diff options
author | Roman Divacky <rdivacky@FreeBSD.org> | 2010-03-03 17:28:16 +0000 |
---|---|---|
committer | Roman Divacky <rdivacky@FreeBSD.org> | 2010-03-03 17:28:16 +0000 |
commit | 79ade4e028932fcb9dab15e2fb2305ca15ab0f14 (patch) | |
tree | e1a885aadfd80632f5bd70d4bd2d37e715e35a79 | |
parent | ecb7e5c8afe929ee38155db94de6b084ec32a645 (diff) | |
download | src-79ade4e028932fcb9dab15e2fb2305ca15ab0f14.tar.gz src-79ade4e028932fcb9dab15e2fb2305ca15ab0f14.zip |
Update clang to 97654.
Notes
Notes:
svn path=/vendor/clang/dist/; revision=204643
371 files changed, 15422 insertions, 4563 deletions
diff --git a/clang.xcodeproj/project.pbxproj b/clang.xcodeproj/project.pbxproj index e24b54d3e892..1fcc7c8ad493 100644 --- a/clang.xcodeproj/project.pbxproj +++ b/clang.xcodeproj/project.pbxproj @@ -420,7 +420,7 @@ 1A81AA5D108278A20094E50B /* CGVtable.h */ = {isa = PBXFileReference; fileEncoding = 4; indentWidth = 2; lastKnownFileType = sourcecode.c.h; name = CGVtable.h; path = lib/CodeGen/CGVtable.h; sourceTree = "<group>"; tabWidth = 2; }; 1A869A6E0BA2164C008DA07A /* LiteralSupport.h */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.c.h; path = LiteralSupport.h; sourceTree = "<group>"; }; 1A869AA70BA21ABA008DA07A /* LiteralSupport.cpp */ = {isa = PBXFileReference; fileEncoding = 30; lastKnownFileType = sourcecode.cpp.cpp; path = LiteralSupport.cpp; sourceTree = "<group>"; }; - 1A97825A1108BA18002B98FC /* CGVTT.cpp */ = {isa = PBXFileReference; fileEncoding = 4; lastKnownFileType = sourcecode.cpp.cpp; name = CGVTT.cpp; path = lib/CodeGen/CGVTT.cpp; sourceTree = "<group>"; }; + 1A97825A1108BA18002B98FC /* CGVTT.cpp */ = {isa = PBXFileReference; fileEncoding = 4; indentWidth = 2; lastKnownFileType = sourcecode.cpp.cpp; name = CGVTT.cpp; path = lib/CodeGen/CGVTT.cpp; sourceTree = "<group>"; tabWidth = 2; }; 1A986AB610D0746D00A8EA9E /* CGDeclCXX.cpp */ = {isa = PBXFileReference; fileEncoding = 4; indentWidth = 2; lastKnownFileType = sourcecode.cpp.cpp; name = CGDeclCXX.cpp; path = lib/CodeGen/CGDeclCXX.cpp; sourceTree = "<group>"; tabWidth = 2; }; 1AA1D91610125DE30078DEBC /* RecordLayoutBuilder.cpp */ = {isa = PBXFileReference; fileEncoding = 4; indentWidth = 2; lastKnownFileType = sourcecode.cpp.cpp; name = RecordLayoutBuilder.cpp; path = lib/AST/RecordLayoutBuilder.cpp; sourceTree = "<group>"; tabWidth = 2; }; 1AA1D91710125DE30078DEBC /* RecordLayoutBuilder.h */ = {isa = PBXFileReference; fileEncoding = 4; indentWidth = 2; lastKnownFileType = sourcecode.c.h; name = RecordLayoutBuilder.h; path = lib/AST/RecordLayoutBuilder.h; sourceTree = "<group>"; tabWidth = 2; }; diff --git a/examples/CMakeLists.txt b/examples/CMakeLists.txt index 04332b7025d3..d2738c69035e 100644 --- a/examples/CMakeLists.txt +++ b/examples/CMakeLists.txt @@ -1,3 +1,4 @@ +add_subdirectory(clang-interpreter) add_subdirectory(PrintFunctionNames) add_subdirectory(wpa) diff --git a/examples/Makefile b/examples/Makefile index ced158f9d0b7..869197db35d2 100644 --- a/examples/Makefile +++ b/examples/Makefile @@ -9,6 +9,6 @@ LEVEL = ../../.. -PARALLEL_DIRS := PrintFunctionNames wpa +PARALLEL_DIRS := clang-interpreter PrintFunctionNames wpa include $(LEVEL)/Makefile.common diff --git a/examples/clang-interpreter/CMakeLists.txt b/examples/clang-interpreter/CMakeLists.txt new file mode 100644 index 000000000000..0f63b5f5b91b --- /dev/null +++ b/examples/clang-interpreter/CMakeLists.txt @@ -0,0 +1,30 @@ +set(LLVM_NO_RTTI 1) + +set(LLVM_USED_LIBS + clangFrontend + clangDriver + clangCodeGen + clangSema + clangChecker + clangAnalysis + clangRewrite + clangAST + clangParse + clangLex + clangBasic + ) + +set(LLVM_LINK_COMPONENTS + jit + interpreter + nativecodegen + bitreader + bitwriter + ipo + selectiondag + ) + +add_clang_executable(clang-interpreter + main.cpp + ) +add_dependencies(clang-interpreter clang-headers) diff --git a/examples/clang-interpreter/Makefile b/examples/clang-interpreter/Makefile new file mode 100644 index 000000000000..fecc3f576c58 --- /dev/null +++ b/examples/clang-interpreter/Makefile @@ -0,0 +1,30 @@ +##===- examples/clang-interpreter/Makefile -----------------*- Makefile -*-===## +# +# The LLVM Compiler Infrastructure +# +# This file is distributed under the University of Illinois Open Source +# License. See LICENSE.TXT for details. +# +##===----------------------------------------------------------------------===## + +LEVEL = ../../../.. + +TOOLNAME = clang-interpreter +CPPFLAGS += -I$(PROJ_SRC_DIR)/../../include -I$(PROJ_OBJ_DIR)/../../include +NO_INSTALL = 1 + +# No plugins, optimize startup time. +TOOL_NO_EXPORTS = 1 + +# Include this here so we can get the configuration of the targets that have +# been configured for construction. We have to do this early so we can set up +# LINK_COMPONENTS before including Makefile.rules +include $(LEVEL)/Makefile.config + +LINK_COMPONENTS := jit interpreter nativecodegen bitreader bitwriter ipo \ + selectiondag +USEDLIBS = clangFrontend.a clangDriver.a clangCodeGen.a clangSema.a \ + clangChecker.a clangAnalysis.a clangRewrite.a clangAST.a \ + clangParse.a clangLex.a clangBasic.a + +include $(LLVM_SRC_ROOT)/Makefile.rules diff --git a/examples/clang-interpreter/README.txt b/examples/clang-interpreter/README.txt new file mode 100644 index 000000000000..7dd45fad5048 --- /dev/null +++ b/examples/clang-interpreter/README.txt @@ -0,0 +1,17 @@ +This is an example of Clang based interpreter, for executing standalone C +programs. + +It demonstrates the following features: + 1. Parsing standard compiler command line arguments using the Driver library. + + 2. Constructing a Clang compiler instance, using the appropriate arguments + derived in step #1. + + 3. Invoking the Clang compiler to lex, parse, syntax check, and then generate + LLVM code. + + 4. Use the LLVM JIT functionality to execute the final module. + +The implementation has many limitations and is not designed to be a full fledged +C interpreter. It is designed to demonstrate a simple but functional use of the +Clang compiler libraries. diff --git a/examples/clang-interpreter/main.cpp b/examples/clang-interpreter/main.cpp new file mode 100644 index 000000000000..b739b7156bb1 --- /dev/null +++ b/examples/clang-interpreter/main.cpp @@ -0,0 +1,152 @@ +//===-- examples/clang-interpreter/main.cpp - Clang C Interpreter Example -===// +// +// The LLVM Compiler Infrastructure +// +// This file is distributed under the University of Illinois Open Source +// License. See LICENSE.TXT for details. +// +//===----------------------------------------------------------------------===// + +#include "clang/Driver/Compilation.h" +#include "clang/Driver/Driver.h" +#include "clang/Driver/Tool.h" +#include "clang/Frontend/CodeGenAction.h" +#include "clang/Frontend/CompilerInvocation.h" +#include "clang/Frontend/CompilerInstance.h" +#include "clang/Frontend/DiagnosticOptions.h" +#include "clang/Frontend/FrontendDiagnostic.h" +#include "clang/Frontend/TextDiagnosticPrinter.h" + +#include "llvm/LLVMContext.h" +#include "llvm/Module.h" +#include "llvm/Config/config.h" +#include "llvm/ADT/OwningPtr.h" +#include "llvm/ADT/SmallString.h" +#include "llvm/Config/config.h" +#include "llvm/ExecutionEngine/ExecutionEngine.h" +#include "llvm/Support/ManagedStatic.h" +#include "llvm/Support/raw_ostream.h" +#include "llvm/System/Host.h" +#include "llvm/System/Path.h" +#include "llvm/Target/TargetSelect.h" +using namespace clang; +using namespace clang::driver; + +llvm::sys::Path GetExecutablePath(const char *Argv0) { + // This just needs to be some symbol in the binary; C++ doesn't + // allow taking the address of ::main however. + void *MainAddr = (void*) (intptr_t) GetExecutablePath; + return llvm::sys::Path::GetMainExecutable(Argv0, MainAddr); +} + +int Execute(llvm::Module *Mod, char * const *envp) { + llvm::InitializeNativeTarget(); + + std::string Error; + llvm::OwningPtr<llvm::ExecutionEngine> EE( + llvm::ExecutionEngine::createJIT(Mod, &Error)); + if (!EE) { + llvm::errs() << "unable to make execution engine: " << Error << "\n"; + return 255; + } + + llvm::Function *EntryFn = Mod->getFunction("main"); + if (!EntryFn) { + llvm::errs() << "'main' function not found in module.\n"; + return 255; + } + + // FIXME: Support passing arguments. + std::vector<std::string> Args; + Args.push_back(Mod->getModuleIdentifier()); + + return EE->runFunctionAsMain(EntryFn, Args, envp); +} + +int main(int argc, const char **argv, char * const *envp) { + void *MainAddr = (void*) (intptr_t) GetExecutablePath; + llvm::sys::Path Path = GetExecutablePath(argv[0]); + TextDiagnosticPrinter DiagClient(llvm::errs(), DiagnosticOptions()); + + Diagnostic Diags(&DiagClient); + Driver TheDriver(Path.getBasename(), Path.getDirname(), + llvm::sys::getHostTriple(), + "a.out", /*IsProduction=*/false, Diags); + TheDriver.setTitle("clang interpreter"); + + // FIXME: This is a hack to try to force the driver to do something we can + // recognize. We need to extend the driver library to support this use model + // (basically, exactly one input, and the operation mode is hard wired). + llvm::SmallVector<const char *, 16> Args(argv, argv + argc); + Args.push_back("-fsyntax-only"); + llvm::OwningPtr<Compilation> C(TheDriver.BuildCompilation(Args.size(), + Args.data())); + if (!C) + return 0; + + // FIXME: This is copied from ASTUnit.cpp; simplify and eliminate. + + // We expect to get back exactly one command job, if we didn't something + // failed. Extract that job from the compilation. + const driver::JobList &Jobs = C->getJobs(); + if (Jobs.size() != 1 || !isa<driver::Command>(Jobs.begin())) { + llvm::SmallString<256> Msg; + llvm::raw_svector_ostream OS(Msg); + C->PrintJob(OS, C->getJobs(), "; ", true); + Diags.Report(diag::err_fe_expected_compiler_job) << OS.str(); + return 1; + } + + const driver::Command *Cmd = cast<driver::Command>(*Jobs.begin()); + if (llvm::StringRef(Cmd->getCreator().getName()) != "clang") { + Diags.Report(diag::err_fe_expected_clang_command); + return 1; + } + + // Initialize a compiler invocation object from the clang (-cc1) arguments. + const driver::ArgStringList &CCArgs = Cmd->getArguments(); + llvm::OwningPtr<CompilerInvocation> CI(new CompilerInvocation); + CompilerInvocation::CreateFromArgs(*CI, (const char**) CCArgs.data(), + (const char**) CCArgs.data()+CCArgs.size(), + Diags); + + // Show the invocation, with -v. + if (CI->getHeaderSearchOpts().Verbose) { + llvm::errs() << "clang invocation:\n"; + C->PrintJob(llvm::errs(), C->getJobs(), "\n", true); + llvm::errs() << "\n"; + } + + // FIXME: This is copied from cc1_main.cpp; simplify and eliminate. + + // Create a compiler instance to handle the actual work. + CompilerInstance Clang; + Clang.setLLVMContext(new llvm::LLVMContext); + Clang.setInvocation(CI.take()); + + // Create the compilers actual diagnostics engine. + Clang.createDiagnostics(int(CCArgs.size()), (char**) CCArgs.data()); + if (!Clang.hasDiagnostics()) + return 1; + + // Infer the builtin include path if unspecified. + if (Clang.getHeaderSearchOpts().UseBuiltinIncludes && + Clang.getHeaderSearchOpts().ResourceDir.empty()) + Clang.getHeaderSearchOpts().ResourceDir = + CompilerInvocation::GetResourcesPath(argv[0], MainAddr); + + // Create and execute the frontend to generate an LLVM bitcode module. + llvm::OwningPtr<CodeGenAction> Act(new EmitLLVMOnlyAction()); + if (!Clang.ExecuteAction(*Act)) + return 1; + + int Res = 255; + if (llvm::Module *Module = Act->takeModule()) + Res = Execute(Module, envp); + + // Shutdown. + + llvm::llvm_shutdown(); + + return Res; +} diff --git a/examples/wpa/Makefile b/examples/wpa/Makefile index 2be7ff10d899..6b7f407b6d23 100644 --- a/examples/wpa/Makefile +++ b/examples/wpa/Makefile @@ -1,3 +1,12 @@ +##===- examples/wpa/Makefile -------------------------------*- Makefile -*-===## +# +# The LLVM Compiler Infrastructure +# +# This file is distributed under the University of Illinois Open Source +# License. See LICENSE.TXT for details. +# +##===----------------------------------------------------------------------===## + LEVEL = ../../../.. TOOLNAME = clang-wpa @@ -7,6 +16,9 @@ NO_INSTALL = 1 # No plugins, optimize startup time. TOOL_NO_EXPORTS = 1 +# Include this here so we can get the configuration of the targets that have +# been configured for construction. We have to do this early so we can set up +# LINK_COMPONENTS before including Makefile.rules include $(LEVEL)/Makefile.config LINK_COMPONENTS := bitreader mc core diff --git a/include/clang-c/Index.h b/include/clang-c/Index.h index 84ec4724e0db..7bc290d88f4e 100644 --- a/include/clang-c/Index.h +++ b/include/clang-c/Index.h @@ -18,6 +18,7 @@ #include <sys/stat.h> #include <time.h> +#include <stdio.h> #ifdef __cplusplus extern "C" { @@ -86,14 +87,12 @@ struct CXUnsavedFile { const char *Filename; /** - * \brief A null-terminated buffer containing the unsaved contents - * of this file. + * \brief A buffer containing the unsaved contents of this file. */ const char *Contents; /** - * \brief The length of the unsaved contents of this buffer, not - * counting the NULL at the end of the buffer. + * \brief The length of the unsaved contents of this buffer. */ unsigned long Length; }; @@ -145,8 +144,8 @@ CINDEX_LINKAGE void clang_disposeString(CXString string); * * Here is an example: * - * // excludeDeclsFromPCH = 1 - * Idx = clang_createIndex(1); + * // excludeDeclsFromPCH = 1, displayDiagnostics=1 + * Idx = clang_createIndex(1, 1); * * // IndexTest.pch was produced with the following command: * // "clang -x c IndexTest.h -emit-ast -o IndexTest.pch" @@ -170,7 +169,8 @@ CINDEX_LINKAGE void clang_disposeString(CXString string); * -include-pch) allows 'excludeDeclsFromPCH' to remove redundant callbacks * (which gives the indexer the same performance benefit as the compiler). */ -CINDEX_LINKAGE CXIndex clang_createIndex(int excludeDeclarationsFromPCH); +CINDEX_LINKAGE CXIndex clang_createIndex(int excludeDeclarationsFromPCH, + int displayDiagnostics); /** * \brief Destroy the given index. @@ -207,7 +207,7 @@ typedef void *CXFile; /** * \brief Retrieve the complete file and path name of the given file. */ -CINDEX_LINKAGE const char *clang_getFileName(CXFile SFile); +CINDEX_LINKAGE CXString clang_getFileName(CXFile SFile); /** * \brief Retrieve the last modification time of the given file. @@ -388,45 +388,105 @@ enum CXDiagnosticSeverity { }; /** - * \brief Describes the kind of fix-it hint expressed within a - * diagnostic. + * \brief A single diagnostic, containing the diagnostic's severity, + * location, text, source ranges, and fix-it hints. */ -enum CXFixItKind { +typedef void *CXDiagnostic; + +/** + * \brief Determine the number of diagnostics produced for the given + * translation unit. + */ +CINDEX_LINKAGE unsigned clang_getNumDiagnostics(CXTranslationUnit Unit); + +/** + * \brief Retrieve a diagnostic associated with the given translation unit. + * + * \param Unit the translation unit to query. + * \param Index the zero-based diagnostic number to retrieve. + * + * \returns the requested diagnostic. This diagnostic must be freed + * via a call to \c clang_disposeDiagnostic(). + */ +CINDEX_LINKAGE CXDiagnostic clang_getDiagnostic(CXTranslationUnit Unit, + unsigned Index); + +/** + * \brief Destroy a diagnostic. + */ +CINDEX_LINKAGE void clang_disposeDiagnostic(CXDiagnostic Diagnostic); + +/** + * \brief Options to control the display of diagnostics. + * + * The values in this enum are meant to be combined to customize the + * behavior of \c clang_displayDiagnostic(). + */ +enum CXDiagnosticDisplayOptions { /** - * \brief A fix-it hint that inserts code at a particular position. + * \brief Display the source-location information where the + * diagnostic was located. + * + * When set, diagnostics will be prefixed by the file, line, and + * (optionally) column to which the diagnostic refers. For example, + * + * \code + * test.c:28: warning: extra tokens at end of #endif directive + * \endcode + * + * This option corresponds to the clang flag \c -fshow-source-location. */ - CXFixIt_Insertion = 0, + CXDiagnostic_DisplaySourceLocation = 0x01, /** - * \brief A fix-it hint that removes code within a range. + * \brief If displaying the source-location information of the + * diagnostic, also include the column number. + * + * This option corresponds to the clang flag \c -fshow-column. */ - CXFixIt_Removal = 1, + CXDiagnostic_DisplayColumn = 0x02, /** - * \brief A fix-it hint that replaces the code within a range with another - * string. + * \brief If displaying the source-location information of the + * diagnostic, also include information about source ranges in a + * machine-parsable format. + * + * This option corresponds to the clang flag + * \c -fdiagnostics-print-source-range-info. */ - CXFixIt_Replacement = 2 + CXDiagnostic_DisplaySourceRanges = 0x04 }; /** - * \brief A single diagnostic, containing the diagnostic's severity, - * location, text, source ranges, and fix-it hints. + * \brief Format the given diagnostic in a manner that is suitable for display. + * + * This routine will format the given diagnostic to a string, rendering + * the diagnostic according to the various options given. The + * \c clang_defaultDiagnosticDisplayOptions() function returns the set of + * options that most closely mimics the behavior of the clang compiler. + * + * \param Diagnostic The diagnostic to print. + * + * \param Options A set of options that control the diagnostic display, + * created by combining \c CXDiagnosticDisplayOptions values. + * + * \returns A new string containing for formatted diagnostic. */ -typedef void *CXDiagnostic; +CINDEX_LINKAGE CXString clang_formatDiagnostic(CXDiagnostic Diagnostic, + unsigned Options); /** - * \brief Callback function invoked for each diagnostic emitted during - * translation. - * - * \param Diagnostic the diagnostic emitted during translation. This - * diagnostic pointer is only valid during the execution of the - * callback. + * \brief Retrieve the set of display options most similar to the + * default behavior of the clang compiler. * - * \param ClientData the callback client data. + * \returns A set of display options suitable for use with \c + * clang_displayDiagnostic(). + */ +CINDEX_LINKAGE unsigned clang_defaultDiagnosticDisplayOptions(void); + +/** + * \brief Print a diagnostic to the given file. */ -typedef void (*CXDiagnosticCallback)(CXDiagnostic Diagnostic, - CXClientData ClientData); /** * \brief Determine the severity of the given diagnostic. @@ -476,69 +536,33 @@ CINDEX_LINKAGE CXSourceRange clang_getDiagnosticRange(CXDiagnostic Diagnostic, CINDEX_LINKAGE unsigned clang_getDiagnosticNumFixIts(CXDiagnostic Diagnostic); /** - * \brief Retrieve the kind of the given fix-it. - * - * \param Diagnostic the diagnostic whose fix-its are being queried. - * - * \param FixIt the zero-based index of the fix-it to query. - */ -CINDEX_LINKAGE enum CXFixItKind -clang_getDiagnosticFixItKind(CXDiagnostic Diagnostic, unsigned FixIt); - -/** - * \brief Retrieve the insertion information for an insertion fix-it. + * \brief Retrieve the replacement information for a given fix-it. * - * For a fix-it that describes an insertion into a text buffer, - * retrieve the source location where the text should be inserted and - * the text to be inserted. + * Fix-its are described in terms of a source range whose contents + * should be replaced by a string. This approach generalizes over + * three kinds of operations: removal of source code (the range covers + * the code to be removed and the replacement string is empty), + * replacement of source code (the range covers the code to be + * replaced and the replacement string provides the new code), and + * insertion (both the start and end of the range point at the + * insertion location, and the replacement string provides the text to + * insert). * - * \param Diagnostic the diagnostic whose fix-its are being queried. + * \param Diagnostic The diagnostic whose fix-its are being queried. * - * \param FixIt the zero-based index of the insertion fix-it. + * \param FixIt The zero-based index of the fix-it. * - * \param Location will be set to the location where text should be - * inserted. + * \param ReplacementRange The source range whose contents will be + * replaced with the returned replacement string. Note that source + * ranges are half-open ranges [a, b), so the source code should be + * replaced from a and up to (but not including) b. * - * \returns the text string to insert at the given location. + * \returns A string containing text that should be replace the source + * code indicated by the \c ReplacementRange. */ -CINDEX_LINKAGE CXString -clang_getDiagnosticFixItInsertion(CXDiagnostic Diagnostic, unsigned FixIt, - CXSourceLocation *Location); - -/** - * \brief Retrieve the removal information for a removal fix-it. - * - * For a fix-it that describes a removal from a text buffer, retrieve - * the source range that should be removed. - * - * \param Diagnostic the diagnostic whose fix-its are being queried. - * - * \param FixIt the zero-based index of the removal fix-it. - * - * \returns a source range describing the text that should be removed - * from the buffer. - */ -CINDEX_LINKAGE CXSourceRange -clang_getDiagnosticFixItRemoval(CXDiagnostic Diagnostic, unsigned FixIt); - -/** - * \brief Retrieve the replacement information for an replacement fix-it. - * - * For a fix-it that describes replacement of text in the text buffer - * with alternative text. - * - * \param Diagnostic the diagnostic whose fix-its are being queried. - * - * \param FixIt the zero-based index of the replacement fix-it. - * - * \param Range will be set to the source range whose text should be - * replaced with the returned text. - * - * \returns the text string to use as replacement text. - */ -CINDEX_LINKAGE CXString -clang_getDiagnosticFixItReplacement(CXDiagnostic Diagnostic, unsigned FixIt, - CXSourceRange *Range); +CINDEX_LINKAGE CXString clang_getDiagnosticFixIt(CXDiagnostic Diagnostic, + unsigned FixIt, + CXSourceRange *ReplacementRange); /** * @} @@ -600,17 +624,13 @@ CINDEX_LINKAGE CXTranslationUnit clang_createTranslationUnitFromSourceFile( int num_clang_command_line_args, const char **clang_command_line_args, unsigned num_unsaved_files, - struct CXUnsavedFile *unsaved_files, - CXDiagnosticCallback diag_callback, - CXClientData diag_client_data); + struct CXUnsavedFile *unsaved_files); /** * \brief Create a translation unit from an AST file (-emit-ast). */ CINDEX_LINKAGE CXTranslationUnit clang_createTranslationUnit(CXIndex, - const char *ast_filename, - CXDiagnosticCallback diag_callback, - CXClientData diag_client_data); + const char *ast_filename); /** * \brief Destroy the specified CXTranslationUnit object. @@ -764,7 +784,19 @@ enum CXCursorKind { * The translation unit cursor exists primarily to act as the root * cursor for traversing the contents of a translation unit. */ - CXCursor_TranslationUnit = 300 + CXCursor_TranslationUnit = 300, + + /* Attributes */ + CXCursor_FirstAttr = 400, + /** + * \brief An attribute whose specific kind is not exposed via this + * interface. + */ + CXCursor_UnexposedAttr = 400, + + CXCursor_IBActionAttr = 401, + CXCursor_IBOutletAttr = 402, + CXCursor_LastAttr = CXCursor_IBOutletAttr }; /** @@ -857,6 +889,32 @@ CINDEX_LINKAGE unsigned clang_isInvalid(enum CXCursorKind); CINDEX_LINKAGE unsigned clang_isTranslationUnit(enum CXCursorKind); /** + * \brief Describe the linkage of the entity referred to by a cursor. + */ +enum CXLinkageKind { + /** \brief This value indicates that no linkage information is available + * for a provided CXCursor. */ + CXLinkage_Invalid, + /** + * \brief This is the linkage for variables, parameters, and so on that + * have automatic storage. This covers normal (non-extern) local variables. + */ + CXLinkage_NoLinkage, + /** \brief This is the linkage for static variables and static functions. */ + CXLinkage_Internal, + /** \brief This is the linkage for entities with external linkage that live + * in C++ anonymous namespaces.*/ + CXLinkage_UniqueExternal, + /** \brief This is the linkage for entities with true, external linkage. */ + CXLinkage_External +}; + +/** + * \brief Determine the linkage of the entity referred to be a given cursor. + */ +CINDEX_LINKAGE enum CXLinkageKind clang_getCursorLinkage(CXCursor cursor); + +/** * @} */ @@ -1221,7 +1279,7 @@ CINDEX_LINKAGE void clang_disposeTokens(CXTranslationUnit TU, */ /* for debug/testing */ -CINDEX_LINKAGE const char *clang_getCursorKindSpelling(enum CXCursorKind Kind); +CINDEX_LINKAGE CXString clang_getCursorKindSpelling(enum CXCursorKind Kind); CINDEX_LINKAGE void clang_getDefinitionSpellingAndExtent(CXCursor, const char **startBuf, const char **endBuf, @@ -1229,7 +1287,7 @@ CINDEX_LINKAGE void clang_getDefinitionSpellingAndExtent(CXCursor, unsigned *startColumn, unsigned *endLine, unsigned *endColumn); - +CINDEX_LINKAGE void clang_enableStackTraces(void); /** * @} */ @@ -1313,13 +1371,13 @@ enum CXCompletionChunkKind { * - a Placeholder chunk for "int x" * - an Optional chunk containing the remaining defaulted arguments, e.g., * - a Comma chunk for "," - * - a Placeholder chunk for "float x" + * - a Placeholder chunk for "float y" * - an Optional chunk containing the last defaulted argument: * - a Comma chunk for "," * - a Placeholder chunk for "double z" * - a RightParen chunk for ")" * - * There are many ways two handle Optional chunks. Two simple approaches are: + * There are many ways to handle Optional chunks. Two simple approaches are: * - Completely ignore optional chunks, in which case the template for the * function "f" would only include the first parameter ("int x"). * - Fully expand all optional chunks, in which case the template for the @@ -1478,7 +1536,7 @@ clang_getCompletionChunkKind(CXCompletionString completion_string, * * \returns the text associated with the chunk at index \c chunk_number. */ -CINDEX_LINKAGE const char * +CINDEX_LINKAGE CXString clang_getCompletionChunkText(CXCompletionString completion_string, unsigned chunk_number); @@ -1613,9 +1671,7 @@ CXCodeCompleteResults *clang_codeComplete(CXIndex CIdx, struct CXUnsavedFile *unsaved_files, const char *complete_filename, unsigned complete_line, - unsigned complete_column, - CXDiagnosticCallback diag_callback, - CXClientData diag_client_data); + unsigned complete_column); /** * \brief Free the given set of code-completion results. @@ -1624,6 +1680,26 @@ CINDEX_LINKAGE void clang_disposeCodeCompleteResults(CXCodeCompleteResults *Results); /** + * \brief Determine the number of diagnostics produced prior to the + * location where code completion was performed. + */ +CINDEX_LINKAGE +unsigned clang_codeCompleteGetNumDiagnostics(CXCodeCompleteResults *Results); + +/** + * \brief Retrieve a diagnostic associated with the given code completion. + * + * \param Result the code completion results to query. + * \param Index the zero-based diagnostic number to retrieve. + * + * \returns the requested diagnostic. This diagnostic must be freed + * via a call to \c clang_disposeDiagnostic(). + */ +CINDEX_LINKAGE +CXDiagnostic clang_codeCompleteGetDiagnostic(CXCodeCompleteResults *Results, + unsigned Index); + +/** * @} */ diff --git a/include/clang/AST/ASTContext.h b/include/clang/AST/ASTContext.h index 2ed9fd708018..6767f52f4d83 100644 --- a/include/clang/AST/ASTContext.h +++ b/include/clang/AST/ASTContext.h @@ -67,6 +67,28 @@ namespace clang { namespace Builtin { class Context; } +/// \brief A vector of C++ member functions that is optimized for +/// storing a single method. +class CXXMethodVector { + /// \brief Storage for the vector. + /// + /// When the low bit is zero, this is a const CXXMethodDecl *. When the + /// low bit is one, this is a std::vector<const CXXMethodDecl *> *. + mutable uintptr_t Storage; + + typedef std::vector<const CXXMethodDecl *> vector_type; + +public: + CXXMethodVector() : Storage(0) { } + + typedef const CXXMethodDecl **iterator; + iterator begin() const; + iterator end() const; + + void push_back(const CXXMethodDecl *Method); + void Destroy(); +}; + /// ASTContext - This class holds long-lived AST nodes (such as types and /// decls) that can be referred to throughout the semantic analysis of a file. class ASTContext { @@ -219,6 +241,14 @@ class ASTContext { llvm::DenseMap<FieldDecl *, FieldDecl *> InstantiatedFromUnnamedFieldDecl; + /// \brief Mapping that stores the methods overridden by a given C++ + /// member function. + /// + /// Since most C++ member functions aren't virtual and therefore + /// don't override anything, we store the overridden functions in + /// this map on the side rather than within the CXXMethodDecl structure. + llvm::DenseMap<const CXXMethodDecl *, CXXMethodVector> OverriddenMethods; + TranslationUnitDecl *TUDecl; /// SourceMgr - The associated SourceManager object. @@ -310,6 +340,19 @@ public: void setInstantiatedFromUnnamedFieldDecl(FieldDecl *Inst, FieldDecl *Tmpl); + // Access to the set of methods overridden by the given C++ method. + typedef CXXMethodVector::iterator overridden_cxx_method_iterator; + overridden_cxx_method_iterator + overridden_methods_begin(const CXXMethodDecl *Method) const; + + overridden_cxx_method_iterator + overridden_methods_end(const CXXMethodDecl *Method) const; + + /// \brief Note that the given C++ \p Method overrides the given \p + /// Overridden method. + void addOverriddenMethod(const CXXMethodDecl *Method, + const CXXMethodDecl *Overridden); + TranslationUnitDecl *getTranslationUnitDecl() const { return TUDecl; } @@ -529,11 +572,11 @@ public: /// list. isVariadic indicates whether the argument list includes '...'. QualType getFunctionType(QualType ResultTy, const QualType *ArgArray, unsigned NumArgs, bool isVariadic, - unsigned TypeQuals, bool hasExceptionSpec = false, - bool hasAnyExceptionSpec = false, - unsigned NumExs = 0, const QualType *ExArray = 0, - bool NoReturn = false, - CallingConv CallConv = CC_Default); + unsigned TypeQuals, bool hasExceptionSpec, + bool hasAnyExceptionSpec, + unsigned NumExs, const QualType *ExArray, + bool NoReturn, + CallingConv CallConv); /// getTypeDeclType - Return the unique reference to the type for /// the specified type declaration. @@ -882,9 +925,8 @@ public: llvm::SmallVectorImpl<FieldDecl*> &Fields); void ShallowCollectObjCIvars(const ObjCInterfaceDecl *OI, - llvm::SmallVectorImpl<ObjCIvarDecl*> &Ivars, - bool CollectSynthesized = true); - void CollectSynthesizedIvars(const ObjCInterfaceDecl *OI, + llvm::SmallVectorImpl<ObjCIvarDecl*> &Ivars); + void CollectNonClassIvars(const ObjCInterfaceDecl *OI, llvm::SmallVectorImpl<ObjCIvarDecl*> &Ivars); void CollectProtocolSynthesizedIvars(const ObjCProtocolDecl *PD, llvm::SmallVectorImpl<ObjCIvarDecl*> &Ivars); diff --git a/include/clang/AST/ASTImporter.h b/include/clang/AST/ASTImporter.h index f5f11ca83662..7975c4378876 100644 --- a/include/clang/AST/ASTImporter.h +++ b/include/clang/AST/ASTImporter.h @@ -156,6 +156,12 @@ namespace clang { /// \returns the equivalent identifier in the "to" context. IdentifierInfo *Import(IdentifierInfo *FromId); + /// \brief Import the given Objective-C selector from the "from" + /// context into the "to" context. + /// + /// \returns the equivalent selector in the "to" context. + Selector Import(Selector FromSel); + /// \brief Import the given file ID from the "from" context into the /// "to" context. /// diff --git a/include/clang/AST/Attr.h b/include/clang/AST/Attr.h index 37225907c6de..19744931762b 100644 --- a/include/clang/AST/Attr.h +++ b/include/clang/AST/Attr.h @@ -62,7 +62,8 @@ public: FormatArg, GNUInline, Hiding, - IBOutletKind, // Clang-specific. Use "Kind" suffix to not conflict with + IBOutletKind, // Clang-specific. Use "Kind" suffix to not conflict w/ macro. + IBActionKind, // Clang-specific. Use "Kind" suffix to not conflict w/ macro. Malloc, NoDebug, NoInline, @@ -72,8 +73,10 @@ public: ObjCException, ObjCNSObject, Override, - CFReturnsRetained, // Clang/Checker-specific. - NSReturnsRetained, // Clang/Checker-specific. + CFReturnsRetained, // Clang/Checker-specific. + CFReturnsNotRetained, // Clang/Checker-specific. + NSReturnsRetained, // Clang/Checker-specific. + NSReturnsNotRetained, // Clang/Checker-specific. Overloadable, // Clang-specific Packed, PragmaPack, @@ -91,6 +94,7 @@ public: WarnUnusedResult, Weak, WeakImport, + WeakRef, FIRST_TARGET_ATTRIBUTE, DLLExport, @@ -300,37 +304,38 @@ public: static bool classof(const DestructorAttr *A) { return true; } }; -class GNUInlineAttr : public Attr { +class IBOutletAttr : public Attr { public: - GNUInlineAttr() : Attr(GNUInline) {} + IBOutletAttr() : Attr(IBOutletKind) {} virtual Attr *clone(ASTContext &C) const; // Implement isa/cast/dyncast/etc. static bool classof(const Attr *A) { - return A->getKind() == GNUInline; + return A->getKind() == IBOutletKind; } - static bool classof(const GNUInlineAttr *A) { return true; } + static bool classof(const IBOutletAttr *A) { return true; } }; -class IBOutletAttr : public Attr { +class IBActionAttr : public Attr { public: - IBOutletAttr() : Attr(IBOutletKind) {} + IBActionAttr() : Attr(IBActionKind) {} virtual Attr *clone(ASTContext &C) const; - // Implement isa/cast/dyncast/etc. + // Implement isa/cast/dyncast/etc. static bool classof(const Attr *A) { - return A->getKind() == IBOutletKind; + return A->getKind() == IBActionKind; } - static bool classof(const IBOutletAttr *A) { return true; } + static bool classof(const IBActionAttr *A) { return true; } }; -DEF_SIMPLE_ATTR(Malloc); -DEF_SIMPLE_ATTR(NoReturn); DEF_SIMPLE_ATTR(AnalyzerNoReturn); DEF_SIMPLE_ATTR(Deprecated); DEF_SIMPLE_ATTR(Final); +DEF_SIMPLE_ATTR(GNUInline); +DEF_SIMPLE_ATTR(Malloc); +DEF_SIMPLE_ATTR(NoReturn); class SectionAttr : public AttrWithString { public: @@ -353,6 +358,7 @@ DEF_SIMPLE_ATTR(Unused); DEF_SIMPLE_ATTR(Used); DEF_SIMPLE_ATTR(Weak); DEF_SIMPLE_ATTR(WeakImport); +DEF_SIMPLE_ATTR(WeakRef); DEF_SIMPLE_ATTR(NoThrow); DEF_SIMPLE_ATTR(Const); DEF_SIMPLE_ATTR(Pure); @@ -543,7 +549,9 @@ public: }; // Checker-specific attributes. +DEF_SIMPLE_ATTR(CFReturnsNotRetained); DEF_SIMPLE_ATTR(CFReturnsRetained); +DEF_SIMPLE_ATTR(NSReturnsNotRetained); DEF_SIMPLE_ATTR(NSReturnsRetained); // C++0x member checking attributes. diff --git a/include/clang/AST/CXXInheritance.h b/include/clang/AST/CXXInheritance.h index 79a3022ee014..c89e5e4b167a 100644 --- a/include/clang/AST/CXXInheritance.h +++ b/include/clang/AST/CXXInheritance.h @@ -16,6 +16,7 @@ #include "clang/AST/DeclarationName.h" #include "clang/AST/DeclBase.h" +#include "clang/AST/DeclCXX.h" #include "clang/AST/Type.h" #include "clang/AST/TypeOrdering.h" #include "llvm/ADT/SmallVector.h" @@ -159,7 +160,11 @@ class CXXBasePaths { friend class CXXRecordDecl; void ComputeDeclsFound(); - + + bool lookupInBases(ASTContext &Context, + const CXXRecordDecl *Record, + CXXRecordDecl::BaseMatchesCallback *BaseMatches, + void *UserData); public: typedef std::list<CXXBasePath>::iterator paths_iterator; typedef std::list<CXXBasePath>::const_iterator const_paths_iterator; diff --git a/include/clang/AST/CanonicalType.h b/include/clang/AST/CanonicalType.h index 93e41d38d48c..1f459b08ca78 100644 --- a/include/clang/AST/CanonicalType.h +++ b/include/clang/AST/CanonicalType.h @@ -120,6 +120,13 @@ public: return Stored.isLocalRestrictQualified(); } + /// \brief Determines if this canonical type is furthermore + /// canonical as a parameter. The parameter-canonicalization + /// process decays arrays to pointers and drops top-level qualifiers. + bool isCanonicalAsParam() const { + return Stored.isCanonicalAsParam(); + } + /// \brief Retrieve the unqualified form of this type. CanQual<T> getUnqualifiedType() const; @@ -157,6 +164,10 @@ public: /// ensure that the given type is a canonical type with the correct // (dynamic) type. static CanQual<T> CreateUnsafe(QualType Other); + + void Profile(llvm::FoldingSetNodeID &ID) const { + ID.AddPointer(getAsOpaquePtr()); + } }; template<typename T, typename U> @@ -172,6 +183,10 @@ inline bool operator!