILER (of size gss_context_stream_sizes.trailer)</li></ul>
-The input sizes of HEADER, PADDING and TRAILER can be fetched using <a class="el" href="group__gssapi.html#g6216cfcb1ba8dc2d1a1d680d21752f26">gss_wrap_iov_length()</a> or gss_context_query_attributes().
+<li>HEADER (of size gss_context_stream_sizes.header) { DATA or SIGN_ONLY } (optional, zero or more) PADDING (of size gss_context_stream_sizes.blocksize, if zero padding is zero, can be omitted) TRAILER (of size gss_context_stream_sizes.trailer)</li>
+<p>The input sizes of HEADER, PADDING and TRAILER can be fetched using <a class="el" href="group__gssapi.html#ga6216cfcb1ba8dc2d1a1d680d21752f26">gss_wrap_iov_length()</a> or gss_context_query_attributes(). </p>
-<a class="anchor" name="g6216cfcb1ba8dc2d1a1d680d21752f26"></a><!-- doxytag: member="gss_aeap.c::gss_wrap_iov_length" ref="g6216cfcb1ba8dc2d1a1d680d21752f26" args="(OM_uint32 *minor_status, gss_ctx_id_t context_handle, int conf_req_flag, gss_qop_t qop_req, int *conf_state, gss_iov_buffer_desc *iov, int iov_count)" -->
+<a id="ga6216cfcb1ba8dc2d1a1d680d21752f26"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#ga6216cfcb1ba8dc2d1a1d680d21752f26">&#9670;&nbsp;</a></span>gss_wrap_iov_length()</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_wrap_iov_length </td>
+ <td class="memname">GSSAPI_LIB_FUNCTION OM_uint32 GSSAPI_LIB_CALL gss_wrap_iov_length </td>
- <td class="paramtype">OM_uint32 *&nbsp;</td>
- <td class="paramname"> <em>minor_status</em>, </td>
+ <td class="paramtype">OM_uint32 *&#160;</td>
+ <td class="paramname"><em>minor_status</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_ctx_id_t&nbsp;</td>
- <td class="paramname"> <em>context_handle</em>, </td>
+ <td class="paramtype">gss_ctx_id_t&#160;</td>
+ <td class="paramname"><em>context_handle</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">int&nbsp;</td>
- <td class="paramname"> <em>conf_req_flag</em>, </td>
+ <td class="paramtype">int&#160;</td>
+ <td class="paramname"><em>conf_req_flag</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_qop_t&nbsp;</td>
- <td class="paramname"> <em>qop_req</em>, </td>
+ <td class="paramtype">gss_qop_t&#160;</td>
+ <td class="paramname"><em>qop_req</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">int *&nbsp;</td>
- <td class="paramname"> <em>conf_state</em>, </td>
+ <td class="paramtype">int *&#160;</td>
+ <td class="paramname"><em>conf_state</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">gss_iov_buffer_desc *&nbsp;</td>
- <td class="paramname"> <em>iov</em>, </td>
+ <td class="paramtype">gss_iov_buffer_desc *&#160;</td>
+ <td class="paramname"><em>iov</em>, </td>
<td class="paramkey"></td>
- <td class="paramtype">int&nbsp;</td>
- <td class="paramname"> <em>iov_count</em></td><td>&nbsp;</td>
+ <td class="paramtype">int&#160;</td>
+ <td class="paramname"><em>iov_count</em>&#160;</td>
- <td></td><td></td><td></td>
+ <td></td><td></td>
-<div class="memdoc">
+</div><div class="memdoc">
+<p>Update the length fields in iov buffer for the types:</p><ul>
+<p>Consider using gss_context_query_attributes() to fetch the data instead. </p>
-Update the length fields in iov buffer for the types:<ul>
-Consider using gss_context_query_attributes() to fetch the data instead.
-<hr><h2>Variable Documentation</h2>
-<a class="anchor" name="g961f7a7f9f92e06b91c6d503e524a672"></a><!-- doxytag: member="gss_aeap.c::__gss_c_attr_stream_sizes_oid_desc" ref="g961f7a7f9f92e06b91c6d503e524a672" args="" -->
+<h2 class="groupheader">Variable Documentation</h2>
+<a id="ga961f7a7f9f92e06b91c6d503e524a672"></a>
+<h2 class="memtitle"><span class="permalink"><a href="#ga961f7a7f9f92e06b91c6d503e524a672">&#9670;&nbsp;</a></span>__gss_c_attr_stream_sizes_oid_desc</h2>
<div class="memitem">
<div class="memproto">
<table class="memname">
- <td class="memname">gss_OID_desc GSSAPI_LIB_FUNCTION <a class="el" href="group__gssapi.html#g961f7a7f9f92e06b91c6d503e524a672">__gss_c_attr_stream_sizes_oid_desc</a> </td>
+ <td class="memname">gss_OID_desc GSSAPI_LIB_FUNCTION __gss_c_attr_stream_sizes_oid_desc</td>
-<div class="memdoc">
-<b>Initial value:</b><div class="fragment"><pre class="fragment">
- {10, rk_UNCONST(<span class="stringliteral">"\x2a\x86\x48\x86\xf7\x12\x01\x02\x01\x03"</span>)}
-</pre></div>Query the context for parameters.<p>
-SSPI equivalent if this function is QueryContextAttributes.<p>
+</div><div class="memdoc">
+<b>Initial value:</b><div class="fragment"><div class="line">=</div><div class="line"> {10, rk_UNCONST(<span class="stringliteral">&quot;\x2a\x86\x48\x86\xf7\x12\x01\x02\x01\x03&quot;</span>)}</div></div><!-- fragment --><p>Query the context for parameters.</p>
+<p>SSPI equivalent if this function is QueryContextAttributes.</p>
-<li>GSS_C_ATTR_STREAM_SIZES data is a gss_context_stream_sizes. </li></ul>
+<li>GSS_C_ATTR_STREAM_SIZES data is a gss_context_stream_sizes. </li>
+</div><!-- contents -->
<hr size="1"><address style="text-align: right;"><small>
-Generated on Wed Jan 11 14:07:44 2012 for HeimdalGSS-APIlibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.5.6</small></address>
+Generated on Fri Dec 8 2017 03:48:58 for HeimdalGSS-APIlibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.8.13</small></address>
diff --git a/doc/doxyout/gssapi/html/gssapi_mechs_intro.html b/doc/doxyout/gssapi/html/gssapi_mechs_intro.html
index cc28b7b74f9b..8dc4dc867309 100644
--- a/doc/doxyout/gssapi/html/gssapi_mechs_intro.html
+++ b/doc/doxyout/gssapi/html/gssapi_mechs_intro.html
@@ -1,6 +1,6 @@
<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN">
<html><head><meta http-equiv="Content-Type" content="text/html;charset=UTF-8">
-<title>HeimdalGSS-APIlibrary: GSS-API mechanisms</title>
+<title>GSS-API mechanisms</title>
<link href="doxygen.css" rel="stylesheet" type="text/css">
<link href="tabs.css" rel="stylesheet" type="text/css">
@@ -8,23 +8,30 @@
<a href="http://www.h5l.org/"><img src="http://www.h5l.org/keyhole-heimdal.png" alt="keyhole logo"/></a>
<!-- end of header marker -->
-<!-- Generated by Doxygen 1.5.6 -->
-<div class="navigation" id="top">
- <div class="tabs">
- <ul>
- <li><a href="index.html"><span>Main&nbsp;Page</span></a></li>
- <li><a href="pages.html"><span>Related&nbsp;Pages</span></a></li>
- <li><a href="modules.html"><span>Modules</span></a></li>
- </ul>
- </div>
+<!-- Generated by Doxygen 1.8.13 -->
+<script type="text/javascript" src="menudata.js"></script>
+<script type="text/javascript" src="menu.js"></script>
+<script type="text/javascript">
+$(function() {
+ initMenu('',false,false,'search.php','Search');
+<div id="main-nav"></div>
+</div><!-- top -->
+<div class="header">
+ <div class="headertitle">
+<div class="title">GSS-API mechanisms </div> </div>
<div class="contents">
-<h1><a class="anchor" name="gssapi_mechs_intro">GSS-API mechanisms </a></h1><h2><a class="anchor" name="gssapi_mechs">
-GSS-API mechanisms</a></h2>
+<div class="textblock"><h1><a class="anchor" id="gssapi_mechs"></a>
+GSS-API mechanisms</h1>
+<li>Kerberos 5 - GSS_KRB5_MECHANISM</li>
+</div></div><!-- contents -->
<hr size="1"><address style="text-align: right;"><small>
-Generated on Wed Jan 11 14:07:43 2012 for HeimdalGSS-APIlibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.5.6</small></address>
+Generated on Fri Dec 8 2017 03:48:58 for HeimdalGSS-APIlibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.8.13</small></address>
diff --git a/doc/doxyout/gssapi/html/gssapi_services_intro.html b/doc/doxyout/gssapi/html/gssapi_services_intro.html
index 069bc942ea6a..3a4713933796 100644
--- a/doc/doxyout/gssapi/html/gssapi_services_intro.html
+++ b/doc/doxyout/gssapi/html/gssapi_services_intro.html
@@ -1,6 +1,6 @@
<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN">
<html><head><meta http-equiv="Content-Type" content="text/html;charset=UTF-8">
-<title>HeimdalGSS-APIlibrary: Introduction to GSS-API services</title>
+<title>Introduction to GSS-API services</title>
<link href="doxygen.css" rel="stylesheet" type="text/css">
<link href="tabs.css" rel="stylesheet" type="text/css">
@@ -8,36 +8,63 @@
<a href="http://www.h5l.org/"><img src="http://www.h5l.org/keyhole-heimdal.png" alt="keyhole logo"/></a>
<!-- end of header marker -->
-<!-- Generated by Doxygen 1.5.6 -->
-<div class="navigation" id="top">
- <div class="tabs">
- <ul>
- <li><a href="index.html"><span>Main&nbsp;Page</span></a></li>
- <li><a href="pages.html"><span>Related&nbsp;Pages</span></a></li>
- <li><a href="modules.html"><span>Modules</span></a></li>
- </ul>
- </div>
+<!-- Generated by Doxygen 1.8.13 -->
+<script type="text/javascript" src="menudata.js"></script>
+<script type="text/javascript" src="menu.js"></script>
+<script type="text/javascript">
+$(function() {
+ initMenu('',false,false,'search.php','Search');
+<div id="main-nav"></div>
+</div><!-- top -->
+<div class="header">
+ <div class="headertitle">
+<div class="title">Introduction to GSS-API services </div> </div>
<div class="contents">
-<h1><a class="anchor" name="gssapi_services_intro">Introduction to GSS-API services </a></h1><h2><a class="anchor" name="gssapi_services">
-GSS-API services</a></h2>
-<h3><a class="anchor" name="gssapi_services_context">
-Context creation</a></h3>
+<div class="textblock"><h1><a class="anchor" id="gssapi_services"></a>
+GSS-API services</h1>
+<h2><a class="anchor" id="gssapi_services_context"></a>
+Context creation</h2>
-<li>delegation</li><li>mutual authentication</li><li>anonymous</li><li>use per message before context creation has completed</li></ul>
-return status:<ul>
-<li>support conf</li><li>support int</li></ul>
-<h3><a class="anchor" name="gssapi_context_flags">
-Context creation flags</a></h3>
+<li>mutual authentication</li>
+<li>use per message before context creation has completed</li>
+<p>return status:</p><ul>
+<li>support conf</li>
+<li>support int</li>
+<h2><a class="anchor" id="gssapi_context_flags"></a>
+Context creation flags</h2>
-<h3><a class="anchor" name="gssapi_services_permessage">
-Per-message services</a></h3>
+<h2><a class="anchor" id="gssapi_services_permessage"></a>
+Per-message services</h2>
-<li>conf</li><li>int</li><li>message integrity</li><li>replay detection</li><li>out of sequence </li></ul>
+<li>message integrity</li>
+<li>replay detection</li>
+<li>out of sequence </li>
+</div></div><!-- contents -->
<hr size="1"><address style="text-align: right;"><small>
-Generated on Wed Jan 11 14:07:43 2012 for HeimdalGSS-APIlibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.5.6</small></address>
+Generated on Fri Dec 8 2017 03:48:58 for HeimdalGSS-APIlibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.8.13</small></address>
diff --git a/doc/doxyout/gssapi/html/index.html b/doc/doxyout/gssapi/html/index.html
index 34c5848a2640..683bd855d30b 100644
--- a/doc/doxyout/gssapi/html/index.html
+++ b/doc/doxyout/gssapi/html/index.html
@@ -1,6 +1,6 @@
<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN">
<html><head><meta http-equiv="Content-Type" content="text/html;charset=UTF-8">
-<title>HeimdalGSS-APIlibrary: Heimdal GSS-API Library</title>
+<title>Heimdal GSS-API Library</title>
<link href="doxygen.css" rel="stylesheet" type="text/css">
<link href="tabs.css" rel="stylesheet" type="text/css">
@@ -8,29 +8,36 @@
<a href="http://www.h5l.org/"><img src="http://www.h5l.org/keyhole-heimdal.png" alt="keyhole logo"/></a>
<!-- end of header marker -->
-<!-- Generated by Doxygen 1.5.6 -->
-<div class="navigation" id="top">
- <div class="tabs">
- <ul>
- <li class="current"><a href="index.html"><span>Main&nbsp;Page</span></a></li>
- <li><a href="pages.html"><span>Related&nbsp;Pages</span></a></li>
- <li><a href="modules.html"><span>Modules</span></a></li>
- </ul>
- </div>
+<!-- Generated by Doxygen 1.8.13 -->
+<script type="text/javascript" src="menudata.js"></script>
+<script type="text/javascript" src="menu.js"></script>
+<script type="text/javascript">
+$(function() {
+ initMenu('',false,false,'search.php','Search');
+<div id="main-nav"></div>
+</div><!-- top -->
+<div class="header">
+ <div class="headertitle">
+<div class="title">Heimdal GSS-API Library </div> </div>
<div class="contents">
-<h1>Heimdal GSS-API Library</h1>
-<h3 align="center">1.5.2 </h3>Heimdal implements the following mechanisms:<p>
+<div class="textblock"><p>Heimdal implements the following mechanisms:</p>
-<li>Kerberos 5</li><li>SPNEGO</li><li>NTLM</li></ul>
-See <a class="el" href="gssapi_mechs_intro.html#gssapi_mechs">GSS-API mechanisms</a> for more describtion about these mechanisms.<p>
-The project web page: <a href="http://www.h5l.org/">http://www.h5l.org/</a><p>
+<li>Kerberos 5</li>
+<dl class="section see"><dt>See also</dt><dd></dd></dl>
-<li><a class="el" href="gssapi_services_intro.html">Introduction to GSS-API services</a></li><li><a class="el" href="gssapi_mechs_intro.html#gssapi_mechs">GSS-API mechanisms</a></li><li><a class="el" href="internalvsmechname.html#gssapi_api_INvsMN">Name forms</a> </li></ul>
+<li><a class="el" href="gssapi_services_intro.html">Introduction to GSS-API services</a></li>
+<li><a class="el" href="gssapi_mechs_intro.html#gssapi_mechs">GSS-API mechanisms</a></li>
+<li><a class="el" href="internal_v_smechname.html#gssapi_api_INvsMN">Name forms</a></li>
+<li>The project web page: <a href="http://www.h5l.org/">http://www.h5l.org/</a> </li>
+</div></div><!-- contents -->
<hr size="1"><address style="text-align: right;"><small>
-Generated on Wed Jan 11 14:07:43 2012 for HeimdalGSS-APIlibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.5.6</small></address>
+Generated on Fri Dec 8 2017 03:48:58 for HeimdalGSS-APIlibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.8.13</small></address>
diff --git a/doc/doxyout/gssapi/html/internal_v_smechname.html b/doc/doxyout/gssapi/html/internal_v_smechname.html
new file mode 100644
index 000000000000..5f94e5683680
--- /dev/null
+++ b/doc/doxyout/gssapi/html/internal_v_smechname.html
@@ -0,0 +1,40 @@
+<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN">
+<html><head><meta http-equiv="Content-Type" content="text/html;charset=UTF-8">
+<title>Internal names and mechanism names</title>
+<link href="doxygen.css" rel="stylesheet" type="text/css">
+<link href="tabs.css" rel="stylesheet" type="text/css">
+<a href="http://www.h5l.org/"><img src="http://www.h5l.org/keyhole-heimdal.png" alt="keyhole logo"/></a>
+<!-- end of header marker -->
+<!-- Generated by Doxygen 1.8.13 -->
+<script type="text/javascript" src="menudata.js"></script>
+<script type="text/javascript" src="menu.js"></script>
+<script type="text/javascript">
+$(function() {
+ initMenu('',false,false,'search.php','Search');
+<div id="main-nav"></div>
+</div><!-- top -->
+<div class="header">
+ <div class="headertitle">
+<div class="title">Internal names and mechanism names </div> </div>
+<div class="contents">
+<div class="textblock"><h1><a class="anchor" id="gssapi_api_INvsMN"></a>
+Name forms</h1>
+<p>There are two name representations in GSS-API: Internal form and Contiguous string ("flat") form. Functions <a class="el" href="group__gssapi.html#ga353814c7de38c9e2894ca66f0c15c8eb">gss_export_name()</a> and <a class="el" href="group__gssapi.html#ga0afe06fd5264ebfb93ecca4bcc70895b">gss_import_name()</a> can be used to convert between the two forms.</p>
+<li>The contiguous string form is described by an oid specificing the type and an octet string. A special form of the contiguous string form is the exported name object. The exported name defined for each mechanism, is something that can be stored and compared later. The exported name is what should be used for ACLs comparisons.</li>
+<li>The Internal form is opaque to the application programmer and is implementation-dependent.</li>
+<li>There is also a special form of the Internal Name (IN), and that is the Mechanism Name (MN). In the mechanism name all the generic information is stripped of and only contain the information for one mechanism. In GSS-API some function return MN and some require MN as input. Each of these function is marked up as such.</li>
+<p>Describe relationship between import_name, canonicalize_name, export_name and friends. Also, update for RFC2743 language ("contiguous" and "flat" are gone, leaving just "exported name
+token", "internal", and "MN"). </p>
+</div></div><!-- contents -->
+<hr size="1"><address style="text-align: right;"><small>
+Generated on Fri Dec 8 2017 03:48:58 for HeimdalGSS-APIlibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.8.13</small></address>
diff --git a/doc/doxyout/gssapi/html/internalvsmechname.html b/doc/doxyout/gssapi/html/internalvsmechname.html
deleted file mode 100644
index 1aafdad9e2b5..000000000000
--- a/doc/doxyout/gssapi/html/internalvsmechname.html
+++ /dev/null
@@ -1,36 +0,0 @@
-<!DOCTYPE HTML PUBLIC "-//W3C//DTD HTML 4.01 Transitional//EN">
-<html><head><meta http-equiv="Content-Type" content="text/html;charset=UTF-8">
-<title>HeimdalGSS-APIlibrary: Internal names and mechanism names</title>
-<link href="doxygen.css" rel="stylesheet" type="text/css">
-<link href="tabs.css" rel="stylesheet" type="text/css">
-<a href="http://www.h5l.org/"><img src="http://www.h5l.org/keyhole-heimdal.png" alt="keyhole logo"/></a>
-<!-- end of header marker -->
-<!-- Generated by Doxygen 1.5.6 -->
-<div class="navigation" id="top">
- <div class="tabs">
- <ul>
- <li><a href="index.html"><span>Main&nbsp;Page</span></a></li>
- <li><a href="pages.html"><span>Related&nbsp;Pages</span></a></li>
- <li><a href="modules.html"><span>Modules</span></a></li>
- </ul>
- </div>
-<div class="contents">
-<h1><a class="anchor" name="internalVSmechname">Internal names and mechanism names </a></h1><h2><a class="anchor" name="gssapi_api_INvsMN">
-Name forms</a></h2>
-There are two forms of name in GSS-API, Internal form and Contiguous string ("flat") form. gss_export_name() and <a class="el" href="group__gssapi.html#g0afe06fd5264ebfb93ecca4bcc70895b">gss_import_name()</a> can be used to convert between the two forms.<p>
-<li>The contiguous string form is described by an oid specificing the type and an octet string. A special form of the contiguous string form is the exported name object. The exported name defined for each mechanism, is something that can be stored and complared later. The exported name is what should be used for ACLs comparisons.</li></ul>
-<li>The Internal form</li></ul>
-There is also special form of the Internal Name (IN), and that is the Mechanism Name (MN). In the mechanism name all the generic information is stripped of and only contain the information for one mechanism. In GSS-API some function return MN and some require MN as input. Each of these function is marked up as such.<p>
-Describe relationship between import_name, canonicalize_name, export_name and friends. </div>
-<hr size="1"><address style="text-align: right;"><small>
-Generated on Wed Jan 11 14:07:43 2012 for HeimdalGSS-APIlibrary by&nbsp;<a href="http://www.doxygen.org/index.html"><img src="doxygen.png" alt="doxygen" align="middle" border="0"></a> 1.5.6</small></address>
diff --git a/doc/doxyout/gssapi/html/jquery.js b/doc/doxyout/gssapi/html/jquery.js
new file mode 100644
index 000000000000..f5343eda922a
--- /dev/null
+++ b/doc/doxyout/gssapi/html/jquery.js
@@ -0,0 +1,87 @@
+ * jQuery JavaScript Library v1.7.1
+ * http://jquery.com/
+ *
+ * Copyright 2011, John Resig
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * Includes Sizzle.js
+ * http://sizzlejs.com/
+ * Copyright 2011, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ *
+ * Date: Mon Nov 21 21:11:03 2011 -0500
+ */
+(function(bb,L){var av=bb.document,bu=bb.navigator,bl=bb.location;var b=(function(){var bF=function(b0,b1){return new bF.fn.init(b0,b1,bD)},bU=bb.jQuery,bH=bb.$,bD,bY=/^(?:[^#<]*(<[\w\W]+>)[^>]*$|#([\w\-]*)$)/,bM=/\S/,bI=/^\s+/,bE=/\s+$/,bA=/^<(\w+)\s*\/?>(?:<\/\1>)?$/,bN=/^[\],:{}\s]*$/,bW=/\\(?:["\\\/bfnrt]|u[0-9a-fA-F]{4})/g,bP=/"[^"\\\n\r]*"|true|false|null|-?\d+(?:\.\d*)?(?:[eE][+\-]?\d+)?/g,bJ=/(?:^|:|,)(?:\s*\[)+/g,by=/(webkit)[ \/]([\w.]+)/,bR=/(opera)(?:.*version)?[ \/]([\w.]+)/,bQ=/(msie) ([\w.]+)/,bS=/(mozilla)(?:.*? rv:([\w.]+))?/,bB=/-([a-z]|[0-9])/ig,bZ=/^-ms-/,bT=function(b0,b1){return(b1+"").toUpperCase()},bX=bu.userAgent,bV,bC,e,bL=Object.prototype.toString,bG=Object.prototype.hasOwnProperty,bz=Array.prototype.push,bK=Array.prototype.slice,bO=String.prototype.trim,bv=Array.prototype.indexOf,bx={};bF.fn=bF.prototype={constructor:bF,init:function(b0,b4,b3){var b2,b5,b1,b6;if(!b0){return this}if(b0.nodeType){this.context=this[0]=b0;this.length=1;return this}if(b0==="body"&&!b4&&av.body){this.context=av;this[0]=av.body;this.selector=b0;this.length=1;return this}if(typeof b0==="string"){if(b0.charAt(0)==="<"&&b0.charAt(b0.length-1)===">"&&b0.length>=3){b2=[null,b0,null]}else{b2=bY.exec(b0)}if(b2&&(b2[1]||!b4)){if(b2[1]){b4=b4 instanceof bF?b4[0]:b4;b6=(b4?b4.ownerDocument||b4:av);b1=bA.exec(b0);if(b1){if(bF.isPlainObject(b4)){b0=[av.createElement(b1[1])];bF.fn.attr.call(b0,b4,true)}else{b0=[b6.createElement(b1[1])]}}else{b1=bF.buildFragment([b2[1]],[b6]);b0=(b1.cacheable?bF.clone(b1.fragment):b1.fragment).childNodes}return bF.merge(this,b0)}else{b5=av.getElementById(b2[2]);if(b5&&b5.parentNode){if(b5.id!==b2[2]){return b3.find(b0)}this.length=1;this[0]=b5}this.context=av;this.selector=b0;return this}}else{if(!b4||b4.jquery){return(b4||b3).find(b0)}else{return this.constructor(b4).find(b0)}}}else{if(bF.isFunction(b0)){return b3.ready(b0)}}if(b0.selector!==L){this.selector=b0.selector;this.context=b0.context}return bF.makeArray(b0,this)},selector:"",jquery:"1.7.1",length:0,size:function(){return this.length},toArray:function(){return bK.call(this,0)},get:function(b0){return b0==null?this.toArray():(b0<0?this[this.length+b0]:this[b0])},pushStack:function(b1,b3,b0){var b2=this.constructor();if(bF.isArray(b1)){bz.apply(b2,b1)}else{bF.merge(b2,b1)}b2.prevObject=this;b2.context=this.context;if(b3==="find"){b2.selector=this.selector+(this.selector?" ":"")+b0}else{if(b3){b2.selector=this.selector+"."+b3+"("+b0+")"}}return b2},each:function(b1,b0){return bF.each(this,b1,b0)},ready:function(b0){bF.bindReady();bC.add(b0);return this},eq:function(b0){b0=+b0;return b0===-1?this.slice(b0):this.slice(b0,b0+1)},first:function(){return this.eq(0)},last:function(){return this.eq(-1)},slice:function(){return this.pushStack(bK.apply(this,arguments),"slice",bK.call(arguments).join(","))},map:function(b0){return this.pushStack(bF.map(this,function(b2,b1){return b0.call(b2,b1,b2)}))},end:function(){return this.prevObject||this.constructor(null)},push:bz,sort:[].sort,splice:[].splice};bF.fn.init.prototype=bF.fn;bF.extend=bF.fn.extend=function(){var b9,b2,b0,b1,b6,b7,b5=arguments[0]||{},b4=1,b3=arguments.length,b8=false;if(typeof b5==="boolean"){b8=b5;b5=arguments[1]||{};b4=2}if(typeof b5!=="object"&&!bF.isFunction(b5)){b5={}}if(b3===b4){b5=this;--b4}for(;b4<b3;b4++){if((b9=arguments[b4])!=null){for(b2 in b9){b0=b5[b2];b1=b9[b2];if(b5===b1){continue}if(b8&&b1&&(bF.isPlainObject(b1)||(b6=bF.isArray(b1)))){if(b6){b6=false;b7=b0&&bF.isArray(b0)?b0:[]}else{b7=b0&&bF.isPlainObject(b0)?b0:{}}b5[b2]=bF.extend(b8,b7,b1)}else{if(b1!==L){b5[b2]=b1}}}}}return b5};bF.extend({noConflict:function(b0){if(bb.$===bF){bb.$=bH}if(b0&&bb.jQuery===bF){bb.jQuery=bU}return bF},isReady:false,readyWait:1,holdReady:function(b0){if(b0){bF.readyWait++}else{bF.ready(true)}},ready:function(b0){if((b0===true&&!--bF.readyWait)||(b0!==true&&!bF.isReady)){if(!av.body){return setTimeout(bF.ready,1)}bF.isReady=true;if(b0!==true&&--bF.readyWait>0){return}bC.fireWith(av,[bF]);if(bF.fn.trigger){bF(av).trigger("ready").off("ready")}}},bindReady:function(){if(bC){return}bC=bF.Callbacks("once memory");if(av.readyState==="complete"){return setTimeout(bF.ready,1)}if(av.addEventListener){av.addEventListener("DOMContentLoaded",e,false);bb.addEventListener("load",bF.ready,false)}else{if(av.attachEvent){av.attachEvent("onreadystatechange",e);bb.attachEvent("onload",bF.ready);var b0=false;try{b0=bb.frameElement==null}catch(b1){}if(av.documentElement.doScroll&&b0){bw()}}}},isFunction:function(b0){return bF.type(b0)==="function"},isArray:Array.isArray||function(b0){return bF.type(b0)==="array"},isWindow:function(b0){return b0&&typeof b0==="object"&&"setInterval" in b0},isNumeric:function(b0){return !isNaN(parseFloat(b0))&&isFinite(b0)},type:function(b0){return b0==null?String(b0):bx[bL.call(b0)]||"object"},isPlainObject:function(b2){if(!b2||bF.type(b2)!=="object"||b2.nodeType||bF.isWindow(b2)){return false}try{if(b2.constructor&&!bG.call(b2,"constructor")&&!bG.call(b2.constructor.prototype,"isPrototypeOf")){return false}}catch(b1){return false}var b0;for(b0 in b2){}return b0===L||bG.call(b2,b0)},isEmptyObject:function(b1){for(var b0 in b1){return false}return true},error:function(b0){throw new Error(b0)},parseJSON:function(b0){if(typeof b0!