=(CanQual<T> x, CanQual<U> y) { /// \brief Represents a canonical, potentially-qualified type. typedef CanQual<Type> CanQualType; +inline CanQualType Type::getCanonicalTypeUnqualified() const { + return CanQualType::CreateUnsafe(getCanonicalTypeInternal()); +} + inline const DiagnosticBuilder &operator<<(const DiagnosticBuilder &DB, CanQualType T) { DB << static_cast<QualType>(T); @@ -547,18 +562,24 @@ struct CanProxyAdaptor<ExtVectorType> : public CanProxyBase<ExtVectorType> { template<> struct CanProxyAdaptor<FunctionType> : public CanProxyBase<FunctionType> { LLVM_CLANG_CANPROXY_TYPE_ACCESSOR(getResultType) + LLVM_CLANG_CANPROXY_SIMPLE_ACCESSOR(bool, getNoReturnAttr) + LLVM_CLANG_CANPROXY_SIMPLE_ACCESSOR(CallingConv, getCallConv) }; template<> struct CanProxyAdaptor<FunctionNoProtoType> : public CanProxyBase<FunctionNoProtoType> { LLVM_CLANG_CANPROXY_TYPE_ACCESSOR(getResultType) + LLVM_CLANG_CANPROXY_SIMPLE_ACCESSOR(bool, getNoReturnAttr) + LLVM_CLANG_CANPROXY_SIMPLE_ACCESSOR(CallingConv, getCallConv) }; template<> struct CanProxyAdaptor<FunctionProtoType> : public CanProxyBase<FunctionProtoType> { LLVM_CLANG_CANPROXY_TYPE_ACCESSOR(getResultType) + LLVM_CLANG_CANPROXY_SIMPLE_ACCESSOR(bool, getNoReturnAttr) + LLVM_CLANG_CANPROXY_SIMPLE_ACCESSOR(CallingConv, getCallConv) LLVM_CLANG_CANPROXY_SIMPLE_ACCESSOR(unsigned, getNumArgs) CanQualType getArgType(unsigned i) const { return CanQualType::CreateUnsafe(this->getTypePtr()->getArgType(i)); diff --git a/include/clang/AST/Decl.h b/include/clang/AST/Decl.h index 07442896dc4b..91aeff3439b3 100644 --- a/include/clang/AST/Decl.h +++ b/include/clang/AST/Decl.h @@ -267,8 +267,8 @@ public: } void setAnonymousNamespace(NamespaceDecl *D) { - assert(D->isAnonymousNamespace()); - assert(D->getParent() == this); + assert(!D || D->isAnonymousNamespace()); + assert(!D || D->getParent() == this); AnonymousNamespace = D; } @@ -561,7 +561,7 @@ public: /// \brief Determine whether this is or was instantiated from an out-of-line /// definition of a static data member. - bool isOutOfLine() const; + virtual bool isOutOfLine() const; /// \brief If this is a static data member, find its out-of-line definition. VarDecl *getOutOfLineDefinition(); @@ -1306,7 +1306,7 @@ public: /// \brief Determine whether this is or was instantiated from an out-of-line /// definition of a member function. - bool isOutOfLine() const; + virtual bool isOutOfLine() const; // Implement isa/cast/dyncast/etc. static bool classof(const Decl *D) { return classofKind(D->getKind()); } diff --git a/include/clang/AST/DeclBase.h b/include/clang/AST/DeclBase.h index a407a1627747..7fb5f9daae17 100644 --- a/include/clang/AST/DeclBase.h +++ b/include/clang/AST/DeclBase.h @@ -279,7 +279,8 @@ public: /// \brief Whether this declaration was used, meaning that a definition /// is required. - bool isUsed() const { return Used; } + bool isUsed() const; + void setUsed(bool U = true) { Used = U; } /// \brief Retrieve the level of precompiled header from which this @@ -330,7 +331,7 @@ public: return const_cast<Decl*>(this)->getLexicalDeclContext(); } - bool isOutOfLine() const { + virtual bool isOutOfLine() const { return getLexicalDeclContext() != getDeclContext(); } diff --git a/include/clang/AST/DeclCXX.h b/include/clang/AST/DeclCXX.h index 0978c6da9d66..af00c8d7e8ad 100644 --- a/include/clang/AST/DeclCXX.h +++ b/include/clang/AST/DeclCXX.h @@ -710,7 +710,7 @@ public: CXXConstructorDecl *getDefaultConstructor(ASTContext &Context); /// getDestructor - Returns the destructor decl for this class. - CXXDestructorDecl *getDestructor(ASTContext &Context); + CXXDestructorDecl *getDestructor(ASTContext &Context) const; /// isLocalClass - If the class is a local class [class.local], returns /// the enclosing function declaration. @@ -751,6 +751,21 @@ public: /// tangling input and output in \p Paths bool isDerivedFrom(CXXRecordDecl *Base, CXXBasePaths &Paths) const; + /// \brief Determine whether this class is virtually derived from + /// the class \p Base. + /// + /// This routine only determines whether this class is virtually + /// derived from \p Base, but does not account for factors that may + /// make a Derived -> Base class ill-formed, such as + /// private/protected inheritance or multiple, ambiguous base class + /// subobjects. + /// + /// \param Base the base class we are searching for. + /// + /// \returns true if this class is virtually derived from Base, + /// false otherwise. + bool isVirtuallyDerivedFrom(CXXRecordDecl *Base) const; + /// \brief Determine whether this class is provably not derived from /// the type \p Base. bool isProvablyNotDerivedFrom(const CXXRecordDecl *Base) const; @@ -824,6 +839,18 @@ public: /// base class that we are searching for. static bool FindBaseClass(const CXXBaseSpecifier *Specifier, CXXBasePath &Path, void *BaseRecord); + + /// \brief Base-class lookup callback that determines whether the + /// given base class specifier refers to a specific class + /// declaration and describes virtual derivation. + /// + /// This callback can be used with \c lookupInBases() to determine + /// whether a given derived class has is a virtual base class + /// subobject of a particular type. The user data pointer should + /// refer to the canonical CXXRecordDecl of the base class that we + /// are searching for. + static bool FindVirtualBaseClass(const CXXBaseSpecifier *Specifier, + CXXBasePath &Path, void *BaseRecord); /// \brief Base-class lookup callback that determines whether there exists /// a tag with the given name. diff --git a/include/clang/AST/DeclObjC.h b/include/clang/AST/DeclObjC.h index e562d352e070..26656bf30a65 100644 --- a/include/clang/AST/DeclObjC.h +++ b/include/clang/AST/DeclObjC.h @@ -494,11 +494,13 @@ public: } unsigned protocol_size() const { return ReferencedProtocols.size(); } - typedef ObjCList<ObjCIvarDecl>::iterator ivar_iterator; - ivar_iterator ivar_begin() const { return IVars.begin(); } - ivar_iterator ivar_end() const { return IVars.end(); } - unsigned ivar_size() const { return IVars.size(); } - bool ivar_empty() const { return IVars.empty(); } + typedef specific_decl_iterator<ObjCIvarDecl> ivar_iterator; + ivar_iterator ivar_begin() const { return ivar_iterator(decls_begin()); } + ivar_iterator ivar_end() const { return ivar_iterator(decls_end()); } + unsigned ivar_size() const { + return std::distance(ivar_begin(), ivar_end()); + } + bool ivar_empty() const { return ivar_begin() == ivar_end(); } /// setProtocolList - Set the list of protocols that this interface /// implements. @@ -514,10 +516,6 @@ public: const SourceLocation *Locs, ASTContext &C); - void setIVarList(ObjCIvarDecl * const *List, unsigned Num, ASTContext &C) { - IVars.set(List, Num, C); - } - bool isForwardDecl() const { return ForwardDecl; } void setForwardDecl(bool val) { ForwardDecl = val; } @@ -529,6 +527,8 @@ public: CategoryList = category; } + ObjCCategoryDecl* getClassExtension() const; + /// isSuperClassOf - Return true if this class is the specified class or is a /// super class of the specified interface class. bool isSuperClassOf(const ObjCInterfaceDecl *I) const { @@ -951,6 +951,20 @@ public: bool IsClassExtension() const { return getIdentifier() == 0; } + typedef specific_decl_iterator<ObjCIvarDecl> ivar_iterator; + ivar_iterator ivar_begin() const { + return ivar_iterator(decls_begin()); + } + ivar_iterator ivar_end() const { + return ivar_iterator(decls_end()); + } + unsigned ivar_size() const { + return std::distance(ivar_begin(), ivar_end()); + } + bool ivar_empty() const { + return ivar_begin() == ivar_end(); + } + SourceLocation getAtLoc() const { return AtLoc; } void setAtLoc(SourceLocation At) { AtLoc = At; } diff --git a/include/clang/AST/Expr.h b/include/clang/AST/Expr.h index 114a19800f50..23076b93e13b 100644 --- a/include/clang/AST/Expr.h +++ b/include/clang/AST/Expr.h @@ -150,7 +150,8 @@ public: LV_InvalidExpression, LV_MemberFunction, LV_SubObjCPropertySetting, - LV_SubObjCPropertyGetterSetting + LV_SubObjCPropertyGetterSetting, + LV_ClassTemporary }; isLvalueResult isLvalue(ASTContext &Ctx) const; @@ -181,7 +182,8 @@ public: MLV_NoSetterProperty, MLV_MemberFunction, MLV_SubObjCPropertySetting, - MLV_SubObjCPropertyGetterSetting + MLV_SubObjCPropertyGetterSetting, + MLV_ClassTemporary }; isModifiableLvalueResult isModifiableLvalue(ASTContext &Ctx, SourceLocation *Loc = 0) const; diff --git a/include/clang/AST/ExprCXX.h b/include/clang/AST/ExprCXX.h index e4bc4b746439..d1351b8b1447 100644 --- a/include/clang/AST/ExprCXX.h +++ b/include/clang/AST/ExprCXX.h @@ -997,21 +997,59 @@ public: virtual child_iterator child_end(); }; +/// \brief Structure used to store the type being destroyed by a +/// pseudo-destructor expression. +class PseudoDestructorTypeStorage { + /// \brief Either the type source information or the name of the type, if + /// it couldn't be resolved due to type-dependence. + llvm::PointerUnion<TypeSourceInfo *, IdentifierInfo *> Type; + + /// \brief The starting source location of the pseudo-destructor type. + SourceLocation Location; + +public: + PseudoDestructorTypeStorage() { } + + PseudoDestructorTypeStorage(IdentifierInfo *II, SourceLocation Loc) + : Type(II), Location(Loc) { } + + PseudoDestructorTypeStorage(TypeSourceInfo *Info); + + TypeSourceInfo *getTypeSourceInfo() const { + return Type.dyn_cast<TypeSourceInfo *>(); + } + + IdentifierInfo *getIdentifier() const { + return Type.dyn_cast<IdentifierInfo *>(); + } + + SourceLocation getLocation() const { return Location; } +}; + /// \brief Represents a C++ pseudo-destructor (C++ [expr.pseudo]). /// -/// Example: +/// A pseudo-destructor is an expression that looks like a member access to a +/// destructor of a scalar type, except that scalar types don't have +/// destructors. For example: /// /// \code +/// typedef int T; +/// void f(int *p) { +/// p->T::~T(); +/// } +/// \endcode +/// +/// Pseudo-destructors typically occur when instantiating templates such as: +/// +/// \code /// template<typename T> /// void destroy(T* ptr) { -/// ptr->~T(); +/// ptr->T::~T(); /// } /// \endcode /// -/// When the template is parsed, the expression \c ptr->~T will be stored as -/// a member reference expression. If it then instantiated with a scalar type -/// as a template argument for T, the resulting expression will be a -/// pseudo-destructor expression. +/// for scalar types. A pseudo-destructor expression has no run-time semantics +/// beyond evaluating the base expression. class CXXPseudoDestructorExpr : public Expr { /// \brief The base expression (that is being destroyed). Stmt *Base; @@ -1030,28 +1068,44 @@ class CXXPseudoDestructorExpr : public Expr { /// present. SourceRange QualifierRange; - /// \brief The type being destroyed. - QualType DestroyedType; - - /// \brief The location of the type after the '~'. - SourceLocation DestroyedTypeLoc; + /// \brief The type that precedes the '::' in a qualified pseudo-destructor + /// expression. + TypeSourceInfo *ScopeType; + + /// \brief The location of the '::' in a qualified pseudo-destructor + /// expression. + SourceLocation ColonColonLoc; + + /// \brief The location of the '~'. + SourceLocation TildeLoc; + + /// \brief The type being destroyed, or its name if we were unable to + /// resolve the name. + PseudoDestructorTypeStorage DestroyedType; public: CXXPseudoDestructorExpr(ASTContext &Context, Expr *Base, bool isArrow, SourceLocation OperatorLoc, NestedNameSpecifier *Qualifier, SourceRange QualifierRange, - QualType DestroyedType, - SourceLocation DestroyedTypeLoc) + TypeSourceInfo *ScopeType, + SourceLocation ColonColonLoc, + SourceLocation TildeLoc, + PseudoDestructorTypeStorage DestroyedType) : Expr(CXXPseudoDestructorExprClass, Context.getPointerType(Context.getFunctionType(Context.VoidTy, 0, 0, - false, 0)), - /*isTypeDependent=*/false, + false, 0, false, + false, 0, 0, false, + CC_Default)), + /*isTypeDependent=*/(Base->isTypeDependent() || + (DestroyedType.getTypeSourceInfo() && + DestroyedType.getTypeSourceInfo()->getType()->isDependentType())), /*isValueDependent=*/Base->isValueDependent()), Base(static_cast<Stmt *>(Base)), IsArrow(isArrow), OperatorLoc(OperatorLoc), Qualifier(Qualifier), - QualifierRange(QualifierRange), DestroyedType(DestroyedType), - DestroyedTypeLoc(DestroyedTypeLoc) { } + QualifierRange(QualifierRange), + ScopeType(ScopeType), ColonColonLoc(ColonColonLoc), TildeLoc(TildeLoc), + DestroyedType(DestroyedType) { } void setBase(Expr *E) { Base = E; } Expr *getBase() const { return cast<Expr>(Base); } @@ -1079,15 +1133,51 @@ public: /// \brief Retrieve the location of the '.' or '->' operator. SourceLocation getOperatorLoc() const { return OperatorLoc; } - /// \brief Retrieve the type that is being destroyed. - QualType getDestroyedType() const { return DestroyedType; } - - /// \brief Retrieve the location of the type being destroyed. - SourceLocation getDestroyedTypeLoc() const { return DestroyedTypeLoc; } - - virtual SourceRange getSourceRange() const { - return SourceRange(Base->getLocStart(), DestroyedTypeLoc); + /// \brief Retrieve the scope type in a qualified pseudo-destructor + /// expression. + /// + /// Pseudo-destructor expressions can have extra qualification within them + /// that is not part of the nested-name-specifier, e.g., \c p->T::~T(). + /// Here, if the object type of the expression is (or may be) a scalar type, + /// \p T may also be a scalar type and, therefore, cannot be part of a + /// nested-name-specifier. It is stored as the "scope type" of the pseudo- + /// destructor expression. + TypeSourceInfo *getScopeTypeInfo() const { return ScopeType; } + + /// \brief Retrieve the location of the '::' in a qualified pseudo-destructor + /// expression. + SourceLocation getColonColonLoc() const { return ColonColonLoc; } + + /// \brief Retrieve the location of the '~'. + SourceLocation getTildeLoc() const { return TildeLoc; } + + /// \brief Retrieve the source location information for the type + /// being destroyed. + /// + /// This type-source information is available for non-dependent + /// pseudo-destructor expressions and some dependent pseudo-destructor + /// expressions. Returns NULL if we only have the identifier for a + /// dependent pseudo-destructor expression. + TypeSourceInfo *getDestroyedTypeInfo() const { + return DestroyedType.getTypeSourceInfo(); } + + /// \brief In a dependent pseudo-destructor expression for which we do not + /// have full type information on the destroyed type, provides the name + /// of the destroyed type. + IdentifierInfo *getDestroyedTypeIdentifier() const { + return DestroyedType.getIdentifier(); + } + + /// \brief Retrieve the type being destroyed. + QualType getDestroyedType() const; + + /// \brief Retrieve the starting location of the type being destroyed. + SourceLocation getDestroyedTypeLoc() const { + return DestroyedType.getLocation(); + } + + virtual SourceRange getSourceRange() const; static bool classof(const Stmt *T) { return T->getStmtClass() == CXXPseudoDestructorExprClass; diff --git a/include/clang/AST/Type.h b/include/clang/AST/Type.h index 40e50988e6d2..bd8a6bc8467c 100644 --- a/include/clang/AST/Type.h +++ b/include/clang/AST/Type.h @@ -90,9 +90,13 @@ namespace clang { class TemplateArgument; class TemplateArgumentLoc; class TemplateArgumentListInfo; + class Type; class QualifiedNameType; struct PrintingPolicy; + template <typename> class CanQual; + typedef CanQual<Type> CanQualType; + // Provide forward declarations for all of the *Type classes #define TYPE(Class, Base) class Class##Type; #include "clang/AST/TypeNodes.def" @@ -976,7 +980,10 @@ public: /// \brief Determine the linkage of this type. virtual Linkage getLinkage() const; - QualType getCanonicalTypeInternal() const { return CanonicalType; } + QualType getCanonicalTypeInternal() const { + return CanonicalType; + } + CanQualType getCanonicalTypeUnqualified() const; // in CanonicalType.h void dump() const; static bool classof(const Type *) { return true; } }; diff --git a/include/clang/AST/TypeNodes.def b/include/clang/AST/TypeNodes.def index 9cf2cb7bd773..8187caddc6aa 100644 --- a/include/clang/AST/TypeNodes.def +++ b/include/clang/AST/TypeNodes.def @@ -31,7 +31,11 @@ // type that is always dependent. Clients that do not need to deal // with uninstantiated C++ templates can ignore these types. // -// There is a fifth macro, independent of the others. Most clients +// NON_CANONICAL_UNLESS_DEPENDENT_TYPE(Class, Base) - A type that +// is non-canonical unless it is dependent. Defaults to TYPE because +// it is neither reliably dependent nor reliably non-canonical. +// +// There is a sixth macro, independent of the others. Most clients // will not need to use it. // // LEAF_TYPE(Class) - A type that never has inner types. Clients @@ -51,6 +55,10 @@ # define DEPENDENT_TYPE(Class, Base) TYPE(Class, Base) #endif +#ifndef NON_CANONICAL_UNLESS_DEPENDENT_TYPE +# define NON_CANONICAL_UNLESS_DEPENDENT_TYPE(Class, Base) TYPE(Class, Base) +#endif + TYPE(Builtin, Type) TYPE(Complex, Type) TYPE(Pointer, Type) @@ -72,16 +80,16 @@ TYPE(FunctionProto, FunctionType) TYPE(FunctionNoProto, FunctionType) DEPENDENT_TYPE(UnresolvedUsing, Type) NON_CANONICAL_TYPE(Typedef, Type) -NON_CANONICAL_TYPE(TypeOfExpr, Type) -NON_CANONICAL_TYPE(TypeOf, Type) -NON_CANONICAL_TYPE(Decltype, Type) +NON_CANONICAL_UNLESS_DEPENDENT_TYPE(TypeOfExpr, Type) +NON_CANONICAL_UNLESS_DEPENDENT_TYPE(TypeOf, Type) +NON_CANONICAL_UNLESS_DEPENDENT_TYPE(Decltype, Type) ABSTRACT_TYPE(Tag, Type) TYPE(Record, TagType) TYPE(Enum, TagType) NON_CANONICAL_TYPE(Elaborated, Type) DEPENDENT_TYPE(TemplateTypeParm, Type) NON_CANONICAL_TYPE(SubstTemplateTypeParm, Type) -TYPE(TemplateSpecialization, Type) +NON_CANONICAL_UNLESS_DEPENDENT_TYPE(TemplateSpecialization, Type) NON_CANONICAL_TYPE(QualifiedName, Type) DEPENDENT_TYPE(Typename, Type) TYPE(ObjCInterface, Type) @@ -101,6 +109,7 @@ LEAF_TYPE(TemplateTypeParm) #undef LEAF_TYPE #endif +#undef NON_CANONICAL_UNLESS_DEPENDENT_TYPE #undef DEPENDENT_TYPE #undef NON_CANONICAL_TYPE #undef ABSTRACT_TYPE diff --git a/include/clang/Analysis/Analyses/PrintfFormatString.h b/include/clang/Analysis/Analyses/PrintfFormatString.h index a4ad0b703708..e4f7c57061d4 100644 --- a/include/clang/Analysis/Analyses/PrintfFormatString.h +++ b/include/clang/Analysis/Analyses/PrintfFormatString.h @@ -75,11 +75,14 @@ public: VoidPtrArg, // 'p' OutIntPtrArg, // 'n' PercentArg, // '%' - // Objective-C specific specifiers. + // MacOS X unicode extensions. + CArg, // 'C' + UnicodeStrArg, // 'S' + // Objective-C specific specifiers. ObjCObjArg, // '@' - // GlibC specific specifiers. + // GlibC specific specifiers. PrintErrno, // 'm' - // Specifier ranges. + // Specifier ranges. IntArgBeg = dArg, IntArgEnd = iArg, UIntArgBeg = oArg, @@ -147,20 +150,27 @@ enum LengthModifier { class OptionalAmount { public: - enum HowSpecified { NotSpecified, Constant, Arg }; + enum HowSpecified { NotSpecified, Constant, Arg, Invalid }; - OptionalAmount(HowSpecified h, const char *st) - : start(st), hs(h), amt(0) {} + OptionalAmount(HowSpecified h, unsigned i, const char *st) + : start(st), hs(h), amt(i) {} - OptionalAmount() - : start(0), hs(NotSpecified), amt(0) {} + OptionalAmount(bool b = true) + : start(0), hs(b ? NotSpecified : Invalid), amt(0) {} - OptionalAmount(unsigned i, const char *st) - : start(st), hs(Constant), amt(i) {} + bool isInvalid() const { + return hs == Invalid; + } HowSpecified getHowSpecified() const { return hs; } + bool hasDataArgument() const { return hs == Arg; } + unsigned getArgIndex() const { + assert(hasDataArgument()); + return amt; + } + unsigned getConstantAmount() const { assert(hs == Constant); return amt; @@ -185,14 +195,19 @@ class FormatSpecifier { unsigned HasSpacePrefix : 1; unsigned HasAlternativeForm : 1; unsigned HasLeadingZeroes : 1; - unsigned flags : 5; + /// Positional arguments, an IEEE extension: + /// IEEE Std 1003.1, 2004 Edition + /// http://www.opengroup.org/onlinepubs/009695399/functions/printf.html + unsigned UsesPositionalArg : 1; + unsigned argIndex; ConversionSpecifier CS; OptionalAmount FieldWidth; OptionalAmount Precision; public: FormatSpecifier() : LM(None), IsLeftJustified(0), HasPlusPrefix(0), HasSpacePrefix(0), - HasAlternativeForm(0), HasLeadingZeroes(0) {} + HasAlternativeForm(0), HasLeadingZeroes(0), UsesPositionalArg(0), + argIndex(0) {} static FormatSpecifier Parse(const char *beg, const char *end); @@ -208,6 +223,17 @@ public: void setHasSpacePrefix() { HasSpacePrefix = 1; } void setHasAlternativeForm() { HasAlternativeForm = 1; } void setHasLeadingZeros() { HasLeadingZeroes = 1; } + void setUsesPositionalArg() { UsesPositionalArg = 1; } + + void setArgIndex(unsigned i) { + assert(CS.consumesDataArgument()); + argIndex = i; + } + + unsigned getArgIndex() const { + assert(CS.consumesDataArgument()); + return argIndex; + } // Methods for querying the format specifier. @@ -247,8 +273,11 @@ public: bool hasAlternativeForm() const { return (bool) HasAlternativeForm; } bool hasLeadingZeros() const { return (bool) HasLeadingZeroes; } bool hasSpacePrefix() const { return (bool) HasSpacePrefix; } + bool usesPositionalArg() const { return (bool) UsesPositionalArg; } }; +enum PositionContext { FieldWidthPos = 0, PrecisionPos = 1 }; + class FormatStringHandler { public: FormatStringHandler() {} @@ -259,10 +288,15 @@ public: virtual void HandleNullChar(const char *nullCharacter) {} - virtual void + virtual void HandleInvalidPosition(const char *startPos, unsigned posLen, + PositionContext p) {} + + virtual void HandleZeroPosition(const char *startPos, unsigned posLen) {} + + virtual bool HandleInvalidConversionSpecifier(const analyze_printf::FormatSpecifier &FS, const char *startSpecifier, - unsigned specifierLen) {} + unsigned specifierLen) { return true; } virtual bool HandleFormatSpecifier(const analyze_printf::FormatSpecifier &FS, const char *startSpecifier, diff --git a/include/clang/Analysis/Analyses/ReachableCode.h b/include/clang/Analysis/Analyses/ReachableCode.h new file mode 100644 index 000000000000..e0c84f97fd33 --- /dev/null +++ b/include/clang/Analysis/Analyses/ReachableCode.h @@ -0,0 +1,55 @@ +//===- ReachableCode.h -----------------------------------------*- C++ --*-===// +// +// The LLVM Compiler Infrastructure +// +// This file is distributed under the University of Illinois Open Source +// License. See LICENSE.TXT for details. +// +//===----------------------------------------------------------------------===// +// +// A flow-sensitive, path-insensitive analysis of unreachable code. +// +//===----------------------------------------------------------------------===// + +#ifndef LLVM_CLANG_REACHABLECODE_H +#define LLVM_CLANG_REACHABLECODE_H + +#include "clang/Basic/SourceLocation.h" + +//===----------------------------------------------------------------------===// +// Forward declarations. +//===----------------------------------------------------------------------===// + +namespace llvm { + class BitVector; +} + +namespace clang { + class AnalysisContext; + class CFGBlock; +} + +//===----------------------------------------------------------------------===// +// API. +//===----------------------------------------------------------------------===// + +namespace clang { +namespace reachable_code { + +class Callback { +public: + virtual ~Callback() {} + virtual void HandleUnreachable(SourceLocation L, SourceRange R1, + SourceRange R2) = 0; +}; + +/// ScanReachableFromBlock - Mark all blocks reachable from Start. +/// Returns the total number of blocks that were marked reachable. +unsigned ScanReachableFromBlock(const CFGBlock &Start, + llvm::BitVector &Reachable); + +void FindUnreachableCode(AnalysisContext &AC, Callback &CB); + +}} // end namespace clang::reachable_code + +#endif diff --git a/include/clang/Analysis/AnalysisContext.h b/include/clang/Analysis/AnalysisContext.h index ea4f5b20669c..bde441741227 100644 --- a/include/clang/Analysis/AnalysisContext.h +++ b/include/clang/Analysis/AnalysisContext.h @@ -110,6 +110,8 @@ public: const LocationContext *getParent() const { return Parent; } + bool isParentOf(const LocationContext *LC) const; + const Decl *getDecl() const { return getAnalysisContext()->getDecl(); } CFG *getCFG() const { return getAnalysisContext()->getCFG(); } diff --git a/include/clang/Analysis/CFG.h b/include/clang/Analysis/CFG.h index e87784fd85e1..528cf878031e 100644 --- a/include/clang/Analysis/CFG.h +++ b/include/clang/Analysis/CFG.h @@ -245,8 +245,6 @@ public: Stmt* getLabel() { return Label; } const Stmt* getLabel() const { return Label; } - void reverseStmts(); - unsigned getBlockID() const { return BlockID; } void dump(const CFG *cfg, const LangOptions &LO) const; diff --git a/include/clang/Analysis/ProgramPoint.h b/include/clang/Analysis/ProgramPoint.h index 332f9d384f0c..fb8d4d5ff53a 100644 --- a/include/clang/Analysis/ProgramPoint.h +++ b/include/clang/Analysis/ProgramPoint.h @@ -26,6 +26,7 @@ namespace clang { class LocationContext; +class FunctionDecl; class ProgramPoint { public: @@ -41,6 +42,8 @@ public: PostPurgeDeadSymbolsKind, PostStmtCustomKind, PostLValueKind, + CallEnterKind, + CallExitKind, MinPostStmtKind = PostStmtKind, MaxPostStmtKind = PostLValueKind }; @@ -308,6 +311,36 @@ public: } }; +class CallEnter : public StmtPoint { +public: + // CallEnter uses the caller's location context. + CallEnter(const Stmt *S, const FunctionDecl *fd, const LocationContext *L) + : StmtPoint(S, fd, CallEnterKind, L, 0) {} + + const Stmt *getCallExpr() const { + return static_cast<const Stmt *>(getData1()); + } + + const FunctionDecl *getCallee() const { + return static_cast<const FunctionDecl *>(getData2()); + } + + static bool classof(const ProgramPoint *Location) { + return Location->getKind() == CallEnterKind; + } +}; + +class CallExit : public StmtPoint { +public: + // CallExit uses the callee's location context. + CallExit(const Stmt *S, const LocationContext *L) + : StmtPoint(S, 0, CallExitKind, L, 0) {} + + static bool classof(const ProgramPoint *Location) { + return Location->getKind() == CallExitKind; + } +}; + } // end namespace clang diff --git a/include/clang/Analysis/Support/BumpVector.h b/include/clang/Analysis/Support/BumpVector.h index 48851d0f2637..c6c9eedcbf09 100644 --- a/include/clang/Analysis/Support/BumpVector.h +++ b/include/clang/Analysis/Support/BumpVector.h @@ -23,6 +23,7 @@ #include "llvm/Support/Allocator.h" #include "llvm/ADT/PointerIntPair.h" #include <algorithm> +#include <cstring> namespace clang { diff --git a/include/clang/Basic/Builtins.def b/include/clang/Basic/Builtins.def index 3251ec4b1f97..9442ac328700 100644 --- a/include/clang/Basic/Builtins.def +++ b/include/clang/Basic/Builtins.def @@ -317,7 +317,7 @@ BUILTIN(__builtin_frob_return_addr, "v*v*", "n") BUILTIN(__builtin_dwarf_cfa, "v*", "n") BUILTIN(__builtin_init_dwarf_reg_size_table, "vv*", "n") BUILTIN(__builtin_dwarf_sp_column, "Ui", "n") -BUILTIN(__builtin_extend_pointer, "iv*", "n") +BUILTIN(__builtin_extend_pointer, "ULLiv*", "n") // _Unwind_Word == uint64_t // GCC Object size checking builtins BUILTIN(__builtin_object_size, "zv*i", "n") diff --git a/include/clang/Basic/Diagnostic.h b/include/clang/Basic/Diagnostic.h index d2516f8695b8..d6c8797fc901 100644 --- a/include/clang/Basic/Diagnostic.h +++ b/include/clang/Basic/Diagnostic.h @@ -403,13 +403,6 @@ public: /// \brief Clear out the current diagnostic. void Clear() { CurDiagID = ~0U; } - /// Deserialize - Deserialize the first diagnostic within the memory - /// [Memory, MemoryEnd), producing a new diagnostic builder describing the - /// deserialized diagnostic. If the memory does not contain a - /// diagnostic, returns a diagnostic builder with no diagnostic ID. - DiagnosticBuilder Deserialize(FileManager &FM, SourceManager &SM, - const char *&Memory, const char *MemoryEnd); - private: /// getDiagnosticMappingInfo - Return the mapping info currently set for the /// specified builtin diagnostic. This returns the high bit encoding, or zero @@ -799,12 +792,54 @@ public: /// output buffer using the arguments stored in this diagnostic. void FormatDiagnostic(const char *DiagStr, const char *DiagEnd, llvm::SmallVectorImpl<char> &OutStr) const; +}; + +/** + * \brief Represents a diagnostic in a form that can be serialized and + * deserialized. + */ +class StoredDiagnostic { + Diagnostic::Level Level; + FullSourceLoc Loc; + std::string Message; + std::vector<SourceRange> Ranges; + std::vector<CodeModificationHint> FixIts; + +public: + StoredDiagnostic(); + StoredDiagnostic(Diagnostic::Level Level, const DiagnosticInfo &Info); + StoredDiagnostic(Diagnostic::Level Level, llvm::StringRef Message); + ~StoredDiagnostic(); + + /// \brief Evaluates true when this object stores a diagnostic. + operator bool() const { return Message.size() > 0; } + + Diagnostic::Level getLevel() const { return Level; } + const FullSourceLoc &getLocation() const { return Loc; } + llvm::StringRef getMessage() const { return Message; } + + typedef std::vector<SourceRange>::const_iterator range_iterator; + range_iterator range_begin() const { return Ranges.begin(); } + range_iterator range_end() const { return Ranges.end(); } + unsigned range_size() const { return Ranges.size(); } + + typedef std::vector<CodeModificationHint>::const_iterator fixit_iterator; + fixit_iterator fixit_begin() const { return FixIts.begin(); } + fixit_iterator fixit_end() const { return FixIts.end(); } + unsigned fixit_size() const { return FixIts.size(); } /// Serialize - Serialize the given diagnostic (with its diagnostic /// level) to the given stream. Serialization is a lossy operation, /// since the specific diagnostic ID and any macro-instantiation /// information is lost. - void Serialize(Diagnostic::Level DiagLevel, llvm::raw_ostream &OS) const; + void Serialize(llvm::raw_ostream &OS) const; + + /// Deserialize - Deserialize the first diagnostic within the memory + /// [Memory, MemoryEnd), producing a new diagnostic builder describing the + /// deserialized diagnostic. If the memory does not contain a + /// diagnostic, returns a diagnostic builder with no diagnostic ID. + static StoredDiagnostic Deserialize(FileManager &FM, SourceManager &SM, + const char *&Memory, const char *MemoryEnd); }; /// DiagnosticClient - This is an abstract interface implemented by clients of diff --git a/include/clang/Basic/DiagnosticASTKinds.td b/include/clang/Basic/DiagnosticASTKinds.td index b6c2b13895d6..cc89c7caec3c 100644 --- a/include/clang/Basic/DiagnosticASTKinds.td +++ b/include/clang/Basic/DiagnosticASTKinds.td @@ -53,6 +53,29 @@ def note_odr_number_of_bases : Note< "class has %0 base %plural{1:class|:classes}0">; def note_odr_enumerator : Note<"enumerator %0 with value %1 here">; def note_odr_missing_enumerator : Note<"no corresponding enumerator here">; - +def err_odr_ivar_type_inconsistent : Error< + "instance variable %0 declared with incompatible types in different " + "translation units (%1 vs. %2)">; +def err_odr_objc_superclass_inconsistent : Error< + "class %0 has incompatible superclasses">; +def note_odr_objc_superclass : Note<"inherits from superclass %0 here">; +def note_odr_objc_missing_superclass : Note<"no corresponding superclass here">; +def err_odr_objc_method_result_type_inconsistent : Error< + "%select{class|instance}0 method %1 has incompatible result types in " + "different translation units (%2 vs. %3)">; +def err_odr_objc_method_num_params_inconsistent : Error< + "%select{class|instance}0 method %1 has a different number of parameters in " + "different translation units (%2 vs. %3)">; +def err_odr_objc_method_param_type_inconsistent : Error< + "%select{class|instance}0 method %1 has a parameter with a different types " + "in different translation units (%2 vs. %3)">; +def err_odr_objc_method_variadic_inconsistent : Error< + "%select{class|instance}0 method %1 is variadic in one translation unit " + "and not variadic in another">; +def note_odr_objc_method_here : Note< + "%select{class|instance}0 method %1 also declared here">; +def err_odr_objc_property_type_inconsistent : Error< + "property %0 declared with incompatible types in different " + "translation units (%1 vs. %2)">; def err_unsupported_ast_node: Error<"cannot import unsupported AST node %0">; } diff --git a/include/clang/Basic/DiagnosticDriverKinds.td b/include/clang/Basic/DiagnosticDriverKinds.td index dc5ccfdf5202..9175bef60f1e 100644 --- a/include/clang/Basic/DiagnosticDriverKinds.td +++ b/include/clang/Basic/DiagnosticDriverKinds.td @@ -88,6 +88,8 @@ def warn_ignoring_ftabstop_value : Warning< def warn_drv_missing_resource_library : Warning< "missing resource library '%0', link may fail">; def warn_drv_conflicting_deployment_targets : Warning< - "conflicting deployment targets, both MACOSX_DEPLOYMENT_TARGET '%0' and IPHONEOS_DEPLOYMENT_TARGET '%1' are present in environment">; + "conflicting deployment targets, both MACOSX_DEPLOYMENT_TARGET '%0' and IPHONEOS_DEPLOYMENT_TARGET '%1' are present in environment">; +def warn_drv_treating_input_as_cxx : Warning< + "treating '%0' input as '%1' when in C++ mode, this behavior is deprecated">; } diff --git a/include/clang/Basic/DiagnosticFrontendKinds.td b/include/clang/Basic/DiagnosticFrontendKinds.td index 79147eac5f32..b77614bbefc0 100644 --- a/include/clang/Basic/DiagnosticFrontendKinds.td +++ b/include/clang/Basic/DiagnosticFrontendKinds.td @@ -82,7 +82,7 @@ def note_fixit_main_file_unchanged : Note< def warn_fixit_no_changes : Note< "FIX-IT detected errors it could not fix; no output will be generated">; -def err_fe_clang : Error<"error invoking%s: %s">, DefaultFatal; +def err_fe_invoking : Error<"error invoking%0: %1">, DefaultFatal; // PCH reader def err_relocatable_without_without_isysroot : Error< diff --git a/include/clang/Basic/DiagnosticGroups.td b/include/clang/Basic/DiagnosticGroups.td index 82f9eca12960..c3c0cf5d0c7c 100644 --- a/include/clang/Basic/DiagnosticGroups.td +++ b/include/clang/Basic/DiagnosticGroups.td @@ -18,11 +18,13 @@ def Implicit : DiagGroup<"implicit", [ -// Empty DiagGroups: these are recognized by clang but ignored. +// Empty DiagGroups are recognized by clang but ignored. def : DiagGroup<"address">; +def AddressOfTemporary : DiagGroup<"address-of-temporary">; def : DiagGroup<"aggregate-return">; def : DiagGroup<"attributes">; def : DiagGroup<"bad-function-cast">; +def BadLiteral : DiagGroup<"bad-literal">; def : DiagGroup<"c++-compat">; def : DiagGroup<"cast-align">; def : DiagGroup<"cast-qual">; @@ -119,7 +121,6 @@ def VectorConversions : DiagGroup<"vector-conversions">; // clang specific def VolatileRegisterVar : DiagGroup<"volatile-register-var">; def : DiagGroup<"write-strings">; def CharSubscript : DiagGroup<"char-subscripts">; -def ForceAlignArgPointer : DiagGroup<"force-align-arg-pointer">; // Aggregation warning settings. @@ -180,4 +181,4 @@ def : DiagGroup<"comments", [Comment]>; // -Wcomments = -Wcomment // A warning group for warnings that we want to have on by default in clang, // but which aren't on by default in GCC. def NonGCC : DiagGroup<"non-gcc", - [SignCompare, Conversion, ForceAlignArgPointer]>; + [SignCompare, Conversion, BadLiteral]>; diff --git a/include/clang/Basic/DiagnosticParseKinds.td b/include/clang/Basic/DiagnosticParseKinds.td index bc26c3b0dad9..fb80dccc6fb9 100644 --- a/include/clang/Basic/DiagnosticParseKinds.td +++ b/include/clang/Basic/DiagnosticParseKinds.td @@ -146,8 +146,6 @@ def err_missing_comma_before_ellipsis : Error< def err_unexpected_typedef_ident : Error< "unexpected type name %0: expected identifier">; def err_expected_class_name : Error<"expected class name">; -def err_destructor_class_name : Error< - "expected the class name after '~' to name a destructor">; def err_unspecified_vla_size_with_static : Error< "'static' may not be used with an unspecified variable length array size">; @@ -247,8 +245,10 @@ def err_expected_catch : Error<"expected catch">; def err_expected_lbrace_or_comma : Error<"expected '{' or ','">; def err_using_namespace_in_class : Error< "'using namespace' is not allowed in classes">; -def err_ident_in_pseudo_dtor_not_a_type : Error< - "identifier %0 in pseudo-destructor expression does not name a type">; +def err_destructor_tilde_identifier : Error< + "expected a class name after '~' to name a destructor">; +def err_destructor_template_id : Error< + "destructor name %0 does not refer to a template">; // C++ derived classes def err_dup_virtual : Error<"duplicate 'virtual' in base specifier">; @@ -300,6 +300,7 @@ def err_explicit_instantiation_with_definition : Error< "explicit template instantiation cannot have a definition; if this " "definition is meant to be an explicit specialization, add '<>' after the " "'template' keyword">; +def err_enum_template : Error<"enumeration cannot be a template">; // Constructor template diagnostics. def err_out_of_line_constructor_template_id : Error< diff --git a/include/clang/Basic/DiagnosticSemaKinds.td b/include/clang/Basic/DiagnosticSemaKinds.td index 19b242e86b69..9f77655052eb 100644 --- a/include/clang/Basic/DiagnosticSemaKinds.td +++ b/include/clang/Basic/DiagnosticSemaKinds.td @@ -29,10 +29,12 @@ def ext_null_pointer_expr_not_ice : Extension< // Semantic analysis of constant literals. def ext_predef_outside_function : Warning< "predefined identifier is only valid inside function">; -def err_float_overflow : Error< - "magnitude of floating-point constant too large for type %0; maximum is %1">; -def err_float_underflow : Error< - "magnitude of floating-point constant too small for type %0; minimum is %1">; +def warn_float_overflow : Warning< + "magnitude of floating-point constant too large for type %0; maximum is %1">, + InGroup<BadLiteral>; +def warn_float_underflow : Warning< + "magnitude of floating-point constant too small for type %0; minimum is %1">, + InGroup<BadLiteral>; // C99 Designated Initializers def err_array_designator_negative : Error< @@ -253,6 +255,12 @@ def err_dup_implementation_category : Error< "reimplementation of category %1 for class %0">; def err_conflicting_ivar_type : Error< "instance variable %0 has conflicting type: %1 vs %2">; +def err_duplicate_ivar_declaration : Error< + "instance variable is already declared">; +def warn_on_superclass_use : Warning< + "class implementation may not have super class">; +def err_non_private_ivar_declaration : Error< + "only private ivars may be declared in implementation">; def err_conflicting_ivar_bitwidth : Error< "instance variable %0 has conflicting bit-field width">; def err_conflicting_ivar_name : Error< @@ -447,6 +455,8 @@ def err_qualified_member_nonclass : Error< "qualified member access refers to a member in %0">; def err_incomplete_member_access : Error< "member access into incomplete type %0">; +def err_incomplete_type : Error< + "incomplete type %0 where a complete type is required">; // C++ class members def err_storageclass_invalid_for_member : Error< @@ -486,8 +496,7 @@ def err_implicit_object_parameter_init : Error< def note_field_decl : Note<"member is declared here">; def note_bitfield_decl : Note<"bit-field is declared here">; -def note_previous_decl : Note< - "%0 declared here">; +def note_previous_decl : Note<"%0 declared here">; def note_member_synthesized_at : Note< "implicit default %select{constructor|copy constructor|" "copy assignment operator|destructor}0 for %1 first required here">; @@ -557,6 +566,10 @@ def err_destructor_typedef_name : Error< "destructor cannot be declared using a typedef %0 of the class name">; def err_destructor_name : Error< "expected the class name after '~' to name the enclosing class">; +def err_destructor_class_name : Error< + "expected the class name after '~' to name a destructor">; +def err_ident_in_pseudo_dtor_not_a_type : Error< + "identifier %0 in pseudo-destructor expression does not name a type">; // C++ initialization def err_init_conversion_failed : Error< @@ -724,9 +737,6 @@ def err_attribute_aligned_not_power_of_two : Error< def warn_redeclaration_without_attribute_prev_attribute_ignored : Warning< "'%0' redeclared without %1 attribute: previous %1 ignored">; def warn_attribute_ignored : Warning<"%0 attribute ignored">; -def warn_faap_attribute_ignored : Warning< - "force_align_arg_pointer used on function pointer; attribute ignored">, - InGroup<ForceAlignArgPointer>; def warn_attribute_precede_definition : Warning< "attribute declaration must precede definition">; def warn_attribute_void_function : Warning< @@ -741,6 +751,12 @@ def err_attribute_weak_static : Error< "weak declaration of '%0' must be public">; def warn_attribute_weak_import_invalid_on_definition : Warning< "'weak_import' attribute cannot be specified on a definition">; +def err_attribute_weakref_not_static : Error< + "weakref declaration of '%0' must be static">; +def err_attribute_weakref_not_global_context : Error< + "weakref declaration of '%0' must be in a global context">; +def err_attribute_weakref_without_alias : Error< + "weakref declaration of '%0' must also have an alias attribute">; def warn_attribute_wrong_decl_type : Warning< "%0 attribute only applies to %select{function|union|" "variable and function|function or method|parameter|" @@ -846,8 +862,10 @@ def err_attribute_regparm_invalid_number : Error< // Clang-Specific Attributes def err_attribute_iboutlet : Error< - "'iboutlet' attribute can only be applied to instance variables or " + "iboutlet attribute can only be applied to instance variables or " "properties">; +def err_attribute_ibaction: Error< + "ibaction attribute can only be applied to Objective-C instance methods">; def err_attribute_overloadable_not_function : Error< "'overloadable' attribute can only be applied to a function">; def err_attribute_overloadable_missing : Error< @@ -1482,6 +1500,8 @@ def err_forward_ref_enum : Error< "ISO C++ forbids forward references to 'enum' types">; def err_redefinition_of_enumerator : Error<"redefinition of enumerator %0">; def err_duplicate_member : Error<"duplicate member %0">; +def err_misplaced_ivar : Error<"ivar may be placed in a class extension " + "in non-fragile-abi2 mode only">; def ext_enum_value_not_int : Extension< "ISO C restricts enumerator values to range of 'int' (%0 is too " "%select{small|large}1)">; @@ -1572,6 +1592,8 @@ def err_indirect_goto_in_protected_scope : Error< def err_addr_of_label_in_protected_scope : Error< "address taken of label in protected scope, jump to it would have " "unknown effect on scope">; +def note_protected_by_variable_init : Note< + "jump bypasses variable initialization">; def note_protected_by_vla_typedef : Note< "jump bypasses initialization of VLA typedef">; def note_protected_by_vla : Note< @@ -1761,7 +1783,8 @@ def err_typecheck_incomplete_array_needs_initializer : Error< def err_array_init_not_init_list : Error< "array initializer must be an initializer " "list%select{| or string literal}0">; - +def warn_deprecated_string_literal_conversion : Warning< + "conversion from string literal to %0 is deprecated">; def err_realimag_invalid_type : Error<"invalid type %0 to %1 operator">; def err_typecheck_sclass_fscope : Error< "illegal storage class on file-scoped variable">; @@ -1777,6 +1800,11 @@ def err_unqualified_pointer_member_function : Error< "must explicitly qualify member function %0 when taking its address">; def err_typecheck_invalid_lvalue_addrof : Error< "address expression must be an lvalue or a function designator">; +def ext_typecheck_addrof_class_temporary : ExtWarn< + "taking the address of a temporary object of type %0">, + InGroup<DiagGroup<"address-of-temporary">>, DefaultError; +def err_typecheck_addrof_class_temporary : Error< + "taking the address of a temporary object of type %0">; def err_typecheck_unary_expr : Error< "invalid argument type %0 to unary expression">; def err_typecheck_indirection_requires_pointer : Error< @@ -1807,6 +1835,9 @@ def ext_typecheck_cond_incompatible_operands : ExtWarn< "incompatible operand types (%0 and %1)">; def err_typecheck_comparison_of_distinct_pointers : Error< "comparison of distinct pointer types (%0 and %1)">; +def ext_typecheck_comparison_of_distinct_pointers_nonstandard : ExtWarn< + "comparison of distinct pointer types (%0 and %1) uses non-standard " + "composite pointer type %2">; def err_typecheck_vector_comparison : Error< "comparison of vector types (%0 and %1) not supported yet">; def err_typecheck_assign_const : Error<"read-only variable is not assignable">; @@ -1992,6 +2023,9 @@ def err_new_array_nonconst : Error< "only the first dimension of an allocated array may have dynamic size">; def err_new_paren_array_nonconst : Error< "when type is in parentheses, array cannot have dynamic size">; +def err_placement_new_non_placement_delete : Error< + "'new' expression with placement arguments refers to non-placement " + "'operator delete'">; def err_array_size_not_integral : Error< "array size expression must have integral or enumerated type, not %0">; def err_default_init_const : Error< @@ -2057,7 +2091,12 @@ def err_pseudo_dtor_call_with_args : Error< def err_dtor_expr_without_call : Error< "%select{destructor reference|pseudo-destructor expression}0 must be " "called immediately with '()'">; - +def err_pseudo_dtor_destructor_non_type : Error< + "%0 does not refer to a type name in pseudo-destructor expression; expected " + "the name of type %1">; +def err_pseudo_dtor_template : Error< + "specialization of template %0 does not refer to a scalar type in pseudo-" + "destructor expression">; def err_invalid_use_of_function_type : Error< "a function type is not allowed here">; def err_invalid_use_of_array_type : Error<"an array type is not allowed here">; @@ -2226,6 +2265,9 @@ def err_typecheck_expect_scalar_operand : Error< "operand of type %0 where arithmetic or pointer type is required">; def err_typecheck_cond_incompatible_operands : Error< "incompatible operand types (%0 and %1)">; +def ext_typecheck_cond_incompatible_operands_nonstandard : ExtWarn< + "incompatible operand types (%0 and %1) use non-standard composite pointer " + "type %2">; def err_cast_selector_expr : Error< "cannot type cast @selector expression">; def warn_typecheck_cond_incompatible_pointers : ExtWarn< @@ -2486,8 +2528,8 @@ def warn_printf_write_back : Warning< InGroup<FormatSecurity>; def warn_printf_insufficient_data_args : Warning< "more '%%' conversions than data arguments">, InGroup<Format>; -def warn_printf_too_many_data_args : Warning< - "more data arguments than format specifiers">, InGroup<FormatExtraArgs>; +def warn_printf_data_arg_not_used : Warning< + "data argument not used by format string">, InGroup<FormatExtraArgs>; def warn_printf_invalid_conversion : Warning< "invalid conversion specifier '%0'">, InGroup<Format>; def warn_printf_incomplete_specifier : Warning< @@ -2497,6 +2539,15 @@ def warn_printf_missing_format_string : Warning< def warn_printf_conversion_argument_type_mismatch : Warning< "conversion specifies type %0 but the argument has type %1">, InGroup<Format>; +def warn_printf_zero_positional_specifier : Warning< + "position arguments in format strings start counting at 1 (not 0)">, + InGroup<Format>; +def warn_printf_invalid_positional_specifier : Warning< + "invalid position specified for %select{field width|field precision}0">, + InGroup<Format>; +def warn_printf_mix_positional_nonpositional_args : Warning< + "cannot mix positional and non-positional arguments in format string">, + InGroup<Format>; def warn_null_arg : Warning< "null passed to a callee which requires a non-null argument">, InGroup<NonNull>; @@ -2506,15 +2557,10 @@ def warn_printf_format_string_is_wide_literal : Warning< "format string should not be a wide string">, InGroup<Format>; def warn_printf_format_string_contains_null_char : Warning< "format string contains '\\0' within the string body">, InGroup<Format>; -def warn_printf_asterisk_width_missing_arg : Warning< - "'*' specified field width is missing a matching 'int' argument">; -def warn_printf_asterisk_precision_missing_arg : Warning< - "'.*' specified field precision is missing a matching 'int' argument">; -def warn_printf_asterisk_width_wrong_type : Warning< - "field width should have type %0, but argument has type %1">, - InGroup<Format>; -def warn_printf_asterisk_precision_wrong_type : Warning< - "field precision should have type %0, but argument has type %1">, +def warn_printf_asterisk_missing_arg : Warning< + "'%select{*|.*}0' specified field %select{width|precision}0 is missing a matching 'int' argument">; +def warn_printf_asterisk_wrong_type : Warning< + "field %select{width|precision}0 should have type %1, but argument has type %2">, InGroup<Format>; def warn_printf_nonsensical_precision: Warning< "precision used in '%0' conversion specifier (where it has no meaning)">, @@ -2571,7 +2617,8 @@ def err_case_not_in_switch : Error<"'case' statement not in switch statement">; def warn_bool_switch_condition : Warning< "switch condition is a bool">; def warn_case_value_overflow : Warning< - "overflow converting case value to switch condition type (%0 to %1)">; + "overflow converting case value to switch condition type (%0 to %1)">, + InGroup<DiagGroup<"switch">>; def err_duplicate_case : Error<"duplicate case value '%0'">; def warn_case_empty_range : Warning<"empty case range specified">; def warn_missing_cases : Warning<"enumeration value %0 not handled in switch">, @@ -2695,6 +2742,8 @@ def ext_c99_array_usage : Extension< def err_c99_array_usage_cxx : Error< "C99-specific array features are not permitted in C++">; +def note_getter_unavailable : Note< + "or because setter is declared here, but no getter method %0 is found">; def err_invalid_protocol_qualifiers : Error< "invalid protocol qualifiers on non-ObjC type">; def warn_ivar_use_hidden : Warning< diff --git a/include/clang/Basic/LangOptions.h b/include/clang/Basic/LangOptions.h index d909f83e74d5..23e6efe8bd70 100644 --- a/include/clang/Basic/LangOptions.h +++ b/include/clang/Basic/LangOptions.h @@ -59,7 +59,6 @@ public: unsigned POSIXThreads : 1; // Compiling with POSIX thread support // (-pthread) unsigned Blocks : 1; // block extension to C - unsigned BlockIntrospection: 1; // block have ObjC type encodings. unsigned EmitAllDecls : 1; // Emit all declarations, even if // they are unused. unsigned MathErrno : 1; // Math functions must respect errno @@ -143,7 +142,6 @@ public: ThreadsafeStatics = 1; POSIXThreads = 0; Blocks = 0; - BlockIntrospection = 0; EmitAllDecls = 0; MathErrno = 1; @@ -156,7 +154,7 @@ public: OverflowChecking = 0; ObjCGCBitmapPrint = 0; - InstantiationDepth = 99; + InstantiationDepth = 500; Optimize = 0; OptimizeSize = 0; diff --git a/include/clang/Basic/OnDiskHashTable.h b/include/clang/Basic/OnDiskHashTable.h index 9b50e8df02b9..2019e27ce5de 100644 --- a/include/clang/Basic/OnDiskHashTable.h +++ b/include/clang/Basic/OnDiskHashTable.h @@ -38,6 +38,13 @@ inline void Emit16(llvm::raw_ostream& Out, uint32_t V) { assert((V >> 16) == 0); } +inline void Emit24(llvm::raw_ostream& Out, uint32_t V) { + Out << (unsigned char)(V); + Out << (unsigned char)(V >> 8); + Out << (unsigned char)(V >> 16); + assert((V >> 24) == 0); +} + inline void Emit32(llvm::raw_ostream& Out, uint32_t V) { Out << (unsigned char)(V); Out << (unsigned char)(V >> 8); diff --git a/include/clang/Checker/PathSensitive/Checker.h b/include/clang/Checker/PathSensitive/Checker.h index d498044b82ca..2401a72741b2 100644 --- a/include/clang/Checker/PathSensitive/Checker.h +++ b/include/clang/Checker/PathSensitive/Checker.h @@ -147,12 +147,22 @@ public: void addTransition(const GRState *state) { assert(state); + // If the 'state' is not new, we need to check if the cached state 'ST' + // is new. if (state != getState() || (ST && ST != B.GetState(Pred))) GenerateNode(state, true); else Dst.Add(Pred); } + // Generate a node with a new program point different from the one that will + // be created by the GRStmtNodeBuilder. + void addTransition(const GRState *state, ProgramPoint Loc) { + ExplodedNode *N = B.generateNode(Loc, state, Pred); + if (N) + addTransition(N); + } + void EmitReport(BugReport *R) { Eng.getBugReporter().EmitReport(R); } diff --git a/include/clang/Checker/PathSensitive/GRCoreEngine.h b/include/clang/Checker/PathSensitive/GRCoreEngine.h index 6da45815f996..c5bf5138a63f 100644 --- a/include/clang/Checker/PathSensitive/GRCoreEngine.h +++ b/include/clang/Checker/PathSensitive/GRCoreEngine.h @@ -40,6 +40,8 @@ class GRCoreEngine { friend class GRIndirectGotoNodeBuilder; friend class GRSwitchNodeBuilder; friend class GREndPathNodeBuilder; + friend class GRCallEnterNodeBuilder; + friend class GRCallExitNodeBuilder; GRSubEngine& SubEngine; @@ -67,6 +69,9 @@ class GRCoreEngine { void HandleBranch(Stmt* Cond, Stmt* Term, CFGBlock* B, ExplodedNode* Pred); + void HandleCallEnter(const CallEnter &L, const CFGBlock *Block, + unsigned Index, ExplodedNode *Pred); + void HandleCallExit(const CallExit &L, ExplodedNode *Pred); /// Get the initial state from the subengine. const GRState* getInitialState(const LocationContext *InitLoc) { @@ -90,6 +95,9 @@ class GRCoreEngine { void ProcessSwitch(GRSwitchNodeBuilder& Builder); + void ProcessCallEnter(GRCallEnterNodeBuilder &Builder); + void ProcessCallExit(GRCallExitNodeBuilder &Builder); + private: GRCoreEngine(const GRCoreEngine&); // Do not implement. GRCoreEngine& operator=(const GRCoreEngine&); @@ -130,7 +138,6 @@ class GRStmtNodeBuilder { CFGBlock& B; const unsigned Idx; ExplodedNode* Pred; - ExplodedNode* LastNode; GRStateManager& Mgr; GRAuditor* Auditor; @@ -157,10 +164,6 @@ public: ExplodedNode* getBasePredecessor() const { return Pred; } - ExplodedNode* getLastNode() const { - return LastNode ? (LastNode->isSink() ? NULL : LastNode) : NULL; - } - // FIXME: This should not be exposed. GRWorkList *getWorkList() { return Eng.WList; } @@ -194,6 +197,12 @@ public: return generateNode(S, St, Pred, PointKind); } + ExplodedNode *generateNode(const ProgramPoint &PP, const GRState* State, + ExplodedNode* Pred) { + HasGeneratedNode = true; + return generateNodeInternal(PP, State, Pred); + } + ExplodedNode* generateNodeInternal(const ProgramPoint &PP, const GRState* State, ExplodedNode* Pred); @@ -431,6 +440,8 @@ public: ExplodedNode* generateNode(const GRState* State, const void *tag = 0, ExplodedNode *P = 0); + void GenerateCallExitNode(const GRState *state); + CFGBlock* getBlock() const { return &B; } const GRState* getState() const { @@ -438,6 +449,60 @@ public: } }; +class GRCallEnterNodeBuilder { + GRCoreEngine &Eng; + + const ExplodedNode *Pred; + + // The call site. + const Stmt *CE; + + // The definition of callee. + const FunctionDecl *FD; + + // The parent block of the CallExpr. + const CFGBlock *Block; + + // The CFGBlock index of the CallExpr. + unsigned Index; + +public: + GRCallEnterNodeBuilder(GRCoreEngine &eng, const ExplodedNode *pred, + const Stmt *s, const FunctionDecl *fd, + const CFGBlock *blk, unsigned