=="string"||!b0){return null}b0=bF.trim(b0);if(bb.JSON&&bb.JSON.parse){return bb.JSON.parse(b0)}if(bN.test(b0.replace(bW,"@").replace(bP,"]").replace(bJ,""))){return(new Function("return "+b0))()}bF.error("Invalid JSON: "+b0)},parseXML:function(b2){var b0,b1;try{if(bb.DOMParser){b1=new DOMParser();b0=b1.parseFromString(b2,"text/xml")}else{b0=new ActiveXObject("Microsoft.XMLDOM");b0.async="false";b0.loadXML(b2)}}catch(b3){b0=L}if(!b0||!b0.documentElement||b0.getElementsByTagName("parsererror").length){bF.error("Invalid XML: "+b2)}return b0},noop:function(){},globalEval:function(b0){if(b0&&bM.test(b0)){(bb.execScript||function(b1){bb["eval"].call(bb,b1)})(b0)}},camelCase:function(b0){return b0.replace(bZ,"ms-").replace(bB,bT)},nodeName:function(b1,b0){return b1.nodeName&&b1.nodeName.toUpperCase()===b0.toUpperCase()},each:function(b3,b6,b2){var b1,b4=0,b5=b3.length,b0=b5===L||bF.isFunction(b3);if(b2){if(b0){for(b1 in b3){if(b6.apply(b3[b1],b2)===false){break}}}else{for(;b4<b5;){if(b6.apply(b3[b4++],b2)===false){break}}}}else{if(b0){for(b1 in b3){if(b6.call(b3[b1],b1,b3[b1])===false){break}}}else{for(;b4<b5;){if(b6.call(b3[b4],b4,b3[b4++])===false){break}}}}return b3},trim:bO?function(b0){return b0==null?"":bO.call(b0)}:function(b0){return b0==null?"":b0.toString().replace(bI,"").replace(bE,"")},makeArray:function(b3,b1){var b0=b1||[];if(b3!=null){var b2=bF.type(b3);if(b3.length==null||b2==="string"||b2==="function"||b2==="regexp"||bF.isWindow(b3)){bz.call(b0,b3)}else{bF.merge(b0,b3)}}return b0},inArray:function(b2,b3,b1){var b0;if(b3){if(bv){return bv.call(b3,b2,b1)}b0=b3.length;b1=b1?b1<0?Math.max(0,b0+b1):b1:0;for(;b1<b0;b1++){if(b1 in b3&&b3[b1]===b2){return b1}}}return -1},merge:function(b4,b2){var b3=b4.length,b1=0;if(typeof b2.length==="number"){for(var b0=b2.length;b1<b0;b1++){b4[b3++]=b2[b1]}}else{while(b2[b1]!==L){b4[b3++]=b2[b1++]}}b4.length=b3;return b4},grep:function(b1,b6,b0){var b2=[],b5;b0=!!b0;for(var b3=0,b4=b1.length;b3<b4;b3++){b5=!!b6(b1[b3],b3);if(b0!==b5){b2.push(b1[b3])}}return b2},map:function(b0,b7,b8){var b5,b6,b4=[],b2=0,b1=b0.length,b3=b0 instanceof bF||b1!==L&&typeof b1==="number"&&((b1>0&&b0[0]&&b0[b1-1])||b1===0||bF.isArray(b0));if(b3){for(;b2<b1;b2++){b5=b7(b0[b2],b2,b8);if(b5!=null){b4[b4.length]=b5}}}else{for(b6 in b0){b5=b7(b0[b6],b6,b8);if(b5!=null){b4[b4.length]=b5}}}return b4.concat.apply([],b4)},guid:1,proxy:function(b4,b3){if(typeof b3==="string"){var b2=b4[b3];b3=b4;b4=b2}if(!bF.isFunction(b4)){return L}var b0=bK.call(arguments,2),b1=function(){return b4.apply(b3,b0.concat(bK.call(arguments)))};b1.guid=b4.guid=b4.guid||b1.guid||bF.guid++;return b1},access:function(b0,b8,b6,b2,b5,b7){var b1=b0.length;if(typeof b8==="object"){for(var b3 in b8){bF.access(b0,b3,b8[b3],b2,b5,b6)}return b0}if(b6!==L){b2=!b7&&b2&&bF.isFunction(b6);for(var b4=0;b4<b1;b4++){b5(b0[b4],b8,b2?b6.call(b0[b4],b4,b5(b0[b4],b8)):b6,b7)}return b0}return b1?b5(b0[0],b8):L},now:function(){return(new Date()).getTime()},uaMatch:function(b1){b1=b1.toLowerCase();var b0=by.exec(b1)||bR.exec(b1)||bQ.exec(b1)||b1.indexOf("compatible")<0&&bS.exec(b1)||[];return{browser:b0[1]||"",version:b0[2]||"0"}},sub:function(){function b0(b3,b4){return new b0.fn.init(b3,b4)}bF.extend(true,b0,this);b0.superclass=this;b0.fn=b0.prototype=this();b0.fn.constructor=b0;b0.sub=this.sub;b0.fn.init=function b2(b3,b4){if(b4&&b4 instanceof bF&&!(b4 instanceof b0)){b4=b0(b4)}return bF.fn.init.call(this,b3,b4,b1)};b0.fn.init.prototype=b0.fn;var b1=b0(av);return b0},browser:{}});bF.each("Boolean Number String Function Array Date RegExp Object".split(" "),function(b1,b0){bx["[object "+b0+"]"]=b0.toLowerCase()});bV=bF.uaMatch(bX);if(bV.browser){bF.browser[bV.browser]=true;bF.browser.version=bV.version}if(bF.browser.webkit){bF.browser.safari=true}if(bM.test("\xA0")){bI=/^[\s\xA0]+/;bE=/[\s\xA0]+$/}bD=bF(av);if(av.addEventListener){e=function(){av.removeEventListener("DOMContentLoaded",e,false);bF.ready()}}else{if(av.attachEvent){e=function(){if(av.readyState==="complete"){av.detachEvent("onreadystatechange",e);bF.ready()}}}}function bw(){if(bF.isReady){return}try{av.documentElement.doScroll("left")}catch(b0){setTimeout(bw,1);return}bF.ready()}return bF})();var a2={};function X(e){var bv=a2[e]={},bw,bx;e=e.split(/\s+/);for(bw=0,bx=e.length;bw<bx;bw++){bv[e[bw]]=true}return bv}b.Callbacks=function(bw){bw=bw?(a2[bw]||X(bw)):{};var bB=[],bC=[],bx,by,bv,bz,bA,bE=function(bF){var bG,bJ,bI,bH,bK;for(bG=0,bJ=bF.length;bG<bJ;bG++){bI=bF[bG];bH=b.type(bI);if(bH==="array"){bE(bI)}else{if(bH==="function"){if(!bw.unique||!bD.has(bI)){bB.push(bI)}}}}},e=function(bG,bF){bF=bF||[];bx=!bw.memory||[bG,bF];by=true;bA=bv||0;bv=0;bz=bB.length;for(;bB&&bA<bz;bA++){if(bB[bA].apply(bG,bF)===false&&bw.stopOnFalse){bx=true;break}}by=false;if(bB){if(!bw.once){if(bC&&bC.length){bx=bC.shift();bD.fireWith(bx[0],bx[1])}}else{if(bx===true){bD.disable()}else{bB=[]}}}},bD={add:function(){if(bB){var bF=bB.length;bE(arguments);if(by){bz=bB.length}else{if(bx&&bx!==true){bv=bF;e(bx[0],bx[1])}}}return this},remove:function(){if(bB){var bF=arguments,bH=0,bI=bF.length;for(;bH<bI;bH++){for(var bG=0;bG<bB.length;bG++){if(bF[bH]===bB[bG]){if(by){if(bG<=bz){bz--;if(bG<=bA){bA--}}}bB.splice(bG--,1);if(bw.unique){break}}}}}return this},has:function(bG){if(bB){var bF=0,bH=bB.length;for(;bF<bH;bF++){if(bG===bB[bF]){return true}}}return false},empty:function(){bB=[];return this},disable:function(){bB=bC=bx=L;return this},disabled:function(){return !bB},lock:function(){bC=L;if(!bx||bx===true){bD.disable()}return this},locked:function(){return !bC},fireWith:function(bG,bF){if(bC){if(by){if(!bw.once){bC.push([bG,bF])}}else{if(!(bw.once&&bx)){e(bG,bF)}}}return this},fire:function(){bD.fireWith(this,arguments);return this},fired:function(){return !!bx}};return bD};var aJ=[].slice;b.extend({Deferred:function(by){var bx=b.Callbacks("once memory"),bw=b.Callbacks("once memory"),bv=b.Callbacks("memory"),e="pending",bA={resolve:bx,reject:bw,notify:bv},bC={done:bx.add,fail:bw.add,progress:bv.add,state:function(){return e},isResolved:bx.fired,isRejected:bw.fired,then:function(bE,bD,bF){bB.done(bE).fail(bD).progress(bF);return this},always:function(){bB.done.apply(bB,arguments).fail.apply(bB,arguments);return this},pipe:function(bF,bE,bD){return b.Deferred(function(bG){b.each({done:[bF,"resolve"],fail:[bE,"reject"],progress:[bD,"notify"]},function(bI,bL){var bH=bL[0],bK=bL[1],bJ;if(b.isFunction(bH)){bB[bI](function(){bJ=bH.apply(this,arguments);if(bJ&&b.isFunction(bJ.promise)){bJ.promise().then(bG.resolve,bG.reject,bG.notify)}else{bG[bK+"With"](this===bB?bG:this,[bJ])}})}else{bB[bI](bG[bK])}})}).promise()},promise:function(bE){if(bE==null){bE=bC}else{for(var bD in bC){bE[bD]=bC[bD]}}return bE}},bB=bC.promise({}),bz;for(bz in bA){bB[bz]=bA[bz].fire;bB[bz+"With"]=bA[bz].fireWith}bB.done(function(){e="resolved"},bw.disable,bv.lock).fail(function(){e="rejected"},bx.disable,bv.lock);if(by){by.call(bB,bB)}return bB},when:function(bA){var bx=aJ.call(arguments,0),bv=0,e=bx.length,bB=new Array(e),bw=e,by=e,bC=e<=1&&bA&&b.isFunction(bA.promise)?bA:b.Deferred(),bE=bC.promise();function bD(bF){return function(bG){bx[bF]=arguments.length>1?aJ.call(arguments,0):bG;if(!(--bw)){bC.resolveWith(bC,bx)}}}function bz(bF){return function(bG){bB[bF]=arguments.length>1?aJ.call(arguments,0):bG;bC.notifyWith(bE,bB)}}if(e>1){for(;bv<e;bv++){if(bx[bv]&&bx[bv].promise&&b.isFunction(bx[bv].promise)){bx[bv].promise().then(bD(bv),bC.reject,bz(bv))}else{--bw}}if(!bw){bC.resolveWith(bC,bx)}}else{if(bC!==bA){bC.resolveWith(bC,e?[bA]:[])}}return bE}});b.support=(function(){var bJ,bI,bF,bG,bx,bE,bA,bD,bz,bK,bB,by,bw,bv=av.createElement("div"),bH=av.documentElement;bv.setAttribute("className","t");bv.innerHTML=" <link/><table></table><a href='/a' style='top:1px;float:left;opacity:.55;'>a</a><input type='checkbox'/>";bI=bv.getElementsByTagName("*");bF=bv.getElementsByTagName("a")[0];if(!bI||!bI.length||!bF){return{}}bG=av.createElement("select");bx=bG.appendChild(av.createElement("option"));bE=bv.getElementsByTagName("input")[0];bJ={leadingWhitespace:(bv.firstChild.nodeType===3),tbody:!bv.getElementsByTagName("tbody").length,htmlSerialize:!!bv.getElementsByTagName("link").length,style:/top/.test(bF.getAttribute("style")),hrefNormalized:(bF.getAttribute("href")==="/a"),opacity:/^0.55/.test(bF.style.opacity),cssFloat:!!bF.style.cssFloat,checkOn:(bE.value==="on"),optSelected:bx.selected,getSetAttribute:bv.className!=="t",enctype:!!av.createElement("form").enctype,html5Clone:av.createElement("nav").cloneNode(true).outerHTML!=="<:nav></:nav>",submitBubbles:true,changeBubbles:true,focusinBubbles:false,deleteExpando:true,noCloneEvent:true,inlineBlockNeedsLayout:false,shrinkWrapBlocks:false,reliableMarginRight:true};bE.checked=true;bJ.noCloneChecked=bE.cloneNode(true).checked;bG.disabled=true;bJ.optDisabled=!bx.disabled;try{delete bv.test}catch(bC){bJ.deleteExpando=false}if(!bv.addEventListener&&bv.attachEvent&&bv.fireEvent){bv.attachEvent("onclick",function(){bJ.noCloneEvent=false});bv.cloneNode(true).fireEvent("onclick")}bE=av.createElement("input");bE.value="t";bE.setAttribute("type","radio");bJ.radioValue=bE.value==="t";bE.setAttribute("checked","checked");bv.appendChild(bE);bD=av.createDocumentFragment();bD.appendChild(bv.lastChild);bJ.checkClone=bD.cloneNode(true).cloneNode(true).lastChild.checked;bJ.appendChecked=bE.checked;bD.removeChild(bE);bD.appendChild(bv);bv.innerHTML="";if(bb.getComputedStyle){bA=av.createElement("div");bA.style.width="0";bA.style.marginRight="0";bv.style.width="2px";bv.appendChild(bA);bJ.reliableMarginRight=(parseInt((bb.getComputedStyle(bA,null)||{marginRight:0}).marginRight,10)||0)===0}if(bv.attachEvent){for(by in {submit:1,change:1,focusin:1}){bB="on"+by;bw=(bB in bv);if(!bw){bv.setAttribute(bB,"return;");bw=(typeof bv[bB]==="function")}bJ[by+"Bubbles"]=bw}}bD.removeChild(bv);bD=bG=bx=bA=bv=bE=null;b(function(){var bM,bU,bV,bT,bN,bO,bL,bS,bR,e,bP,bQ=av.getElementsByTagName("body")[0];if(!bQ){return}bL=1;bS="position:absolute;top:0;left:0;width:1px;height:1px;margin:0;";bR="visibility:hidden;border:0;";e="style='"+bS+"border:5px solid #000;padding:0;'";bP="<div "+e+"><div></div></div><table "+e+" cellpadding='0' cellspacing='0'><tr><td></td></tr></table>";bM=av.createElement("div");bM.style.cssText=bR+"width:0;height:0;position:static;top:0;margin-top:"+bL+"px";bQ.insertBefore(bM,bQ.firstChild);bv=av.createElement("div");bM.appendChild(bv);bv.innerHTML="<table><tr><td style='padding:0;border:0;display:none'></td><td>t</td></tr></table>";bz=bv.getElementsByTagName("td");bw=(bz[0].offsetHeight===0);bz[0].style.display="";bz[1].style.display="none";bJ.reliableHiddenOffsets=bw&&(bz[0].offsetHeight===0);bv.innerHTML="";bv.style.width=bv.style.paddingLeft="1px";b.boxModel=bJ.boxModel=bv.offsetWidth===2;if(typeof bv.style.zoom!=="undefined"){bv.style.display="inline";bv.style.zoom=1;bJ.inlineBlockNeedsLayout=(bv.offsetWidth===2);bv.style.display="";bv.innerHTML="<div style='width:4px;'></div>";bJ.shrinkWrapBlocks=(bv.offsetWidth!==2)}bv.style.cssText=bS+bR;bv.innerHTML=bP;bU=bv.firstChild;bV=bU.firstChild;bN=bU.nextSibling.firstChild.firstChild;bO={doesNotAddBorder:(bV.offsetTop!==5),doesAddBorderForTableAndCells:(bN.offsetTop===5)};bV.style.position="fixed";bV.style.top="20px";bO.fixedPosition=(bV.offsetTop===20||bV.offsetTop===15);bV.style.position=bV.style.top="";bU.style.overflow="hidden";bU.style.position="relative";bO.subtractsBorderForOverflowNotVisible=(bV.offsetTop===-5);bO.doesNotIncludeMarginInBodyOffset=(bQ.offsetTop!==bL);bQ.removeChild(bM);bv=bM=null;b.extend(bJ,bO)});return bJ})();var aS=/^(?:\{.*\}|\[.*\])$/,aA=/([A-Z])/g;b.extend({cache:{},uuid:0,expando:"jQuery"+(b.fn.jquery+Math.random()).replace(/\D/g,""),noData:{embed:true,object:"clsid:D27CDB6E-AE6D-11cf-96B8-444553540000",applet:true},hasData:function(e){e=e.nodeType?b.cache[e[b.expando]]:e[b.expando];return !!e&&!S(e)},data:function(bx,bv,bz,by){if(!b.acceptData(bx)){return}var bG,bA,bD,bE=b.expando,bC=typeof bv==="string",bF=bx.nodeType,e=bF?b.cache:bx,bw=bF?bx[bE]:bx[bE]&&bE,bB=bv==="events";if((!bw||!e[bw]||(!bB&&!by&&!e[bw].data))&&bC&&bz===L){return}if(!bw){if(bF){bx[bE]=bw=++b.uuid}else{bw=bE}}if(!e[bw]){e[bw]={};if(!bF){e[bw].toJSON=b.noop}}if(typeof bv==="object"||typeof bv==="function"){if(by){e[bw]=b.extend(e[bw],bv)}else{e[bw].data=b.extend(e[bw].data,bv)}}bG=bA=e[bw];if(!by){if(!bA.data){bA.data={}}bA=bA.data}if(bz!==L){bA[b.camelCase(bv)]=bz}if(bB&&!bA[bv]){return bG.events}if(bC){bD=bA[bv];if(bD==null){bD=bA[b.camelCase(bv)]}}else{bD=bA}return bD},removeData:function(bx,bv,by){if(!b.acceptData(bx)){return}var bB,bA,bz,bC=b.expando,bD=bx.nodeType,e=bD?b.cache:bx,bw=bD?bx[bC]:bC;if(!e[bw]){return}if(bv){bB=by?e[bw]:e[bw].data;if(bB){if(!b.isArray(bv)){if(bv in bB){bv=[bv]}else{bv=b.camelCase(bv);if(bv in bB){bv=[bv]}else{bv=bv.split(" ")}}}for(bA=0,bz=bv.length;bA<bz;bA++){delete bB[bv[bA]]}if(!(by?S:b.isEmptyObject)(bB)){return}}}if(!by){delete e[bw].data;if(!S(e[bw])){return}}if(b.support.deleteExpando||!e.setInterval){delete e[bw]}else{e[bw]=null}if(bD){if(b.support.deleteExpando){delete bx[bC]}else{if(bx.removeAttribute){bx.removeAttribute(bC)}else{bx[bC]=null}}}},_data:function(bv,e,bw){return b.data(bv,e,bw,true)},acceptData:function(bv){if(bv.nodeName){var e=b.noData[bv.nodeName.toLowerCase()];if(e){return !(e===true||bv.getAttribute("classid")!==e)}}return true}});b.fn.extend({data:function(by,bA){var bB,e,bw,bz=null;if(typeof by==="undefined"){if(this.length){bz=b.data(this[0]);if(this[0].nodeType===1&&!b._data(this[0],"parsedAttrs")){e=this[0].attributes;for(var bx=0,bv=e.length;bx<bv;bx++){bw=e[bx].name;if(bw.indexOf("data-")===0){bw=b.camelCase(bw.substring(5));a5(this[0],bw,bz[bw])}}b._data(this[0],"parsedAttrs",true)}}return bz}else{if(typeof by==="object"){return this.each(function(){b.data(this,by)})}}bB=by.split(".");bB[1]=bB[1]?"."+bB[1]:"";if(bA===L){bz=this.triggerHandler("getData"+bB[1]+"!",[bB[0]]);if(bz===L&&this.length){bz=b.data(this[0],by);bz=a5(this[0],by,bz)}return bz===L&&bB[1]?this.data(bB[0]):bz}else{return this.each(function(){var bC=b(this),bD=[bB[0],bA];bC.triggerHandler("setData"+bB[1]+"!",bD);b.data(this,by,bA);bC.triggerHandler("changeData"+bB[1]+"!",bD)})}},removeData:function(e){return this.each(function(){b.removeData(this,e)})}});function a5(bx,bw,by){if(by===L&&bx.nodeType===1){var bv="data-"+bw.replace(aA,"-$1").toLowerCase();by=bx.getAttribute(bv);if(typeof by==="string"){try{by=by==="true"?true:by==="false"?false:by==="null"?null:b.isNumeric(by)?parseFloat(by):aS.test(by)?b.parseJSON(by):by}catch(bz){}b.data(bx,bw,by)}else{by=L}}return by}function S(bv){for(var e in bv){if(e==="data"&&b.isEmptyObject(bv[e])){continue}if(e!=="toJSON"){return false}}return true}function bi(by,bx,bA){var bw=bx+"defer",bv=bx+"queue",e=bx+"mark",bz=b._data(by,bw);if(bz&&(bA==="queue"||!b._data(by,bv))&&(bA==="mark"||!b._data(by,e))){setTimeout(function(){if(!b._data(by,bv)&&!b._data(by,e)){b.removeData(by,bw,true);bz.fire()}},0)}}b.extend({_mark:function(bv,e){if(bv){e=(e||"fx")+"mark";b._data(bv,e,(b._data(bv,e)||0)+1)}},_unmark:function(by,bx,bv){if(by!==true){bv=bx;bx=by;by=false}if(bx){bv=bv||"fx";var e=bv+"mark",bw=by?0:((b._data(bx,e)||1)-1);if(bw){b._data(bx,e,bw)}else{b.removeData(bx,e,true);bi(bx,bv,"mark")}}},queue:function(bv,e,bx){var bw;if(bv){e=(e||"fx")+"queue";bw=b._data(bv,e);if(bx){if(!bw||b.isArray(bx)){bw=b._data(bv,e,b.makeArray(bx))}else{bw.push(bx)}}return bw||[]}},dequeue:function(by,bx){bx=bx||"fx";var bv=b.queue(by,bx),bw=bv.shift(),e={};if(bw==="inprogress"){bw=bv.shift()}if(bw){if(bx==="fx"){bv.unshift("inprogress")}b._data(by,bx+".run",e);bw.call(by,function(){b.dequeue(by,bx)},e)}if(!bv.length){b.removeData(by,bx+"queue "+bx+".run",true);bi(by,bx,"queue")}}});b.fn.extend({queue:function(e,bv){if(typeof e!=="string"){bv=e;e="fx"}if(bv===L){return b.queue(this[0],e)}return this.each(function(){var bw=b.queue(this,e,bv);if(e==="fx"&&bw[0]!=="inprogress"){b.dequeue(this,e)}})},dequeue:function(e){return this.each(function(){b.dequeue(this,e)})},delay:function(bv,e){bv=b.fx?b.fx.speeds[bv]||bv:bv;e=e||"fx";return this.queue(e,function(bx,bw){var by=setTimeout(bx,bv);bw.stop=function(){clearTimeout(by)}})},clearQueue:function(e){return this.queue(e||"fx",[])},promise:function(bD,bw){if(typeof bD!=="string"){bw=bD;bD=L}bD=bD||"fx";var e=b.Deferred(),bv=this,by=bv.length,bB=1,bz=bD+"defer",bA=bD+"queue",bC=bD+"mark",bx;function bE(){if(!(--bB)){e.resolveWith(bv,[bv])}}while(by--){if((bx=b.data(bv[by],bz,L,true)||(b.data(bv[by],bA,L,true)||b.data(bv[by],bC,L,true))&&b.data(bv[by],bz,b.Callbacks("once memory"),true))){bB++;bx.add(bE)}}bE();return e.promise()}});var aP=/[\n\t\r]/g,af=/\s+/,aU=/\r/g,g=/^(?:button|input)$/i,D=/^(?:button|input|object|select|textarea)$/i,l=/^a(?:rea)?$/i,ao=/^(?:autofocus|autoplay|async|checked|controls|defer|disabled|hidden|loop|multiple|open|readonly|required|scoped|selected)$/i,F=b.support.getSetAttribute,be,aY,aF;b.fn.extend({attr:function(e,bv){return b.access(this,e,bv,true,b.attr)},removeAttr:function(e){return this.each(function(){b.removeAttr(this,e)})},prop:function(e,bv){return b.access(this,e,bv,true,b.prop)},removeProp:function(e){e=b.propFix[e]||e;return this.each(function(){try{this[e]=L;delete this[e]}catch(bv){}})},addClass:function(by){var bA,bw,bv,bx,bz,bB,e;if(b.isFunction(by)){return this.each(function(bC){b(this).addClass(by.call(this,bC,this.className))})}if(by&&typeof by==="string"){bA=by.split(af);for(bw=0,bv=this.length;bw<bv;bw++){bx=this[bw];if(bx.nodeType===1){if(!bx.className&&bA.length===1){bx.className=by}else{bz=" "+bx.className+" ";for(bB=0,e=bA.length;bB<e;bB++){if(!~bz.indexOf(" "+bA[bB]+" ")){bz+=bA[bB]+" "}}bx.className=b.trim(bz)}}}}return this},removeClass:function(bz){var bA,bw,bv,by,bx,bB,e;if(b.isFunction(bz)){return this.each(function(bC){b(this).removeClass(bz.call(this,bC,this.className))})}if((bz&&typeof bz==="string")||bz===L){bA=(bz||"").split(af);for(bw=0,bv=this.length;bw<bv;bw++){by=this[bw];if(by.nodeType===1&&by.className){if(bz){bx=(" "+by.className+" ").replace(aP," ");for(bB=0,e=bA.length;bB<e;bB++){bx=bx.replace(" "+bA[bB]+" "," ")}by.className=b.trim(bx)}else{by.className=""}}}}return this},toggleClass:function(bx,bv){var bw=typeof bx,e=typeof bv==="boolean";if(b.isFunction(bx)){return this.each(function(by){b(this).toggleClass(bx.call(this,by,this.className,bv),bv)})}return this.each(function(){if(bw==="string"){var bA,bz=0,by=b(this),bB=bv,bC=bx.split(af);while((bA=bC[bz++])){bB=e?bB:!by.hasClass(bA);by[bB?"addClass":"removeClass"](bA)}}else{if(bw==="undefined"||bw==="boolean"){if(this.className){b._data(this,"__className__",this.className)}this.className=this.className||bx===false?"":b._data(this,"__className__")||""}}})},hasClass:function(e){var bx=" "+e+" ",bw=0,bv=this.length;for(;bw<bv;bw++){if(this[bw].nodeType===1&&(" "+this[bw].className+" ").replace(aP," ").indexOf(bx)>-1){return true}}return false},val:function(bx){var e,bv,by,bw=this[0];if(!arguments.length){if(bw){e=b.valHooks[bw.nodeName.toLowerCase()]||b.valHooks[bw.type];if(e&&"get" in e&&(bv=e.get(bw,"value"))!==L){return bv}bv=bw.value;return typeof bv==="string"?bv.replace(aU,""):bv==null?"":bv}return}by=b.isFunction(bx);return this.each(function(bA){var bz=b(this),bB;if(this.nodeType!==1){return}if(by){bB=bx.call(this,bA,bz.val())}else{bB=bx}if(bB==null){bB=""}else{if(typeof bB==="number"){bB+=""}else{if(b.isArray(bB)){bB=b.map(bB,function(bC){return bC==null?"":bC+""})}}}e=b.valHooks[this.nodeName.toLowerCase()]||b.valHooks[this.type];if(!e||!("set" in e)||e.set(this,bB,"value")===L){this.value=bB}})}});b.extend({valHooks:{option:{get:function(e){var bv=e.attributes.value;return !bv||bv.specified?e.value:e.text}},select:{get:function(e){var bA,bv,bz,bx,by=e.selectedIndex,bB=[],bC=e.options,bw=e.type==="select-one";if(by<0){return null}bv=bw?by:0;bz=bw?by+1:bC.length;for(;bv<bz;bv++){bx=bC[bv];if(bx.selected&&(b.support.optDisabled?!bx.disabled:bx.getAttribute("disabled")===null)&&(!bx.parentNode.disabled||!b.nodeName(bx.parentNode,"optgroup"))){bA=b(bx).val();if(bw){return bA}bB.push(bA)}}if(bw&&!bB.length&&bC.length){return b(bC[by]).val()}return bB},set:function(bv,bw){var e=b.makeArray(bw);b(bv).find("option").each(function(){this.selected=b.inArray(b(this).val(),e)>=0});if(!e.length){bv.selectedIndex=-1}return e}}},attrFn:{val:true,css:true,html:true,text:true,data:true,width:true,height:true,offset:true},attr:function(bA,bx,bB,bz){var bw,e,by,bv=bA.nodeType;if(!bA||bv===3||bv===8||bv===2){return}if(bz&&bx in b.attrFn){return b(bA)[bx](bB)}if(typeof bA.getAttribute==="undefined"){return b.prop(bA,bx,bB)}by=bv!==1||!b.isXMLDoc(bA);if(by){bx=bx.toLowerCase();e=b.attrHooks[bx]||(ao.test(bx)?aY:be)}if(bB!==L){if(bB===null){b.removeAttr(bA,bx);return}else{if(e&&"set" in e&&by&&(bw=e.set(bA,bB,bx))!==L){return bw}else{bA.setAttribute(bx,""+bB);return bB}}}else{if(e&&"get" in e&&by&&(bw=e.get(bA,bx))!==null){return bw}else{bw=bA.getAttribute(bx);return bw===null?L:bw}}},removeAttr:function(bx,bz){var by,bA,bv,e,bw=0;if(bz&&bx.nodeType===1){bA=bz.toLowerCase().split(af);e=bA.length;for(;bw<e;bw++){bv=bA[bw];if(bv){by=b.propFix[bv]||bv;b.attr(bx,bv,"");bx.removeAttribute(F?bv:by);if(ao.test(bv)&&by in bx){bx[by]=false}}}}},attrHooks:{type:{set:function(e,bv){if(g.test(e.nodeName)&&e.parentNode){b.error("type property can't be changed")}else{if(!b.support.radioValue&&bv==="radio"&&b.nodeName(e,"input")){var bw=e.value;e.setAttribute("type",bv);if(bw){e.value=bw}return bv}}}},value:{get:function(bv,e){if(be&&b.nodeName(bv,"button")){return be.get(bv,e)}return e in bv?bv.value:null},set:function(bv,bw,e){if(be&&b.nodeName(bv,"button")){return be.set(bv,bw,e)}bv.value=bw}}},propFix:{tabindex:"tabIndex",readonly:"readOnly","for":"htmlFor","class":"className",maxlength:"maxLength",cellspacing:"cellSpacing",cellpadding:"cellPadding",rowspan:"rowSpan",colspan:"colSpan",usemap:"useMap",frameborder:"frameBorder",contenteditable:"contentEditable"},prop:function(bz,bx,bA){var bw,e,by,bv=bz.nodeType;if(!bz||bv===3||bv===8||bv===2){return}by=bv!==1||!b.isXMLDoc(bz);if(by){bx=b.propFix[bx]||bx;e=b.propHooks[bx]}if(bA!==L){if(e&&"set" in e&&(bw=e.set(bz,bA,bx))!==L){return bw}else{return(bz[bx]=bA)}}else{if(e&&"get" in e&&(bw=e.get(bz,bx))!==null){return bw}else{return bz[bx]}}},propHooks:{tabIndex:{get:function(bv){var e=bv.getAttributeNode("tabindex");return e&&e.specified?parseInt(e.value,10):D.test(bv.nodeName)||l.test(bv.nodeName)&&bv.href?0:L}}}});b.attrHooks.tabindex=b.propHooks.tabIndex;aY={get:function(bv,e){var bx,bw=b.prop(bv,e);return bw===true||typeof bw!=="boolean"&&(bx=bv.getAttributeNode(e))&&bx.nodeValue!==false?e.toLowerCase():L},set:function(bv,bx,e){var bw;if(bx===false){b.removeAttr(bv,e)}else{bw=b.propFix[e]||e;if(bw in bv){bv[bw]=true}bv.setAttribute(e,e.toLowerCase())}return e}};if(!F){aF={name:true,id:true};be=b.valHooks.button={get:function(bw,bv){var e;e=bw.getAttributeNode(bv);return e&&(aF[bv]?e.nodeValue!=="":e.specified)?e.nodeValue:L},set:function(bw,bx,bv){var e=bw.getAttributeNode(bv);if(!e){e=av.createAttribute(bv);bw.setAttributeNode(e)}return(e.nodeValue=bx+"")}};b.attrHooks.tabindex.set=be.set;b.each(["width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{set:function(bw,bx){if(bx===""){bw.setAttribute(e,"auto");return bx}}})});b.attrHooks.contenteditable={get:be.get,set:function(bv,bw,e){if(bw===""){bw="false"}be.set(bv,bw,e)}}}if(!b.support.hrefNormalized){b.each(["href","src","width","height"],function(bv,e){b.attrHooks[e]=b.extend(b.attrHooks[e],{get:function(bx){var bw=bx.getAttribute(e,2);return bw===null?L:bw}})})}if(!b.support.style){b.attrHooks.style={get:function(e){return e.style.cssText.toLowerCase()||L},set:function(e,bv){return(e.style.cssText=""+bv)}}}if(!b.support.optSelected){b.propHooks.selected=b.extend(b.propHooks.selected,{get:function(bv){var e=bv.parentNode;if(e){e.selectedIndex;if(e.parentNode){e.parentNode.selectedIndex}}return null}})}if(!b.support.enctype){b.propFix.enctype="encoding"}if(!b.support.checkOn){b.each(["radio","checkbox"],function(){b.valHooks[this]={get:function(e){return e.getAttribute("value")===null?"on":e.value}}})}b.each(["radio","checkbox"],function(){b.valHooks[this]=b.extend(b.valHooks[this],{set:function(e,bv){if(b.isArray(bv)){return(e.checked=b.inArray(b(e).val(),bv)>=0)}}})});var bd=/^(?:textarea|input|select)$/i,n=/^([^\.]*)?(?:\.(.+))?$/,J=/\bhover(\.\S+)?\b/,aO=/^key/,bf=/^(?:mouse|contextmenu)|click/,T=/^(?:focusinfocus|focusoutblur)$/,U=/^(\w*)(?:#([\w\-]+))?(?:\.([\w\-]+))?$/,Y=function(e){var bv=U.exec(e);if(bv){bv[1]=(bv[1]||"").toLowerCase();bv[3]=bv[3]&&new RegExp("(?:^|\\s)"+bv[3]+"(?:\\s|$)")}return bv},j=function(bw,e){var bv=bw.attributes||{};return((!e[1]||bw.nodeName.toLowerCase()===e[1])&&(!e[2]||(bv.id||{}).value===e[2])&&(!e[3]||e[3].test((bv["class"]||{}).value)))},bt=function(e){return b.event.special.hover?e:e.replace(J,"mouseenter$1 mouseleave$1")};b.event={add:function(bx,bC,bJ,bA,by){var bD,bB,bK,bI,bH,bF,e,bG,bv,bz,bw,bE;if(bx.nodeType===3||bx.nodeType===8||!bC||!bJ||!(bD=b._data(bx))){return}if(bJ.handler){bv=bJ;bJ=bv.handler}if(!bJ.guid){bJ.guid=b.guid++}bK=bD.events;if(!bK){bD.events=bK={}}bB=bD.handle;if(!bB){bD.handle=bB=function(bL){return typeof b!=="undefined"&&(!bL||b.event.triggered!==bL.type)?b.event.dispatch.apply(bB.elem,arguments):L};bB.elem=bx}bC=b.trim(bt(bC)).split(" ");for(bI=0;bI<bC.length;bI++){bH=n.exec(bC[bI])||[];bF=bH[1];e=(bH[2]||"").split(".").sort();bE=b.event.special[bF]||{};bF=(by?bE.delegateType:bE.bindType)||bF;bE=b.event.special[bF]||{};bG=b.extend({type:bF,origType:bH[1],data:bA,handler:bJ,guid:bJ.guid,selector:by,quick:Y(by),namespace:e.join(".")},bv);bw=bK[bF];if(!bw){bw=bK[bF]=[];bw.delegateCount=0;if(!bE.setup||bE.setup.call(bx,bA,e,bB)===false){if(bx.addEventListener){bx.addEventListener(bF,bB,false)}else{if(bx.attachEvent){bx.attachEvent("on"+bF,bB)}}}}if(bE.add){bE.add.call(bx,bG);if(!bG.handler.guid){bG.handler.guid=bJ.guid}}if(by){bw.splice(bw.delegateCount++,0,bG)}else{bw.push(bG)}b.event.global[bF]=true}bx=null},global:{},remove:function(bJ,bE,bv,bH,bB){var bI=b.hasData(bJ)&&b._data(bJ),bF,bx,bz,bL,bC,bA,bG,bw,by,bK,bD,e;if(!bI||!(bw=bI.events)){return}bE=b.trim(bt(bE||"")).split(" ");for(bF=0;bF<bE.length;bF++){bx=n.exec(bE[bF])||[];bz=bL=bx[1];bC=bx[2];if(!bz){for(bz in bw){b.event.remove(bJ,bz+bE[bF],bv,bH,true)}continue}by=b.event.special[bz]||{};bz=(bH?by.delegateType:by.bindType)||bz;bD=bw[bz]||[];bA=bD.length;bC=bC?new RegExp("(^|\\.)"+bC.split(".").sort().join("\\.(?:.*\\.)?")+"(\\.|$)"):null;for(bG=0;bG<bD.length;bG++){e=bD[bG];if((bB||bL===e.origType)&&(!bv||bv.guid===e.guid)&&(!bC||bC.test(e.namespace))&&(!bH||bH===e.selector||bH==="**"&&e.selector)){bD.splice(bG--,1);if(e.selector){bD.delegateCount--}if(by.remove){by.remove.call(bJ,e)}}}if(bD.length===0&&bA!==bD.length){if(!by.teardown||by.teardown.call(bJ,bC)===false){b.removeEvent(bJ,bz,bI.handle)}delete bw[bz]}}if(b.isEmptyObject(bw)){bK=bI.handle;if(bK){bK.elem=null}b.removeData(bJ,["events","handle"],true)}},customEvent:{getData:true,setData:true,changeData:true},trigger:function(bv,bD,bA,bJ){if(bA&&(bA.nodeType===3||bA.nodeType===8)){return}var bG=bv.type||bv,bx=[],e,bw,bC,bH,bz,by,bF,bE,bB,bI;if(T.test(bG+b.event.triggered)){return}if(bG.indexOf("!")>=0){bG=bG.slice(0,-1);bw=true}if(bG.indexOf(".")>=0){bx=bG.split(".");bG=bx.shift();bx.sort()}if((!bA||b.event.customEvent[bG])&&!b.event.global[bG]){return}bv=typeof bv==="object"?bv[b.expando]?bv:new b.Event(bG,bv):new b.Event(bG);bv.type=bG;bv.isTrigger=true;bv.exclusive=bw;bv.namespace=bx.join(".");bv.namespace_re=bv.namespace?new RegExp("(^|\\.)"+bx.join("\\.(?:.*\\.)?")+"(\\.|$)"):null;by=bG.indexOf(":")<0?"on"+bG:"";if(!bA){e=b.cache;for(bC in e){if(e[bC].events&&e[bC].events[bG]){b.event.trigger(bv,bD,e[bC].handle.elem,true)}}return}bv.result=L;if(!bv.target){bv.target=bA}bD=bD!=null?b.makeArray(bD):[];bD.unshift(bv);bF=b.event.special[bG]||{};if(bF.trigger&&bF.trigger.apply(bA,bD)===false){return}bB=[[bA,bF.bindType||bG]];if(!bJ&&!bF.noBubble&&!b.isWindow(bA)){bI=bF.delegateType||bG;bH=T.test(bI+bG)?bA:bA.parentNode;bz=null;for(;bH;bH=bH.parentNode){bB.push([bH,bI]);bz=bH}if(bz&&bz===bA.ownerDocument){bB.push([bz.defaultView||bz.parentWindow||bb,bI])}}for(bC=0;bC<bB.length&&!bv.isPropagationStopped();bC++){bH=bB[bC][0];bv.type=bB[bC][1];bE=(b._data(bH,"events")||{})[bv.type]&&b._data(bH,"handle");if(bE){bE.apply(bH,bD)}bE=by&&bH[by];if(bE&&b.acceptData(bH)&&bE.apply(bH,bD)===false){bv.preventDefault()}}bv.type=bG;if(!bJ&&!bv.isDefaultPrevented()){if((!bF._default||bF._default.apply(bA.ownerDocument,bD)===false)&&!(bG==="click"&&b.nodeName(bA,"a"))&&b.acceptData(bA)){if(by&&bA[bG]&&((bG!=="focus"&&bG!=="blur")||bv.target.offsetWidth!==0)&&!b.isWindow(bA)){bz=bA[by];if(bz){bA[by]=null}b.event.triggered=bG;bA[bG]();b.event.triggered=L;if(bz){bA[by]=bz}}}}return bv.result},dispatch:function(e){e=b.event.fix(e||bb.event);var bz=((b._data(this,"events")||{})[e.type]||[]),bA=bz.delegateCount,bG=[].slice.call(arguments,0),by=!e.exclusive&&!e.namespace,bH=[],bC,bB,bK,bx,bF,bE,bv,bD,bI,bw,bJ;bG[0]=e;e.delegateTarget=this;if(bA&&!e.target.disabled&&!(e.button&&e.type==="click")){bx=b(this);bx.context=this.ownerDocument||this;for(bK=e.target;bK!=this;bK=bK.parentNode||this){bE={};bD=[];bx[0]=bK;for(bC=0;bC<bA;bC++){bI=bz[bC];bw=bI.selector;if(bE[bw]===L){bE[bw]=(bI.quick?j(bK,bI.quick):bx.is(bw))}if(bE[bw]){bD.push(bI)}}if(bD.length){bH.push({elem:bK,matches:bD})}}}if(bz.length>bA){bH.push({elem:this,matches:bz.slice(bA)})}for(bC=0;bC<bH.length&&!e.isPropagationStopped();bC++){bv=bH[bC];e.currentTarget=bv.elem;for(bB=0;bB<bv.matches.length&&!e.isImmediatePropagationStopped();bB++){bI=bv.matches[bB];if(by||(!e.namespace&&!bI.namespace)||e.namespace_re&&e.namespace_re.test(bI.namespace)){e.data=bI.data;e.handleObj=bI;bF=((b.event.special[bI.origType]||{}).handle||bI.handler).apply(bv.elem,bG);if(bF!==L){e.result=bF;if(bF===false){e.preventDefault();e.stopPropagation()}}}}}return e.result},props:"attrChange attrName relatedNode srcElement altKey bubbles cancelable ctrlKey currentTarget eventPhase metaKey relatedTarget shiftKey target timeStamp view which".split(" "),fixHooks:{},keyHooks:{props:"char charCode key keyCode".split(" "),filter:function(bv,e){if(bv.which==null){bv.which=e.charCode!=null?e.charCode:e.keyCode}return bv}},mouseHooks:{props:"button buttons clientX clientY fromElement offsetX offsetY pageX pageY screenX screenY toElement".split(" "),filter:function(bx,bw){var by,bz,e,bv=bw.button,bA=bw.fromElement;if(bx.pageX==null&&bw.clientX!=null){by=bx.target.ownerDocument||av;bz=by.documentElement;e=by.body;bx.pageX=bw.clientX+(bz&&bz.scrollLeft||e&&e.scrollLeft||0)-(bz&&bz.clientLeft||e&&e.clientLeft||0);bx.pageY=bw.clientY+(bz&&bz.scrollTop||e&&e.scrollTop||0)-(bz&&bz.clientTop||e&&e.clientTop||0)}if(!bx.relatedTarget&&bA){bx.relatedTarget=bA===bx.target?bw.toElement:bA}if(!bx.which&&bv!==L){bx.which=(bv&1?1:(bv&2?3:(bv&4?2:0)))}return bx}},fix:function(bw){if(bw[b.expando]){return bw}var bv,bz,e=bw,bx=b.event.fixHooks[bw.type]||{},by=bx.props?this.props.concat(bx.props):this.props;bw=b.Event(e);for(bv=by.length;bv;){bz=by[--bv];bw[bz]=e[bz]}if(!bw.target){bw.target=e.srcElement||av}if(bw.target.nodeType===3){bw.target=bw.target.parentNode}if(bw.metaKey===L){bw.metaKey=bw.ctrlKey}return bx.filter?bx.filter(bw,e):bw},special:{ready:{setup:b.bindReady},load:{noBubble:true},focus:{delegateType:"focusin"},blur:{delegateType:"focusout"},beforeunload:{setup:function(bw,bv,e){if(b.isWindow(this)){this.onbeforeunload=e}},teardown:function(bv,e){if(this.onbeforeunload===e){this.onbeforeunload=null}}}},simulate:function(bw,by,bx,bv){var bz=b.extend(new b.Event(),bx,{type:bw,isSimulated:true,originalEvent:{}});if(bv){b.event.trigger(bz,null,by)}else{b.event.dispatch.call(by,bz)}if(bz.isDefaultPrevented()){bx.preventDefault()}}};b.event.handle=b.event.dispatch;b.removeEvent=av.removeEventListener?function(bv,e,bw){if(bv.removeEventListener){bv.removeEventListener(e,bw,false)}}:function(bv,e,bw){if(bv.detachEvent){bv.detachEvent("on"+e,bw)}};b.Event=function(bv,e){if(!(this instanceof b.Event)){return new b.Event(bv,e)}if(bv&&bv.type){this.originalEvent=bv;this.type=bv.type;this.isDefaultPrevented=(bv.defaultPrevented||bv.returnValue===false||bv.getPreventDefault&&bv.getPreventDefault())?i:bk}else{this.type=bv}if(e){b.extend(this,e)}this.timeStamp=bv&&bv.timeStamp||b.now();this[b.expando]=true};function bk(){return false}function i(){return true}b.Event.prototype={preventDefault:function(){this.isDefaultPrevented=i;var bv=this.originalEvent;if(!bv){return}if(bv.preventDefault){bv.preventDefault()}else{bv.returnValue=false}},stopPropagation:function(){this.isPropagationStopped=i;var bv=this.originalEvent;if(!bv){return}if(bv.stopPropagation){bv.stopPropagation()}bv.cancelBubble=true},stopImmediatePropagation:function(){this.isImmediatePropagationStopped=i;this.stopPropagation()},isDefaultPrevented:bk,isPropagationStopped:bk,isImmediatePropagationStopped:bk};b.each({mouseenter:"mouseover",mouseleave:"mouseout"},function(bv,e){b.event.special[bv]={delegateType:e,bindType:e,handle:function(bz){var bB=this,bA=bz.relatedTarget,by=bz.handleObj,bw=by.selector,bx;if(!bA||(bA!==bB&&!b.contains(bB,bA))){bz.type=by.origType;bx=by.handler.apply(this,arguments);bz.type=e}return bx}}});if(!b.support.submitBubbles){b.event.special.submit={setup:function(){if(b.nodeName(this,"form")){return false}b.event.add(this,"click._submit keypress._submit",function(bx){var bw=bx.target,bv=b.nodeName(bw,"input")||b.nodeName(bw,"button")?bw.form:L;if(bv&&!bv._submit_attached){b.event.add(bv,"submit._submit",function(e){if(this.parentNode&&!e.isTrigger){b.event.simulate("submit",this.parentNode,e,true)}});bv._submit_attached=true}})},teardown:function(){if(b.nodeName(this,"form")){return false}b.event.remove(this,"._submit")}}}if(!b.support.changeBubbles){b.event.special.change={setup:function(){if(bd.test(this.nodeName)){if(this.type==="checkbox"||this.type==="radio"){b.event.add(this,"propertychange._change",function(e){if(e.originalEvent.propertyName==="checked"){this._just_changed=true}});b.event.add(this,"click._change",function(e){if(this._just_changed&&!e.isTrigger){this._just_changed=false;b.event.simulate("change",this,e,true)}})}return false}b.event.add(this,"beforeactivate._change",function(bw){var bv=bw.target;if(bd.test(bv.nodeName)&&!bv._change_attached){b.event.add(bv,"change._change",function(e){if(this.parentNode&&!e.isSimulated&&!e.isTrigger){b.event.simulate("change",this.parentNode,e,true)}});bv._change_attached=true}})},handle:function(bv){var e=bv.target;if(this!==e||bv.isSimulated||bv.isTrigger||(e.type!=="radio"&&e.type!=="checkbox")){return bv.handleObj.handler.apply(this,arguments)}},teardown:function(){b.event.remove(this,"._change");return bd.test(this.nodeName)}}}if(!b.support.focusinBubbles){b.each({focus:"focusin",blur:"focusout"},function(bx,e){var bv=0,bw=function(by){b.event.simulate(e,by.target,b.event.fix(by),true)};b.event.special[e]={setup:function(){if(bv++===0){av.addEventListener(bx,bw,true)}},teardown:function(){if(--bv===0){av.removeEventListener(bx,bw,true)}}}})}b.fn.extend({on:function(bw,e,bz,by,bv){var bA,bx;if(typeof bw==="object"){if(typeof e!=="string"){bz=e;e=L}for(bx in bw){this.on(bx,e,bz,bw[bx],bv)}return this}if(bz==null&&by==null){by=e;bz=e=L}else{if(by==null){if(typeof e==="string"){by=bz;bz=L}else{by=bz;bz=e;e=L}}}if(by===false){by=bk}else{if(!by){return this}}if(bv===1){bA=by;by=function(bB){b().off(bB);return bA.apply(this,arguments)};by.guid=bA.guid||(bA.guid=b.guid++)}return this.each(function(){b.event.add(this,bw,by,bz,e)})},one:function(bv,e,bx,bw){return this.on.call(this,bv,e,bx,bw,1)},off:function(bw,e,by){if(bw&&bw.preventDefault&&bw.handleObj){var bv=bw.handleObj;b(bw.delegateTarget).off(bv.namespace?bv.type+"."+bv.namespace:bv.type,bv.selector,bv.handler);return this}if(typeof bw==="object"){for(var bx in bw){this.off(bx,e,bw[bx])}return this}if(e===false||typeof e==="function"){by=e;e=L}if(by===false){by=bk}return this.each(function(){b.event.remove(this,bw,by,e)})},bind:function(e,bw,bv){return this.on(e,null,bw,bv)},unbind:function(e,bv){return this.off(e,null,bv)},live:function(e,bw,bv){b(this.context).on(e,this.selector,bw,bv);return this},die:function(e,bv){b(this.context).off(e,this.selector||"**",bv);return this},delegate:function(e,bv,bx,bw){return this.on(bv,e,bx,bw)},undelegate:function(e,bv,bw){return arguments.length==1?this.off(e,"**"):this.off(bv,e,bw)},trigger:function(e,bv){return this.each(function(){b.event.trigger(e,bv,this)})},triggerHandler:function(e,bv){if(this[0]){return b.event.trigger(e,bv,this[0],true)}},toggle:function(bx){var bv=arguments,e=bx.guid||b.guid++,bw=0,by=function(bz){var bA=(b._data(this,"lastToggle"+bx.guid)||0)%bw;b._data(this,"lastToggle"+bx.guid,bA+1);bz.preventDefault();return bv[bA].apply(this,arguments)||false};by.guid=e;while(bw<bv.length){bv[bw++].guid=e}return this.click(by)},hover:function(e,bv){return this.mouseenter(e).mouseleave(bv||e)}});b.each(("blur focus focusin focusout load resize scroll unload click dblclick mousedown mouseup mousemove mouseover mouseout mouseenter mouseleave change select submit keydown keypress keyup error contextmenu").split(" "),function(bv,e){b.fn[e]=function(bx,bw){if(bw==null){bw=bx;bx=null}return arguments.length>0?this.on(e,null,bx,bw):this.trigger(e)};if(b.attrFn){b.attrFn[e]=true}if(aO.test(e)){b.event.fixHooks[e]=b.event.keyHooks}if(bf.test(e)){b.event.fixHooks[e]=b.event.mouseHooks}});
+ * Sizzle CSS Selector Engine
+ * Copyright 2011, The Dojo Foundation
+ * Released under the MIT, BSD, and GPL Licenses.
+ * More information: http://sizzlejs.com/
+ */
+(function(){var bH=/((?:\((?:\([^()]+\)|[^()]+)+\)|\[(?:\[[^\[\]]*\]|['"][^'"]*['"]|[^\[\]'"]+)+\]|\\.|[^ >+~,(\[\\]+)+|[>+~])(\s*,\s*)?((?:.|\r|\n)*)/g,bC="sizcache"+(Math.random()+"").replace(".",""),bI=0,bL=Object.prototype.toString,bB=false,bA=true,bK=/\\/g,bO=/\r\n/g,bQ=/\W/;[0,0].sort(function(){bA=false;return 0});var by=function(bV,e,bY,bZ){bY=bY||[];e=e||av;var b1=e;if(e.nodeType!==1&&e.nodeType!==9){return[]}if(!bV||typeof bV!=="string"){return bY}var bS,b3,b6,bR,b2,b5,b4,bX,bU=true,bT=by.isXML(e),bW=[],b0=bV;do{bH.exec("");bS=bH.exec(b0);if(bS){b0=bS[3];bW.push(bS[1]);if(bS[2]){bR=bS[3];break}}}while(bS);if(bW.length>1&&bD.exec(bV)){if(bW.length===2&&bE.relative[bW[0]]){b3=bM(bW[0]+bW[1],e,bZ)}else{b3=bE.relative[bW[0]]?[e]:by(bW.shift(),e);while(bW.length){bV=bW.shift();if(bE.relative[bV]){bV+=bW.shift()}b3=bM(bV,b3,bZ)}}}else{if(!bZ&&bW.length>1&&e.nodeType===9&&!bT&&bE.match.ID.test(bW[0])&&!bE.match.ID.test(bW[bW.length-1])){b2=by.find(bW.shift(),e,bT);e=b2.expr?by.filter(b2.expr,b2.set)[0]:b2.set[0]}if(e){b2=bZ?{expr:bW.pop(),set:bF(bZ)}:by.find(bW.pop(),bW.length===1&&(bW[0]==="~"||bW[0]==="+")&&e.parentNode?e.parentNode:e,bT);b3=b2.expr?by.filter(b2.expr,b2.set):b2.set;if(bW.length>0){b6=bF(b3)}else{bU=false}while(bW.length){b5=bW.pop();b4=b5;if(!bE.relative[b5]){b5=""}else{b4=bW.pop()}if(b4==null){b4=e}bE.relative[b5](b6,b4,bT)}}else{b6=bW=[]}}if(!b6){b6=b3}if(!b6){by.error(b5||bV)}if(bL.call(b6)==="[object Array]"){if(!bU){bY.push.apply(bY,b6)}else{if(e&&e.nodeType===1){for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&(b6[bX]===true||b6[bX].nodeType===1&&by.contains(e,b6[bX]))){bY.push(b3[bX])}}}else{for(bX=0;b6[bX]!=null;bX++){if(b6[bX]&&b6[bX].nodeType===1){bY.push(b3[bX])}}}}}else{bF(b6,bY)}if(bR){by(bR,b1,bY,bZ);by.uniqueSort(bY)}return bY};by.uniqueSort=function(bR){if(bJ){bB=bA;bR.sort(bJ);if(bB){for(var e=1;e<bR.length;e++){if(bR[e]===bR[e-1]){bR.splice(e--,1)}}}}return bR};by.matches=function(e,bR){return by(e,null,null,bR)};by.matchesSelector=function(e,bR){return by(bR,null,null,[e]).length>0};by.find=function(bX,e,bY){var bW,bS,bU,bT,bV,bR;if(!bX){return[]}for(bS=0,bU=bE.order.length;bS<bU;bS++){bV=bE.order[bS];if((bT=bE.leftMatch[bV].exec(bX))){bR=bT[1];bT.splice(1,1);if(bR.substr(bR.length-1)!=="\\"){bT[1]=(bT[1]||"").replace(bK,"");bW=bE.find[bV](bT,e,bY);if(bW!=null){bX=bX.replace(bE.match[bV],"");break}}}}if(!bW){bW=typeof e.getElementsByTagName!=="undefined"?e.getElementsByTagName("*"):[]}return{set:bW,expr:bX}};by.filter=function(b1,b0,b4,bU){var bW,e,bZ,b6,b3,bR,bT,bV,b2,bS=b1,b5=[],bY=b0,bX=b0&&b0[0]&&by.isXML(b0[0]);while(b1&&b0.length){for(bZ in bE.filter){if((bW=bE.leftMatch[bZ].exec(b1))!=null&&bW[2]){bR=bE.filter[bZ];bT=bW[1];e=false;bW.splice(1,1);if(bT.substr(bT.length-1)==="\\"){continue}if(bY===b5){b5=[]}if(bE.preFilter[bZ]){bW=bE.preFilter[bZ](bW,bY,b4,b5,bU,bX);if(!bW){e=b6=true}else{if(bW===true){continue}}}if(bW){for(bV=0;(b3=bY[bV])!=null;bV++){if(b3){b6=bR(b3,bW,bV,bY);b2=bU^b6;if(b4&&b6!=null){if(b2){e=true}else{bY[bV]=false}}else{if(b2){b5.push(b3);e=true}}}}}if(b6!==L){if(!b4){bY=b5}b1=b1.replace(bE.match[bZ],"");if(!e){return[]}break}}}if(b1===bS){if(e==null){by.error(b1)}else{break}}bS=b1}return bY};by.error=function(e){throw new Error("Syntax error, unrecognized expression: "+e)};var bw=by.getText=function(bU){var bS,bT,e=bU.nodeType,bR="";if(e){if(e===1||e===9){if(typeof bU.textContent==="string"){return bU.textContent}else{if(typeof bU.innerText==="string"){return bU.innerText.replace(bO,"")}else{for(bU=bU.firstChild;bU;bU=bU.nextSibling){bR+=bw(bU)}}}}else{if(e===3||e===4){return bU.nodeValue}}}else{for(bS=0;(bT=bU[bS]);bS++){if(bT.nodeType!==8){bR+=bw(bT)}}}return bR};var bE=by.selectors={order:["ID","NAME","TAG"],match:{ID:/#((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,CLASS:/\.((?:[\w\u00c0-\uFFFF\-]|\\.)+)/,NAME:/\[name=['"]*((?:[\w\u00c0-\uFFFF\-]|\\.)+)['"]*\]/,ATTR:/\[\s*((?:[\w\u00c0-\uFFFF\-]|\\.)+)\s*(?:(\S?=)\s*(?:(['"])(.*?)\3|(#?(?:[\w\u00c0-\uFFFF\-]|\\.)*)|)|)\s*\]/,TAG:/^((?:[\w\u00c0-\uFFFF\*\-]|\\.)+)/,CHILD:/:(only|nth|last|first)-child(?:\(\s*(even|odd|(?:[+\-]?\d+|(?:[+\-]?\d*)?n\s*(?:[+\-]\s*\d+)?))\s*\))?/,POS:/:(nth|eq|gt|lt|first|last|even|odd)(?:\((\d*)\))?(?=[^\-]|$)/,PSEUDO:/:((?:[\w\u00c0-\uFFFF\-]|\\.)+)(?:\((['"]?)((?:\([^\)]+\)|[^\(\)]*)+)\2\))?/},leftMatch:{},attrMap:{"class":"className","for":"htmlFor"},attrHandle:{href:function(e){return e.getAttribute("href")},type:function(e){return e.getAttribute("type")}},relative:{"+":function(bW,bR){var bT=typeof bR==="string",bV=bT&&!bQ.test(bR),bX=bT&&!bV;if(bV){bR=bR.toLowerCase()}for(var bS=0,e=bW.length,bU;bS<e;bS++){if((bU=bW[bS])){while((bU=bU.previousSibling)&&bU.nodeType!==1){}bW[bS]=bX||bU&&bU.nodeName.toLowerCase()===bR?bU||false:bU===bR}}if(bX){by.filter(bR,bW,true)}},">":function(bW,bR){var bV,bU=typeof bR==="string",bS=0,e=bW.length;if(bU&&!bQ.test(bR)){bR=bR.toLowerCase();for(;bS<e;bS++){bV=bW[bS];if(bV){var bT=bV.parentNode;bW[bS]=bT.nodeName.toLowerCase()===bR?bT:false}}}else{for(;bS<e;bS++){bV=bW[bS];if(bV){bW[bS]=bU?bV.parentNode:bV.parentNode===bR}}if(bU){by.filter(bR,bW,true)}}},"":function(bT,bR,bV){var bU,bS=bI++,e=bN;if(typeof bR==="string"&&!bQ.test(bR)){bR=bR.toLowerCase();bU=bR;e=bv}e("parentNode",bR,bS,bT,bU,bV)},"~":function(bT,bR,bV){var bU,bS=bI++,e=bN;if(typeof bR==="string"&&!bQ.test(bR)){bR=bR.toLowerCase();bU=bR;e=bv}e("previousSibling",bR,bS,bT,bU,bV)}},find:{ID:function(bR,bS,bT){if(typeof bS.getElementById!=="undefined"&&!bT){var e=bS.getElementById(bR[1]);return e&&e.parentNode?[e]:[]}},NAME:function(bS,bV){if(typeof bV.getElementsByName!=="undefined"){var bR=[],bU=bV.getElementsByName(bS[1]);for(var bT=0,e=bU.length;bT<e;bT++){if(bU[bT].getAttribute("name")===bS[1]){bR.push(bU[bT])}}return bR.length===0?null:bR}},TAG:function(e,bR){if(typeof bR.getElementsByTagName!=="undefined"){return bR.getElementsByTagName(e[1])}}},preFilter:{CLASS:function(bT,bR,bS,e,bW,bX){bT=" "+bT[1].replace(bK,"")+" ";if(bX){return bT}for(var bU=0,bV;(bV=bR[bU])!=null;bU++){if(bV){if(bW^(bV.className&&(" "+bV.className+" ").replace(/[\t\n\r]/g," ").indexOf(bT)>=0)){if(!bS){e.push(bV)}}else{if(bS){bR[bU]=false}}}}return false},ID:function(e){return e[1].replace(bK,"")},TAG:function(bR,e){return bR[1].replace(bK,"").toLowerCase()},CHILD:function(e){if(e[1]==="nth"){if(!e[2]){by.error(e[0])}e[2]=e[2].replace(/^\+|\s*/g,"");var bR=/(-?)(\d*)(?:n([+\-]?\d*))?/.exec(e[2]==="even"&&"2n"||e[2]==="odd"&&"2n+1"||!/\D/.test(e[2])&&"0n+"+e[2]||e[2]);e[2]=(bR[1]+(bR[2]||1))-0;e[3]=bR[3]-0}else{if(e[2]){by.error(e[0])}}e[0]=bI++;return e},ATTR:function(bU,bR,bS,e,bV,bW){var bT=bU[1]=bU[1].replace(bK,"");if(!bW&&bE.attrMap[bT]){bU[1]=bE.attrMap[bT]}bU[4]=(bU[4]||bU[5]||"").replace(bK,"");if(bU[2]==="~="){bU[4]=" "+bU[4]+" "}return bU},PSEUDO:function(bU,bR,bS,e,bV){if(bU[1]==="not"){if((bH.exec(bU[3])||"").length>1||/^\w/.test(bU[3])){bU[3]=by(bU[3],null,null,bR)}else{var bT=by.filter(bU[3],bR,bS,true^bV);if(!bS){e.push.apply(e,bT)}return false}}else{if(bE.match.POS.test(bU[0])||bE.match.CHILD.test(bU[0])){return true}}return bU},POS:function(e){e.unshift(true);return e}},filters:{enabled:function(e){return e.disabled===false&&e.type!=="hidden"},disabled:function(e){return e.disabled===true},checked:function(e){return e.checked===true},selected:function(e){if(e.parentNode){e.parentNode.selectedIndex}return e.selected===true},parent:function(e){return !!e.firstChild},empty:function(e){return !e.firstChild},has:function(bS,bR,e){return !!by(e[3],bS).length},header:function(e){return(/h\d/i).test(e.nodeName)},text:function(bS){var e=bS.getAttribute("type"),bR=bS.type;return bS.nodeName.toLowerCase()==="input"&&"text"===bR&&(e===bR||e===null)},radio:function(e){return e.nodeName.toLowerCase()==="input"&&"radio"===e.type},checkbox:function(e){return e.nodeName.toLowerCase()==="input"&&"checkbox"===e.type},file:function(e){return e.nodeName.toLowerCase()==="input"&&"file"===e.type},password:function(e){return e.nodeName.toLowerCase()==="input"&&"password"===e.type},submit:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"submit"===bR.type},image:function(e){return e.nodeName.toLowerCase()==="input"&&"image"===e.type},reset:function(bR){var e=bR.nodeName.toLowerCase();return(e==="input"||e==="button")&&"reset"===bR.type},button:function(bR){var e=bR.nodeName.toLowerCase();return e==="input"&&"button"===bR.type||e==="button"},input:function(e){return(/input|select|textarea|button/i).test(e.nodeName)},focus:function(e){return e===e.ownerDocument.activeElement}},setFilters:{first:function(bR,e){return e===0},last:function(bS,bR,e,bT){return bR===bT.length-1},even:function(bR,e){return e%2===0},odd:function(bR,e){return e%2===1},lt:function(bS,bR,e){return bR<e[3]-0},gt:function(bS,bR,e){return bR>e[3]-0},nth:function(bS,bR,e){return e[3]-0===bR},eq:function(bS,bR,e){return e[3]-0===bR}},filter:{PSEUDO:function(bS,bX,bW,bY){var e=bX[1],bR=bE.filters[e];if(bR){return bR(bS,bW,bX,bY)}else{if(e==="contains"){return(bS.textContent||bS.innerText||bw([bS])||"").indexOf(bX[3])>=0}else{if(e==="not"){var bT=bX[3];for(var bV=0,bU=bT.length;bV<bU;bV++){if(bT[bV]===bS){return false}}return true}else{by.error(e)}}}},CHILD:function(bS,bU){var bT,b0,bW,bZ,e,bV,bY,bX=bU[1],bR=bS;switch(bX){case"only":case"first":while((bR=bR.previousSibling)){if(bR.nodeType===1){return false}}if(bX==="first"){return true}bR=bS;case"last":while((bR=bR.nextSibling)){if(bR.nodeType===1){return false}}return true;case"nth":bT=bU[2];b0=bU[3];if(bT===1&&b0===0){return true}bW=bU[0];bZ=bS.parentNode;if(bZ&&(bZ[bC]!==bW||!bS.nodeIndex)){bV=0;for(bR=bZ.firstChild;bR;bR=bR.nextSibling){if(bR.nodeType===1){bR.nodeIndex=++bV}}bZ[bC]=bW}bY=bS.nodeIndex-b0;if(bT===0){return bY===0}else{return(bY%bT===0&&bY/bT>=0)}}},ID:function(bR,e){return bR.nodeType===1&&bR.getAttribute("id")===e},TAG:function(bR,e){return(e==="*"&&bR.nodeType===1)||!!bR.nodeName&&bR.nodeName.toLowerCase()===e},CLASS:function(bR,e){return(" "+(bR.className||bR.getAttribute("class"))+" ").indexOf(e)>-1},ATTR:function(bV,bT){var bS=bT[1],e=by.attr?by.attr(bV,bS):bE.attrHandle[bS]?bE.attrHandle[bS](bV):bV[bS]!=null?bV[bS]:bV.getAttribute(bS),bW=e+"",bU=bT[2],bR=bT[4];return e==null?bU==="!=":!bU&&by.attr?e!=null:bU==="="?bW===bR:bU==="*="?bW.indexOf(bR)>=0:bU==="~="?(" "+bW+" ").indexOf(bR)>=0:!bR?bW&&e!==false:bU==="!="?bW!==bR:bU==="^="?bW.indexOf(bR)===0:bU==="$="?bW.substr(bW.length-bR.length)===bR:bU==="|="?bW===bR||bW.substr(0,bR.length+1)===bR+"-":false},POS:function(bU,bR,bS,bV){var e=bR[2],bT=bE.setFilters[e];if(bT){return bT(bU,bS,bR,bV)}}}};var bD=bE.match.POS,bx=function(bR,e){return"\\"+(e-0+1)};for(var bz in bE.match){bE.match[bz]=new RegExp(bE.match[bz].source+(/(?![^\[]*\])(?![^\(]*\))/.source));bE.leftMatch[bz]=new RegExp(/(^(?:.|\r|\n)*?)/.source+bE.match[bz].source.replace(/\\(\d+)/g,bx))}var bF=function(bR,e){bR=Array.prototype.slice.call(bR,0);if(e){e.push.apply(e,bR);return e}return bR};try{Array.prototype.slice.call(av.documentElement.childNodes,0)[0].nodeType}catch(bP){bF=function(bU,bT){var bS=0,bR=bT||[];if(bL.call(bU)==="[object Array]"){Array.prototype.push.apply(bR,bU)}else{if(typeof bU.length==="number"){for(var e=bU.length;bS<e;bS++){bR.push(bU[bS])}}else{for(;bU[bS];bS++){bR.push(bU[bS])}}}return bR}}var bJ,bG;if(av.documentElement.compareDocumentPosition){bJ=function(bR,e){if(bR===e){bB=true;return 0}if(!bR.compareDocumentPosition||!e.compareDocumentPosition){return bR.compareDocumentPosition?-1:1}return bR.compareDocumentPosition(e)&4?-1:1}}else{bJ=function(bY,bX){if(bY===bX){bB=true;return 0}else{if(bY.sourceIndex&&bX.sourceIndex){return bY.sourceIndex-bX.sourceIndex}}var bV,bR,bS=[],e=[],bU=bY.parentNode,bW=bX.parentNode,bZ=bU;if(bU===bW){return bG(bY,bX)}else{if(!bU){return -1}else{if(!bW){return 1}}}while(bZ){bS.unshift(bZ);bZ=bZ.parentNode}bZ=bW;while(bZ){e.unshift(bZ);bZ=bZ.parentNode}bV=bS.length;bR=e.length;for(var bT=0;bT<bV&&bT<bR;bT++){if(bS[bT]!==e[bT]){return bG(bS[bT],e[bT])}}return bT===bV?bG(bY,e[bT],-1):bG(bS[bT],bX,1)};bG=function(bR,e,bS){if(bR===e){return bS}var bT=bR.nextSibling;while(bT){if(bT===e){return -1}bT=bT.nextSibling}return 1}}(function(){var bR=av.createElement("div"),bS="script"+(new Date()).getTime(),e=av.documentElement;bR.innerHTML="<a name='"+bS+"'/>";e.insertBefore(bR,e.firstChild);if(av.getElementById(bS)){bE.find.ID=function(bU,bV,bW){if(typeof bV.getElementById!=="undefined"&&!bW){var bT=bV.getElementById(bU[1]);return bT?bT.id===bU[1]||typeof bT.getAttributeNode!=="undefined"&&bT.getAttributeNode("id").nodeValue===bU[1]?[bT]:L:[]}};bE.filter.ID=function(bV,bT){var bU=typeof bV.getAttributeNode!=="undefined"&&bV.getAttributeNode("id");return bV.nodeType===1&&bU&&bU.nodeValue===bT}}e.removeChild(bR);e=bR=null})();(function(){var e=av.createElement("div");e.appendChild(av.createComment(""));if(e.getElementsByTagName("*").length>0){bE.find.TAG=function(bR,bV){var bU=bV.getElementsByTagName(bR[1]);if(bR[1]==="*"){var bT=[];for(var bS=0;bU[bS];bS++){if(bU[bS].nodeType===1){bT.push(bU[bS])}}bU=bT}return bU}}e.innerHTML="<a href='#'></a>";if(e.firstChild&&typeof e.firstChild.getAttribute!=="undefined"&&e.firstChild.getAttribute("href")!=="#"){bE.attrHandle.href=function(bR){return bR.getAttribute("href",2)}}e=null})();if(av.querySelectorAll){(function(){var e=by,bT=av.createElement("div"),bS="__sizzle__";bT.innerHTML="<p class='TEST'></p>";if(bT.querySelectorAll&&bT.querySelectorAll(".TEST").length===0){return}by=function(b4,bV,bZ,b3){bV=bV||av;if(!b3&&!by.isXML(bV)){var b2=/^(\w+$)|^\.([\w\-]+$)|^#([\w\-]+$)/.exec(b4);if(b2&&(bV.nodeType===1||bV.nodeType===9)){if(b2[1]){return bF(bV.getElementsByTagName(b4),bZ)}else{if(b2[2]&&bE.find.CLASS&&bV.getElementsByClassName){return bF(bV.getElementsByClassName(b2[2]),bZ)}}}if(bV.nodeType===9){if(b4==="body"&&bV.body){return bF([bV.body],bZ)}else{if(b2&&b2[3]){var bY=bV.getElementById(b2[3]);if(bY&&bY.parentNode){if(bY.id===b2[3]){return bF([bY],bZ)}}else{return bF([],bZ)}}}try{return bF(bV.querySelectorAll(b4),bZ)}catch(b0){}}else{if(bV.nodeType===1&&bV.nodeName.toLowerCase()!=="object"){var bW=bV,bX=bV.getAttribute("id"),bU=bX||bS,b6=bV.parentNode,b5=/^\s*[+~]/.test(b4);if(!bX){bV.setAttribute("id",bU)}else{bU=bU.replace(/'/g,"\\$&")}if(b5&&b6){bV=bV.parentNode}try{if(!b5||b6){return bF(bV.querySelectorAll("[id='"+bU+"'] "+b4),bZ)}}catch(b1){}finally{if(!bX){bW.removeAttribute("id")}}}}}return e(b4,bV,bZ,b3)};for(var bR in e){by[bR]=e[bR]}bT=null})()}(function(){var e=av.documentElement,bS=e.matchesSelector||e.mozMatchesSelector||e.webkitMatchesSelector||e.msMatchesSelector;if(bS){var bU=!bS.call(av.createElement("div"),"div"),bR=false;try{bS.call(av.documentElement,"[test!='']:sizzle")}catch(bT){bR=true}by.matchesSelector=function(bW,bY){bY=bY.replace(/\=\s*([^'"\]]*)\s*\]/g,"='$1']");if(!by.isXML(bW)){try{if(bR||!bE.match.PSEUDO.test(bY)&&!/!=/.test(bY)){var bV=bS.call(bW,bY);if(bV||!bU||bW.document&&bW.document.nodeType!==11){return bV}}}catch(bX){}}return by(bY,null,null,[bW]).length>0}}})();(function(){var e=av.createElement("div");e.innerHTML="<div class='test e'></div><div class='test'></div>";if(!e.getElementsByClassName||e.getElementsByClassName("e").length===0){return}e.lastChild.className="e";if(e.getElementsByClassName("e").length===1){return}bE.order.splice(1,0,"CLASS");bE.find.CLASS=function(bR,bS,bT){if(typeof bS.getElementsByClassName!=="undefined"&&!bT){return bS.getElementsByClassName(bR[1])}};e=null})();function bv(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT<bS;bT++){var e=bZ[bT];if(e){var bU=false;e=e[bR];while(e){if(e[bC]===bV){bU=bZ[e.sizset];break}if(e.nodeType===1&&!bY){e[bC]=bV;e.sizset=bT}if(e.nodeName.toLowerCase()===bW){bU=e;break}e=e[bR]}bZ[bT]=bU}}}function bN(bR,bW,bV,bZ,bX,bY){for(var bT=0,bS=bZ.length;bT<bS;bT++){var e=bZ[bT];if(e){var bU=false;e=e[bR];while(e){if(e[bC]===bV){bU=bZ[e.sizset];break}if(e.nodeType===1){if(!bY){e[bC]=bV;e.sizset=bT}if(typeof bW!=="string"){if(e===bW){bU=true;break}}else{if(by.filter(bW,[e]).length>0){bU=e;break}}}e=e[bR]}bZ[bT]=bU}}}if(av.documentElement.contains){by.contains=function(bR,e){return bR!==e&&(bR.contains?bR.contains(e):true)}}else{if(av.documentElement.compareDocumentPosition){by.contains=function(bR,e){return !!(bR.compareDocumentPosition(e)&16)}}else{by.contains=function(){return false}}}by.isXML=function(e){var bR=(e?e.ownerDocument||e:0).documentElement;return bR?bR.nodeName!=="HTML":false};var bM=function(bS,e,bW){var bV,bX=[],bU="",bY=e.nodeType?[e]:e;while((bV=bE.match.PSEUDO.exec(bS))){bU+=bV[0];bS=bS.replace(bE.match.PSEUDO,"")}bS=bE.relative[bS]?bS+"*":bS;for(var bT=0,bR=bY.length;bT<bR;bT++){by(bS,bY[bT],bX,bW)}return by.filter(bU,bX)};by.attr=b.attr;by.selectors.attrMap={};b.find=by;b.expr=by.selectors;b.expr[":"]=b.expr.filters;b.unique=by.uniqueSort;b.text=by.getText;b.isXMLDoc=by.isXML;b.contains=by.contains})();var ab=/Until$/,aq=/^(?:parents|prevUntil|prevAll)/,a9=/,/,bp=/^.[^:#\[\.,]*$/,P=Array.prototype.slice,H=b.expr.match.POS,ay={children:true,contents:true,next:true,prev:true};b.fn.extend({find:function(e){var bw=this,by,bv;if(typeof e!=="string"){return b(e).filter(function(){for(by=0,bv=bw.length;by<bv;by++){if(b.contains(bw[by],this)){return true}}})}var bx=this.pushStack("","find",e),bA,bB,bz;for(by=0,bv=this.length;by<bv;by++){bA=bx.length;b.find(e,this[by],bx);if(by>0){for(bB=bA;bB<bx.length;bB++){for(bz=0;bz<bA;bz++){if(bx[bz]===bx[bB]){bx.splice(bB--,1);break}}}}}return bx},has:function(bv){var e=b(bv);return this.filter(function(){for(var bx=0,bw=e.length;bx<bw;bx++){if(b.contains(this,e[bx])){return true}}})},not:function(e){return this.pushStack(aG(this,e,false),"not",e)},filter:function(e){return this.pushStack(aG(this,e,true),"filter",e)},is:function(e){return !!e&&(typeof e==="string"?H.test(e)?b(e,this.context).index(this[0])>=0:b.filter(e,this).length>0:this.filter(e).length>0)},closest:function(by,bx){var bv=[],bw,e,bz=this[0];if(b.isArray(by)){var bB=1;while(bz&&bz.ownerDocument&&bz!==bx){for(bw=0;bw<by.length;bw++){if(b(bz).is(by[bw])){bv.push({selector:by[bw],elem:bz,level:bB})}}bz=bz.parentNode;bB++}return bv}var bA=H.test(by)||typeof by!=="string"?b(by,bx||this.context):0;for(bw=0,e=this.length;bw<e;bw++){bz=this[bw];while(bz){if(bA?bA.index(bz)>-1:b.find.matchesSelector(bz,by)){bv.push(bz);break}else{bz=bz.parentNode;if(!bz||!bz.ownerDocument||bz===bx||bz.nodeType===11){break}}}}bv=bv.length>1?b.unique(bv):bv;return this.pushStack(bv,"closest",by)},index:function(e){if(!e){return(this[0]&&this[0].parentNode)?this.prevAll().length:-1}if(typeof e==="string"){return b.inArray(this[0],b(e))}return b.inArray(e.jquery?e[0]:e,this)},add:function(e,bv){var bx=typeof e==="string"?b(e,bv):b.makeArray(e&&e.nodeType?[e]:e),bw=b.merge(this.get(),bx);return this.pushStack(C(bx[0])||C(bw[0])?bw:b.unique(bw))},andSelf:function(){return this.add(this.prevObject)}});function C(e){return !e||!e.parentNode||e.parentNode.nodeType===11}b.each({parent:function(bv){var e=bv.parentNode;return e&&e.nodeType!==11?e:null},parents:function(e){return b.dir(e,"parentNode")},parentsUntil:function(bv,e,bw){return b.dir(bv,"parentNode",bw)},next:function(e){return b.nth(e,2,"nextSibling")},prev:function(e){return b.nth(e,2,"previousSibling")},nextAll:function(e){return b.dir(e,"nextSibling")},prevAll:function(e){return b.dir(e,"previousSibling")},nextUntil:function(bv,e,bw){return b.dir(bv,"nextSibling",bw)},prevUntil:function(bv,e,bw){return b.dir(bv,"previousSibling",bw)},siblings:function(e){return b.sibling(e.parentNode.firstChild,e)},children:function(e){return b.sibling(e.firstChild)},contents:function(e){return b.nodeName(e,"iframe")?e.contentDocument||e.contentWindow.document:b.makeArray(e.childNodes)}},function(e,bv){b.fn[e]=function(by,bw){var bx=b.map(this,bv,by);if(!ab.test(e)){bw=by}if(bw&&typeof bw==="string"){bx=b.filter(bw,bx)}bx=this.length>1&&!ay[e]?b.unique(bx):bx;if((this.length>1||a9.test(bw))&&aq.test(e)){bx=bx.reverse()}return this.pushStack(bx,e,P.call(arguments).join(","))}});b.extend({filter:function(bw,e,bv){if(bv){bw=":not("+bw+")"}return e.length===1?b.find.matchesSelector(e[0],bw)?[e[0]]:[]:b.find.matches(bw,e)},dir:function(bw,bv,by){var e=[],bx=bw[bv];while(bx&&bx.nodeType!==9&&(by===L||bx.nodeType!==1||!b(bx).is(by))){if(bx.nodeType===1){e.push(bx)}bx=bx[bv]}return e},nth:function(by,e,bw,bx){e=e||1;var bv=0;for(;by;by=by[bw]){if(by.nodeType===1&&++bv===e){break}}return by},sibling:function(bw,bv){var e=[];for(;bw;bw=bw.nextSibling){if(bw.nodeType===1&&bw!==bv){e.push(bw)}}return e}});function aG(bx,bw,e){bw=bw||0;if(b.isFunction(bw)){return b.grep(bx,function(bz,by){var bA=!!bw.call(bz,by,bz);return bA===e})}else{if(bw.nodeType){return b.grep(bx,function(bz,by){return(bz===bw)===e})}else{if(typeof bw==="string"){var bv=b.grep(bx,function(by){return by.nodeType===1});if(bp.test(bw)){return b.filter(bw,bv,!e)}else{bw=b.filter(bw,bv)}}}}return b.grep(bx,function(bz,by){return(b.inArray(bz,bw)>=0)===e})}function a(e){var bw=aR.split("|"),bv=e.createDocumentFragment();if(bv.createElement){while(bw.length){bv.createElement(bw.pop())}}return bv}var aR="abbr|article|aside|audio|canvas|datalist|details|figcaption|figure|footer|header|hgroup|mark|meter|nav|output|progress|section|summary|time|video",ag=/ jQuery\d+="(?:\d+|null)"/g,ar=/^\s+/,R=/<(?!area|br|col|embed|hr|img|input|link|meta|param)(([\w:]+)[^>]*)\/>/ig,d=/<([\w:]+)/,w=/<tbody/i,W=/<|&#?\w+;/,ae=/<(?:script|style)/i,O=/<(?:script|object|embed|option|style)/i,ah=new RegExp("<(?:"+aR+")","i"),o=/checked\s*(?:[^=]|=\s*.checked.)/i,bm=/\/(java|ecma)script/i,aN=/^\s*<!(?:\[CDATA\[|\-\-)/,ax={option:[1,"<select multiple='multiple'>","</select>"],legend:[1,"<fieldset>","</fieldset>"],thead:[1,"<table>","</table>"],tr:[2,"<table><tbody>","</tbody></table>"],td:[3,"<table><tbody><tr>","</tr></tbody></table>"],col:[2,"<table><tbody></tbody><colgroup>","</colgroup></table>"],area:[1,"<map>","</map>"],_default:[0,"",""]},ac=a(av);ax.optgroup=ax.option;ax.tbody=ax.tfoot=ax.colgroup=ax.caption=ax.thead;ax.th=ax.td;if(!b.support.htmlSerialize){ax._default=[1,"div<div>","</div>"]}b.fn.extend({text:function(e){if(b.isFunction(e)){return this.each(function(bw){var bv=b(this);bv.text(e.call(this,bw,bv.text()))})}if(typeof e!=="object"&&e!==L){return this.empty().append((this[0]&&this[0].ownerDocument||av).createTextNode(e))}return b.text(this)},wrapAll:function(e){if(b.isFunction(e)){return this.each(function(bw){b(this).wrapAll(e.call(this,bw))})}if(this[0]){var bv=b(e,this[0].ownerDocument).eq(0).clone(true);if(this[0].parentNode){bv.insertBefore(this[0])}bv.map(function(){var bw=this;while(bw.firstChild&&bw.firstChild.nodeType===1){bw=bw.firstChild}return bw}).append(this)}return this},wrapInner:function(e){if(b.isFunction(e)){return this.each(function(bv){b(this).wrapInner(e.call(this,bv))})}return this.each(function(){var bv=b(this),bw=bv.contents();if(bw.length){bw.wrapAll(e)}else{bv.append(e)}})},wrap:function(e){var bv=b.isFunction(e);return this.each(function(bw){b(this).wrapAll(bv?e.call(this,bw):e)})},unwrap:function(){return this.parent().each(function(){if(!b.nodeName(this,"body")){b(this).replaceWith(this.childNodes)}}).end()},append:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.appendChild(e)}})},prepend:function(){return this.domManip(arguments,true,function(e){if(this.nodeType===1){this.insertBefore(e,this.firstChild)}})},before:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this)})}else{if(arguments.length){var e=b.clean(arguments);e.push.apply(e,this.toArray());return this.pushStack(e,"before",arguments)}}},after:function(){if(this[0]&&this[0].parentNode){return this.domManip(arguments,false,function(bv){this.parentNode.insertBefore(bv,this.nextSibling)})}else{if(arguments.length){var e=this.pushStack(this,"after",arguments);e.push.apply(e,b.clean(arguments));return e}}},remove:function(e,bx){for(var bv=0,bw;(bw=this[bv])!=null;bv++){if(!e||b.filter(e,[bw]).length){if(!bx&&bw.nodeType===1){b.cleanData(bw.getElementsByTagName("*"));b.cleanData([bw])}if(bw.parentNode){bw.parentNode.removeChild(bw)}}}return this},empty:function(){for(var e=0,bv;(bv=this[e])!=null;e++){if(bv.nodeType===1){b.cleanData(bv.getElementsByTagName("*"))}while(bv.firstChild){bv.removeChild(bv.firstChild)}}return this},clone:function(bv,e){bv=bv==null?false:bv;e=e==null?bv:e;return this.map(function(){return b.clone(this,bv,e)})},html:function(bx){if(bx===L){return this[0]&&this[0].nodeType===1?this[0].innerHTML.replace(ag,""):null}else{if(typeof bx==="string"&&!ae.test(bx)&&(b.support.leadingWhitespace||!ar.test(bx))&&!ax[(d.exec(bx)||["",""])[1].toLowerCase()]){bx=bx.replace(R,"<$1></$2>");try{for(var bw=0,bv=this.length;bw<bv;bw++){if(this[bw].nodeType===1){b.cleanData(this[bw].getElementsByTagName("*"));this[bw].innerHTML=bx}}}catch(by){this.empty().append(bx)}}else{if(b.isFunction(bx)){this.each(function(bz){var e=b(this);e.html(bx.call(this,bz,e.html()))})}else{this.empty().append(bx)}}}return this},replaceWith:function(e){if(this[0]&&this[0].parentNode){if(b.isFunction(e)){return this.each(function(bx){var bw=b(this),bv=bw.html();bw.replaceWith(e.call(this,bx,bv))})}if(typeof e!=="string"){e=b(e).detach()}return this.each(function(){var bw=this.nextSibling,bv=this.parentNode;b(this).remove();if(bw){b(bw).before(e)}else{b(bv).append(e)}})}else{return this.length?this.pushStack(b(b.isFunction(e)?e():e),"replaceWith",e):this}},detach:function(e){return this.remove(e,true)},domManip:function(bB,bF,bE){var bx,by,bA,bD,bC=bB[0],bv=[];if(!b.support.checkClone&&arguments.length===3&&typeof bC==="string"&&o.test(bC)){return this.each(function(){b(this).domManip(bB,bF,bE,true)})}if(b.isFunction(bC)){return this.each(function(bH){var bG=b(this);bB[0]=bC.call(this,bH,bF?bG.html():L);bG.domManip(bB,bF,bE)})}if(this[0]){bD=bC&&bC.parentNode;if(b.support.parentNode&&bD&&bD.nodeType===11&&bD.childNodes.length===this.length){bx={fragment:bD}}else{bx=b.buildFragment(bB,this,bv)}bA=bx.fragment;if(bA.childNodes.length===1){by=bA=bA.firstChild}else{by=bA.firstChild}if(by){bF=bF&&b.nodeName(by,"tr");for(var bw=0,e=this.length,bz=e-1;bw<e;bw++){bE.call(bF?ba(this[bw],by):this[bw],bx.cacheable||(e>1&&bw<bz)?b.clone(bA,true,true):bA)}}if(bv.length){b.each(bv,bo)}}return this}});function ba(e,bv){return b.nodeName(e,"table")?(e.getElementsByTagName("tbody")[0]||e.appendChild(e.ownerDocument.createElement("tbody"))):e}function t(bB,bv){if(bv.nodeType!==1||!b.hasData(bB)){return}var by,bx,e,bA=b._data(bB),bz=b._data(bv,bA),bw=bA.events;if(bw){delete bz.handle;bz.events={};for(by in bw){for(bx=0,e=bw[by].length;bx<e;bx++){b.event.add(bv,by+(bw[by][bx].namespace?".":"")+bw[by][bx].namespace,bw[by][bx],bw[by][bx].data)}}}if(bz.data){bz.data=b.extend({},bz.data)}}function ai(bv,e){var bw;if(e.nodeType!==1){return}if(e.clearAttributes){e.clearAttributes()}if(e.mergeAttributes){e.mergeAttributes(bv)}bw=e.nodeName.toLowerCase();if(bw==="object"){e.outerHTML=bv.outerHTML}else{if(bw==="input"&&(bv.type==="checkbox"||bv.type==="radio")){if(bv.checked){e.defaultChecked=e.checked=bv.checked}if(e.value!==bv.value){e.value=bv.value}}else{if(bw==="option"){e.selected=bv.defaultSelected}else{if(bw==="input"||bw==="textarea"){e.defaultValue=bv.defaultValue}}}}e.removeAttribute(b.expando)}b.buildFragment=function(bz,bx,bv){var by,e,bw,bA,bB=bz[0];if(bx&&bx[0]){bA=bx[0].ownerDocument||bx[0]}if(!bA.createDocumentFragment){bA=av}if(bz.length===1&&typeof bB==="string"&&bB.length<512&&bA===av&&bB.charAt(0)==="<"&&!O.test(bB)&&(b.support.checkClone||!o.test(bB))&&(b.support.html5Clone||!ah.test(bB))){e=true;bw=b.fragments[bB];if(bw&&bw!==1){by=bw}}if(!by){by=bA.createDocumentFragment();b.clean(bz,bA,by,bv)}if(e){b.fragments[bB]=bw?by:1}return{fragment:by,cacheable:e}};b.fragments={};b.each({appendTo:"append",prependTo:"prepend",insertBefore:"before",insertAfter:"after",replaceAll:"replaceWith"},function(e,bv){b.fn[e]=function(bw){var bz=[],bC=b(bw),bB=this.length===1&&this[0].parentNode;if(bB&&bB.nodeType===11&&bB.childNodes.length===1&&bC.length===1){bC[bv](this[0]);return this}else{for(var bA=0,bx=bC.length;bA<bx;bA++){var by=(bA>0?this.clone(true):this).get();b(bC[bA])[bv](by);bz=bz.concat(by)}return this.pushStack(bz,e,bC.selector)}}});function bg(e){if(typeof e.getElementsByTagName!=="undefined"){return e.getElementsByTagName("*")}else{if(typeof e.querySelectorAll!=="undefined"){return e.querySelectorAll("*")}else{return[]}}}function az(e){if(e.type==="checkbox"||e.type==="radio"){e.defaultChecked=e.checked}}function E(e){var bv=(e.nodeName||"").toLowerCase();if(bv==="input"){az(e)}else{if(bv!=="script"&&typeof e.getElementsByTagName!=="undefined"){b.grep(e.getElementsByTagName("input"),az)}}}function al(e){var bv=av.createElement("div");ac.appendChild(bv);bv.innerHTML=e.outerHTML;return bv.firstChild}b.extend({clone:function(by,bA,bw){var e,bv,bx,bz=b.support.html5Clone||!ah.test("<"+by.nodeName)?by.cloneNode(true):al(by);if((!b.support.noCloneEvent||!b.support.noCloneChecked)&&(by.nodeType===1||by.nodeType===11)&&!b.isXMLDoc(by)){ai(by,bz);e=bg(by);bv=bg(bz);for(bx=0;e[bx];++bx){if(bv[bx]){ai(e[bx],bv[bx])}}}if(bA){t(by,bz);if(bw){e=bg(by);bv=bg(bz);for(bx=0;e[bx];++bx){t(e[bx],bv[bx])}}}e=bv=null;return bz},clean:function(bw,by,bH,bA){var bF;by=by||av;if(typeof by.createElement==="undefined"){by=by.ownerDocument||by[0]&&by[0].ownerDocument||av}var bI=[],bB;for(var bE=0,bz;(bz=bw[bE])!=null;bE++){if(typeof bz==="number"){bz+=""}if(!bz){continue}if(typeof bz==="string"){if(!W.test(bz)){bz=by.createTextNode(bz)}else{bz=bz.replace(R,"<$1></$2>");var bK=(d.exec(bz)||["",""])[1].toLowerCase(),bx=ax[bK]||ax._default,bD=bx[0],bv=by.createElement("div");if(by===av){ac.appendChild(bv)}else{a(by).appendChild(bv)}bv.innerHTML=bx[1]+bz+bx[2];while(bD--){bv=bv.lastChild}if(!b.support.tbody){var e=w.test(bz),bC=bK==="table"&&!e?bv.firstChild&&bv.firstChild.childNodes:bx[1]==="<table>"&&!e?bv.childNodes:[];for(bB=bC.length-1;bB>=0;--bB){if(b.nodeName(bC[bB],"tbody")&&!bC[bB].childNodes.length){bC[bB].parentNode.removeChild(bC[bB])}}}if(!b.support.leadingWhitespace&&ar.test(bz)){bv.insertBefore(by.createTextNode(ar.exec(bz)[0]),bv.firstChild)}bz=bv.childNodes}}var bG;if(!b.support.appendChecked){if(bz[0]&&typeof(bG=bz.length)==="number"){for(bB=0;bB<bG;bB++){E(bz[bB])}}else{E(bz)}}if(bz.nodeType){bI.push(bz)}else{bI=b.merge(bI,bz)}}if(bH){bF=function(bL){return !bL.type||bm.test(bL.type)};for(bE=0;bI[bE];bE++){if(bA&&b.nodeName(bI[bE],"script")&&(!bI[bE].type||bI[bE].type.toLowerCase()==="text/javascript")){bA.push(bI[bE].parentNode?bI[bE].parentNode.removeChild(bI[bE]):bI[bE])}else{if(bI[bE].nodeType===1){var bJ=b.grep(bI[bE].getElementsByTagName("script"),bF);bI.splice.apply(bI,[bE+1,0].concat(bJ))}bH.appendChild(bI[bE])}}}return bI},cleanData:function(bv){var by,bw,e=b.cache,bB=b.event.special,bA=b.support.deleteExpando;for(var bz=0,bx;(bx=bv[bz])!=null;bz++){if(bx.nodeName&&b.noData[bx.nodeName.toLowerCase()]){continue}bw=bx[b.expando];if(bw){by=e[bw];if(by&&by.events){for(var bC in by.events){if(bB[bC]){b.event.remove(bx,bC)}else{b.removeEvent(bx,bC,by.handle)}}if(by.handle){by.handle.elem=null}}if(bA){delete bx[b.expando]}else{if(bx.removeAttribute){bx.removeAttribute(b.expando)}}delete e[bw]}}}});function bo(e,bv){if(bv.src){b.ajax({url:bv.src,async:false,dataType:"script"})}else{b.globalEval((bv.text||bv.textContent||bv.innerHTML||"").replace(aN,"/*$0*/"))}if(bv.parentNode){bv.parentNode.removeChild(bv)}}var ak=/alpha\([^)]*\)/i,au=/opacity=([^)]*)/,z=/([A-Z]|^ms)/g,bc=/^-?\d+(?:px)?$/i,bn=/^-?\d/,I=/^([\-+])=([\-+.\de]+)/,a7={position:"absolute",visibility:"hidden",display:"block"},an=["Left","Right"],a1=["Top","Bottom"],Z,aI,aX;b.fn.css=function(e,bv){if(arguments.length===2&&bv===L){return this}return b.access(this,e,bv,true,function(bx,bw,by){return by!==L?b.style(bx,bw,by):b.css(bx,bw)})};b.extend({cssHooks:{opacity:{get:function(bw,bv){if(bv){var e=Z(bw,"opacity","opacity");return e===""?"1":e}else{return bw.style.opacity}}}},cssNumber:{fillOpacity:true,fontWeight:true,lineHeight:true,opacity:true,orphans:true,widows:true,zIndex:true,zoom:true},cssProps:{"float":b.support.cssFloat?"cssFloat":"styleFloat"},style:function(bx,bw,bD,by){if(!bx||bx.nodeType===3||bx.nodeType===8||!bx.style){return}var bB,bC,bz=b.camelCase(bw),bv=bx.style,bE=b.cssHooks[bz];bw=b.cssProps[bz]||bz;if(bD!==L){bC=typeof bD;if(bC==="string"&&(bB=I.exec(bD))){bD=(+(bB[1]+1)*+bB[2])+parseFloat(b.css(bx,bw));bC="number"}if(bD==null||bC==="number"&&isNaN(bD)){return}if(bC==="number"&&!b.cssNumber[bz]){bD+="px"}if(!bE||!("set" in bE)||(bD=bE.set(bx,bD))!==L){try{bv[bw]=bD}catch(bA){}}}else{if(bE&&"get" in bE&&(bB=bE.get(bx,false,by))!==L){return bB}return bv[bw]}},css:function(by,bx,bv){var bw,e;bx=b.camelCase(bx);e=b.cssHooks[bx];bx=b.cssProps[bx]||bx;if(bx==="cssFloat"){bx="float"}if(e&&"get" in e&&(bw=e.get(by,true,bv))!==L){return bw}else{if(Z){return Z(by,bx)}}},swap:function(bx,bw,by){var e={};for(var bv in bw){e[bv]=bx.style[bv];bx.style[bv]=bw[bv]}by.call(bx);for(bv in bw){bx.style[bv]=e[bv]}}});b.curCSS=b.css;b.each(["height","width"],function(bv,e){b.cssHooks[e]={get:function(by,bx,bw){var bz;if(bx){if(by.offsetWidth!==0){return p(by,e,bw)}else{b.swap(by,a7,function(){bz=p(by,e,bw)})}return bz}},set:function(bw,bx){if(bc.test(bx)){bx=parseFloat(bx);if(bx>=0){return bx+"px"}}else{return bx}}}});if(!b.support.opacity){b.cssHooks.opacity={get:function(bv,e){return au.test((e&&bv.currentStyle?bv.currentStyle.filter:bv.style.filter)||"")?(parseFloat(RegExp.$1)/100)+"":e?"1":""},set:function(by,bz){var bx=by.style,bv=by.currentStyle,e=b.isNumeric(bz)?"alpha(opacity="+bz*100+")":"",bw=bv&&bv.filter||bx.filter||"";bx.zoom=1;if(bz>=1&&b.trim(bw.replace(ak,""))===""){bx.removeAttribute("filter");if(bv&&!bv.filter){return}}bx.filter=ak.test(bw)?bw.replace(ak,e):bw+" "+e}}}b(function(){if(!b.support.reliableMarginRight){b.cssHooks.marginRight={get:function(bw,bv){var e;b.swap(bw,{display:"inline-block"},function(){if(bv){e=Z(bw,"margin-right","marginRight")}else{e=bw.style.marginRight}});return e}}}});if(av.defaultView&&av.defaultView.getComputedStyle){aI=function(by,bw){var bv,bx,e;bw=bw.replace(z,"-$1").toLowerCase();if((bx=by.ownerDocument.defaultView)&&(e=bx.getComputedStyle(by,null))){bv=e.getPropertyValue(bw);if(bv===""&&!b.contains(by.ownerDocument.documentElement,by)){bv=b.style(by,bw)}}return bv}}if(av.documentElement.currentStyle){aX=function(bz,bw){var bA,e,by,bv=bz.currentStyle&&bz.currentStyle[bw],bx=bz.style;if(bv===null&&bx&&(by=bx[bw])){bv=by}if(!bc.test(bv)&&bn.test(bv)){bA=bx.left;e=bz.runtimeStyle&&bz.runtimeStyle.left;if(e){bz.runtimeStyle.left=bz.currentStyle.left}bx.left=bw==="fontSize"?"1em":(bv||0);bv=bx.pixelLeft+"px";bx.left=bA;if(e){bz.runtimeStyle.left=e}}return bv===""?"auto":bv}}Z=aI||aX;function p(by,bw,bv){var bA=bw==="width"?by.offsetWidth:by.offsetHeight,bz=bw==="width"?an:a1,bx=0,e=bz.length;if(bA>0){if(bv!=="border"){for(;bx<e;bx++){if(!bv){bA-=parseFloat(b.css(by,"padding"+bz[bx]))||0}if(bv==="margin"){bA+=parseFloat(b.css(by,bv+bz[bx]))||0}else{bA-=parseFloat(b.css(by,"border"+bz[bx]+"Width"))||0}}}return bA+"px"}bA=Z(by,bw,bw);if(bA<0||bA==null){bA=by.style[bw]||0}bA=parseFloat(bA)||0;if(bv){for(;bx<e;bx++){bA+=parseFloat(b.css(by,"padding"+bz[bx]))||0;if(bv!=="padding"){bA+=parseFloat(b.css(by,"border"+bz[bx]+"Width"))||0}if(bv==="margin"){bA+=parseFloat(b.css(by,bv+bz[bx]))||0}}}return bA+"px"}if(b.expr&&b.expr.filters){b.expr.filters.hidden=function(bw){var bv=bw.offsetWidth,e=bw.offsetHeight;return(bv===0&&e===0)||(!b.support.reliableHiddenOffsets&&((bw.style&&bw.style.display)||b.css(bw,"display"))==="none")};b.expr.filters.visible=function(e){return !b.expr.filters.hidden(e)}}var k=/%20/g,ap=/\[\]$/,bs=/\r?\n/g,bq=/#.*$/,aD=/^(.*?):[ \t]*([^\r\n]*)\r?$/mg,aZ=/^(?:color|date|datetime|datetime-local|email|hidden|month|number|password|range|search|tel|text|time|url|week)$/i,aM=/^(?:about|app|app\-storage|.+\-extension|file|res|widget):$/,aQ=/^(?:GET|HEAD)$/,c=/^\/\//,M=/\?/,a6=/<script\b[^<]*(?:(?!<\/script>)<[^<]*)*<\/script>/gi,q=/^(?:select|textarea)/i,h=/\s+/,br=/([?&])_=[^&]*/,K=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,A=b.fn.load,aa={},r={},aE,s,aV=["*/"]+["*"];try{aE=bl.href}catch(aw){aE=av.createElement("a");aE.href="";aE=aE.href}s=K.exec(aE.toLowerCase())||[];function f(e){return function(by,bA){if(typeof by!=="string"){bA=by;by="*"}if(b.isFunction(bA)){var bx=by.toLowerCase().split(h),bw=0,bz=bx.length,bv,bB,bC;for(;bw<bz;bw++){bv=bx[bw];bC=/^\+/.test(bv);if(bC){bv=bv.substr(1)||"*"}bB=e[bv]=e[bv]||[];bB[bC?"unshift":"push"](bA)}}}}function aW(bv,bE,bz,bD,bB,bx){bB=bB||bE.dataTypes[0];bx=bx||{};bx[bB]=true;var bA=bv[bB],bw=0,e=bA?bA.length:0,by=(bv===aa),bC;for(;bw<e&&(by||!bC);bw++){bC=bA[bw](bE,bz,bD);if(typeof bC==="string"){if(!by||bx[bC]){bC=L}else{bE.dataTypes.unshift(bC);bC=aW(bv,bE,bz,bD,bC,bx)}}}if((by||!bC)&&!bx["*"]){bC=aW(bv,bE,bz,bD,"*",bx)}return bC}function am(bw,bx){var bv,e,by=b.ajaxSettings.flatOptions||{};for(bv in bx){if(bx[bv]!==L){(by[bv]?bw:(e||(e={})))[bv]=bx[bv]}}if(e){b.extend(true,bw,e)}}b.fn.extend({load:function(bw,bz,bA){if(typeof bw!=="string"&&A){return A.apply(this,arguments)}else{if(!this.length){return this}}var by=bw.indexOf(" ");if(by>=0){var e=bw.slice(by,bw.length);bw=bw.slice(0,by)}var bx="GET";if(bz){if(b.isFunction(bz)){bA=bz;bz=L}else{if(typeof bz==="object"){bz=b.param(bz,b.ajaxSettings.traditional);bx="POST"}}}var bv=this;b.ajax({url:bw,type:bx,dataType:"html",data:bz,complete:function(bC,bB,bD){bD=bC.responseText;if(bC.isResolved()){bC.done(function(bE){bD=bE});bv.html(e?b("<div>").append(bD.replace(a6,"")).find(e):bD)}if(bA){bv.each(bA,[bD,bB,bC])}}});return this},serialize:function(){return b.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?b.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||q.test(this.nodeName)||aZ.test(this.type))}).map(function(e,bv){var bw=b(this).val();return bw==null?null:b.isArray(bw)?b.map(bw,function(by,bx){return{name:bv.name,value:by.replace(bs,"\r\n")}}):{name:bv.name,value:bw.replace(bs,"\r\n")}}).get()}});b.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(e,bv){b.fn[bv]=function(bw){return this.on(bv,bw)}});b.each(["get","post"],function(e,bv){b[bv]=function(bw,by,bz,bx){if(b.isFunction(by)){bx=bx||bz;bz=by;by=L}return b.ajax({type:bv,url:bw,data:by,success:bz,dataType:bx})}});b.extend({getScript:function(e,bv){return b.get(e,L,bv,"script")},getJSON:function(e,bv,bw){return b.get(e,bv,bw,"json")},ajaxSetup:function(bv,e){if(e){am(bv,b.ajaxSettings)}else{e=bv;bv=b.ajaxSettings}am(bv,e);return bv},ajaxSettings:{url:aE,isLocal:aM.test(s[1]),global:true,type:"GET",contentType:"application/x-www-form-urlencoded",processData:true,async:true,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":aV},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":bb.String,"text html":true,"text json":b.parseJSON,"text xml":b.parseXML},flatOptions:{context:true,url:true}},ajaxPrefilter:f(aa),ajaxTransport:f(r),ajax:function(bz,bx){if(typeof bz==="object"){bx=bz;bz=L}bx=bx||{};var bD=b.ajaxSetup({},bx),bS=bD.context||bD,bG=bS!==bD&&(bS.nodeType||bS instanceof b)?b(bS):b.event,bR=b.Deferred(),bN=b.Callbacks("once memory"),bB=bD.statusCode||{},bC,bH={},bO={},bQ,by,bL,bE,bI,bA=0,bw,bK,bJ={readyState:0,setRequestHeader:function(bT,bU){if(!bA){var e=bT.toLowerCase();bT=bO[e]=bO[e]||bT;bH[bT]=bU}return this},getAllResponseHeaders:function(){return bA===2?bQ:null},getResponseHeader:function(bT){var e;if(bA===2){if(!by){by={};while((e=aD.exec(bQ))){by[e[1].toLowerCase()]=e[2]}}e=by[bT.toLowerCase()]}return e===L?null:e},overrideMimeType:function(e){if(!bA){bD.mimeType=e}return this},abort:function(e){e=e||"abort";if(bL){bL.abort(e)}bF(0,e);return this}};function bF(bZ,bU,b0,bW){if(bA===2){return}bA=2;if(bE){clearTimeout(bE)}bL=L;bQ=bW||"";bJ.readyState=bZ>0?4:0;var bT,b4,b3,bX=bU,bY=b0?bj(bD,bJ,b0):L,bV,b2;if(bZ>=200&&bZ<300||bZ===304){if(bD.ifModified){if((bV=bJ.getResponseHeader("Last-Modified"))){b.lastModified[bC]=bV}if((b2=bJ.getResponseHeader("Etag"))){b.etag[bC]=b2}}if(bZ===304){bX="notmodified";bT=true}else{try{b4=G(bD,bY);bX="success";bT=true}catch(b1){bX="parsererror";b3=b1}}}else{b3=bX;if(!bX||bZ){bX="error";if(bZ<0){bZ=0}}}bJ.status=bZ;bJ.statusText=""+(bU||bX);if(bT){bR.resolveWith(bS,[b4,bX,bJ])}else{bR.rejectWith(bS,[bJ,bX,b3])}bJ.statusCode(bB);bB=L;if(bw){bG.trigger("ajax"+(bT?"Success":"Error"),[bJ,bD,bT?b4:b3])}bN.fireWith(bS,[bJ,bX]);if(bw){bG.trigger("ajaxComplete",[bJ,bD]);if(!(--b.active)){b.event.trigger("ajaxStop")}}}bR.promise(bJ);bJ.success=bJ.done;bJ.error=bJ.fail;bJ.complete=bN.add;bJ.statusCode=function(bT){if(bT){var e;if(bA<2){for(e in bT){bB[e]=[bB[e],bT[e]]}}else{e=bT[bJ.status];bJ.then(e,e)}}return this};bD.url=((bz||bD.url)+"").replace(bq,"").replace(c,s[1]+"//");bD.dataTypes=b.trim(bD.dataType||"*").toLowerCase().split(h);if(bD.crossDomain==null){bI=K.exec(bD.url.toLowerCase());bD.crossDomain=!!(bI&&(bI[1]!=s[1]||bI[2]!=s[2]||(bI[3]||(bI[1]==="http:"?80:443))!=(s[3]||(s[1]==="http:"?80:443))))}if(bD.data&&bD.processData&&typeof bD.data!=="string"){bD.data=b.param(bD.data,bD.traditional)}aW(aa,bD,bx,bJ);if(bA===2){return false}bw=bD.global;bD.type=bD.type.toUpperCase();bD.hasContent=!aQ.test(bD.type);if(bw&&b.active++===0){b.event.trigger("ajaxStart")}if(!bD.hasContent){if(bD.data){bD.url+=(M.test(bD.url)?"&":"?")+bD.data;delete bD.data}bC=bD.url;if(bD.cache===false){var bv=b.now(),bP=bD.url.replace(br,"$1_="+bv);bD.url=bP+((bP===bD.url)?(M.test(bD.url)?"&":"?")+"_="+bv:"")}}if(bD.data&&bD.hasContent&&bD.contentType!==false||bx.contentType){bJ.setRequestHeader("Content-Type",bD.contentType)}if(bD.ifModified){bC=bC||bD.url;if(b.lastModified[bC]){bJ.setRequestHeader("If-Modified-Since",b.lastModified[bC])}if(b.etag[bC]){bJ.setRequestHeader("If-None-Match",b.etag[bC])}}bJ.setRequestHeader("Accept",bD.dataTypes[0]&&bD.accepts[bD.dataTypes[0]]?bD.accepts[bD.dataTypes[0]]+(bD.dataTypes[0]!=="*"?", "+aV+"; q=0.01":""):bD.accepts["*"]);for(bK in bD.headers){bJ.setRequestHeader(bK,bD.headers[bK])}if(bD.beforeSend&&(bD.beforeSend.call(bS,bJ,bD)===false||bA===2)){bJ.abort();return false}for(bK in {success:1,error:1,complete:1}){bJ[bK](bD[bK])}bL=aW(r,bD,bx,bJ);if(!bL){bF(-1,"No Transport")}else{bJ.readyState=1;if(bw){bG.trigger("ajaxSend",[bJ,bD])}if(bD.async&&bD.timeout>0){bE=setTimeout(function(){bJ.abort("timeout")},bD.timeout)}try{bA=1;bL.send(bH,bF)}catch(bM){if(bA<2){bF(-1,bM)}else{throw bM}}}return bJ},param:function(e,bw){var bv=[],by=function(bz,bA){bA=b.isFunction(bA)?bA():bA;bv[bv.length]=encodeURIComponent(bz)+"="+encodeURIComponent(bA)};if(bw===L){bw=b.ajaxSettings.traditional}if(b.isArray(e)||(e.jquery&&!b.isPlainObject(e))){b.each(e,function(){by(this.name,this.value)})}else{for(var bx in e){v(bx,e[bx],bw,by)}}return bv.join("&").replace(k,"+")}});function v(bw,by,bv,bx){if(b.isArray(by)){b.each(by,function(bA,bz){if(bv||ap.test(bw)){bx(bw,bz)}else{v(bw+"["+(typeof bz==="object"||b.isArray(bz)?bA:"")+"]",bz,bv,bx)}})}else{if(!bv&&by!=null&&typeof by==="object"){for(var e in by){v(bw+"["+e+"]",by[e],bv,bx)}}else{bx(bw,by)}}}b.extend({active:0,lastModified:{},etag:{}});function bj(bD,bC,bz){var bv=bD.contents,bB=bD.dataTypes,bw=bD.responseFields,by,bA,bx,e;for(bA in bw){if(bA in bz){bC[bw[bA]]=bz[bA]}}while(bB[0]==="*"){bB.shift();if(by===L){by=bD.mimeType||bC.getResponseHeader("content-type")}}if(by){for(bA in bv){if(bv[bA]&&bv[bA].test(by)){bB.unshift(bA);break}}}if(bB[0] in bz){bx=bB[0]}else{for(bA in bz){if(!bB[0]||bD.converters[bA+" "+bB[0]]){bx=bA;break}if(!e){e=bA}}bx=bx||e}if(bx){if(bx!==bB[0]){bB.unshift(bx)}return bz[bx]}}function G(bH,bz){if(bH.dataFilter){bz=bH.dataFilter(bz,bH.dataType)}var bD=bH.dataTypes,bG={},bA,bE,bw=bD.length,bB,bC=bD[0],bx,by,bF,bv,e;for(bA=1;bA<bw;bA++){if(bA===1){for(bE in bH.converters){if(typeof bE==="string"){bG[bE.toLowerCase()]=bH.converters[bE]}}}bx=bC;bC=bD[bA];if(bC==="*"){bC=bx}else{if(bx!=="*"&&bx!==bC){by=bx+" "+bC;bF=bG[by]||bG["* "+bC];if(!bF){e=L;for(bv in bG){bB=bv.split(" ");if(bB[0]===bx||bB[0]==="*"){e=bG[bB[1]+" "+bC];if(e){bv=bG[bv];if(bv===true){bF=e}else{if(e===true){bF=bv}}break}}}}if(!(bF||e)){b.error("No conversion from "+by.replace(" "," to "))}if(bF!==true){bz=bF?bF(bz):e(bv(bz))}}}}return bz}var aC=b.now(),u=/(\=)\?(&|$)|\?\?/i;b.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return b.expando+"_"+(aC++)}});b.ajaxPrefilter("json jsonp",function(bD,bA,bC){var bx=bD.contentType==="application/x-www-form-urlencoded"&&(typeof bD.data==="string");if(bD.dataTypes[0]==="jsonp"||bD.jsonp!==false&&(u.test(bD.url)||bx&&u.test(bD.data))){var bB,bw=bD.jsonpCallback=b.isFunction(bD.jsonpCallback)?bD.jsonpCallback():bD.jsonpCallback,bz=bb[bw],e=bD.url,by=bD.data,bv="$1"+bw+"$2";if(bD.jsonp!==false){e=e.replace(u,bv);if(bD.url===e){if(bx){by=by.replace(u,bv)}if(bD.data===by){e+=(/\?/.test(e)?"&":"?")+bD.jsonp+"="+bw}}}bD.url=e;bD.data=by;bb[bw]=function(bE){bB=[bE]};bC.always(function(){bb[bw]=bz;if(bB&&b.isFunction(bz)){bb[bw](bB[0])}});bD.converters["script json"]=function(){if(!bB){b.error(bw+" was not called")}return bB[0]};bD.dataTypes[0]="json";return"script"}});b.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(e){b.globalEval(e);return e}}});b.ajaxPrefilter("script",function(e){if(e.cache===L){e.cache=false}if(e.crossDomain){e.type="GET";e.global=false}});b.ajaxTransport("script",function(bw){if(bw.crossDomain){var e,bv=av.head||av.getElementsByTagName("head")[0]||av.documentElement;return{send:function(bx,by){e=av.createElement("script");e.async="async";if(bw.scriptCharset){e.charset=bw.scriptCharset}e.src=bw.url;e.onload=e.onreadystatechange=function(bA,bz){if(bz||!e.readyState||/loaded|complete/.test(e.readyState)){e.onload=e.onreadystatechange=null;if(bv&&e.parentNode){bv.removeChild(e)}e=L;if(!bz){by(200,"success")}}};bv.insertBefore(e,bv.firstChild)},abort:function(){if(e){e.onload(0,1)}}}}});var B=bb.ActiveXObject?function(){for(var e in N){N[e](0,1)}}:false,y=0,N;function aL(){try{return new bb.XMLHttpRequest()}catch(bv){}}function aj(){try{return new bb.ActiveXObject("Microsoft.XMLHTTP")}catch(bv){}}b.ajaxSettings.xhr=bb.ActiveXObject?function(){return !this.isLocal&&aL()||aj()}:aL;(function(e){b.extend(b.support,{ajax:!!e,cors:!!e&&("withCredentials" in e)})})(b.ajaxSettings.xhr());if(b.support.ajax){b.ajaxTransport(function(e){if(!e.crossDomain||b.support.cors){var bv;return{send:function(bB,bw){var bA=e.xhr(),bz,by;if(e.username){bA.open(e.type,e.url,e.async,e.username,e.password)}else{bA.open(e.type,e.url,e.async)}if(e.xhrFields){for(by in e.xhrFields){bA[by]=e.xhrFields[by]}}if(e.mimeType&&bA.overrideMimeType){bA.overrideMimeType(e.mimeType)}if(!e.crossDomain&&!bB["X-Requested-With"]){bB["X-Requested-With"]="XMLHttpRequest"}try{for(by in bB){bA.setRequestHeader(by,bB[by])}}catch(bx){}bA.send((e.hasContent&&e.data)||null);bv=function(bK,bE){var bF,bD,bC,bI,bH;try{if(bv&&(bE||bA.readyState===4)){bv=L;if(bz){bA.onreadystatechange=b.noop;if(B){delete N[bz]}}if(bE){if(bA.readyState!==4){bA.abort()}}else{bF=bA.status;bC=bA.getAllResponseHeaders();bI={};bH=bA.responseXML;if(bH&&bH.documentElement){bI.xml=bH}bI.text=bA.responseText;try{bD=bA.statusText}catch(bJ){bD=""}if(!bF&&e.isLocal&&!e.crossDomain){bF=bI.text?200:404}else{if(bF===1223){bF=204}}}}}catch(bG){if(!bE){bw(-1,bG)}}if(bI){bw(bF,bD,bI,bC)}};if(!e.async||bA.readyState===4){bv()}else{bz=++y;if(B){if(!N){N={};b(bb).unload(B)}N[bz]=bv}bA.onreadystatechange=bv}},abort:function(){if(bv){bv(0,1)}}}}})}var Q={},a8,m,aB=/^(?:toggle|show|hide)$/,aT=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,a3,aH=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],a4;b.fn.extend({show:function(bx,bA,bz){var bw,by;if(bx||bx===0){return this.animate(a0("show",3),bx,bA,bz)}else{for(var bv=0,e=this.length;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(!b._data(bw,"olddisplay")&&by==="none"){by=bw.style.display=""}if(by===""&&b.css(bw,"display")==="none"){b._data(bw,"olddisplay",x(bw.nodeName))}}}for(bv=0;bv<e;bv++){bw=this[bv];if(bw.style){by=bw.style.display;if(by===""||by==="none"){bw.style.display=b._data(bw,"olddisplay")||""}}}return this}},hide:function(bx,bA,bz){if(bx||bx===0){return this.animate(a0("hide",3),bx,bA,bz)}else{var bw,by,bv=0,e=this.length;for(;bv<e;bv++){bw=this[bv];if(bw.style){by=b.css(bw,"display");if(by!=="none"&&!b._data(bw,"olddisplay")){b._data(bw,"olddisplay",by)}}}for(bv=0;bv<e;bv++){if(this[bv].style){this[bv].style.display="none"}}return this}},_toggle:b.fn.toggle,toggle:function(bw,bv,bx){var e=typeof bw==="boolean";if(b.isFunction(bw)&&b.isFunction(bv)){this._toggle.apply(this,arguments)}else{if(bw==null||e){this.each(function(){var by=e?bw:b(this).is(":hidden");b(this)[by?"show":"hide"]()})}else{this.animate(a0("toggle",3),bw,bv,bx)}}return this},fadeTo:function(e,bx,bw,bv){return this.filter(":hidden").css("opacity",0).show().end().animate({opacity:bx},e,bw,bv)},animate:function(bz,bw,by,bx){var e=b.speed(bw,by,bx);if(b.isEmptyObject(bz)){return this.each(e.complete,[false])}bz=b.extend({},bz);function bv(){if(e.queue===false){b._mark(this)}var bE=b.extend({},e),bK=this.nodeType===1,bI=bK&&b(this).is(":hidden"),bB,bF,bD,bJ,bH,bC,bG,bL,bA;bE.animatedProperties={};for(bD in bz){bB=b.camelCase(bD);if(bD!==bB){bz[bB]=bz[bD];delete bz[bD]}bF=bz[bB];if(b.isArray(bF)){bE.animatedProperties[bB]=bF[1];bF=bz[bB]=bF[0]}else{bE.animatedProperties[bB]=bE.specialEasing&&bE.specialEasing[bB]||bE.easing||"swing"}if(bF==="hide"&&bI||bF==="show"&&!bI){return bE.complete.call(this)}if(bK&&(bB==="height"||bB==="width")){bE.overflow=[this.style.overflow,this.style.overflowX,this.style.overflowY];if(b.css(this,"display")==="inline"&&b.css(this,"float")==="none"){if(!b.support.inlineBlockNeedsLayout||x(this.nodeName)==="inline"){this.style.display="inline-block"}else{this.style.zoom=1}}}}if(bE.overflow!=null){this.style.overflow="hidden"}for(bD in bz){bJ=new b.fx(this,bE,bD);bF=bz[bD];if(aB.test(bF)){bA=b._data(this,"toggle"+bD)||(bF==="toggle"?bI?"show":"hide":0);if(bA){b._data(this,"toggle"+bD,bA==="show"?"hide":"show");bJ[bA]()}else{bJ[bF]()}}else{bH=aT.exec(bF);bC=bJ.cur();if(bH){bG=parseFloat(bH[2]);bL=bH[3]||(b.cssNumber[bD]?"":"px");if(bL!=="px"){b.style(this,bD,(bG||1)+bL);bC=((bG||1)/bJ.cur())*bC;b.style(this,bD,bC+bL)}if(bH[1]){bG=((bH[1]==="-="?-1:1)*bG)+bC}bJ.custom(bC,bG,bL)}else{bJ.custom(bC,bF,"")}}}return true}return e.queue===false?this.each(bv):this.queue(e.queue,bv)},stop:function(bw,bv,e){if(typeof bw!=="string"){e=bv;bv=bw;bw=L}if(bv&&bw!==false){this.queue(bw||"fx",[])}return this.each(function(){var bx,by=false,bA=b.timers,bz=b._data(this);if(!e){b._unmark(true,this)}function bB(bE,bF,bD){var bC=bF[bD];b.removeData(bE,bD,true);bC.stop(e)}if(bw==null){for(bx in bz){if(bz[bx]&&bz[bx].stop&&bx.indexOf(".run")===bx.length-4){bB(this,bz,bx)}}}else{if(bz[bx=bw+".run"]&&bz[bx].stop){bB(this,bz,bx)}}for(bx=bA.length;bx--;){if(bA[bx].elem===this&&(bw==null||bA[bx].queue===bw)){if(e){bA[bx](true)}else{bA[bx].saveState()}by=true;bA.splice(bx,1)}}if(!(e&&by)){b.dequeue(this,bw)}})}});function bh(){setTimeout(at,0);return(a4=b.now())}function at(){a4=L}function a0(bv,e){var bw={};b.each(aH.concat.apply([],aH.slice(0,e)),function(){bw[this]=bv});return bw}b.each({slideDown:a0("show",1),slideUp:a0("hide",1),slideToggle:a0("toggle",1),fadeIn:{opacity:"show"},fadeOut:{opacity:"hide"},fadeToggle:{opacity:"toggle"}},function(e,bv){b.fn[e]=function(bw,by,bx){return this.animate(bv,bw,by,bx)}});b.extend({speed:function(bw,bx,bv){var e=bw&&typeof bw==="object"?b.extend({},bw):{complete:bv||!bv&&bx||b.isFunction(bw)&&bw,duration:bw,easing:bv&&bx||bx&&!b.isFunction(bx)&&bx};e.duration=b.fx.off?0:typeof e.duration==="number"?e.duration:e.duration in b.fx.speeds?b.fx.speeds[e.duration]:b.fx.speeds._default;if(e.queue==null||e.queue===true){e.queue="fx"}e.old=e.complete;e.complete=function(by){if(b.isFunction(e.old)){e.old.call(this)}if(e.queue){b.dequeue(this,e.queue)}else{if(by!==false){b._unmark(this)}}};return e},easing:{linear:function(bw,bx,e,bv){return e+bv*bw},swing:function(bw,bx,e,bv){return((-Math.cos(bw*Math.PI)/2)+0.5)*bv+e}},timers:[],fx:function(bv,e,bw){this.options=e;this.elem=bv;this.prop=bw;e.orig=e.orig||{}}});b.fx.prototype={update:function(){if(this.options.step){this.options.step.call(this.elem,this.now,this)}(b.fx.step[this.prop]||b.fx.step._default)(this)},cur:function(){if(this.elem[this.prop]!=null&&(!this.elem.style||this.elem.style[this.prop]==null)){return this.elem[this.prop]}var e,bv=b.css(this.elem,this.prop);return isNaN(e=parseFloat(bv))?!bv||bv==="auto"?0:bv:e},custom:function(bz,by,bx){var e=this,bw=b.fx;this.startTime=a4||bh();this.end=by;this.now=this.start=bz;this.pos=this.state=0;this.unit=bx||this.unit||(b.cssNumber[this.prop]?"":"px");function bv(bA){return e.step(bA)}bv.queue=this.options.queue;bv.elem=this.elem;bv.saveState=function(){if(e.options.hide&&b._data(e.elem,"fxshow"+e.prop)===L){b._data(e.elem,"fxshow"+e.prop,e.start)}};if(bv()&&b.timers.push(bv)&&!a3){a3=setInterval(bw.tick,bw.interval)}},show:function(){var e=b._data(this.elem,"fxshow"+this.prop);this.options.orig[this.prop]=e||b.style(this.elem,this.prop);this.options.show=true;if(e!==L){this.custom(this.cur(),e)}else{this.custom(this.prop==="width"||this.prop==="height"?1:0,this.cur())}b(this.elem).show()},hide:function(){this.options.orig[this.prop]=b._data(this.elem,"fxshow"+this.prop)||b.style(this.elem,this.prop);this.options.hide=true;this.custom(this.cur(),0)},step:function(by){var bA,bB,bv,bx=a4||bh(),e=true,bz=this.elem,bw=this.options;if(by||bx>=bw.duration+this.startTime){this.now=this.end;this.pos=this.state=1;this.update();bw.animatedProperties[this.prop]=true;for(bA in bw.animatedProperties){if(bw.animatedProperties[bA]!==true){e=false}}if(e){if(bw.overflow!=null&&!b.support.shrinkWrapBlocks){b.each(["","X","Y"],function(bC,bD){bz.style["overflow"+bD]=bw.overflow[bC]})}if(bw.hide){b(bz).hide()}if(bw.hide||bw.show){for(bA in bw.animatedProperties){b.style(bz,bA,bw.orig[bA]);b.removeData(bz,"fxshow"+bA,true);b.removeData(bz,"toggle"+bA,true)}}bv=bw.complete;if(bv){bw.complete=false;bv.call(bz)}}return false}else{if(bw.duration==Infinity){this.now=bx}else{bB=bx-this.startTime;this.state=bB/bw.duration;this.pos=b.easing[bw.animatedProperties[this.prop]](this.state,bB,0,1,bw.duration);this.now=this.start+((this.end-this.start)*this.pos)}this.update()}return true}};b.extend(b.fx,{tick:function(){var bw,bv=b.timers,e=0;for(;e<bv.length;e++){bw=bv[e];if(!bw()&&bv[e]===bw){bv.splice(e--,1)}}if(!bv.length){b.fx.stop()}},interval:13,stop:function(){clearInterval(a3);a3=null},speeds:{slow:600,fast:200,_default:400},step:{opacity:function(e){b.style(e.elem,"opacity",e.now)},_default:function(e){if(e.elem.style&&e.elem.style[e.prop]!=null){e.elem.style[e.prop]=e.now+e.unit}else{e.elem[e.prop]=e.now}}}});b.each(["width","height"],function(e,bv){b.fx.step[bv]=function(bw){b.style(bw.elem,bv,Math.max(0,bw.now)+bw.unit)}});if(b.expr&&b.expr.filters){b.expr.filters.animated=function(e){return b.grep(b.timers,function(bv){return e===bv.elem}).length}}function x(bx){if(!Q[bx]){var e=av.body,bv=b("<"+bx+">").appendTo(e),bw=bv.css("display");bv.remove();if(bw==="none"||bw===""){if(!a8){a8=av.createElement("iframe");a8.frameBorder=a8.width=a8.height=0}e.appendChild(a8);if(!m||!a8.createElement){m=(a8.contentWindow||a8.contentDocument).document;m.write((av.compatMode==="CSS1Compat"?"<!doctype html>":"")+"<html><body>");m.close()}bv=m.createElement(bx);m.body.appendChild(bv);bw=b.css(bv,"display");e.removeChild(a8)}Q[bx]=bw}return Q[bx]}var V=/^t(?:able|d|h)$/i,ad=/^(?:body|html)$/i;if("getBoundingClientRect" in av.documentElement){b.fn.offset=function(bI){var by=this[0],bB;if(bI){return this.each(function(e){b.offset.setOffset(this,bI,e)})}if(!by||!by.ownerDocument){return null}if(by===by.ownerDocument.body){return b.offset.bodyOffset(by)}try{bB=by.getBoundingClientRect()}catch(bF){}var bH=by.ownerDocument,bw=bH.documentElement;if(!bB||!b.contains(bw,by)){return bB?{top:bB.top,left:bB.left}:{top:0,left:0}}var bC=bH.body,bD=aK(bH),bA=bw.clientTop||bC.clientTop||0,bE=bw.clientLeft||bC.clientLeft||0,bv=bD.pageYOffset||b.support.boxModel&&bw.scrollTop||bC.scrollTop,bz=bD.pageXOffset||b.support.boxModel&&bw.scrollLeft||bC.scrollLeft,bG=bB.top+bv-bA,bx=bB.left+bz-bE;return{top:bG,left:bx}}}else{b.fn.offset=function(bF){var bz=this[0];if(bF){return this.each(function(bG){b.offset.setOffset(this,bF,bG)})}if(!bz||!bz.ownerDocument){return null}if(bz===bz.ownerDocument.body){return b.offset.bodyOffset(bz)}var bC,bw=bz.offsetParent,bv=bz,bE=bz.ownerDocument,bx=bE.documentElement,bA=bE.body,bB=bE.defaultView,e=bB?bB.getComputedStyle(bz,null):bz.currentStyle,bD=bz.offsetTop,by=bz.offsetLeft;while((bz=bz.parentNode)&&bz!==bA&&bz!==bx){if(b.support.fixedPosition&&e.position==="fixed"){break}bC=bB?bB.getComputedStyle(bz,null):bz.currentStyle;bD-=bz.scrollTop;by-=bz.scrollLeft;if(bz===bw){bD+=bz.offsetTop;by+=bz.offsetLeft;if(b.support.doesNotAddBorder&&!(b.support.doesAddBorderForTableAndCells&&V.test(bz.nodeName))){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}bv=bw;bw=bz.offsetParent}if(b.support.subtractsBorderForOverflowNotVisible&&bC.overflow!=="visible"){bD+=parseFloat(bC.borderTopWidth)||0;by+=parseFloat(bC.borderLeftWidth)||0}e=bC}if(e.position==="relative"||e.position==="static"){bD+=bA.offsetTop;by+=bA.offsetLeft}if(b.support.fixedPosition&&e.position==="fixed"){bD+=Math.max(bx.scrollTop,bA.scrollTop);by+=Math.max(bx.scrollLeft,bA.scrollLeft)}return{top:bD,left:by}}}b.offset={bodyOffset:function(e){var bw=e.offsetTop,bv=e.offsetLeft;if(b.support.doesNotIncludeMarginInBodyOffset){bw+=parseFloat(b.css(e,"marginTop"))||0;bv+=parseFloat(b.css(e,"marginLeft"))||0}return{top:bw,left:bv}},setOffset:function(bx,bG,bA){var bB=b.css(bx,"position");if(bB==="static"){bx.style.position="relative"}var bz=b(bx),bv=bz.offset(),e=b.css(bx,"top"),bE=b.css(bx,"left"),bF=(bB==="absolute"||bB==="fixed")&&b.inArray("auto",[e,bE])>-1,bD={},bC={},bw,by;if(bF){bC=bz.position();bw=bC.top;by=bC.left}else{bw=parseFloat(e)||0;by=parseFloat(bE)||0}if(b.isFunction(bG)){bG=bG.call(bx,bA,bv)}if(bG.top!=null){bD.top=(bG.top-bv.top)+bw}if(bG.left!=null){bD.left=(bG.left-bv.left)+by}if("using" in bG){bG.using.call(bx,bD)}else{bz.css(bD)}}};b.fn.extend({position:function(){if(!this[0]){return null}var bw=this[0],bv=this.offsetParent(),bx=this.offset(),e=ad.test(bv[0].nodeName)?{top:0,left:0}:bv.offset();bx.top-=parseFloat(b.css(bw,"marginTop"))||0;bx.left-=parseFloat(b.css(bw,"marginLeft"))||0;e.top+=parseFloat(b.css(bv[0],"borderTopWidth"))||0;e.left+=parseFloat(b.css(bv[0],"borderLeftWidth"))||0;return{top:bx.top-e.top,left:bx.left-e.left}},offsetParent:function(){return this.map(function(){var e=this.offsetParent||av.body;while(e&&(!ad.test(e.nodeName)&&b.css(e,"position")==="static")){e=e.offsetParent}return e})}});b.each(["Left","Top"],function(bv,e){var bw="scroll"+e;b.fn[bw]=function(bz){var bx,by;if(bz===L){bx=this[0];if(!bx){return null}by=aK(bx);return by?("pageXOffset" in by)?by[bv?"pageYOffset":"pageXOffset"]:b.support.boxModel&&by.document.documentElement[bw]||by.document.body[bw]:bx[bw]}return this.each(function(){by=aK(this);if(by){by.scrollTo(!bv?bz:b(by).scrollLeft(),bv?bz:b(by).scrollTop())}else{this[bw]=bz}})}});function aK(e){return b.isWindow(e)?e:e.nodeType===9?e.defaultView||e.parentWindow:false}b.each(["Height","Width"],function(bv,e){var bw=e.toLowerCase();b.fn["inner"+e]=function(){var bx=this[0];return bx?bx.style?parseFloat(b.css(bx,bw,"padding")):this[bw]():null};b.fn["outer"+e]=function(by){var bx=this[0];return bx?bx.style?parseFloat(b.css(bx,bw,by?"margin":"border")):this[bw]():null};b.fn[bw]=function(bz){var bA=this[0];if(!bA){return bz==null?null:this}if(b.isFunction(bz)){return this.each(function(bE){var bD=b(this);bD[bw](bz.call(this,bE,bD[bw]()))})}if(b.isWindow(bA)){var bB=bA.document.documentElement["client"+e],bx=bA.document.body;return bA.document.compatMode==="CSS1Compat"&&bB||bx&&bx["client"+e]||bB}else{if(bA.nodeType===9){return Math.max(bA.documentElement["client"+e],bA.body["scroll"+e],bA.documentElement["scroll"+e],bA.body["offset"+e],bA.documentElement["offset"+e])}else{if(bz===L){var bC=b.css(bA,bw),by=parseFloat(bC);return b.isNumeric(by)?by:bC}else{return this.css(bw,typeof bz==="string"?bz:bz+"px")}}}}});bb.jQuery=bb.$=b;if(typeof define==="function"&&define.amd&&define.amd.jQuery){define("jquery",[],function(){return b})}})(window);/*!
+ * jQuery UI 1.8.18
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(a,d){a.ui=a.ui||{};if(a.ui.version){return}a.extend(a.ui,{version:"1.8.18",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});a.fn.extend({propAttr:a.fn.prop||a.fn.attr,_focus:a.fn.focus,focus:function(e,f){return typeof e==="number"?this.each(function(){var g=this;setTimeout(function(){a(g).focus();if(f){f.call(g)}},e)}):this._focus.apply(this,arguments)},scrollParent:function(){var e;if((a.browser.msie&&(/(static|relative)/).test(this.css("position")))||(/absolute/).test(this.css("position"))){e=this.parents().filter(function(){return(/(relative|absolute|fixed)/).test(a.curCSS(this,"position",1))&&(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}else{e=this.parents().filter(function(){return(/(auto|scroll)/).test(a.curCSS(this,"overflow",1)+a.curCSS(this,"overflow-y",1)+a.curCSS(this,"overflow-x",1))}).eq(0)}return(/fixed/).test(this.css("position"))||!e.length?a(document):e},zIndex:function(h){if(h!==d){return this.css("zIndex",h)}if(this.length){var f=a(this[0]),e,g;while(f.length&&f[0]!==document){e=f.css("position");if(e==="absolute"||e==="relative"||e==="fixed"){g=parseInt(f.css("zIndex"),10);if(!isNaN(g)&&g!==0){return g}}f=f.parent()}}return 0},disableSelection:function(){return this.bind((a.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(e){e.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});a.each(["Width","Height"],function(g,e){var f=e==="Width"?["Left","Right"]:["Top","Bottom"],h=e.toLowerCase(),k={innerWidth:a.fn.innerWidth,innerHeight:a.fn.innerHeight,outerWidth:a.fn.outerWidth,outerHeight:a.fn.outerHeight};function j(m,l,i,n){a.each(f,function(){l-=parseFloat(a.curCSS(m,"padding"+this,true))||0;if(i){l-=parseFloat(a.curCSS(m,"border"+this+"Width",true))||0}if(n){l-=parseFloat(a.curCSS(m,"margin"+this,true))||0}});return l}a.fn["inner"+e]=function(i){if(i===d){return k["inner"+e].call(this)}return this.each(function(){a(this).css(h,j(this,i)+"px")})};a.fn["outer"+e]=function(i,l){if(typeof i!=="number"){return k["outer"+e].call(this,i)}return this.each(function(){a(this).css(h,j(this,i,true,l)+"px")})}});function c(g,e){var j=g.nodeName.toLowerCase();if("area"===j){var i=g.parentNode,h=i.name,f;if(!g.href||!h||i.nodeName.toLowerCase()!=="map"){return false}f=a("img[usemap=#"+h+"]")[0];return !!f&&b(f)}return(/input|select|textarea|button|object/.test(j)?!g.disabled:"a"==j?g.href||e:e)&&b(g)}function b(e){return !a(e).parents().andSelf().filter(function(){return a.curCSS(this,"visibility")==="hidden"||a.expr.filters.hidden(this)}).length}a.extend(a.expr[":"],{data:function(g,f,e){return !!a.data(g,e[3])},focusable:function(e){return c(e,!isNaN(a.attr(e,"tabindex")))},tabbable:function(g){var e=a.attr(g,"tabindex"),f=isNaN(e);return(f||e>=0)&&c(g,!f)}});a(function(){var e=document.body,f=e.appendChild(f=document.createElement("div"));f.offsetHeight;a.extend(f.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});a.support.minHeight=f.offsetHeight===100;a.support.selectstart="onselectstart" in f;e.removeChild(f).style.display="none"});a.extend(a.ui,{plugin:{add:function(f,g,j){var h=a.ui[f].prototype;for(var e in j){h.plugins[e]=h.plugins[e]||[];h.plugins[e].push([g,j[e]])}},call:function(e,g,f){var j=e.plugins[g];if(!j||!e.element[0].parentNode){return}for(var h=0;h<j.length;h++){if(e.options[j[h][0]]){j[h][1].apply(e.element,f)}}}},contains:function(f,e){return document.compareDocumentPosition?f.compareDocumentPosition(e)&16:f!==e&&f.contains(e)},hasScroll:function(h,f){if(a(h).css("overflow")==="hidden"){return false}var e=(f&&f==="left")?"scrollLeft":"scrollTop",g=false;if(h[e]>0){return true}h[e]=1;g=(h[e]>0);h[e]=0;return g},isOverAxis:function(f,e,g){return(f>e)&&(f<(e+g))},isOver:function(j,f,i,h,e,g){return a.ui.isOverAxis(j,i,e)&&a.ui.isOverAxis(f,h,g)}})})(jQuery);/*!
+ * jQuery UI Widget 1.8.18
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Widget
+ */
+(function(b,d){if(b.cleanData){var c=b.cleanData;b.cleanData=function(f){for(var g=0,h;(h=f[g])!=null;g++){try{b(h).triggerHandler("remove")}catch(j){}}c(f)}}else{var a=b.fn.remove;b.fn.remove=function(e,f){return this.each(function(){if(!f){if(!e||b.filter(e,[this]).length){b("*",this).add([this]).each(function(){try{b(this).triggerHandler("remove")}catch(g){}})}}return a.call(b(this),e,f)})}}b.widget=function(f,h,e){var g=f.split(".")[0],j;f=f.split(".")[1];j=g+"-"+f;if(!e){e=h;h=b.Widget}b.expr[":"][j]=function(k){return !!b.data(k,f)};b[g]=b[g]||{};b[g][f]=function(k,l){if(arguments.length){this._createWidget(k,l)}};var i=new h();i.options=b.extend(true,{},i.options);b[g][f].prototype=b.extend(true,i,{namespace:g,widgetName:f,widgetEventPrefix:b[g][f].prototype.widgetEventPrefix||f,widgetBaseClass:j},e);b.widget.bridge(f,b[g][f])};b.widget.bridge=function(f,e){b.fn[f]=function(i){var g=typeof i==="string",h=Array.prototype.slice.call(arguments,1),j=this;i=!g&&h.length?b.extend.apply(null,[true,i].concat(h)):i;if(g&&i.charAt(0)==="_"){return j}if(g){this.each(function(){var k=b.data(this,f),l=k&&b.isFunction(k[i])?k[i].apply(k,h):k;if(l!==k&&l!==d){j=l;return false}})}else{this.each(function(){var k=b.data(this,f);if(k){k.option(i||{})._init()}else{b.data(this,f,new e(i,this))}})}return j}};b.Widget=function(e,f){if(arguments.length){this._createWidget(e,f)}};b.Widget.prototype={widgetName:"widget",widgetEventPrefix:"",options:{disabled:false},_createWidget:function(f,g){b.data(g,this.widgetName,this);this.element=b(g);this.options=b.extend(true,{},this.options,this._getCreateOptions(),f);var e=this;this.element.bind("remove."+this.widgetName,function(){e.destroy()});this._create();this._trigger("create");this._init()},_getCreateOptions:function(){return b.metadata&&b.metadata.get(this.element[0])[this.widgetName]},_create:function(){},_init:function(){},destroy:function(){this.element.unbind("."+this.widgetName).removeData(this.widgetName);this.widget().unbind("."+this.widgetName).removeAttr("aria-disabled").removeClass(this.widgetBaseClass+"-disabled ui-state-disabled")},widget:function(){return this.element},option:function(f,g){var e=f;if(arguments.length===0){return b.extend({},this.options)}if(typeof f==="string"){if(g===d){return this.options[f]}e={};e[f]=g}this._setOptions(e);return this},_setOptions:function(f){var e=this;b.each(f,function(g,h){e._setOption(g,h)});return this},_setOption:function(e,f){this.options[e]=f;if(e==="disabled"){this.widget()[f?"addClass":"removeClass"](this.widgetBaseClass+"-disabled ui-state-disabled").attr("aria-disabled",f)}return this},enable:function(){return this._setOption("disabled",false)},disable:function(){return this._setOption("disabled",true)},_trigger:function(e,f,g){var j,i,h=this.options[e];g=g||{};f=b.Event(f);f.type=(e===this.widgetEventPrefix?e:this.widgetEventPrefix+e).toLowerCase();f.target=this.element[0];i=f.originalEvent;if(i){for(j in i){if(!(j in f)){f[j]=i[j]}}}this.element.trigger(f,g);return !(b.isFunction(h)&&h.call(this.element[0],f,g)===false||f.isDefaultPrevented())}}})(jQuery);/*!
+ * jQuery UI Mouse 1.8.18
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Mouse
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ */
+(function(b,c){var a=false;b(document).mouseup(function(d){a=false});b.widget("ui.mouse",{options:{cancel:":input,option",distance:1,delay:0},_mouseInit:function(){var d=this;this.element.bind("mousedown."+this.widgetName,function(e){return d._mouseDown(e)}).bind("click."+this.widgetName,function(e){if(true===b.data(e.target,d.widgetName+".preventClickEvent")){b.removeData(e.target,d.widgetName+".preventClickEvent");e.stopImmediatePropagation();return false}});this.started=false},_mouseDestroy:function(){this.element.unbind("."+this.widgetName)},_mouseDown:function(f){if(a){return}(this._mouseStarted&&this._mouseUp(f));this._mouseDownEvent=f;var e=this,g=(f.which==1),d=(typeof this.options.cancel=="string"&&f.target.nodeName?b(f.target).closest(this.options.cancel).length:false);if(!g||d||!this._mouseCapture(f)){return true}this.mouseDelayMet=!this.options.delay;if(!this.mouseDelayMet){this._mouseDelayTimer=setTimeout(function(){e.mouseDelayMet=true},this.options.delay)}if(this._mouseDistanceMet(f)&&this._mouseDelayMet(f)){this._mouseStarted=(this._mouseStart(f)!==false);if(!this._mouseStarted){f.preventDefault();return true}}if(true===b.data(f.target,this.widgetName+".preventClickEvent")){b.removeData(f.target,this.widgetName+".preventClickEvent")}this._mouseMoveDelegate=function(h){return e._mouseMove(h)};this._mouseUpDelegate=function(h){return e._mouseUp(h)};b(document).bind("mousemove."+this.widgetName,this._mouseMoveDelegate).bind("mouseup."+this.widgetName,this._mouseUpDelegate);f.preventDefault();a=true;return true},_mouseMove:function(d){if(b.browser.msie&&!(document.documentMode>=9)&&!d.button){return this._mouseUp(d)}if(this._mouseStarted){this._mouseDrag(d);return d.preventDefault()}if(this._mouseDistanceMet(d)&&this._mouseDelayMet(d)){this._mouseStarted=(this._mouseStart(this._mouseDownEvent,d)!==false);(this._mouseStarted?this._mouseDrag(d):this._mouseUp(d))}return !this._mouseStarted},_mouseUp:function(d){b(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;if(d.target==this._mouseDownEvent.target){b.data(d.target,this.widgetName+".preventClickEvent",true)}this._mouseStop(d)}return false},_mouseDistanceMet:function(d){return(Math.max(Math.abs(this._mouseDownEvent.pageX-d.pageX),Math.abs(this._mouseDownEvent.pageY-d.pageY))>=this.options.distance)},_mouseDelayMet:function(d){return this.mouseDelayMet},_mouseStart:function(d){},_mouseDrag:function(d){},_mouseStop:function(d){},_mouseCapture:function(d){return true}})})(jQuery);(function(c,d){c.widget("ui.resizable",c.ui.mouse,{widgetEventPrefix:"resize",options:{alsoResize:false,animate:false,animateDuration:"slow",animateEasing:"swing",aspectRatio:false,autoHide:false,containment:false,ghost:false,grid:false,handles:"e,s,se",helper:false,maxHeight:null,maxWidth:null,minHeight:10,minWidth:10,zIndex:1000},_create:function(){var f=this,k=this.options;this.element.addClass("ui-resizable");c.extend(this,{_aspectRatio:!!(k.aspectRatio),aspectRatio:k.aspectRatio,originalElement:this.element,_proportionallyResizeElements:[],_helper:k.helper||k.ghost||k.animate?k.helper||"ui-resizable-helper":null});if(this.element[0].nodeName.match(/canvas|textarea|input|select|button|img/i)){this.element.wrap(c('<div class="ui-wrapper" style="overflow: hidden;"></div>').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=k.handles||(!c(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all"){this.handles="n,e,s,w,se,sw,ne,nw"}var l=this.handles.split(",");this.handles={};for(var g=0;g<l.length;g++){var j=c.trim(l[g]),e="ui-resizable-"+j;var h=c('<div class="ui-resizable-handle '+e+'"></div>');if(/sw|se|ne|nw/.test(j)){h.css({zIndex:++k.zIndex})}if("se"==j){h.addClass("ui-icon ui-icon-gripsmall-diagonal-se")}this.handles[j]=".ui-resizable-"+j;this.element.append(h)}}this._renderAxis=function(q){q=q||this.element;for(var n in this.handles){if(this.handles[n].constructor==String){this.handles[n]=c(this.handles[n],this.element).show()}if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var o=c(this.handles[n],this.element),p=0;p=/sw|ne|nw|se|n|s/.test(n)?o.outerHeight():o.outerWidth();var m=["padding",/ne|nw|n/.test(n)?"Top":/se|sw|s/.test(n)?"Bottom":/^e$/.test(n)?"Right":"Left"].join("");q.css(m,p);this._proportionallyResize()}if(!c(this.handles[n]).length){continue}}};this._renderAxis(this.element);this._handles=c(".ui-resizable-handle",this.element).disableSelection();this._handles.mouseover(function(){if(!f.resizing){if(this.className){var i=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i)}f.axis=i&&i[1]?i[1]:"se"}});if(k.autoHide){this._handles.hide();c(this.element).addClass("ui-resizable-autohide").hover(function(){if(k.disabled){return}c(this).removeClass("ui-resizable-autohide");f._handles.show()},function(){if(k.disabled){return}if(!f.resizing){c(this).addClass("ui-resizable-autohide");f._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var e=function(g){c(g).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};if(this.elementIsWrapper){e(this.element);var f=this.element;f.after(this.originalElement.css({position:f.css("position"),width:f.outerWidth(),height:f.outerHeight(),top:f.css("top"),left:f.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);e(this.originalElement);return this},_mouseCapture:function(f){var g=false;for(var e in this.handles){if(c(this.handles[e])[0]==f.target){g=true}}return !this.options.disabled&&g},_mouseStart:function(g){var j=this.options,f=this.element.position(),e=this.element;this.resizing=true;this.documentScroll={top:c(document).scrollTop(),left:c(document).scrollLeft()};if(e.is(".ui-draggable")||(/absolute/).test(e.css("position"))){e.css({position:"absolute",top:f.top,left:f.left})}this._renderProxy();var k=b(this.helper.css("left")),h=b(this.helper.css("top"));if(j.containment){k+=c(j.containment).scrollLeft()||0;h+=c(j.containment).scrollTop()||0}this.offset=this.helper.offset();this.position={left:k,top:h};this.size=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalSize=this._helper?{width:e.outerWidth(),height:e.outerHeight()}:{width:e.width(),height:e.height()};this.originalPosition={left:k,top:h};this.sizeDiff={width:e.outerWidth()-e.width(),height:e.outerHeight()-e.height()};this.originalMousePosition={left:g.pageX,top:g.pageY};this.aspectRatio=(typeof j.aspectRatio=="number")?j.aspectRatio:((this.originalSize.width/this.originalSize.height)||1);var i=c(".ui-resizable-"+this.axis).css("cursor");c("body").css("cursor",i=="auto"?this.axis+"-resize":i);e.addClass("ui-resizable-resizing");this._propagate("start",g);return true},_mouseDrag:function(e){var h=this.helper,g=this.options,m={},q=this,j=this.originalMousePosition,n=this.axis;var r=(e.pageX-j.left)||0,p=(e.pageY-j.top)||0;var i=this._change[n];if(!i){return false}var l=i.apply(this,[e,r,p]),k=c.browser.msie&&c.browser.version<7,f=this.sizeDiff;this._updateVirtualBoundaries(e.shiftKey);if(this._aspectRatio||e.shiftKey){l=this._updateRatio(l,e)}l=this._respectSize(l,e);this._propagate("resize",e);h.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});if(!this._helper&&this._proportionallyResizeElements.length){this._proportionallyResize()}this._updateCache(l);this._trigger("resize",e,this.ui());return false},_mouseStop:function(h){this.resizing=false;var i=this.options,m=this;if(this._helper){var g=this._proportionallyResizeElements,e=g.length&&(/textarea/i).test(g[0].nodeName),f=e&&c.ui.hasScroll(g[0],"left")?0:m.sizeDiff.height,k=e?0:m.sizeDiff.width;var n={width:(m.helper.width()-k),height:(m.helper.height()-f)},j=(parseInt(m.element.css("left"),10)+(m.position.left-m.originalPosition.left))||null,l=(parseInt(m.element.css("top"),10)+(m.position.top-m.originalPosition.top))||null;if(!i.animate){this.element.css(c.extend(n,{top:l,left:j}))}m.helper.height(m.size.height);m.helper.width(m.size.width);if(this._helper&&!i.animate){this._proportionallyResize()}}c("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");this._propagate("stop",h);if(this._helper){this.helper.remove()}return false},_updateVirtualBoundaries:function(g){var j=this.options,i,h,f,k,e;e={minWidth:a(j.minWidth)?j.minWidth:0,maxWidth:a(j.maxWidth)?j.maxWidth:Infinity,minHeight:a(j.minHeight)?j.minHeight:0,maxHeight:a(j.maxHeight)?j.maxHeight:Infinity};if(this._aspectRatio||g){i=e.minHeight*this.aspectRatio;f=e.minWidth/this.aspectRatio;h=e.maxHeight*this.aspectRatio;k=e.maxWidth/this.aspectRatio;if(i>e.minWidth){e.minWidth=i}if(f>e.minHeight){e.minHeight=f}if(h<e.maxWidth){e.maxWidth=h}if(k<e.maxHeight){e.maxHeight=k}}this._vBoundaries=e},_updateCache:function(e){var f=this.options;this.offset=this.helper.offset();if(a(e.left)){this.position.left=e.left}if(a(e.top)){this.position.top=e.top}if(a(e.height)){this.size.height=e.height}if(a(e.width)){this.size.width=e.width}},_updateRatio:function(h,g){var i=this.options,j=this.position,f=this.size,e=this.axis;if(a(h.height)){h.width=(h.height*this.aspectRatio)}else{if(a(h.width)){h.height=(h.width/this.aspectRatio)}}if(e=="sw"){h.left=j.left+(f.width-h.width);h.top=null}if(e=="nw"){h.top=j.top+(f.height-h.height);h.left=j.left+(f.width-h.width)}return h},_respectSize:function(l,g){var j=this.helper,i=this._vBoundaries,r=this._aspectRatio||g.shiftKey,q=this.axis,t=a(l.width)&&i.maxWidth&&(i.maxWidth<l.width),m=a(l.height)&&i.maxHeight&&(i.maxHeight<l.height),h=a(l.width)&&i.minWidth&&(i.minWidth>l.width),s=a(l.height)&&i.minHeight&&(i.minHeight>l.height);if(h){l.width=i.minWidth}if(s){l.height=i.minHeight}if(t){l.width=i.maxWidth}if(m){l.height=i.maxHeight}var f=this.originalPosition.left+this.originalSize.width,p=this.position.top+this.size.height;var k=/sw|nw|w/.test(q),e=/nw|ne|n/.test(q);if(h&&k){l.left=f-i.minWidth}if(t&&k){l.left=f-i.maxWidth}if(s&&e){l.top=p-i.minHeight}if(m&&e){l.top=p-i.maxHeight}var n=!l.width&&!l.height;if(n&&!l.left&&l.top){l.top=null}else{if(n&&!l.top&&l.left){l.left=null}}return l},_proportionallyResize:function(){var k=this.options;if(!this._proportionallyResizeElements.length){return}var g=this.helper||this.element;for(var f=0;f<this._proportionallyResizeElements.length;f++){var h=this._proportionallyResizeElements[f];if(!this.borderDif){var e=[h.css("borderTopWidth"),h.css("borderRightWidth"),h.css("borderBottomWidth"),h.css("borderLeftWidth")],j=[h.css("paddingTop"),h.css("paddingRight"),h.css("paddingBottom"),h.css("paddingLeft")];this.borderDif=c.map(e,function(l,n){var m=parseInt(l,10)||0,o=parseInt(j[n],10)||0;return m+o})}if(c.browser.msie&&!(!(c(g).is(":hidden")||c(g).parents(":hidden").length))){continue}h.css({height:(g.height()-this.borderDif[0]-this.borderDif[2])||0,width:(g.width()-this.borderDif[1]-this.borderDif[3])||0})}},_renderProxy:function(){var f=this.element,i=this.options;this.elementOffset=f.offset();if(this._helper){this.helper=this.helper||c('<div style="overflow:hidden;"></div>');var e=c.browser.msie&&c.browser.version<7,g=(e?1:0),h=(e?2:-1);this.helper.addClass(this._helper).css({width:this.element.outerWidth()+h,height:this.element.outerHeight()+h,position:"absolute",left:this.elementOffset.left-g+"px",top:this.elementOffset.top-g+"px",zIndex:++i.zIndex});this.helper.appendTo("body").disableSelection()}else{this.helper=this.element}},_change:{e:function(g,f,e){return{width:this.originalSize.width+f}},w:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{left:i.left+f,width:g.width-f}},n:function(h,f,e){var j=this.options,g=this.originalSize,i=this.originalPosition;return{top:i.top+e,height:g.height-e}},s:function(g,f,e){return{height:this.originalSize.height+e}},se:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},sw:function(g,f,e){return c.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[g,f,e]))},ne:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[g,f,e]))},nw:function(g,f,e){return c.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[g,f,e]))}},_propagate:function(f,e){c.ui.plugin.call(this,f,[e,this.ui()]);(f!="resize"&&this._trigger(f,e,this.ui()))},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,originalPosition:this.originalPosition}}});c.extend(c.ui.resizable,{version:"1.8.18"});c.ui.plugin.add("resizable","alsoResize",{start:function(f,g){var e=c(this).data("resizable"),i=e.options;var h=function(j){c(j).each(function(){var k=c(this);k.data("resizable-alsoresize",{width:parseInt(k.width(),10),height:parseInt(k.height(),10),left:parseInt(k.css("left"),10),top:parseInt(k.css("top"),10)})})};if(typeof(i.alsoResize)=="object"&&!i.alsoResize.parentNode){if(i.alsoResize.length){i.alsoResize=i.alsoResize[0];h(i.alsoResize)}else{c.each(i.alsoResize,function(j){h(j)})}}else{h(i.alsoResize)}},resize:function(g,i){var f=c(this).data("resizable"),j=f.options,h=f.originalSize,l=f.originalPosition;var k={height:(f.size.height-h.height)||0,width:(f.size.width-h.width)||0,top:(f.position.top-l.top)||0,left:(f.position.left-l.left)||0},e=function(m,n){c(m).each(function(){var q=c(this),r=c(this).data("resizable-alsoresize"),p={},o=n&&n.length?n:q.parents(i.originalElement[0]).length?["width","height"]:["width","height","top","left"];c.each(o,function(s,u){var t=(r[u]||0)+(k[u]||0);if(t&&t>=0){p[u]=t||null}});q.css(p)})};if(typeof(j.alsoResize)=="object"&&!j.alsoResize.nodeType){c.each(j.alsoResize,function(m,n){e(m,n)})}else{e(j.alsoResize)}},stop:function(e,f){c(this).removeData("resizable-alsoresize")}});c.ui.plugin.add("resizable","animate",{stop:function(i,n){var p=c(this).data("resizable"),j=p.options;var h=p._proportionallyResizeElements,e=h.length&&(/textarea/i).test(h[0].nodeName),f=e&&c.ui.hasScroll(h[0],"left")?0:p.sizeDiff.height,l=e?0:p.sizeDiff.width;var g={width:(p.size.width-l),height:(p.size.height-f)},k=(parseInt(p.element.css("left"),10)+(p.position.left-p.originalPosition.left))||null,m=(parseInt(p.element.css("top"),10)+(p.position.top-p.originalPosition.top))||null;p.element.animate(c.extend(g,m&&k?{top:m,left:k}:{}),{duration:j.animateDuration,easing:j.animateEasing,step:function(){var o={width:parseInt(p.element.css("width"),10),height:parseInt(p.element.css("height"),10),top:parseInt(p.element.css("top"),10),left:parseInt(p.element.css("left"),10)};if(h&&h.length){c(h[0]).css({width:o.width,height:o.height})}p._updateCache(o);p._propagate("resize",i)}})}});c.ui.plugin.add("resizable","containment",{start:function(f,r){var t=c(this).data("resizable"),j=t.options,l=t.element;var g=j.containment,k=(g instanceof c)?g.get(0):(/parent/.test(g))?l.parent().get(0):g;if(!k){return}t.containerElement=c(k);if(/document/.test(g)||g==document){t.containerOffset={left:0,top:0};t.containerPosition={left:0,top:0};t.parentData={element:c(document),left:0,top:0,width:c(document).width(),height:c(document).height()||document.body.parentNode.scrollHeight}}else{var n=c(k),i=[];c(["Top","Right","Left","Bottom"]).each(function(p,o){i[p]=b(n.css("padding"+o))});t.containerOffset=n.offset();t.containerPosition=n.position();t.containerSize={height:(n.innerHeight()-i[3]),width:(n.innerWidth()-i[1])};var q=t.containerOffset,e=t.containerSize.height,m=t.containerSize.width,h=(c.ui.hasScroll(k,"left")?k.scrollWidth:m),s=(c.ui.hasScroll(k)?k.scrollHeight:e);t.parentData={element:k,left:q.left,top:q.top,width:h,height:s}}},resize:function(g,q){var t=c(this).data("resizable"),i=t.options,f=t.containerSize,p=t.containerOffset,m=t.size,n=t.position,r=t._aspectRatio||g.shiftKey,e={top:0,left:0},h=t.containerElement;if(h[0]!=document&&(/static/).test(h.css("position"))){e=p}if(n.left<(t._helper?p.left:0)){t.size.width=t.size.width+(t._helper?(t.position.left-p.left):(t.position.left-e.left));if(r){t.size.height=t.size.width/i.aspectRatio}t.position.left=i.helper?p.left:0}if(n.top<(t._helper?p.top:0)){t.size.height=t.size.height+(t._helper?(t.position.top-p.top):t.position.top);if(r){t.size.width=t.size.height*i.aspectRatio}t.position.top=t._helper?p.top:0}t.offset.left=t.parentData.left+t.position.left;t.offset.top=t.parentData.top+t.position.top;var l=Math.abs((t._helper?t.offset.left-e.left:(t.offset.left-e.left))+t.sizeDiff.width),s=Math.abs((t._helper?t.offset.top-e.top:(t.offset.top-p.top))+t.sizeDiff.height);var k=t.containerElement.get(0)==t.element.parent().get(0),j=/relative|absolute/.test(t.containerElement.css("position"));if(k&&j){l-=t.parentData.left}if(l+t.size.width>=t.parentData.width){t.size.width=t.parentData.width-l;if(r){t.size.height=t.size.width/t.aspectRatio}}if(s+t.size.height>=t.parentData.height){t.size.height=t.parentData.height-s;if(r){t.size.width=t.size.height*t.aspectRatio}}},stop:function(f,n){var q=c(this).data("resizable"),g=q.options,l=q.position,m=q.containerOffset,e=q.containerPosition,i=q.containerElement;var j=c(q.helper),r=j.offset(),p=j.outerWidth()-q.sizeDiff.width,k=j.outerHeight()-q.sizeDiff.height;if(q._helper&&!g.animate&&(/relative/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}if(q._helper&&!g.animate&&(/static/).test(i.css("position"))){c(this).css({left:r.left-e.left-m.left,width:p,height:k})}}});c.ui.plugin.add("resizable","ghost",{start:function(g,h){var e=c(this).data("resizable"),i=e.options,f=e.size;e.ghost=e.originalElement.clone();e.ghost.css({opacity:0.25,display:"block",position:"relative",height:f.height,width:f.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof i.ghost=="string"?i.ghost:"");e.ghost.appendTo(e.helper)},resize:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost){e.ghost.css({position:"relative",height:e.size.height,width:e.size.width})}},stop:function(f,g){var e=c(this).data("resizable"),h=e.options;if(e.ghost&&e.helper){e.helper.get(0).removeChild(e.ghost.get(0))}}});c.ui.plugin.add("resizable","grid",{resize:function(e,m){var p=c(this).data("resizable"),h=p.options,k=p.size,i=p.originalSize,j=p.originalPosition,n=p.axis,l=h._aspectRatio||e.shiftKey;h.grid=typeof h.grid=="number"?[h.grid,h.grid]:h.grid;var g=Math.round((k.width-i.width)/(h.grid[0]||1))*(h.grid[0]||1),f=Math.round((k.height-i.height)/(h.grid[1]||1))*(h.grid[1]||1);if(/^(se|s|e)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f}else{if(/^(ne)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f}else{if(/^(sw)$/.test(n)){p.size.width=i.width+g;p.size.height=i.height+f;p.position.left=j.left-g}else{p.size.width=i.width+g;p.size.height=i.height+f;p.position.top=j.top-f;p.position.left=j.left-g}}}}});var b=function(e){return parseInt(e,10)||0};var a=function(e){return !isNaN(parseInt(e,10))}})(jQuery);/*!
+ * jQuery hashchange event - v1.3 - 7/21/2010
+ * http://benalman.com/projects/jquery-hashchange-plugin/
+ *
+ * Copyright (c) 2010 "Cowboy" Ben Alman
+ * Dual licensed under the MIT and GPL licenses.
+ * http://benalman.com/about/license/
+ */
+(function($,e,b){var c="hashchange",h=document,f,g=$.event.special,i=h.documentMode,d="on"+c in e&&(i===b||i>7);function a(j){j=j||location.href;return"#"+j.replace(/^[^#]*#?(.*)$/,"$1")}$.fn[c]=function(j){return j?this.bind(c,j):this.trigger(c)};$.fn[c].delay=50;g[c]=$.extend(g[c],{setup:function(){if(d){return false}$(f.start)},teardown:function(){if(d){return false}$(f.stop)}});f=(function(){var j={},p,m=a(),k=function(q){return q},l=k,o=k;j.start=function(){p||n()};j.stop=function(){p&&clearTimeout(p);p=b};function n(){var r=a(),q=o(m);if(r!==m){l(m=r,q);$(e).trigger(c)}else{if(q!==m){location.href=location.href.replace(/#.*/,"")+q}}p=setTimeout(n,$.fn[c].delay)}$.browser.msie&&!d&&(function(){var q,r;j.start=function(){if(!q){r=$.fn[c].src;r=r&&r+a();q=$('<iframe tabindex="-1" title="empty"/>').hide().one("load",function(){r||l(a());n()}).attr("src",r||"javascript:0").insertAfter("body")[0].contentWindow;h.onpropertychange=function(){try{if(event.propertyName==="title"){q.document.title=h.title}}catch(s){}}}};j.stop=k;o=function(){return a(q.location.href)};l=function(v,s){var u=q.document,t=$.fn[c].domain;if(v!==s){u.title=h.title;u.open();t&&u.write('<script>document.domain="'+t+'"<\/script>');u.close();q.location.hash=v}}})();return j})()})(jQuery,this);(function(c){var a=c.scrollTo=function(f,e,d){c(window).scrollTo(f,e,d)};a.defaults={axis:"xy",duration:parseFloat(c.fn.jquery)>=1.3?0:1};a.window=function(d){return c(window)._scrollable()};c.fn._scrollable=function(){return this.map(function(){var e=this,d=!e.nodeName||c.inArray(e.nodeName.toLowerCase(),["iframe","#document","html","body"])!=-1;if(!d){return e}var f=(e.contentWindow||e).document||e.ownerDocument||e;return c.browser.safari||f.compatMode=="BackCompat"?f.body:f.documentElement})};c.fn.scrollTo=function(f,e,d){if(typeof e=="object"){d=e;e=0}if(typeof d=="function"){d={onAfter:d}}if(f=="max"){f=9000000000}d=c.extend({},a.defaults,d);e=e||d.speed||d.duration;d.queue=d.queue&&d.axis.length>1;if(d.queue){e/=2}d.offset=b(d.offset);d.over=b(d.over);return this._scrollable().each(function(){var l=this,j=c(l),k=f,i,g={},m=j.is("html,body");switch(typeof k){case"number":case"string":if(/^([+-]=)?\d+(\.\d+)?(px|%)?$/.test(k)){k=b(k);break}k=c(k,this);case"object":if(k.is||k.style){i=(k=c(k)).offset()}}c.each(d.axis.split(""),function(q,r){var s=r=="x"?"Left":"Top",u=s.toLowerCase(),p="scroll"+s,o=l[p],n=a.max(l,r);if(i){g[p]=i[u]+(m?0:o-j.offset()[u]);if(d.margin){g[p]-=parseInt(k.css("margin"+s))||0;g[p]-=parseInt(k.css("border"+s+"Width"))||0}g[p]+=d.offset[u]||0;if(d.over[u]){g[p]+=k[r=="x"?"width":"height"]()*d.over[u]}}else{var t=k[u];g[p]=t.slice&&t.slice(-1)=="%"?parseFloat(t)/100*n:t}if(/^\d+$/.test(g[p])){g[p]=g[p]<=0?0:Math.min(g[p],n)}if(!q&&d.queue){if(o!=g[p]){h(d.onAfterFirst)}delete g[p]}});h(d.onAfter);function h(n){j.animate(g,e,d.easing,n&&function(){n.call(this,f,d)})}}).end()};a.max=function(j,i){var h=i=="x"?"Width":"Height",e="scroll"+h;if(!c(j).is("html,body")){return j[e]-c(j)[h.toLowerCase()]()}var g="client"+h,f=j.ownerDocument.documentElement,d=j.ownerDocument.body;return Math.max(f[e],d[e])-Math.min(f[g],d[g])};function b(d){return typeof d=="object"?d:{top:d,left:d}}})(jQuery);/*!
+ PowerTip - v1.2.0 - 2013-04-03
+ http://stevenbenner.github.com/jquery-powertip/
+ Copyright (c) 2013 Steven Benner (http://stevenbenner.com/).
+ Released under MIT license.
+ https://raw.github.com/stevenbenner/jquery-powertip/master/LICENSE.txt
+(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{a(jQuery)}}(function(k){var A=k(document),s=k(window),w=k("body");var n="displayController",e="hasActiveHover",d="forcedOpen",u="hasMouseMove",f="mouseOnToPopup",g="originalTitle",y="powertip",o="powertipjq",l="powertiptarget",E=180/Math.PI;var c={isTipOpen:false,isFixedTipOpen:false,isClosing:false,tipOpenImminent:false,activeHover:null,currentX:0,currentY:0,previousX:0,previousY:0,desyncTimeout:null,mouseTrackingActive:false,delayInProgress:false,windowWidth:0,windowHeight:0,scrollTop:0,scrollLeft:0};var p={none:0,top:1,bottom:2,left:4,right:8};k.fn.powerTip=function(F,N){if(!this.length){return this}if(k.type(F)==="string"&&k.powerTip[F]){return k.powerTip[F].call(this,this,N)}var O=k.extend({},k.fn.powerTip.defaults,F),G=new x(O);h();this.each(function M(){var R=k(this),Q=R.data(y),P=R.data(o),T=R.data(l),S;if(R.data(n)){k.powerTip.destroy(R)}S=R.attr("title");if(!Q&&!T&&!P&&S){R.data(y,S);R.data(g,S);R.removeAttr("title")}R.data(n,new t(R,O,G))});if(!O.manual){this.on({"mouseenter.powertip":function J(P){k.powerTip.show(this,P)},"mouseleave.powertip":function L(){k.powerTip.hide(this)},"focus.powertip":function K(){k.powerTip.show(this)},"blur.powertip":function H(){k.powerTip.hide(this,true)},"keydown.powertip":function I(P){if(P.keyCode===27){k.powerTip.hide(this,true)}}})}return this};k.fn.powerTip.defaults={fadeInTime:200,fadeOutTime:100,followMouse:false,popupId:"powerTip",intentSensitivity:7,intentPollInterval:100,closeDelay:100,placement:"n",smartPlacement:false,offset:10,mouseOnToPopup:false,manual:false};k.fn.powerTip.smartPlacementLists={n:["n","ne","nw","s"],e:["e","ne","se","w","nw","sw","n","s","e"],s:["s","se","sw","n"],w:["w","nw","sw","e","ne","se","n","s","w"],nw:["nw","w","sw","n","s","se","nw"],ne:["ne","e","se","n","s","sw","ne"],sw:["sw","w","nw","s","n","ne","sw"],se:["se","e","ne","s","n","nw","se"],"nw-alt":["nw-alt","n","ne-alt","sw-alt","s","se-alt","w","e"],"ne-alt":["ne-alt","n","nw-alt","se-alt","s","sw-alt","e","w"],"sw-alt":["sw-alt","s","se-alt","nw-alt","n","ne-alt","w","e"],"se-alt":["se-alt","s","sw-alt","ne-alt","n","nw-alt","e","w"]};k.powerTip={show:function z(F,G){if(G){i(G);c.previousX=G.pageX;c.previousY=G.pageY;k(F).data(n).show()}else{k(F).first().data(n).show(true,true)}return F},reposition:function r(F){k(F).first().data(n).resetPosition();return F},hide:function D(G,F){if(G){k(G).first().data(n).hide(F)}else{if(c.activeHover){c.activeHover.data(n).hide(true)}}return G},destroy:function C(G){k(G).off(".powertip").each(function F(){var I=k(this),H=[g,n,e,d];if(I.data(g)){I.attr("title",I.data(g));H.push(y)}I.removeData(H)});return G}};k.powerTip.showTip=k.powerTip.show;k.powerTip.closeTip=k.powerTip.hide;function b(){var F=this;F.top="auto";F.left="auto";F.right="auto";F.bottom="auto";F.set=function(H,G){if(k.isNumeric(G)){F[H]=Math.round(G)}}}function t(K,N,F){var J=null;function L(P,Q){M();if(!K.data(e)){if(!P){c.tipOpenImminent=true;J=setTimeout(function O(){J=null;I()},N.intentPollInterval)}else{if(Q){K.data(d,true)}F.showTip(K)}}}function G(P){M();c.tipOpenImminent=false;if(K.data(e)){K.data(d,false);if(!P){c.delayInProgress=true;J=setTimeout(function O(){J=null;F.hideTip(K);c.delayInProgress=false},N.closeDelay)}else{F.hideTip(K)}}}function I(){var Q=Math.abs(c.previousX-c.currentX),O=Math.abs(c.previousY-c.currentY),P=Q+O;if(P<N.intentSensitivity){F.showTip(K)}else{c.previousX=c.currentX;c.previousY=c.currentY;L()}}function M(){J=clearTimeout(J);c.delayInProgress=false}function H(){F.resetPosition(K)}this.show=L;this.hide=G;this.cancel=M;this.resetPosition=H}function j(){function G(M,L,J,O,P){var K=L.split("-")[0],N=new b(),I;if(q(M)){I=H(M,K)}else{I=F(M,K)}switch(L){case"n":N.set("left",I.left-(J/2));N.set("bottom",c.windowHeight-I.top+P);break;case"e":N.set("left",I.left+P);N.set("top",I.top-(O/2));break;case"s":N.set("left",I.left-(J/2));N.set("top",I.top+P);break;case"w":N.set("top",I.top-(O/2));N.set("right",c.windowWidth-I.left+P);break;case"nw":N.set("bottom",c.windowHeight-I.top+P);N.set("right",c.windowWidth-I.left-20);break;case"nw-alt":N.set("left",I.left);N.set("bottom",c.windowHeight-I.top+P);break;case"ne":N.set("left",I.left-20);N.set("bottom",c.windowHeight-I.top+P);break;case"ne-alt":N.set("bottom",c.windowHeight-I.top+P);N.set("right",c.windowWidth-I.left);break;case"sw":N.set("top",I.top+P);N.set("right",c.windowWidth-I.left-20);break;case"sw-alt":N.set("left",I.left);N.set("top",I.top+P);break;case"se":N.set("left",I.left-20);N.set("top",I.top+P);break;case"se-alt":N.set("top",I.top+P);N.set("right",c.windowWidth-I.left);break}return N}function F(K,J){var O=K.offset(),N=K.outerWidth(),I=K.outerHeight(),M,L;switch(J){case"n":M=O.left+N/2;L=O.top;break;case"e":M=O.left+N;L=O.top+I/2;break;case"s":M=O.left+N/2;L=O.top+I;break;case"w":M=O.left;L=O.top+I/2;break;case"nw":M=O.left;L=O.top;break;case"ne":M=O.left+N;L=O.top;break;case"sw":M=O.left;L=O.top+I;break;case"se":M=O.left+N;L=O.top+I;break}return{top:L,left:M}}function H(O,K){var S=O.closest("svg")[0],N=O[0],W=S.createSVGPoint(),L=N.getBBox(),V=N.getScreenCTM(),M=L.width/2,Q=L.height/2,P=[],I=["nw","n","ne","e","se","s","sw","w"],U,X,R,T;function J(){P.push(W.matrixTransform(V))}W.x=L.x;W.y=L.y;J();W.x+=M;J();W.x+=M;J();W.y+=Q;J();W.y+=Q;J();W.x-=M;J();W.x-=M;J();W.y-=Q;J();if(P[0].y!==P[1].y||P[0].x!==P[7].x){X=Math.atan2(V.b,V.a)*E;R=Math.ceil(((X%360)-22.5)/45);if(R<1){R+=8}while(R--){I.push(I.shift())}}for(T=0;T<P.length;T++){if(I[T]===K){U=P[T];break}}return{top:U.y+c.scrollTop,left:U.x+c.scrollLeft}}this.compute=G}function x(Q){var P=new j(),O=k("#"+Q.popupId);if(O.length===0){O=k("<div/>",{id:Q.popupId});if(w.length===0){w=k("body")}w.append(O)}if(Q.followMouse){if(!O.data(u)){A.on("mousemove",M);s.on("scroll",M);O.data(u,true)}}if(Q.mouseOnToPopup){O.on({mouseenter:function L(){if(O.data(f)){if(c.activeHover){c.activeHover.data(n).cancel()}}},mouseleave:function N(){if(c.activeHover){c.activeHover.data(n).hide()}}})}function I(S){S.data(e,true);O.queue(function R(T){H(S);T()})}function H(S){var U;if(!S.data(e)){return}if(c.isTipOpen){if(!c.isClosing){K(c.activeHover)}O.delay(100).queue(function R(V){H(S);V()});return}S.trigger("powerTipPreRender");U=B(S);if(U){O.empty().append(U)}else{return}S.trigger("powerTipRender");c.activeHover=S;c.isTipOpen=true;O.data(f,Q.mouseOnToPopup);if(!Q.followMouse){G(S);c.isFixedTipOpen=true}else{M()}O.fadeIn(Q.fadeInTime,function T(){if(!c.desyncTimeout){c.desyncTimeout=setInterval(J,500)}S.trigger("powerTipOpen")})}function K(R){c.isClosing=true;c.activeHover=null;c.isTipOpen=false;c.desyncTimeout=clearInterval(c.desyncTimeout);R.data(e,false);R.data(d,false);O.fadeOut(Q.fadeOutTime,function S(){var T=new b();c.isClosing=false;c.isFixedTipOpen=false;O.removeClass();T.set("top",c.currentY+Q.offset);T.set("left",c.currentX+Q.offset);O.css(T);R.trigger("powerTipClose")})}function M(){if(!c.isFixedTipOpen&&(c.isTipOpen||(c.tipOpenImminent&&O.data(u)))){var R=O.outerWidth(),V=O.outerHeight(),U=new b(),S,T;U.set("top",c.currentY+Q.offset);U.set("left",c.currentX+Q.offset);S=m(U,R,V);if(S!==p.none){T=a(S);if(T===1){if(S===p.right){U.set("left",c.windowWidth-R)}else{if(S===p.bottom){U.set("top",c.scrollTop+c.windowHeight-V)}}}else{U.set("left",c.currentX-R-Q.offset);U.set("top",c.currentY-V-Q.offset)}}O.css(U)}}function G(S){var R,T;if(Q.smartPlacement){R=k.fn.powerTip.smartPlacementLists[Q.placement];k.each(R,function(U,W){var V=m(F(S,W),O.outerWidth(),O.outerHeight());T=W;if(V===p.none){return false}})}else{F(S,Q.placement);T=Q.placement}O.addClass(T)}function F(U,T){var R=0,S,W,V=new b();V.set("top",0);V.set("left",0);O.css(V);do{S=O.outerWidth();W=O.outerHeight();V=P.compute(U,T,S,W,Q.offset);O.css(V)}while(++R<=5&&(S!==O.outerWidth()||W!==O.outerHeight()));return V}function J(){var R=false;if(c.isTipOpen&&!c.isClosing&&!c.delayInProgress){if(c.activeHover.data(e)===false||c.activeHover.is(":disabled")){R=true}else{if(!v(c.activeHover)&&!c.activeHover.is(":focus")&&!c.activeHover.data(d)){if(O.data(f)){if(!v(O)){R=true}}else{R=true}}}if(R){K(c.activeHover)}}}this.showTip=I;this.hideTip=K;this.resetPosition=G}function q(F){return window.SVGElement&&F[0] instanceof SVGElement}function h(){if(!c.mouseTrackingActive){c.mouseTrackingActive=true;k(function H(){c.scrollLeft=s.scrollLeft();c.scrollTop=s.scrollTop();c.windowWidth=s.width();c.windowHeight=s.height()});A.on("mousemove",i);s.on({resize:function G(){c.windowWidth=s.width();c.windowHeight=s.height()},scroll:function F(){var I=s.scrollLeft(),J=s.scrollTop();if(I!==c.scrollLeft){c.currentX+=I-c.scrollLeft;c.scrollLeft=I}if(J!==c.scrollTop){c.currentY+=J-c.scrollTop;c.scrollTop=J}}})}}function i(F){c.currentX=F.pageX;c.currentY=F.pageY}function v(F){var H=F.offset(),J=F[0].getBoundingClientRect(),I=J.right-J.left,G=J.bottom-J.top;return c.currentX>=H.left&&c.currentX<=H.left+I&&c.currentY>=H.top&&c.currentY<=H.top+G}function B(I){var G=I.data(y),F=I.data(o),K=I.data(l),H,J;if(G){if(k.isFunction(G)){G=G.call(I[0])}J=G}else{if(F){if(k.isFunction(F)){F=F.call(I[0])}if(F.length>0){J=F.clone(true,true)}}else{if(K){H=k("#"+K);if(H.length>0){J=H.html()}}}}return J}function m(M,L,K){var G=c.scrollTop,J=c.scrollLeft,I=G+c.windowHeight,F=J+c.windowWidth,H=p.none;if(M.top<G||Math.abs(M.bottom-c.windowHeight)-K<G){H|=p.top}if(M.top+K>I||Math.abs(M.bottom-c.windowHeight)>I){H|=p.bottom}if(M.left<J||M.right+L>F){H|=p.left}if(M.left+L>F||M.right<J){H|=p.right}return H}function a(G){var F=0;while(G){G&=G-1;F++}return F}}));/*!
+ * jQuery UI Touch Punch 0.2.3
+ *
+ * Copyright 2011–2014, Dave Furfero
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ *
+ * Depends:
+ * jquery.ui.widget.js
+ * jquery.ui.mouse.js
+ */
+(function(b){b.support.touch="ontouchend" in document;if(!b.support.touch){return}var d=b.ui.mouse.prototype,f=d._mouseInit,c=d._mouseDestroy,a;function e(h,i){if(h.originalEvent.touches.length>1){return}h.preventDefault();var j=h.originalEvent.changedTouches[0],g=document.createEvent("MouseEvents");g.initMouseEvent(i,true,true,window,1,j.screenX,j.screenY,j.clientX,j.clientY,false,false,false,false,0,null);h.target.dispatchEvent(g)}d._touchStart=function(h){var g=this;if(a||!g._mouseCapture(h.originalEvent.changedTouches[0])){return}a=true;g._touchMoved=false;e(h,"mouseover");e(h,"mousemove");e(h,"mousedown")};d._touchMove=function(g){if(!a){return}this._touchMoved=true;e(g,"mousemove")};d._touchEnd=function(g){if(!a){return}e(g,"mouseup");e(g,"mouseout");if(!this._touchMoved){e(g,"click")}a=false};d._mouseInit=function(){var g=this;g.element.bind({touchstart:b.proxy(g,"_touchStart"),touchmove:b.proxy(g,"_touchMove"),touchend:b.proxy(g,"_touchEnd")});f.call(g)};d._mouseDestroy=function(){var g=this;g.element.unbind({touchstart:b.proxy(g,"_touchStart"),touchmove:b.proxy(g,"_touchMove"),touchend:b.proxy(g,"_touchEnd")});c.call(g)}})(jQuery);/*!
+ * SmartMenus jQuery Plugin - v1.0.0 - January 27, 2016
+ * http://www.smartmenus.org/
+ *
+ * Copyright Vasil Dinkov, Vadikom Web Ltd.
+ * http://vadikom.com
+ *
+ * Licensed MIT
+ */
+(function(a){if(typeof define==="function"&&define.amd){define(["jquery"],a)}else{if(typeof module==="object"&&typeof module.exports==="object"){module.exports=a(require("jquery"))}else{a(jQuery)}}}(function(a){var b=[],e=!!window.createPopup,f=false,d="ontouchstart" in window,h=false,g=window.requestAnimationFrame||function(l){return setTimeout(l,1000/60)},c=window.cancelAnimationFrame||function(l){clearTimeout(l)};function k(m){var n=".smartmenus_mouse";if(!h&&!m){var o=true,l=null;a(document).bind(i([["mousemove",function(s){var t={x:s.pageX,y:s.pageY,timeStamp:new Date().getTime()};if(l){var q=Math.abs(l.x-t.x),p=Math.abs(l.y-t.y);if((q>0||p>0)&&q<=2&&p<=2&&t.timeStamp-l.timeStamp<=300){f=true;if(o){var r=a(s.target).closest("a");if(r.is("a")){a.each(b,function(){if(a.contains(this.$root[0],r[0])){this.itemEnter({currentTarget:r[0]});return false}})}o=false}}}l=t}],[d?"touchstart":"pointerover pointermove pointerout MSPointerOver MSPointerMove MSPointerOut",function(p){if(j(p.originalEvent)){f=false}}]],n));h=true}else{if(h&&m){a(document).unbind(n);h=false}}}function j(l){return !/^(4|mouse)$/.test(l.pointerType)}function i(l,n){if(!n){n=""}var m={};a.each(l,function(o,p){m[p[0].split(" ").join(n+" ")+n]=p[1]});return m}a.SmartMenus=function(m,l){this.$root=a(m);this.opts=l;this.rootId="";this.accessIdPrefix="";this.$subArrow=null;this.activatedItems=[];this.visibleSubMenus=[];this.showTimeout=0;this.hideTimeout=0;this.scrollTimeout=0;this.clickActivated=false;this.focusActivated=false;this.zIndexInc=0;this.idInc=0;this.$firstLink=null;this.$firstSub=null;this.disabled=false;this.$disableOverlay=null;this.$touchScrollingSub=null;this.cssTransforms3d="perspective" in m.style||"webkitPerspective" in m.style;this.wasCollapsible=false;this.init()};a.extend(a.SmartMenus,{hideAll:function(){a.each(b,function(){this.menuHideAll()})},destroy:function(){while(b.length){b[0].destroy()}k(true)},prototype:{init:function(n){var l=this;if(!n){b.push(this);this.rootId=(new Date().getTime()+Math.random()+"").replace(/\D/g,"");this.accessIdPrefix="sm-"+this.rootId+"-";if(this.$root.hasClass("sm-rtl")){this.opts.rightToLeftSubMenus=true}var r=".smartmenus";this.$root.data("smartmenus",this).attr("data-smartmenus-id",this.rootId).dataSM("level",1).bind(i([["mouseover focusin",a.proxy(this.rootOver,this)],["mouseout focusout",a.proxy(this.rootOut,this)],["keydown",a.proxy(this.rootKeyDown,this)]],r)).delegate("a",i([["mouseenter",a.proxy(this.itemEnter,this)],["mouseleave",a.proxy(this.itemLeave,this)],["mousedown",a.proxy(this.itemDown,this)],["focus",a.proxy(this.itemFocus,this)],["blur",a.proxy(this.itemBlur,this)],["click",a.proxy(this.itemClick,this)]],r));r+=this.rootId;if(this.opts.hideOnClick){a(document).bind(i([["touchstart",a.proxy(this.docTouchStart,this)],["touchmove",a.proxy(this.docTouchMove,this)],["touchend",a.proxy(this.docTouchEnd,this)],["click",a.proxy(this.docClick,this)]],r))}a(window).bind(i([["resize orientationchange",a.proxy(this.winResize,this)]],r));if(this.opts.subIndicators){this.$subArrow=a("<span/>").addClass("sub-arrow");if(this.opts.subIndicatorsText){this.$subArrow.html(this.opts.subIndicatorsText)}}k()}this.$firstSub=this.$root.find("ul").each(function(){l.menuInit(a(this))}).eq(0);this.$firstLink=this.$root.find("a").eq(0);if(this.opts.markCurrentItem){var p=/(index|default)\.[^#\?\/]*/i,m=/#.*/,q=window.location.href.replace(p,""),o=q.replace(m,"");this.$root.find("a").each(function(){var s=this.href.replace(p,""),t=a(this);if(s==q||s==o){t.addClass("current");if(l.opts.markCurrentTree){t.parentsUntil("[data-smartmenus-id]","ul").each(function(){a(this).dataSM("parent-a").addClass("current")})}}})}this.wasCollapsible=this.isCollapsible()},destroy:function(m){if(!m){var n=".smartmenus";this.$root.removeData("smartmenus").removeAttr("data-smartmenus-id").removeDataSM("level").unbind(n).undelegate(n);n+=this.rootId;a(document).unbind(n);a(window).unbind(n);if(this.opts.subIndicators){this.$subArrow=null}}this.menuHideAll();var l=this;this.$root.find("ul").each(function(){var o=a(this);if(o.dataSM("scroll-arrows")){o.dataSM("scroll-arrows").remove()}if(o.dataSM("shown-before")){if(l.opts.subMenusMinWidth||l.opts.subMenusMaxWidth){o.css({width:"",minWidth:"",maxWidth:""}).removeClass("sm-nowrap")}if(o.dataSM("scroll-arrows")){o.dataSM("scroll-arrows").remove()}o.css({zIndex:"",top:"",left:"",marginLeft:"",marginTop:"",display:""})}if((o.attr("id")||"").indexOf(l.accessIdPrefix)==0){o.removeAttr("id")}}).removeDataSM("in-mega").removeDataSM("shown-before").removeDataSM("ie-shim").removeDataSM("scroll-arrows").removeDataSM("parent-a").removeDataSM("level").removeDataSM("beforefirstshowfired").removeAttr("role").removeAttr("aria-hidden").removeAttr("aria-labelledby").removeAttr("aria-expanded");this.$root.find("a.has-submenu").each(function(){var o=a(this);if(o.attr("id").indexOf(l.accessIdPrefix)==0){o.removeAttr("id")}}).removeClass("has-submenu").removeDataSM("sub").removeAttr("aria-haspopup").removeAttr("aria-controls").removeAttr("aria-expanded").closest("li").removeDataSM("sub");if(this.opts.subIndicators){this.$root.find("span.sub-arrow").remove()}if(this.opts.markCurrentItem){this.$root.find("a.current").removeClass("current")}if(!m){this.$root=null;this.$firstLink=null;this.$firstSub=null;if(this.$disableOverlay){this.$disableOverlay.remove();this.$disableOverlay=null}b.splice(a.inArray(this,b),1)}},disable:function(l){if(!this.disabled){this.menuHideAll();if(!l&&!this.opts.isPopup&&this.$root.is(":visible")){var m=this.$root.offset();this.$disableOverlay=a('<div class="sm-jquery-disable-overlay"/>').css({position:"absolute",top:m.top,left:m.left,width:this.$root.outerWidth(),height:this.$root.outerHeight(),zIndex:this.getStartZIndex(true),opacity:0}).appendTo(document.body)}this.disabled=true}},docClick:function(l){if(this.$touchScrollingSub){this.$touchScrollingSub=null;return}if(this.visibleSubMenus.length&&!a.contains(this.$root[0],l.target)||a(l.target).is("a")){this.menuHideAll()}},docTouchEnd:function(m){if(!this.lastTouch){return}if(this.visibleSubMenus.length&&(this.lastTouch.x2===undefined||this.lastTouch.x1==this.lastTouch.x2)&&(this.lastTouch.y2===undefined||this.lastTouch.y1==this.lastTouch.y2)&&(!this.lastTouch.target||!a.contains(this.$root[0],this.lastTouch.target))){if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}var l=this;this.hideTimeout=setTimeout(function(){l.menuHideAll()},350)}this.lastTouch=null},docTouchMove:function(m){if(!this.lastTouch){return}var l=m.originalEvent.touches[0];this.lastTouch.x2=l.pageX;this.lastTouch.y2=l.pageY},docTouchStart:function(m){var l=m.originalEvent.touches[0];this.lastTouch={x1:l.pageX,y1:l.pageY,target:l.target}},enable:function(){if(this.disabled){if(this.$disableOverlay){this.$disableOverlay.remove();this.$disableOverlay=null}this.disabled=false}},getClosestMenu:function(m){var l=a(m).closest("ul");while(l.dataSM("in-mega")){l=l.parent().closest("ul")}return l[0]||null},getHeight:function(l){return this.getOffset(l,true)},getOffset:function(n,l){var m;if(n.css("display")=="none"){m={position:n[0].style.position,visibility:n[0].style.visibility};n.css({position:"absolute",visibility:"hidden"}).show()}var o=n[0].getBoundingClientRect&&n[0].getBoundingClientRect(),p=o&&(l?o.height||o.bottom-o.top:o.width||o.right-o.left);if(!p&&p!==0){p=l?n[0].offsetHeight:n[0].offsetWidth}if(m){n.hide().css(m)}return p},getStartZIndex:function(l){var m=parseInt(this[l?"$root":"$firstSub"].css("z-index"));if(!l&&isNaN(m)){m=parseInt(this.$root.css("z-index"))}return !isNaN(m)?m:1},getTouchPoint:function(l){return l.touches&&l.touches[0]||l.changedTouches&&l.changedTouches[0]||l},getViewport:function(l){var m=l?"Height":"Width",o=document.documentElement["client"+m],n=window["inner"+m];if(n){o=Math.min(o,n)}return o},getViewportHeight:function(){return this.getViewport(true)},getViewportWidth:function(){return this.getViewport()},getWidth:function(l){return this.getOffset(l)},handleEvents:function(){return !this.disabled&&this.isCSSOn()},handleItemEvents:function(l){return this.handleEvents()&&!this.isLinkInMegaMenu(l)},isCollapsible:function(){return this.$firstSub.css("position")=="static"},isCSSOn:function(){return this.$firstLink.css("display")=="block"},isFixed:function(){var l=this.$root.css("position")=="fixed";if(!l){this.$root.parentsUntil("body").each(function(){if(a(this).css("position")=="fixed"){l=true;return false}})}return l},isLinkInMegaMenu:function(l){return a(this.getClosestMenu(l[0])).hasClass("mega-menu")},isTouchMode:function(){return !f||this.opts.noMouseOver||this.isCollapsible()},itemActivate:function(p,l){var n=p.closest("ul"),q=n.dataSM("level");if(q>1&&(!this.activatedItems[q-2]||this.activatedItems[q-2][0]!=n.dataSM("parent-a")[0])){var m=this;a(n.parentsUntil("[data-smartmenus-id]","ul").get().reverse()).add(n).each(function(){m.itemActivate(a(this).dataSM("parent-a"))})}if(!this.isCollapsible()||l){this.menuHideSubMenus(!this.activatedItems[q-1]||this.activatedItems[q-1][0]!=p[0]?q-1:q)}this.activatedItems[q-1]=p;if(this.$root.triggerHandler("activate.smapi",p[0])===false){return}var o=p.dataSM("sub");if(o&&(this.isTouchMode()||(!this.opts.showOnClick||this.clickActivated))){this.menuShow(o)}},itemBlur:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}this.$root.triggerHandler("blur.smapi",l[0])},itemClick:function(o){var n=a(o.currentTarget);if(!this.handleItemEvents(n)){return}if(this.$touchScrollingSub&&this.$touchScrollingSub[0]==n.closest("ul")[0]){this.$touchScrollingSub=null;o.stopPropagation();return false}if(this.$root.triggerHandler("click.smapi",n[0])===false){return false}var p=a(o.target).is("span.sub-arrow"),m=n.dataSM("sub"),l=m?m.dataSM("level")==2:false;if(m&&!m.is(":visible")){if(this.opts.showOnClick&&l){this.clickActivated=true}this.itemActivate(n);if(m.is(":visible")){this.focusActivated=true;return false}}else{if(this.isCollapsible()&&p){this.itemActivate(n);this.menuHide(m);return false}}if(this.opts.showOnClick&&l||n.hasClass("disabled")||this.$root.triggerHandler("select.smapi",n[0])===false){return false}},itemDown:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}l.dataSM("mousedown",true)},itemEnter:function(n){var m=a(n.currentTarget);if(!this.handleItemEvents(m)){return}if(!this.isTouchMode()){if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}var l=this;this.showTimeout=setTimeout(function(){l.itemActivate(m)},this.opts.showOnClick&&m.closest("ul").dataSM("level")==1?1:this.opts.showTimeout)}this.$root.triggerHandler("mouseenter.smapi",m[0])},itemFocus:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}if(this.focusActivated&&(!this.isTouchMode()||!l.dataSM("mousedown"))&&(!this.activatedItems.length||this.activatedItems[this.activatedItems.length-1][0]!=l[0])){this.itemActivate(l,true)}this.$root.triggerHandler("focus.smapi",l[0])},itemLeave:function(m){var l=a(m.currentTarget);if(!this.handleItemEvents(l)){return}if(!this.isTouchMode()){l[0].blur();if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}}l.removeDataSM("mousedown");this.$root.triggerHandler("mouseleave.smapi",l[0])},menuHide:function(m){if(this.$root.triggerHandler("beforehide.smapi",m[0])===false){return}m.stop(true,true);if(m.css("display")!="none"){var l=function(){m.css("z-index","")};if(this.isCollapsible()){if(this.opts.collapsibleHideFunction){this.opts.collapsibleHideFunction.call(this,m,l)}else{m.hide(this.opts.collapsibleHideDuration,l)}}else{if(this.opts.hideFunction){this.opts.hideFunction.call(this,m,l)}else{m.hide(this.opts.hideDuration,l)}}if(m.dataSM("ie-shim")){m.dataSM("ie-shim").remove().css({"-webkit-transform":"",transform:""})}if(m.dataSM("scroll")){this.menuScrollStop(m);m.css({"touch-action":"","-ms-touch-action":"","-webkit-transform":"",transform:""}).unbind(".smartmenus_scroll").removeDataSM("scroll").dataSM("scroll-arrows").hide()}m.dataSM("parent-a").removeClass("highlighted").attr("aria-expanded","false");m.attr({"aria-expanded":"false","aria-hidden":"true"});var n=m.dataSM("level");this.activatedItems.splice(n-1,1);this.visibleSubMenus.splice(a.inArray(m,this.visibleSubMenus),1);this.$root.triggerHandler("hide.smapi",m[0])}},menuHideAll:function(){if(this.showTimeout){clearTimeout(this.showTimeout);this.showTimeout=0}var m=this.opts.isPopup?1:0;for(var l=this.visibleSubMenus.length-1;l>=m;l--){this.menuHide(this.visibleSubMenus[l])}if(this.opts.isPopup){this.$root.stop(true,true);if(this.$root.is(":visible")){if(this.opts.hideFunction){this.opts.hideFunction.call(this,this.$root)}else{this.$root.hide(this.opts.hideDuration)}if(this.$root.dataSM("ie-shim")){this.$root.dataSM("ie-shim").remove()}}}this.activatedItems=[];this.visibleSubMenus=[];this.clickActivated=false;this.focusActivated=false;this.zIndexInc=0;this.$root.triggerHandler("hideAll.smapi")},menuHideSubMenus:function(n){for(var l=this.activatedItems.length-1;l>=n;l--){var m=this.activatedItems[l].dataSM("sub");if(m){this.menuHide(m)}}},menuIframeShim:function(l){if(e&&this.opts.overlapControlsInIE&&!l.dataSM("ie-shim")){l.dataSM("ie-shim",a("<iframe/>").attr({src:"javascript:0",tabindex:-9}).css({position:"absolute",top:"auto",left:"0",opacity:0,border:"0"}))}},menuInit:function(l){if(!l.dataSM("in-mega")){if(l.hasClass("mega-menu")){l.find("ul").dataSM("in-mega",true)}var q=2,m=l[0];while((m=m.parentNode.parentNode)!=this.$root[0]){q++}var n=l.prevAll("a").eq(-1);if(!n.length){n=l.prevAll().find("a").eq(-1)}n.addClass("has-submenu").dataSM("sub",l);l.dataSM("parent-a",n).dataSM("level",q).parent().dataSM("sub",l);var o=n.attr("id")||this.accessIdPrefix+(++this.idInc),p=l.attr("id")||this.accessIdPrefix+(++this.idInc);n.attr({id:o,"aria-haspopup":"true","aria-controls":p,"aria-expanded":"false"});l.attr({id:p,role:"group","aria-hidden":"true","aria-labelledby":o,"aria-expanded":"false"});if(this.opts.subIndicators){n[this.opts.subIndicatorsPos](this.$subArrow.clone())}}},menuPosition:function(K){var r=K.dataSM("parent-a"),D=r.closest("li"),E=D.parent(),l=K.dataSM("level"),t=this.getWidth(K),J=this.getHeight(K),u=r.offset(),o=u.left,m=u.top,q=this.getWidth(r),F=this.getHeight(r),H=a(window),v=H.scrollLeft(),s=H.scrollTop(),z=this.getViewportWidth(),L=this.getViewportHeight(),w=E.parent().is("[data-sm-horizontal-sub]")||l==2&&!E.hasClass("sm-vertical"),B=this.opts.rightToLeftSubMenus&&!D.is("[data-sm-reverse]")||!this.opts.rightToLeftSubMenus&&D.is("[data-sm-reverse]"),p=l==2?this.opts.mainMenuSubOffsetX:this.opts.subMenusSubOffsetX,n=l==2?this.opts.mainMenuSubOffsetY:this.opts.subMenusSubOffsetY,C,A;if(w){C=B?q-t-p:p;A=this.opts.bottomToTopSubMenus?-J-n:F+n}else{C=B?p-t:q-p;A=this.opts.bottomToTopSubMenus?F-n-J:n}if(this.opts.keepInViewport){var N=o+C,M=m+A;if(B&&N<v){C=w?v-N+C:q-p}else{if(!B&&N+t>v+z){C=w?v+z-t-N+C:p-t}}if(!w){if(J<L&&M+J>s+L){A+=s+L-J-M}else{if(J>=L||M<s){A+=s-M}}}if(w&&(M+J>s+L+0.49||M<s)||!w&&J>L+0.49){var G=this;if(!K.dataSM("scroll-arrows")){K.dataSM("scroll-arrows",a([a('<span class="scroll-up"><span class="scroll-up-arrow"></span></span>')[0],a('<span class="scroll-down"><span class="scroll-down-arrow"></span></span>')[0]]).bind({mouseenter:function(){K.dataSM("scroll").up=a(this).hasClass("scroll-up");G.menuScroll(K)},mouseleave:function(x){G.menuScrollStop(K);G.menuScrollOut(K,x)},"mousewheel DOMMouseScroll":function(x){x.preventDefault()}}).insertAfter(K))}var I=".smartmenus_scroll";K.dataSM("scroll",{y:this.cssTransforms3d?0:A-F,step:1,itemH:F,subH:J,arrowDownH:this.getHeight(K.dataSM("scroll-arrows").eq(1))}).bind(i([["mouseover",function(x){G.menuScrollOver(K,x)}],["mouseout",function(x){G.menuScrollOut(K,x)}],["mousewheel DOMMouseScroll",function(x){G.menuScrollMousewheel(K,x)}]],I)).dataSM("scroll-arrows").css({top:"auto",left:"0",marginLeft:C+(parseInt(K.css("border-left-width"))||0),width:t-(parseInt(K.css("border-left-width"))||0)-(parseInt(K.css("border-right-width"))||0),zIndex:K.css("z-index")}).eq(w&&this.opts.bottomToTopSubMenus?0:1).show();if(this.isFixed()){K.css({"touch-action":"none","-ms-touch-action":"none"}).bind(i([[d?"touchstart touchmove touchend":"pointerdown pointermove pointerup MSPointerDown MSPointerMove MSPointerUp",function(x){G.menuScrollTouch(K,x)}]],I))}}}K.css({top:"auto",left:"0",marginLeft:C,marginTop:A-F});this.menuIframeShim(K);if(K.dataSM("ie-shim")){K.dataSM("ie-shim").css({zIndex:K.css("z-index"),width:t,height:J,marginLeft:C,marginTop:A-F})}},menuScroll:function(r,m,n){var p=r.dataSM("scroll"),q=r.dataSM("scroll-arrows"),o=p.up?p.upEnd:p.downEnd,s;if(!m&&p.momentum){p.momentum*=0.92;s=p.momentum;if(s<0.5){this.menuScrollStop(r);return}}else{s=n||(m||!this.opts.scrollAccelerate?this.opts.scrollStep:Math.floor(p.step))}var l=r.dataSM("level");if(this.activatedItems[l-1]&&this.activatedItems[l-1].dataSM("sub")&&this.activatedItems[l-1].dataSM("sub").is(":visible")){this.menuHideSubMenus(l-1)}p.y=p.up&&o<=p.y||!p.up&&o>=p.y?p.y:(Math.abs(o-p.y)>s?p.y+(p.up?s:-s):o);r.add(r.dataSM("ie-shim")).css(this.cssTransforms3d?{"-webkit-transform":"translate3d(0, "+p.y+"px, 0)",transform:"translate3d(0, "+p.y+"px, 0)"}:{marginTop:p.y});if(f&&(p.up&&p.y>p.downEnd||!p.up&&p.y<p.upEnd)){q.eq(p.up?1:0).show()}if(p.y==o){if(f){q.eq(p.up?0:1).hide()}this.menuScrollStop(r)}else{if(!m){if(this.opts.scrollAccelerate&&p.step<this.opts.scrollStep){p.step+=0.2}var t=this;this.scrollTimeout=g(function(){t.menuScroll(r)})}}},menuScrollMousewheel:function(m,n){if(this.getClosestMenu(n.target)==m[0]){n=n.originalEvent;var l=(n.wheelDelta||-n.detail)>0;if(m.dataSM("scroll-arrows").eq(l?0:1).is(":visible")){m.dataSM("scroll").up=l;this.menuScroll(m,true)}}n.preventDefault()},menuScrollOut:function(l,m){if(f){if(!/^scroll-(up|down)/.test((m.relatedTarget||"").className)&&(l[0]!=m.relatedTarget&&!a.contains(l[0],m.relatedTarget)||this.getClosestMenu(m.relatedTarget)!=l[0])){l.dataSM("scroll-arrows").css("visibility","hidden")}}},menuScrollOver:function(n,o){if(f){if(!/^scroll-(up|down)/.test(o.target.className)&&this.getClosestMenu(o.target)==n[0]){this.menuScrollRefreshData(n);var m=n.dataSM("scroll"),l=a(window).scrollTop()-n.dataSM("parent-a").offset().top-m.itemH;n.dataSM("scroll-arrows").eq(0).css("margin-top",l).end().eq(1).css("margin-top",l+this.getViewportHeight()-m.arrowDownH).end().css("visibility","visible")}}},menuScrollRefreshData:function(n){var m=n.dataSM("scroll"),l=a(window).scrollTop()-n.dataSM("parent-a").offset().top-m.itemH;if(this.cssTransforms3d){l=-(parseFloat(n.css("margin-top"))-l)}a.extend(m,{upEnd:l,downEnd:l+this.getViewportHeight()-m.subH})},menuScrollStop:function(l){if(this.scrollTimeout){c(this.scrollTimeout);this.scrollTimeout=0;l.dataSM("scroll").step=1;return true}},menuScrollTouch:function(p,q){q=q.originalEvent;if(j(q)){var m=this.getTouchPoint(q);if(this.getClosestMenu(m.target)==p[0]){var o=p.dataSM("scroll");if(/(start|down)$/i.test(q.type)){if(this.menuScrollStop(p)){q.preventDefault();this.$touchScrollingSub=p}else{this.$touchScrollingSub=null}this.menuScrollRefreshData(p);a.extend(o,{touchStartY:m.pageY,touchStartTime:q.timeStamp})}else{if(/move$/i.test(q.type)){var n=o.touchY!==undefined?o.touchY:o.touchStartY;if(n!==undefined&&n!=m.pageY){this.$touchScrollingSub=p;var l=n<m.pageY;if(o.up!==undefined&&o.up!=l){a.extend(o,{touchStartY:m.pageY,touchStartTime:q.timeStamp})}a.extend(o,{up:l,touchY:m.pageY});this.menuScroll(p,true,Math.abs(m.pageY-n))}q.preventDefault()}else{if(o.touchY!==undefined){if(o.momentum=Math.pow(Math.abs(m.pageY-o.touchStartY)/(q.timeStamp-o.touchStartTime),2)*15){this.menuScrollStop(p);this.menuScroll(p);q.preventDefault()}delete o.touchY}}}}}},menuShow:function(n){if(!n.dataSM("beforefirstshowfired")){n.dataSM("beforefirstshowfired",true);if(this.$root.triggerHandler("beforefirstshow.smapi",n[0])===false){return}}if(this.$root.triggerHandler("beforeshow.smapi",n[0])===false){return}n.dataSM("shown-before",true).stop(true,true);if(!n.is(":visible")){var m=n.dataSM("parent-a");if(this.opts.keepHighlighted||this.isCollapsible()){m.addClass("highlighted")}if(this.isCollapsible()){n.removeClass("sm-nowrap").css({zIndex:"",width:"auto",minWidth:"",maxWidth:"",top:"",left:"",marginLeft:"",marginTop:""})}else{n.css("z-index",this.zIndexInc=(this.zIndexInc||this.getStartZIndex())+1);if(this.opts.subMenusMinWidth||this.opts.subMenusMaxWidth){n.css({width:"auto",minWidth:"",maxWidth:""}).addClass("sm-nowrap");if(this.opts.subMenusMinWidth){n.css("min-width",this.opts.subMenusMinWidth)}if(this.opts.subMenusMaxWidth){var o=this.getWidth(n);n.css("max-width",this.opts.subMenusMaxWidth);if(o>this.getWidth(n)){n.removeClass("sm-nowrap").css("width",this.opts.subMenusMaxWidth)}}}this.menuPosition(n);if(n.dataSM("ie-shim")){n.dataSM("ie-shim").insertBefore(n)}}var l=function(){n.css("overflow","")};if(this.isCollapsible()){if(this.opts.collapsibleShowFunction){this.opts.collapsibleShowFunction.call(this,n,l)}else{n.show(this.opts.collapsibleShowDuration,l)}}else{if(this.opts.showFunction){this.opts.showFunction.call(this,n,l)}else{n.show(this.opts.showDuration,l)}}m.attr("aria-expanded","true");n.attr({"aria-expanded":"true","aria-hidden":"false"});this.visibleSubMenus.push(n);this.$root.triggerHandler("show.smapi",n[0])}},popupHide:function(l){if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}var m=this;this.hideTimeout=setTimeout(function(){m.menuHideAll()},l?1:this.opts.hideTimeout)},popupShow:function(o,n){if(!this.opts.isPopup){alert('SmartMenus jQuery Error:\n\nIf you want to show this menu via the "popupShow" method, set the isPopup:true option.');return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}this.$root.dataSM("shown-before",true).stop(true,true);if(!this.$root.is(":visible")){this.$root.css({left:o,top:n});this.menuIframeShim(this.$root);if(this.$root.dataSM("ie-shim")){this.$root.dataSM("ie-shim").css({zIndex:this.$root.css("z-index"),width:this.getWidth(this.$root),height:this.getHeight(this.$root),left:o,top:n}).insertBefore(this.$root)}var m=this,l=function(){m.$root.css("overflow","")};if(this.opts.showFunction){this.opts.showFunction.call(this,this.$root,l)}else{this.$root.show(this.opts.showDuration,l)}this.visibleSubMenus[0]=this.$root}},refresh:function(){this.destroy(true);this.init(true)},rootKeyDown:function(o){if(!this.handleEvents()){return}switch(o.keyCode){case 27:var m=this.activatedItems[0];if(m){this.menuHideAll();m[0].focus();var n=m.dataSM("sub");if(n){this.menuHide(n)}}break;case 32:var l=a(o.target);if(l.is("a")&&this.handleItemEvents(l)){var n=l.dataSM("sub");if(n&&!n.is(":visible")){this.itemClick({currentTarget:o.target});o.preventDefault()}}break}},rootOut:function(m){if(!this.handleEvents()||this.isTouchMode()||m.target==this.$root[0]){return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}if(!this.opts.showOnClick||!this.opts.hideOnClick){var l=this;this.hideTimeout=setTimeout(function(){l.menuHideAll()},this.opts.hideTimeout)}},rootOver:function(l){if(!this.handleEvents()||this.isTouchMode()||l.target==this.$root[0]){return}if(this.hideTimeout){clearTimeout(this.hideTimeout);this.hideTimeout=0}},winResize:function(m){if(!this.handleEvents()){if(this.$disableOverlay){var n=this.$root.offset();this.$disableOverlay.css({top:n.top,left:n.left,width:this.$root.outerWidth(),height:this.$root.outerHeight()})}return}if(!("onorientationchange" in window)||m.type=="orientationchange"){var l=this.isCollapsible();if(!(this.wasCollapsible&&l)){if(this.activatedItems.length){this.activatedItems[this.activatedItems.length-1][0].blur()}this.menuHideAll()}this.wasCollapsible=l}}}});a.fn.dataSM=function(l,m){if(m){return this.data(l+"_smartmenus",m)}return this.data(l+"_smartmenus")};a.fn.removeDataSM=function(l){return this.removeData(l+"_smartmenus")};a.fn.smartmenus=function(m){if(typeof m=="string"){var l=arguments,o=m;Array.prototype.shift.call(l);return this.each(function(){var p=a(this).data("smartmenus");if(p&&p[o]){p[o].apply(p,l)}})}var n=a.extend({},a.fn.smartmenus.defaults,m);return this.each(function(){new a.SmartMenus(this,n)})};a.fn.smartmenus.defaults={isPopup:false,mainMenuSubOffsetX:0,mainMenuSubOffsetY:0,subMenusSubOffsetX:0,subMenusSubOffsetY:0,subMenusMinWidth:"10em",subMenusMaxWidth:"20em",subIndicators:true,subIndicatorsPos:"prepend",subIndicatorsText:"+",scrollStep:30,scrollAccelerate:true,showTimeout:250,hideTimeout:500,showDuration:0,showFunction:null,hideDuration:0,hideFunction:function(m,l){m.fadeOut(200,l)},collapsibleShowDuration:0,collapsibleShowFunction:function(m,l){m.slideDown(200,l)},collapsibleHideDuration:0,collapsibleHideFunction:function(m,l){m.slideUp(200,l)},showOnClick:false,hideOnClick:true,noMouseOver:false,keepInViewport:true,keepHighlighted:true,markCurrentItem:false,markCurrentTree:true,rightToLeftSubMenus:false,bottomToTopSubMenus:false,overlapControlsInIE:true};return a})); \ No newline at end of file
diff --git a/doc/doxyout/gssapi/html/menu.js b/doc/doxyout/gssapi/html/menu.js
new file mode 100644
index 000000000000..97db4c239227
--- /dev/null
+++ b/doc/doxyout/gssapi/html/menu.js
@@ -0,0 +1,26 @@
+function initMenu(relPath,searchEnabled,serverSide,searchPage,search) {
+ function makeTree(data,relPath) {
+ var result='';
+ if ('children' in data) {
+ result+='<ul>';
+ for (var i in data.children) {
+ result+='<li><a href="'+relPath+data.children[i].url+'">'+
+ data.children[i].text+'</a>'+
+ makeTree(data.children[i],relPath)+'</li>';
+ }
+ result+='</ul>';
+ }
+ return result;
+ }
+ $('#main-nav').append(makeTree(menudata,relPath));
+ $('#main-nav').children(':first').addClass('sm sm-dox').attr('id','main-menu');
+ if (searchEnabled) {
+ if (serverSide) {
+ $('#main-menu').append('<li style="float:right"><div id="MSearchBox" class="MSearchBoxInactive"><div class="left"><form id="FSearchBox" action="'+searchPage+'" method="get"><img id="MSearchSelect" src="'+relPath+'search/mag.png" alt=""/><input type="text" id="MSearchField" name="query" value="'+search+'" size="20" accesskey="S" onfocus="searchBox.OnSearchFieldFocus(true)" onblur="searchBox.OnSearchFieldFocus(false)"></form></div><div class="right"></div></div></li>');
+ } else {
+ $('#main-menu').append('<li style="float:right"><div id="MSearchBox" class="MSearchBoxInactive"><span class="left"><img id="MSearchSelect" src="'+relPath+'search/mag_sel.png" onmouseover="return searchBox.OnSearchSelectShow()" onmouseout="return searchBox.OnSearchSelectHide()" alt=""/><input type="text" id="MSearchField" value="'+search+'" accesskey="S" onfocus="searchBox.OnSearchFieldFocus(true)" onblur="searchBox.OnSearchFieldFocus(false)" onkeyup="searchBox.OnSearchFieldChange(event)"/></span><span class="right"><a id="MSearchClose" href="javascript:searchBox.CloseResultsWindow()"><img id="MSearchCloseImg" border="0" src="'+relPath+'search/close.png" alt=""/></a></span></div></li>');
+ }
+ }
+ $('#main-menu').smartmenus();
diff --git a/doc/doxyout/gssapi/html/menudata.js b/doc/doxyout/gssapi/html/menudata.js
new file mode 100644
index 000000000000..6eb7a5d2e728
--- /dev/null
+++ b/doc/doxyout/gssapi/html/menudata.js
@@ -0,0 +1,4 @@
+var menudata={children:[
+{text:"Main Page",url:"index.html"},
+{text:"Related Pages",url:"pages.html"},
diff --git a/doc/doxyout/gssapi/html/modules.html b/doc/doxyout/gssapi/html/modules.html
index df4743766fd5..b94726690c3e 100644
--- a/doc/doxyout/gssapi/html/modules.html
+++ b/doc/doxyout/gssapi/html/modules.html
@@ -1,6 +1,6 @@