idx) + : Eng(eng), Pred(pred), CE(s), FD(fd), Block(blk), Index(idx) {} + + const GRState *getState() const { return Pred->getState(); } + + const LocationContext *getLocationContext() const { + return Pred->getLocationContext(); + } + + const Stmt *getCallExpr() const { return CE; } + + const FunctionDecl *getCallee() const { return FD; } + + const CFGBlock *getBlock() const { return Block; } + + unsigned getIndex() const { return Index; } + + void GenerateNode(const GRState *state, const LocationContext *LocCtx); +}; + +class GRCallExitNodeBuilder { + GRCoreEngine &Eng; + const ExplodedNode *Pred; + +public: + GRCallExitNodeBuilder(GRCoreEngine &eng, const ExplodedNode *pred) + : Eng(eng), Pred(pred) {} + + const ExplodedNode *getPredecessor() const { return Pred; } + + const GRState *getState() const { return Pred->getState(); } + + void GenerateNode(const GRState *state); +}; } // end clang namespace #endif diff --git a/include/clang/Checker/PathSensitive/GRExprEngine.h b/include/clang/Checker/PathSensitive/GRExprEngine.h index 90a2cd55972a..763bbcc9e1da 100644 --- a/include/clang/Checker/PathSensitive/GRExprEngine.h +++ b/include/clang/Checker/PathSensitive/GRExprEngine.h @@ -171,7 +171,13 @@ public: /// ProcessEndPath - Called by GRCoreEngine. Used to generate end-of-path /// nodes when the control reaches the end of a function. void ProcessEndPath(GREndPathNodeBuilder& builder); - + + // Generate the entry node of the callee. + void ProcessCallEnter(GRCallEnterNodeBuilder &builder); + + // Generate the first post callsite node. + void ProcessCallExit(GRCallExitNodeBuilder &builder); + /// EvalAssume - Callback function invoked by the ConstraintManager when /// making assumptions about state values. const GRState *ProcessAssume(const GRState *state, SVal cond, bool assumption); diff --git a/include/clang/Checker/PathSensitive/GRState.h b/include/clang/Checker/PathSensitive/GRState.h index 4e44697a272f..9194ee88a1a9 100644 --- a/include/clang/Checker/PathSensitive/GRState.h +++ b/include/clang/Checker/PathSensitive/GRState.h @@ -16,25 +16,24 @@ // FIXME: Reduce the number of includes. +#include "clang/AST/ASTContext.h" +#include "clang/AST/Decl.h" +#include "clang/AST/Expr.h" +#include "clang/Analysis/Analyses/LiveVariables.h" +#include "clang/Checker/PathSensitive/ConstraintManager.h" #include "clang/Checker/PathSensitive/Environment.h" +#include "clang/Checker/PathSensitive/GRCoreEngine.h" #include "clang/Checker/PathSensitive/Store.h" -#include "clang/Checker/PathSensitive/ConstraintManager.h" #include "clang/Checker/PathSensitive/ValueManager.h" -#include "clang/Checker/PathSensitive/GRCoreEngine.h" -#include "clang/AST/Expr.h" -#include "clang/AST/Decl.h" -#include "clang/AST/ASTContext.h" -#include "clang/Analysis/Analyses/LiveVariables.h" -#include "llvm/Support/Casting.h" -#include "llvm/System/DataTypes.h" #include "llvm/ADT/APSInt.h" +#include "llvm/ADT/DenseSet.h" #include "llvm/ADT/FoldingSet.h" #include "llvm/ADT/ImmutableMap.h" #include "llvm/ADT/SmallVector.h" -#include "llvm/ADT/DenseSet.h" #include "llvm/Support/Allocator.h" +#include "llvm/Support/Casting.h" #include "llvm/Support/raw_ostream.h" - +#include "llvm/System/DataTypes.h" #include <functional> namespace clang { @@ -77,16 +76,13 @@ public: typedef llvm::ImmutableMap<void*, void*> GenericDataMap; private: - void operator=(const GRState& R) const; + void operator=(const GRState& R) const; // Do not implement. friend class GRStateManager; GRStateManager *StateMgr; Environment Env; Store St; - - // FIXME: Make these private. -public: GenericDataMap GDM; public: diff --git a/include/clang/Checker/PathSensitive/GRSubEngine.h b/include/clang/Checker/PathSensitive/GRSubEngine.h index ce57c2c68b4b..f2cd0486e326 100644 --- a/include/clang/Checker/PathSensitive/GRSubEngine.h +++ b/include/clang/Checker/PathSensitive/GRSubEngine.h @@ -28,6 +28,8 @@ class GRBranchNodeBuilder; class GRIndirectGotoNodeBuilder; class GRSwitchNodeBuilder; class GREndPathNodeBuilder; +class GRCallEnterNodeBuilder; +class GRCallExitNodeBuilder; class LocationContext; class GRSubEngine { @@ -64,6 +66,12 @@ public: /// ProcessEndPath - Called by GRCoreEngine. Used to generate end-of-path /// nodes when the control reaches the end of a function. virtual void ProcessEndPath(GREndPathNodeBuilder& builder) = 0; + + // Generate the entry node of the callee. + virtual void ProcessCallEnter(GRCallEnterNodeBuilder &builder) = 0; + + // Generate the first post callsite node. + virtual void ProcessCallExit(GRCallExitNodeBuilder &builder) = 0; /// EvalAssume - Called by ConstraintManager. Used to call checker-specific /// logic for handling assumptions on symbolic values. diff --git a/include/clang/Checker/PathSensitive/MemRegion.h b/include/clang/Checker/PathSensitive/MemRegion.h index 12bc0b795685..be89d2a3eb88 100644 --- a/include/clang/Checker/PathSensitive/MemRegion.h +++ b/include/clang/Checker/PathSensitive/MemRegion.h @@ -428,7 +428,6 @@ public: /// which correspond to "code+data". The distinction is important, because /// like a closure a block captures the values of externally referenced /// variables. -/// BlockDataRegion - A region that represents code texts of blocks (closures). class BlockDataRegion : public SubRegion { friend class MemRegionManager; const BlockTextRegion *BC; @@ -798,11 +797,10 @@ class MemRegionManager { GlobalsSpaceRegion *globals; - const StackFrameContext *cachedStackLocalsFrame; - StackLocalsSpaceRegion *cachedStackLocalsRegion; - - const StackFrameContext *cachedStackArgumentsFrame; - StackArgumentsSpaceRegion *cachedStackArgumentsRegion; + llvm::DenseMap<const StackFrameContext *, StackLocalsSpaceRegion *> + StackLocalsSpaceRegions; + llvm::DenseMap<const StackFrameContext *, StackArgumentsSpaceRegion *> + StackArgumentsSpaceRegions; HeapSpaceRegion *heap; UnknownSpaceRegion *unknown; @@ -810,10 +808,7 @@ class MemRegionManager { public: MemRegionManager(ASTContext &c, llvm::BumpPtrAllocator& a) - : C(c), A(a), globals(0), - cachedStackLocalsFrame(0), cachedStackLocalsRegion(0), - cachedStackArgumentsFrame(0), cachedStackArgumentsRegion(0), - heap(0), unknown(0), code(0) {} + : C(c), A(a), globals(0), heap(0), unknown(0), code(0) {} ~MemRegionManager(); diff --git a/include/clang/Checker/PathSensitive/SymbolManager.h b/include/clang/Checker/PathSensitive/SymbolManager.h index 8eb319647953..d49f5e81c802 100644 --- a/include/clang/Checker/PathSensitive/SymbolManager.h +++ b/include/clang/Checker/PathSensitive/SymbolManager.h @@ -89,27 +89,23 @@ public: typedef const SymbolData* SymbolRef; +// A symbol representing the value of a MemRegion. class SymbolRegionValue : public SymbolData { - const MemRegion *R; - // We may cast the region to another type, so the expected type of the symbol - // may be different from the region's original type. - QualType T; + const TypedRegion *R; public: - SymbolRegionValue(SymbolID sym, const MemRegion *r, QualType t = QualType()) - : SymbolData(RegionValueKind, sym), R(r), T(t) {} + SymbolRegionValue(SymbolID sym, const TypedRegion *r) + : SymbolData(RegionValueKind, sym), R(r) {} - const MemRegion* getRegion() const { return R; } + const TypedRegion* getRegion() const { return R; } - static void Profile(llvm::FoldingSetNodeID& profile, const MemRegion* R, - QualType T) { + static void Profile(llvm::FoldingSetNodeID& profile, const TypedRegion* R) { profile.AddInteger((unsigned) RegionValueKind); profile.AddPointer(R); - T.Profile(profile); } virtual void Profile(llvm::FoldingSetNodeID& profile) { - Profile(profile, R, T); + Profile(profile, R); } void dumpToStream(llvm::raw_ostream &os) const; @@ -122,6 +118,7 @@ public: } }; +// A symbol representing the result of an expression. class SymbolConjured : public SymbolData { const Stmt* S; QualType T; @@ -161,6 +158,8 @@ public: } }; +// A symbol representing the value of a MemRegion whose parent region has +// symbolic value. class SymbolDerived : public SymbolData { SymbolRef parentSymbol; const TypedRegion *R; @@ -294,8 +293,8 @@ public: static bool canSymbolicate(QualType T); /// Make a unique symbol for MemRegion R according to its kind. - const SymbolRegionValue* getRegionValueSymbol(const MemRegion* R, - QualType T = QualType()); + const SymbolRegionValue* getRegionValueSymbol(const TypedRegion* R); + const SymbolConjured* getConjuredSymbol(const Stmt* E, QualType T, unsigned VisitCount, const void* SymbolTag = 0); diff --git a/include/clang/Checker/PathSensitive/ValueManager.h b/include/clang/Checker/PathSensitive/ValueManager.h index ea3af57ed3e4..f80ad421742f 100644 --- a/include/clang/Checker/PathSensitive/ValueManager.h +++ b/include/clang/Checker/PathSensitive/ValueManager.h @@ -94,8 +94,7 @@ public: DefinedOrUnknownSVal makeZeroVal(QualType T); /// getRegionValueSymbolVal - make a unique symbol for value of R. - DefinedOrUnknownSVal getRegionValueSymbolVal(const MemRegion *R, - QualType T = QualType()); + DefinedOrUnknownSVal getRegionValueSymbolVal(const TypedRegion *R); DefinedOrUnknownSVal getConjuredSymbolVal(const void *SymbolTag, const Expr *E, unsigned Count); diff --git a/include/clang/CodeGen/CodeGenOptions.h b/include/clang/CodeGen/CodeGenOptions.h index e1d4ad1b1cce..e0e0f779bf5a 100644 --- a/include/clang/CodeGen/CodeGenOptions.h +++ b/include/clang/CodeGen/CodeGenOptions.h @@ -53,6 +53,8 @@ public: unsigned UnwindTables : 1; /// Emit unwind tables. unsigned VerifyModule : 1; /// Control whether the module should be run /// through the LLVM Verifier. + unsigned CXXCtorDtorAliases: 1; /// Emit complete ctors/dtors as linker + /// aliases to base ctors when possible. /// The code model to use (-mcmodel). std::string CodeModel; @@ -101,6 +103,7 @@ public: UnrollLoops = 0; UnwindTables = 0; VerifyModule = 1; + CXXCtorDtorAliases = 0; Inlining = NoInlining; RelocationModel = "pic"; diff --git a/include/clang/Driver/CC1Options.td b/include/clang/Driver/CC1Options.td index 047363ea597b..7cd26ef04cc2 100644 --- a/include/clang/Driver/CC1Options.td +++ b/include/clang/Driver/CC1Options.td @@ -143,6 +143,8 @@ def mrelocation_model : Separate<"-mrelocation-model">, HelpText<"The relocation model to use">; def munwind_tables : Flag<"-munwind-tables">, HelpText<"Generate unwinding tables for all functions">; +def mconstructor_aliases : Flag<"-mconstructor-aliases">, + HelpText<"Emit complete constructors and destructors as aliases when possible">; def O : Joined<"-O">, HelpText<"Optimization level">; def Os : Flag<"-Os">, HelpText<"Optimize for size">; diff --git a/include/clang/Driver/Driver.h b/include/clang/Driver/Driver.h index 64f88ed98318..59c3946a2cb5 100644 --- a/include/clang/Driver/Driver.h +++ b/include/clang/Driver/Driver.h @@ -70,6 +70,9 @@ public: /// Default name for linked images (e.g., "a.out"). std::string DefaultImageName; + /// Driver title to use with help. + std::string DriverTitle; + /// Host information for the platform the driver is running as. This /// will generally be the actual host platform, but not always. const HostInfo *Host; @@ -137,6 +140,9 @@ public: void setCheckInputsExist(bool Value) { CheckInputsExist = Value; } + const std::string &getTitle() { return DriverTitle; } + void setTitle(std::string Value) { DriverTitle = Value; } + /// @} /// @name Primary Functionality /// @{ diff --git a/include/clang/Driver/Options.td b/include/clang/Driver/Options.td index 4693e5c1433c..b462a4d48ed5 100644 --- a/include/clang/Driver/Options.td +++ b/include/clang/Driver/Options.td @@ -235,7 +235,6 @@ def fastcp : Flag<"-fastcp">, Group<f_Group>; def fastf : Flag<"-fastf">, Group<f_Group>; def fast : Flag<"-fast">, Group<f_Group>; def fasynchronous_unwind_tables : Flag<"-fasynchronous-unwind-tables">, Group<f_Group>; -def fblock_introspection : Flag<"-fblock-introspection">, Group<f_Group>; def fblocks : Flag<"-fblocks">, Group<f_Group>; def fbootclasspath_EQ : Joined<"-fbootclasspath=">, Group<f_Group>; def fbuiltin_strcat : Flag<"-fbuiltin-strcat">, Group<f_Group>; @@ -445,7 +444,7 @@ def multiply__defined : Separate<"-multiply_defined">; def mwarn_nonportable_cfstrings : Flag<"-mwarn-nonportable-cfstrings">, Group<m_Group>; def m_Separate : Separate<"-m">, Group<m_Group>; def m_Joined : Joined<"-m">, Group<m_Group>; -def no_canonical_prefixes : Flag<"-no-canonical-prefixes">, Flags<[DriverOption, HelpHidden]>, +def no_canonical_prefixes : Flag<"-no-canonical-prefixes">, Flags<[HelpHidden]>, HelpText<"Use relative instead of canonical paths">; def no_cpp_precomp : Flag<"-no-cpp-precomp">; def no_integrated_as : Flag<"-no-integrated-as">, Flags<[DriverOption]>; diff --git a/include/clang/Driver/Types.h b/include/clang/Driver/Types.h index 3a343b385e7a..d93323016fe3 100644 --- a/include/clang/Driver/Types.h +++ b/include/clang/Driver/Types.h @@ -80,6 +80,10 @@ namespace types { /// getCompilationPhase - Return the \args N th compilation phase to /// be done for this type. phases::ID getCompilationPhase(ID Id, unsigned N); + + /// lookupCXXTypeForCType - Lookup CXX input type that corresponds to given + /// C type (used for clang++ emulation of g++ behaviour) + ID lookupCXXTypeForCType(ID Id); } // end namespace types } // end namespace driver diff --git a/include/clang/Frontend/ASTConsumers.h b/include/clang/Frontend/ASTConsumers.h index 7ec5063b5334..b5b09f536d6e 100644 --- a/include/clang/Frontend/ASTConsumers.h +++ b/include/clang/Frontend/ASTConsumers.h @@ -69,26 +69,6 @@ ASTConsumer *CreateObjCRewriter(const std::string &InFile, const LangOptions &LOpts, bool SilenceRewriteMacroWarning); -// LLVM code generator: uses the code generation backend to generate LLVM -// assembly. This runs optimizations depending on the CodeGenOptions -// parameter. The output depends on the Action parameter. -enum BackendAction { - Backend_EmitAssembly, // Emit native assembly files - Backend_EmitBC, // Emit LLVM bitcode files - Backend_EmitLL, // Emit human-readable LLVM assembly - Backend_EmitNothing, // Don't emit anything (benchmarking mode) - Backend_EmitObj // Emit native object files -}; -ASTConsumer *CreateBackendConsumer(BackendAction Action, - Diagnostic &Diags, - const LangOptions &Features, - const CodeGenOptions &CodeGenOpts, - const TargetOptions &TargetOpts, - bool TimePasses, - const std::string &ModuleID, - llvm::raw_ostream *OS, - llvm::LLVMContext& C); - /// CreateHTMLPrinter - Create an AST consumer which rewrites source code to /// HTML with syntax highlighting suitable for viewing in a web-browser. ASTConsumer *CreateHTMLPrinter(llvm::raw_ostream *OS, Preprocessor &PP, diff --git a/include/clang/Frontend/ASTUnit.h b/include/clang/Frontend/ASTUnit.h index f122dd954d3e..626a162371bd 100644 --- a/include/clang/Frontend/ASTUnit.h +++ b/include/clang/Frontend/ASTUnit.h @@ -18,6 +18,8 @@ #include "llvm/ADT/OwningPtr.h" #include "clang/Basic/FileManager.h" #include "clang/Index/ASTLocation.h" +#include "llvm/ADT/SmallVector.h" +#include "llvm/System/Path.h" #include <string> #include <vector> #include <cassert> @@ -51,7 +53,6 @@ class ASTUnit { llvm::OwningPtr<TargetInfo> Target; llvm::OwningPtr<Preprocessor> PP; llvm::OwningPtr<ASTContext> Ctx; - bool tempFile; /// Optional owned invocation, just used to make the invocation used in /// LoadFromCommandLine available. @@ -80,6 +81,14 @@ class ASTUnit { // Critical optimization when using clang_getCursor(). ASTLocation LastLoc; + /// \brief The set of diagnostics produced when creating this + /// translation unit. + llvm::SmallVector<StoredDiagnostic, 4> Diagnostics; + + /// \brief Temporary files that should be removed when the ASTUnit is + /// destroyed. + llvm::SmallVector<llvm::sys::Path, 4> TemporaryFiles; + ASTUnit(const ASTUnit&); // DO NOT IMPLEMENT ASTUnit &operator=(const ASTUnit &); // DO NOT IMPLEMENT @@ -104,8 +113,13 @@ public: const std::string &getOriginalSourceFileName(); const std::string &getPCHFileName(); - void unlinkTemporaryFile() { tempFile = true; } - + /// \brief Add a temporary file that the ASTUnit depends on. + /// + /// This file will be erased when the ASTUnit is destroyed. + void addTemporaryFile(const llvm::sys::Path &TempFile) { + TemporaryFiles.push_back(TempFile); + } + bool getOnlyLocalDecls() const { return OnlyLocalDecls; } void setLastASTLocation(ASTLocation ALoc) { LastLoc = ALoc; } @@ -120,6 +134,15 @@ public: return TopLevelDecls; } + // Retrieve the diagnostics associated with this AST + typedef const StoredDiagnostic * diag_iterator; + diag_iterator diag_begin() const { return Diagnostics.begin(); } + diag_iterator diag_end() const { return Diagnostics.end(); } + unsigned diag_size() const { return Diagnostics.size(); } + llvm::SmallVector<StoredDiagnostic, 4> &getDiagnostics() { + return Diagnostics; + } + /// \brief A mapping from a file name to the memory buffer that stores the /// remapped contents of that file. typedef std::pair<std::string, const llvm::MemoryBuffer *> RemappedFile; @@ -136,7 +159,8 @@ public: Diagnostic &Diags, bool OnlyLocalDecls = false, RemappedFile *RemappedFiles = 0, - unsigned NumRemappedFiles = 0); + unsigned NumRemappedFiles = 0, + bool CaptureDiagnostics = false); /// LoadFromCompilerInvocation - Create an ASTUnit from a source file, via a /// CompilerInvocation object. @@ -151,7 +175,8 @@ public: // shouldn't need to specify them at construction time. static ASTUnit *LoadFromCompilerInvocation(CompilerInvocation *CI, Diagnostic &Diags, - bool OnlyLocalDecls = false); + bool OnlyLocalDecls = false, + bool CaptureDiagnostics = false); /// LoadFromCommandLine - Create an ASTUnit from a vector of command line /// arguments, which must specify exactly one source file. @@ -173,7 +198,8 @@ public: llvm::StringRef ResourceFilesPath, bool OnlyLocalDecls = false, RemappedFile *RemappedFiles = 0, - unsigned NumRemappedFiles = 0); + unsigned NumRemappedFiles = 0, + bool CaptureDiagnostics = false); }; } // namespace clang diff --git a/include/clang/Frontend/CodeGenAction.h b/include/clang/Frontend/CodeGenAction.h new file mode 100644 index 000000000000..a1e3c42075b6 --- /dev/null +++ b/include/clang/Frontend/CodeGenAction.h @@ -0,0 +1,65 @@ +//===--- CodeGenAction.h - LLVM Code Generation Frontend Action -*- C++ -*-===// +// +// The LLVM Compiler Infrastructure +// +// This file is distributed under the University of Illinois Open Source +// License. See LICENSE.TXT for details. +// +//===----------------------------------------------------------------------===// + +#include "clang/Frontend/FrontendAction.h" +#include "llvm/ADT/OwningPtr.h" + +namespace llvm { + class Module; +} + +namespace clang { + +class CodeGenAction : public ASTFrontendAction { +private: + unsigned Act; + llvm::OwningPtr<llvm::Module> TheModule; + +protected: + CodeGenAction(unsigned _Act); + + virtual ASTConsumer *CreateASTConsumer(CompilerInstance &CI, + llvm::StringRef InFile); + + virtual void EndSourceFileAction(); + +public: + ~CodeGenAction(); + + /// takeModule - Take the generated LLVM module, for use after the action has + /// been run. The result may be null on failure. + llvm::Module *takeModule(); +}; + +class EmitAssemblyAction : public CodeGenAction { +public: + EmitAssemblyAction(); +}; + +class EmitBCAction : public CodeGenAction { +public: + EmitBCAction(); +}; + +class EmitLLVMAction : public CodeGenAction { +public: + EmitLLVMAction(); +}; + +class EmitLLVMOnlyAction : public CodeGenAction { +public: + EmitLLVMOnlyAction(); +}; + +class EmitObjAction : public CodeGenAction { +public: + EmitObjAction(); +}; + +} diff --git a/include/clang/Frontend/FrontendActions.h b/include/clang/Frontend/FrontendActions.h index cbb3508c8a76..5348e6b1ee9c 100644 --- a/include/clang/Frontend/FrontendActions.h +++ b/include/clang/Frontend/FrontendActions.h @@ -159,46 +159,6 @@ public: }; //===----------------------------------------------------------------------===// -// Code Gen AST Actions -//===----------------------------------------------------------------------===// - -class CodeGenAction : public ASTFrontendAction { -private: - unsigned Act; - -protected: - CodeGenAction(unsigned _Act); - - virtual ASTConsumer *CreateASTConsumer(CompilerInstance &CI, - llvm::StringRef InFile); -}; - -class EmitAssemblyAction : public CodeGenAction { -public: - EmitAssemblyAction(); -}; - -class EmitBCAction : public CodeGenAction { -public: - EmitBCAction(); -}; - -class EmitLLVMAction : public CodeGenAction { -public: - EmitLLVMAction(); -}; - -class EmitLLVMOnlyAction : public CodeGenAction { -public: - EmitLLVMOnlyAction(); -}; - -class EmitObjAction : public CodeGenAction { -public: - EmitObjAction(); -}; - -//===----------------------------------------------------------------------===// // Preprocessor Actions //===----------------------------------------------------------------------===// diff --git a/include/clang/Frontend/PCHBitCodes.h b/include/clang/Frontend/PCHBitCodes.h index e22d37ba34f5..d4014b307516 100644 --- a/include/clang/Frontend/PCHBitCodes.h +++ b/include/clang/Frontend/PCHBitCodes.h @@ -524,7 +524,9 @@ namespace clang { /// associates a declaration name with one or more declaration /// IDs. This data is used when performing qualified name lookup /// into a DeclContext via DeclContext::lookup. - DECL_CONTEXT_VISIBLE + DECL_CONTEXT_VISIBLE, + /// \brief A NamespaceDecl record. + DECL_NAMESPACE }; /// \brief Record codes for each kind of statement or expression. diff --git a/include/clang/Frontend/TextDiagnosticPrinter.h b/include/clang/Frontend/TextDiagnosticPrinter.h index d727e4800727..d09e51fd0184 100644 --- a/include/clang/Frontend/TextDiagnosticPrinter.h +++ b/include/clang/Frontend/TextDiagnosticPrinter.h @@ -37,11 +37,19 @@ class TextDiagnosticPrinter : public DiagnosticClient { unsigned LastCaretDiagnosticWasNote : 1; unsigned OwnsOutputStream : 1; + /// A string to prefix to error messages. + std::string Prefix; + public: TextDiagnosticPrinter(llvm::raw_ostream &os, const DiagnosticOptions &diags, bool OwnsOutputStream = false); virtual ~TextDiagnosticPrinter(); + /// setPrefix - Set the diagnostic printer prefix string, which will be + /// printed at the start of any diagnostics. If empty, no prefix string is + /// used. + void setPrefix(std::string Value) { Prefix = Value; } + void BeginSourceFile(const LangOptions &LO, const Preprocessor *PP) { LangOpts = &LO; } diff --git a/include/clang/Lex/Preprocessor.h b/include/clang/Lex/Preprocessor.h index dedbbd868a99..db9c884662ab 100644 --- a/include/clang/Lex/Preprocessor.h +++ b/include/clang/Lex/Preprocessor.h @@ -570,6 +570,12 @@ public: /// if an internal buffer is returned. unsigned getSpelling(const Token &Tok, const char *&Buffer) const; + /// getSpelling - This method is used to get the spelling of a token into a + /// SmallVector. Note that the returned StringRef may not point to the + /// supplied buffer if a copy can be avoided. + llvm::StringRef getSpelling(const Token &Tok, + llvm::SmallVectorImpl<char> &Buffer) const; + /// getSpellingOfSingleCharacterNumericConstant - Tok is a numeric constant /// with length 1, return the character. char getSpellingOfSingleCharacterNumericConstant(const Token &Tok) const { diff --git a/include/clang/Parse/Action.h b/include/clang/Parse/Action.h index ec542f08c303..f211b5ca3a69 100644 --- a/include/clang/Parse/Action.h +++ b/include/clang/Parse/Action.h @@ -327,13 +327,26 @@ public: return false; } + /// \brief Determine whether the given name refers to a non-type nested name + /// specifier, e.g., the name of a namespace or namespace alias. + /// + /// This actual is used in the parsing of pseudo-destructor names to + /// distinguish a nested-name-specifier and a "type-name ::" when we + /// see the token sequence "X :: ~". + virtual bool isNonTypeNestedNameSpecifier(Scope *S, const CXXScopeSpec &SS, + SourceLocation IdLoc, + IdentifierInfo &II, + TypeTy *ObjectType) { + return false; + } + /// ActOnCXXGlobalScopeSpecifier - Return the object that represents the /// global scope ('::'). virtual CXXScopeTy *ActOnCXXGlobalScopeSpecifier(Scope *S, SourceLocation CCLoc) { return 0; } - + /// \brief Parsed an identifier followed by '::' in a C++ /// nested-name-specifier. /// @@ -490,6 +503,12 @@ public: return; } + /// \brief Note that the given declaration had an initializer that could not + /// be parsed. + virtual void ActOnInitializerError(DeclPtrTy Dcl) { + return; + } + /// FinalizeDeclaratorGroup - After a sequence of declarators are parsed, this /// gives the actions implementation a chance to process the group as a whole. virtual DeclGroupPtrTy FinalizeDeclaratorGroup(Scope *S, const DeclSpec& DS, @@ -1075,7 +1094,7 @@ public: SourceLocation RLoc) { return ExprEmpty(); } - + /// \brief Parsed a member access expresion (C99 6.5.2.3, C++ [expr.ref]) /// of the form \c x.m or \c p->m. /// @@ -1473,6 +1492,18 @@ public: //===------------------------- C++ Expressions --------------------------===// + /// \brief Parsed a destructor name or pseudo-destructor name. + /// + /// \returns the type being destructed. + virtual TypeTy *getDestructorName(SourceLocation TildeLoc, + IdentifierInfo &II, SourceLocation NameLoc, + Scope *S, const CXXScopeSpec &SS, + TypeTy *ObjectType, + bool EnteringContext) { + return getTypeName(II, NameLoc, S, &SS, false, ObjectType); + } + + /// ActOnCXXNamedCast - Parse {dynamic,static,reinterpret,const}_cast's. virtual OwningExprResult ActOnCXXNamedCast(SourceLocation OpLoc, tok::TokenKind Kind, @@ -1594,12 +1625,66 @@ public: /// with the type into which name lookup should look to find the member in /// the member access expression. /// + /// \param MayBePseudoDestructor Originally false. The action should + /// set this true if the expression may end up being a + /// pseudo-destructor expression, indicating to the parser that it + /// shoudl be parsed as a pseudo-destructor rather than as a member + /// access expression. Note that this should apply both when the + /// object type is a scalar and when the object type is dependent. + /// /// \returns the (possibly modified) \p Base expression virtual OwningExprResult ActOnStartCXXMemberReference(Scope *S, ExprArg Base, SourceLocation OpLoc, tok::TokenKind OpKind, - TypeTy *&ObjectType) { + TypeTy *&ObjectType, + bool &MayBePseudoDestructor) { + return ExprEmpty(); + } + + /// \brief Parsed a C++ pseudo-destructor expression or a dependent + /// member access expression that has the same syntactic form as a + /// pseudo-destructor expression. + /// + /// \param S The scope in which the member access expression occurs. + /// + /// \param Base The expression in which a member is being accessed, e.g., the + /// "x" in "x.f". + /// + /// \param OpLoc The location of the member access operator ("." or "->") + /// + /// \param OpKind The kind of member access operator ("." or "->") + /// + /// \param SS The nested-name-specifier that precedes the type names + /// in the grammar. Note that this nested-name-specifier will not + /// cover the last "type-name ::" in the grammar, because it isn't + /// necessarily a nested-name-specifier. + /// + /// \param FirstTypeName The type name that follows the optional + /// nested-name-specifier but precedes the '::', e.g., the first + /// type-name in "type-name :: type-name". This type name may be + /// empty. This will be either an identifier or a template-id. + /// + /// \param CCLoc The location of the '::' in "type-name :: + /// typename". May be invalid, if there is no \p FirstTypeName. + /// + /// \param TildeLoc The location of the '~'. + /// + /// \param SecondTypeName The type-name following the '~', which is + /// the name of the type being destroyed. This will be either an + /// identifier or a template-id. + /// + /// \param HasTrailingLParen Whether the next token in the stream is + /// a left parentheses. + virtual OwningExprResult ActOnPseudoDestructorExpr(Scope *S, ExprArg Base, + SourceLocation OpLoc, + tok::TokenKind OpKind, + const CXXScopeSpec &SS, + UnqualifiedId &FirstTypeName, + SourceLocation CCLoc, + SourceLocation TildeLoc, + UnqualifiedId &SecondTypeName, + bool HasTrailingLParen) { return ExprEmpty(); } diff --git a/include/clang/Parse/AttributeList.h b/include/clang/Parse/AttributeList.h index ecaa6aee470b..37acab9b019b 100644 --- a/include/clang/Parse/AttributeList.h +++ b/include/clang/Parse/AttributeList.h @@ -51,7 +51,8 @@ public: AttributeList *Next, bool declspec = false, bool cxx0x = false); ~AttributeList(); - enum Kind { // Please keep this list alphabetized. + enum Kind { // Please keep this list alphabetized. + AT_IBAction, // Clang-specific. AT_IBOutlet, // Clang-specific. AT_address_space, AT_alias, @@ -88,8 +89,10 @@ public: AT_nsobject, AT_objc_exception, AT_override, - AT_cf_returns_retained, // Clang-specific. - AT_ns_returns_retained, // Clang-specific. + AT_cf_returns_not_retained, // Clang-specific. + AT_cf_returns_retained, // Clang-specific. + AT_ns_returns_not_retained, // Clang-specific. + AT_ns_returns_retained, // Clang-specific. AT_objc_gc, AT_overloadable, // Clang-specific. AT_packed, @@ -106,6 +109,7 @@ public: AT_visibility, AT_warn_unused_result, AT_weak, + AT_weakref, AT_weak_import, AT_reqd_wg_size, IgnoredAttribute, diff --git a/include/clang/Parse/Parser.h b/include/clang/Parse/Parser.h index f4d3d3e54d51..f034aa10ce30 100644 --- a/include/clang/Parse/Parser.h +++ b/include/clang/Parse/Parser.h @@ -320,86 +320,39 @@ private: /// This returns true if the token was annotated. bool TryAnnotateTypeOrScopeToken(bool EnteringContext = false); - /// TryAnnotateCXXScopeToken - Like TryAnnotateTypeOrScopeToken but only - /// annotates C++ scope specifiers. This returns true if the token was - /// annotated. + /// TryAnnotateCXXScopeToken - Like TryAnnotateTypeOrScopeToken but + /// only annotates C++ scope specifiers. This returns true if there + /// was an unrecoverable error. bool TryAnnotateCXXScopeToken(bool EnteringContext = false); /// TryAltiVecToken - Check for context-sensitive AltiVec identifier tokens, /// replacing them with the non-context-sensitive keywords. This returns /// true if the token was replaced. bool TryAltiVecToken(DeclSpec &DS, SourceLocation Loc, - const char *&PrevSpec, unsigned &DiagID, bool &isInvalid) { - if (getLang().AltiVec) { - if (Tok.getIdentifierInfo() == Ident_vector) { - const Token nextToken = NextToken(); - switch (nextToken.getKind()) { - case tok::kw_short: - case tok::kw_long: - case tok::kw_signed: - case tok::kw_unsigned: - case tok::kw_void: - case tok::kw_char: - case tok::kw_int: - case tok::kw_float: - case tok::kw_double: - case tok::kw_bool: - case tok::kw___pixel: - isInvalid = DS.SetTypeAltiVecVector(true, Loc, PrevSpec, DiagID); - return true; - case tok::identifier: - if (nextToken.getIdentifierInfo() == Ident_pixel) { - isInvalid = DS.SetTypeAltiVecVector(true, Loc, PrevSpec, DiagID); - return true; - } - break; - default: - break; - } - } else if ((Tok.getIdentifierInfo() == Ident_pixel) && - DS.isTypeAltiVecVector()) { - isInvalid = DS.SetTypeAltiVecPixel(true, Loc, PrevSpec, DiagID); - return true; - } - } - return false; + const char *&PrevSpec, unsigned &DiagID, + bool &isInvalid) { + if (!getLang().AltiVec || + (Tok.getIdentifierInfo() != Ident_vector && + Tok.getIdentifierInfo() != Ident_pixel)) + return false; + + return TryAltiVecTokenOutOfLine(DS, Loc, PrevSpec, DiagID, isInvalid); } /// TryAltiVecVectorToken - Check for context-sensitive AltiVec vector /// identifier token, replacing it with the non-context-sensitive __vector. /// This returns true if the token was replaced. bool TryAltiVecVectorToken() { - if (getLang().AltiVec) { - if (Tok.getIdentifierInfo() == Ident_vector) { - const Token nextToken = NextToken(); - switch (nextToken.getKind()) { - case tok::kw_short: - case tok::kw_long: - case tok::kw_signed: - case tok::kw_unsigned: - case tok::kw_void: - case tok::kw_char: - case tok::kw_int: - case tok::kw_float: - case tok::kw_double: - case tok::kw_bool: - case tok::kw___pixel: - Tok.setKind(tok::kw___vector); - return true; - case tok::identifier: - if (nextToken.getIdentifierInfo() == Ident_pixel) { - Tok.setKind(tok::kw___vector); - return true; - } - break; - default: - break; - } - } - } - return false; + if (!getLang().AltiVec || + Tok.getIdentifierInfo() != Ident_vector) return false; + return TryAltiVecVectorTokenOutOfLine(); } - + + bool TryAltiVecVectorTokenOutOfLine(); + bool TryAltiVecTokenOutOfLine(DeclSpec &DS, SourceLocation Loc, + const char *&PrevSpec, unsigned &DiagID, + bool &isInvalid); + /// TentativeParsingAction - An object that is used as a kind of "tentative /// parsing transaction". It gets instantiated to mark the token position and /// after the token consumption is done, Commit() or Revert() is called to @@ -849,6 +802,7 @@ private: DeclPtrTy ParseObjCAtInterfaceDeclaration(SourceLocation atLoc, AttributeList *prefixAttrs = 0); void ParseObjCClassInstanceVariables(DeclPtrTy interfaceDecl, + tok::ObjCKeywordKind visibility, SourceLocation atLoc); bool ParseObjCProtocolReferences(llvm::SmallVectorImpl<Action::DeclPtrTy> &P, llvm::SmallVectorImpl<SourceLocation> &PLocs, @@ -962,7 +916,8 @@ private: bool ParseOptionalCXXScopeSpecifier(CXXScopeSpec &SS, TypeTy *ObjectType, - bool EnteringContext); + bool EnteringContext, + bool *MayBePseudoDestructor = 0); //===--------------------------------------------------------------------===// // C++ 5.2p1: C++ Casts @@ -973,6 +928,13 @@ private: OwningExprResult ParseCXXTypeid(); //===--------------------------------------------------------------------===// + // C++ 5.2.4: C++ Pseudo-Destructor Expressions + OwningExprResult ParseCXXPseudoDestructor(ExprArg Base, SourceLocation OpLoc, + tok::TokenKind OpKind, + CXXScopeSpec &SS, + Action::TypeTy *ObjectType); + + //===--------------------------------------------------------------------===// // C++ 9.3.2: C++ 'this' pointer OwningExprResult ParseCXXThis(); @@ -1153,7 +1115,7 @@ private: void ParseObjCTypeQualifierList(ObjCDeclSpec &DS); void ParseEnumSpecifier(SourceLocation TagLoc, DeclSpec &DS, - AccessSpecifier AS = AS_none); + const ParsedTemplateInfo &TemplateInfo = ParsedTemplateInfo(), AccessSpecifier AS = AS_none); void ParseEnumBody(SourceLocation StartLoc, DeclPtrTy TagDecl); void ParseStructUnionBody(SourceLocation StartLoc, unsigned TagType, DeclPtrTy TagDecl); @@ -1172,6 +1134,11 @@ private: bool isDeclarationSpecifier(); bool isTypeSpecifierQualifier(); bool isTypeQualifier() const; + + /// isKnownToBeTypeSpecifier - Return true if we know that the specified token + /// is definitely a type-specifier. Return false if it isn't part of a type + /// specifier or if we're not sure. + bool isKnownToBeTypeSpecifier(const Token &Tok) const; /// isDeclarationStatement - Disambiguates between a declaration or an /// expression statement, when parsing function bodies. @@ -1387,8 +1354,7 @@ private: //===--------------------------------------------------------------------===// // C++ 9: classes [class] and C structs/unions. TypeResult ParseClassName(SourceLocation &EndLocation, - const CXXScopeSpec *SS = 0, - bool DestrExpected = false); + const CXXScopeSpec *SS = 0); void ParseClassSpecifier(tok::TokenKind TagTokKind, SourceLocation TagLoc, DeclSpec &DS, const ParsedTemplateInfo &TemplateInfo = ParsedTemplateInfo(), @@ -1414,7 +1380,8 @@ private: SourceLocation NameLoc, bool EnteringContext, TypeTy *ObjectType, - UnqualifiedId &Id); + UnqualifiedId &Id, + bool AssumeTemplateId = false); bool ParseUnqualifiedIdOperator(CXXScopeSpec &SS, bool EnteringContext, TypeTy *ObjectType, UnqualifiedId &Result); diff --git a/include/clang/Parse/Scope.h b/include/clang/Parse/Scope.h index c6a1e53472c1..c9825f60c25c 100644 --- a/include/clang/Parse/Scope.h +++ b/include/clang/Parse/Scope.h @@ -129,6 +129,9 @@ private: typedef llvm::SmallVector<Action::DeclPtrTy, 2> UsingDirectivesTy; UsingDirectivesTy UsingDirectives; + /// \brief The number of errors at the start of the given scope. + unsigned NumErrorsAtStart; + public: Scope(Scope *Parent, unsigned ScopeFlags) { Init(Parent, ScopeFlags); @@ -208,6 +211,14 @@ public: void* getEntity() const { return Entity; } void setEntity(void *E) { Entity = E; } + /// \brief Retrieve the number of errors that had been emitted when we + /// entered this scope. + unsigned getNumErrorsAtStart() const { return NumErrorsAtStart; } + + void setNumErrorsAtStart(unsigned NumErrors) { + NumErrorsAtStart = NumErrors; + } + /// isClassScope - Return true if this scope is a class/struct/union scope. bool isClassScope() const { return (getFlags() & Scope::ClassScope); @@ -300,6 +311,7 @@ public: DeclsInScope.clear(); UsingDirectives.clear(); Entity = 0; + NumErrorsAtStart = 0; } }; diff --git a/lib/AST/ASTContext.cpp b/lib/AST/ASTContext.cpp index c23babb9a4a5..e091bf10b629 100644 --- a/lib/AST/ASTContext.cpp +++ b/lib/AST/ASTContext.cpp @@ -59,6 +59,12 @@ ASTContext::~ASTContext() { // Release the DenseMaps associated with DeclContext objects. // FIXME: Is this the ideal solution? ReleaseDeclContextMaps(); + + // Release all of the memory associated with overridden C++ methods. + for (llvm::DenseMap<const CXXMethodDecl *, CXXMethodVector>::iterator + OM = OverriddenMethods.begin(), OMEnd = OverriddenMethods.end(); + OM != OMEnd; ++OM) + OM->second.Destroy(); if (FreeMemory) { // Deallocate all the types. @@ -319,6 +325,80 @@ void ASTContext::setInstantiatedFromUnnamedFieldDecl(FieldDecl *Inst, InstantiatedFromUnnamedFieldDecl[Inst] = Tmpl; } +CXXMethodVector::iterator CXXMethodVector::begin() const { + if ((Storage & 0x01) == 0) + return reinterpret_cast<iterator>(&Storage); + + vector_type *Vec = reinterpret_cast<vector_type *>(Storage & ~0x01); + return &Vec->front(); +} + +CXXMethodVector::iterator CXXMethodVector::end() const { + if ((Storage & 0x01) == 0) { + if (Storage == 0) + return reinterpret_cast<iterator>(&Storage); + + return reinterpret_cast<iterator>(&Storage) + 1; + } + + vector_type *Vec = reinterpret_cast<vector_type *>(Storage & ~0x01); + return &Vec->front() + Vec->size(); +} + +void CXXMethodVector::push_back(const CXXMethodDecl *Method) { + if (Storage == 0) { + // 0 -> 1 element. + Storage = reinterpret_cast<uintptr_t>(Method); + return; + } + + vector_type *Vec; + if ((Storage & 0x01) == 0) { + // 1 -> 2 elements. Allocate a new vector and push the element into that + // vector. + Vec = new vector_type; + Vec->push_back(reinterpret_cast<const CXXMethodDecl *>(Storage)); + Storage = reinterpret_cast<uintptr_t>(Vec) | 0x01; + } else + Vec = reinterpret_cast<vector_type *>(Storage & ~0x01); + + // Add the new method to the vector. + Vec->push_back(Method); +} + +void CXXMethodVector::Destroy() { + if (Storage & 0x01) + delete reinterpret_cast<vector_type *>(Storage & ~0x01); + + Storage = 0; +} + + +ASTContext::overridden_cxx_method_iterator +ASTContext::overridden_methods_begin(const CXXMethodDecl *Method) const { + llvm::DenseMap<const CXXMethodDecl *, CXXMethodVector>::const_iterator Pos + = OverriddenMethods.find(Method); + if (Pos == OverriddenMethods.end()) + return 0; + + return Pos->second.begin(); +} + +ASTContext::overridden_cxx_method_iterator +ASTContext::overridden_methods_end(const CXXMethodDecl *Method) const { + llvm::DenseMap<const CXXMethodDecl *, CXXMethodVector>::const_iterator Pos + = OverriddenMethods.find(Method); + if (Pos == OverriddenMethods.end()) + return 0; + + return Pos->second.end(); +} + +void ASTContext::addOverriddenMethod(const CXXMethodDecl *Method, + const CXXMethodDecl *Overridden) { + OverriddenMethods[Method].push_back(Overridden); +} + namespace { class BeforeInTranslationUnit : std::binary_function<SourceRange, SourceRange, bool> { @@ -563,6 +643,12 @@ CharUnits ASTContext::getDeclAlign(const Decl *D, bool RefAsPointee) { Align = std::max(Align, getPreferredTypeAlign(T.getTypePtr())); } + if (const FieldDecl *FD = dyn_cast<FieldDecl>(VD)) { + // In the case of a field in a packed struct, we want the minimum + // of the alignment of the field and the alignment of the struct. + Align = std::min(Align, + getPreferredTypeAlign(FD->getParent()->getTypeForDecl())); + } } return CharUnits::fromQuantity(Align / Target.getCharWidth()); @@ -872,14 +958,13 @@ void ASTContext::CollectObjCIvars(const ObjCInterfaceDecl *OI, /// Collect all ivars, including those synthesized, in the current class. /// void ASTContext::ShallowCollectObjCIvars(const ObjCInterfaceDecl *OI, - llvm::SmallVectorImpl<ObjCIvarDecl*> &Ivars, - bool CollectSynthesized) { + llvm::SmallVectorImpl<ObjCIvarDecl*> &Ivars) { for (ObjCInterfaceDecl::ivar_iterator I = OI->ivar_begin(), E = OI->ivar_end(); I != E; ++I) { Ivars.push_back(*I); } - if (CollectSynthesized) - CollectSynthesizedIvars(OI, Ivars); + + CollectNonClassIvars(OI, Ivars); } void ASTContext::CollectProtocolSynthesizedIvars(const ObjCProtocolDecl *PD, @@ -895,11 +980,20 @@ void ASTContext::CollectProtocolSynthesizedIvars(const ObjCProtocolDecl *PD, CollectProtocolSynthesizedIvars(*P, Ivars); } -/// CollectSynthesizedIvars - -/// This routine collect synthesized ivars for the designated class. +/// CollectNonClassIvars - +/// This routine collects all other ivars which are not declared in the class. +/// This includes synthesized ivars and those in class's implementation. /// -void ASTContext::CollectSynthesizedIvars(const ObjCInterfaceDecl *OI, +void ASTContext::CollectNonClassIvars(const ObjCInterfaceDecl *OI, llvm::SmallVectorImpl<ObjCIvarDecl*> &Ivars) { + // Find ivars declared in class extension. + if (const ObjCCategoryDecl *CDecl = OI->getClassExtension()) { + for (ObjCCategoryDecl::ivar_iterator I = CDecl->ivar_begin(), + E = CDecl->ivar_end(); I != E; ++I) { + Ivars.push_back(*I); + } + } + for (ObjCInterfaceDecl::prop_iterator I = OI->prop_begin(), E = OI->prop_end(); I != E; ++I) { if (ObjCIvarDecl *Ivar = (*I)->getPropertyIvarDecl()) @@ -912,6 +1006,13 @@ void ASTContext::CollectSynthesizedIvars(const ObjCInterfaceDecl *OI, ObjCProtocolDecl *PD = (*P); CollectProtocolSynthesizedIvars(PD, Ivars); } + + // Also add any ivar defined in this class's implementation + if (ObjCImplementationDecl *ImplDecl = OI->getImplementation()) { + for (ObjCImplementationDecl::ivar_iterator I = ImplDecl->ivar_begin(), + E = ImplDecl->ivar_end(); I != E; ++I) + Ivars.push_back(*I); + } } /// CollectInheritedProtocols - Collect all protocols in current class and @@ -924,9 +1025,11 @@ void ASTContext::CollectInheritedProtocols(const Decl *CDecl, ObjCProtocolDecl *Proto = (*P); Protocols.insert(Proto); for (ObjCProtocolDecl::protocol_iterator P = Proto->protocol_begin(), - PE = Proto->protocol_end(); P != PE; ++P) + PE = Proto->protocol_end(); P != PE; ++P) { + Protocols.insert(*P); CollectInheritedProtocols(*P, Protocols); } + } // Categories of this Interface. for (const ObjCCategoryDecl *CDeclChain = OI->getCategoryList(); @@ -4401,7 +4504,8 @@ QualType ASTContext::mergeFunctionTypes(QualType lhs, QualType rhs) { if (allRTypes) return rhs; return getFunctionType(retType, proto->arg_type_begin(), proto->getNumArgs(), proto->isVariadic(), - proto->getTypeQuals(), NoReturn, lcc); + proto->getTypeQuals(), + false, false, 0, 0, NoReturn, lcc); } if (allLTypes) return lhs; @@ -4498,6 +4602,7 @@ QualType ASTContext::mergeTypes(QualType LHS, QualType RHS) { switch (LHSClass) { #define TYPE(Class, Base) #define ABSTRACT_TYPE(Class, Base) +#define NON_CANONICAL_UNLESS_DEPENDENT_TYPE(Class, Base) case Type::Class: #define NON_CANONICAL_TYPE(Class, Base) case Type::Class: #define DEPENDENT_TYPE(Class, Base) case Type::Class: #include "clang/AST/TypeNodes.def" @@ -4620,9 +4725,6 @@ QualType ASTContext::mergeTypes(QualType LHS, QualType RHS) { return QualType(); } - case Type::TemplateSpecialization: - assert(false && "Dependent types have no size"); - break; } return QualType(); @@ -4888,8 +4990,11 @@ QualType ASTContext::GetBuiltinType(unsigned id, // handle untyped/variadic arguments "T c99Style();" or "T cppStyle(...);". if (ArgTypes.size() == 0 && TypeStr[0] == '.') return getFunctionNoProtoType(ResType); + + // FIXME: Should we create noreturn types? return getFunctionType(ResType, ArgTypes.data(), ArgTypes.size(), - TypeStr[0] == '.', 0); + TypeStr[0] == '.', 0, false, false, 0, 0, + false, CC_Default); } QualType diff --git a/lib/AST/ASTImporter.cpp b/lib/AST/ASTImporter.cpp index dee0d2b342fc..2bcf07e70040 100644 --- a/lib/AST/ASTImporter.cpp +++ b/lib/AST/ASTImporter.cpp @@ -80,27 +80,49 @@ namespace { // Importing declarations bool ImportDeclParts(NamedDecl *D, DeclContext *&DC, DeclContext *&LexicalDC, DeclarationName &Name, - SourceLocation &Loc); + SourceLocation &Loc); + void ImportDeclContext(DeclContext *FromDC); bool IsStructuralMatch(RecordDecl *FromRecord, RecordDecl *ToRecord); bool IsStructuralMatch(EnumDecl *FromEnum, EnumDecl *ToRecord); Decl *VisitDecl(Decl *D); + Decl *VisitNamespaceDecl(NamespaceDecl *D); Decl *VisitTypedefDecl(TypedefDecl *D); Decl *VisitEnumDecl(EnumDecl *D); Decl *VisitRecordDecl(RecordDecl *D); Decl *VisitEnumConstantDecl(EnumConstantDecl *D); Decl *VisitFunctionDecl(FunctionDecl *D); + Decl *VisitCXXMethodDecl(CXXMethodDecl *D); + Decl *VisitCXXConstructorDecl(CXXConstructorDecl *D); + Decl *VisitCXXDestructorDecl(CXXDestructorDecl *D); + Decl *VisitCXXConversionDecl(CXXConversionDecl *D); Decl *VisitFieldDecl(FieldDecl *D); + Decl *VisitObjCIvarDecl(ObjCIvarDecl *D); Decl *VisitVarDecl(VarDecl *D); + Decl *VisitImplicitParamDecl(ImplicitParamDecl *D); Decl *VisitParmVarDecl(ParmVarDecl *D); + Decl *VisitObjCMethodDecl(ObjCMethodDecl *D); + Decl *VisitObjCCategoryDecl(ObjCCategoryDecl *D); + Decl *VisitObjCProtocolDecl(ObjCProtocolDecl *D); Decl *VisitObjCInterfaceDecl(ObjCInterfaceDecl *D); + Decl *VisitObjCPropertyDecl(ObjCPropertyDecl *D); + Decl *VisitObjCForwardProtocolDecl(ObjCForwardProtocolDecl *D); + Decl *VisitObjCClassDecl(ObjCClassDecl *D); // Importing statements Stmt *VisitStmt(Stmt *S); // Importing expressions Expr *VisitExpr(Expr *E); + Expr *VisitDeclRefExpr(DeclRefExpr *E); Expr *VisitIntegerLiteral(IntegerLiteral *E); + Expr *VisitCharacterLiteral(CharacterLiteral *E); + Expr *VisitParenExpr(ParenExpr *E); + Expr *VisitUnaryOperator(UnaryOperator *E); + Expr *VisitSizeOfAlignOfExpr(SizeOfAlignOfExpr *E); + Expr *VisitBinaryOperator(BinaryOperator *E); + Expr *VisitCompoundAssignOperator(CompoundAssignOperator *E); Expr *VisitImplicitCastExpr(ImplicitCastExpr *E); + Expr *VisitCStyleCastExpr(CStyleCastExpr *E); }; } @@ -421,6 +443,7 @@ static bool IsStructurallyEquivalent(StructuralEquivalenceContext &Context, return false; if (Vec1->isPixel() != Vec2->isPixel()) return false; + break; } case Type::FunctionProto: { @@ -1356,21 +1379,29 @@ bool ASTNodeImporter::ImportDeclParts(NamedDecl *D, DeclContext *&DC, return false; } +void ASTNodeImporter::ImportDeclContext(DeclContext *FromDC) { + for (DeclContext::decl_iterator From = FromDC->decls_begin(), + FromEnd = FromDC->decls_end(); + From != FromEnd; + ++From) + Importer.Import(*From); +} + bool ASTNodeImporter::IsStructuralMatch(RecordDecl *FromRecord, RecordDecl *ToRecord) { - StructuralEquivalenceContext SEC(Importer.getFromContext(), + StructuralEquivalenceContext Ctx(Importer.getFromContext(), Importer.getToContext(), Importer.getDiags(), Importer.getNonEquivalentDecls()); - return SEC.IsStructurallyEquivalent(FromRecord, ToRecord); + return Ctx.IsStructurallyEquivalent(FromRecord, ToRecord); } bool ASTNodeImporter::IsStructuralMatch(EnumDecl *FromEnum, EnumDecl *ToEnum) { - StructuralEquivalenceContext SEC(Importer.getFromContext(), + StructuralEquivalenceContext Ctx(Importer.getFromContext(), Importer.getToContext(), Importer.getDiags(), Importer.getNonEquivalentDecls()); - return SEC.IsStructurallyEquivalent(FromEnum, ToEnum); + return Ctx.IsStructurallyEquivalent(FromEnum, ToEnum); } Decl *ASTNodeImporter::VisitDecl(Decl *D) { @@ -1379,6 +1410,71 @@ Decl *ASTNodeImporter::VisitDecl(Decl *D) { return 0; } +Decl *ASTNodeImporter::VisitNamespaceDecl(NamespaceDecl *D) { + // Import the major distinguishing characteristics of this namespace. + DeclContext *DC, *LexicalDC; + DeclarationName Name; + SourceLocation Loc; + if (ImportDeclParts(D, DC, LexicalDC, Name, Loc)) + return 0; + + NamespaceDecl *MergeWithNamespace = 0; + if (!Name) { + // This is an anonymous namespace. Adopt an existing anonymous + // namespace if we can. + // FIXME: Not testable. + if (TranslationUnitDecl *TU = dyn_cast<TranslationUnitDecl>(DC)) + MergeWithNamespace = TU->getAnonymousNamespace(); + else + MergeWithNamespace = cast<NamespaceDecl>(DC)->getAnonymousNamespace(); + } else { + llvm::SmallVector<NamedDecl *, 4> ConflictingDecls; + for (DeclContext::lookup_result Lookup = DC->lookup(Name); + Lookup.first != Lookup.second; + ++Lookup.first) { + if (!(*Lookup.first)->isInIdentifierNamespace(Decl::IDNS_Ordinary)) + continue; + + if (NamespaceDecl *FoundNS = dyn_cast<NamespaceDecl>(*Lookup.first)) { + MergeWithNamespace = FoundNS; + ConflictingDecls.clear(); + break; + } + + ConflictingDecls.push_back(*Lookup.first); + } + + if (!ConflictingDecls.empty()) { + Name = Importer.HandleNameConflict(Name, DC, Decl::IDNS_Ordinary, + ConflictingDecls.data(), + ConflictingDecls.size()); + } + } + + // Create the "to" namespace, if needed. + NamespaceDecl *ToNamespace = MergeWithNamespace; + if (!ToNamespace) { + ToNamespace = NamespaceDecl::Create(Importer.getToContext(), DC, Loc, + Name.getAsIdentifierInfo()); + ToNamespace->setLexicalDeclContext(LexicalDC); + LexicalDC->addDecl(ToNamespace); + + // If this is an anonymous namespace, register it as the anonymous + // namespace within its context. + if (!Name) { + if (TranslationUnitDecl *TU = dyn_cast<TranslationUnitDecl>(DC)) + TU->setAnonymousNamespace(ToNamespace); + else + cast<NamespaceDecl>(DC)->setAnonymousNamespace(ToNamespace); + } + } + Importer.Imported(D, ToNamespace); + + ImportDeclContext(D); + + return ToNamespace; +} + Decl *ASTNodeImporter::VisitTypedefDecl(TypedefDecl *D) { // Import the major distinguishing characteristics of this typedef. DeclContext *DC, *LexicalDC; @@ -1426,6 +1522,7 @@ Decl *ASTNodeImporter::VisitTypedefDecl(TypedefDecl *D) { TypedefDecl *ToTypedef = TypedefDecl::Create(Importer.getToContext(), DC, Loc, Name.getAsIdentifierInfo(), TInfo); + ToTypedef->setAccess(D->getAccess()); ToTypedef->setLexicalDeclContext(LexicalDC); Importer.Imported(D, ToTypedef); LexicalDC->addDecl(ToTypedef); @@ -1485,6 +1582,7 @@ Decl *ASTNodeImporter::VisitEnumDecl(EnumDecl *D) { Name.getAsIdentifierInfo(), Importer.Import(D->getTagKeywordLoc()), 0); + D2->setAccess(D->getAccess()); D2->setLexicalDeclContext(LexicalDC); Importer.Imported(D, D2); LexicalDC->addDecl(D2); @@ -1506,12 +1604,7 @@ Decl *ASTNodeImporter::VisitEnumDecl(EnumDecl *D) { return 0; D2->startDefinition(); - for (DeclContext::decl_iterator FromMem = D->decls_begin(), - FromMemEnd = D->decls_end(); - FromMem != FromMemEnd; - ++FromMem) - Importer.Import(*FromMem); - + ImportDeclContext(D); D2->completeDefinition(T, ToPromotionType); } @@ -1600,6 +1693,7 @@ Decl *ASTNodeImporter::VisitRecordDecl(RecordDecl *D) { Name.getAsIdentifierInfo(), Importer.Import(D->getTagKeywordLoc())); D2 = D2CXX; + D2->setAccess(D->getAccess()); if (D->isDefinition()) { // Add base classes. @@ -1638,12 +1732,7 @@ Decl *ASTNodeImporter::VisitRecordDecl(RecordDecl *D) { if (D->isDefinition()) { D2->startDefinition(); - for (DeclContext::decl_iterator FromMem = D->decls_begin(), - FromMemEnd = D->decls_end(); - FromMem != FromMemEnd; - ++FromMem) - Importer.Import(*FromMem); - + ImportDeclContext(D); D2->completeDefinition(); } @@ -1693,6 +1782,7 @@ Decl *ASTNodeImporter::VisitEnumConstantDecl(EnumConstantDecl *D) { = EnumConstantDecl::Create(Importer.getToContext(), cast<EnumDecl>(DC), Loc, Name.getAsIdentifierInfo(), T, Init, D->getInitVal()); + ToEnumerator->setAccess(D->getAccess()); ToEnumerator->setLexicalDeclContext(LexicalDC); Importer.Imported(D, ToEnumerator); LexicalDC->addDecl(ToEnumerator); @@ -1773,25 +1863,64 @@ Decl *ASTNodeImporter::VisitFunctionDecl(FunctionDecl *D) { // Create the imported function. TypeSourceInfo *TInfo = Importer.Import(D->getTypeSourceInfo()); - FunctionDecl *ToEnumerator - = FunctionDecl::Create(Importer.getToContext(), DC, Loc, - Name, T, TInfo, D->getStorageClass(), - D->isInlineSpecified(), - D->hasWrittenPrototype()); - ToEnumerator->setLexicalDeclContext(LexicalDC); - Importer.Imported(D, ToEnumerator); - LexicalDC->addDecl(ToEnumerator); + FunctionDecl *ToFunction = 0; + if (CXXConstructorDecl *FromConstructor = dyn_cast<CXXConstructorDecl>(D)) { + ToFunction = CXXConstructorDecl::Create(Importer.getToContext(), + cast<CXXRecordDecl>(DC), + Loc, Name, T, TInfo, + FromConstructor->isExplicit(), + D->isInlineSpecified(), + D->isImplicit()); + } else if (isa<CXXDestructorDecl>(D)) { + ToFunction = CXXDestructorDecl::Create(Importer.getToContext(), + cast<CXXRecordDecl>(DC), + Loc, Name, T, + D->isInlineSpecified(), + D->isImplicit()); + } else if (CXXConversionDecl *FromConversion + = dyn_cast<CXXConversionDecl>(D)) { + ToFunction = CXXConversionDecl::Create(Importer.getToContext(), + cast<CXXRecordDecl>(DC), + Loc, Name, T, TInfo, + D->isInlineSpecified(), + FromConversion->isExplicit()); + } else { + ToFunction = FunctionDecl::Create(Importer.getToContext(), DC, Loc, + Name, T, TInfo, D->getStorageClass(), + D->isInlineSpecified(), + D->hasWrittenPrototype()); + } + ToFunction->setAccess(D->getAccess()); + ToFunction->setLexicalDeclContext(LexicalDC); + Importer.Imported(D, ToFunction); + LexicalDC->addDecl(ToFunction); // Set the parameters. for (unsigned I = 0, N = Parameters.size(); I != N; ++I) { - Parameters[I]->setOwningFunction(ToEnumerator); - ToEnumerator->addDecl(Parameters[I]); + Parameters[I]->setOwningFunction(ToFunction); + ToFunction->addDecl(Parameters[I]); } - ToEnumerator->setParams(Parameters.data(), Parameters.size()); + ToFunction->setParams(Parameters.data(), Parameters.size()); // FIXME: Other bits to merge? - return ToEnumerator; + return ToFunction; +} + +Decl *ASTNodeImporter::VisitCXXMethodDecl(CXXMethodDecl *D) { + return VisitFunctionDecl(D); +} + +Decl *ASTNodeImporter::VisitCXXConstructorDecl(CXXConstructorDecl *D) { + return VisitCXXMethodDecl(D); +} + +Decl *ASTNodeImporter::VisitCXXDestructorDecl(CXXDestructorDecl *D) { + return VisitCXXMethodDecl(D); +} + +Decl *ASTNodeImporter::VisitCXXConversionDecl(CXXConversionDecl *D) { + return VisitCXXMethodDecl(D); } Decl *ASTNodeImporter::VisitFieldDecl(FieldDecl *D) { @@ -1815,12 +1944,61 @@ Decl *ASTNodeImporter::VisitFieldDecl(FieldDecl *D) { FieldDecl *ToField = FieldDecl::Create(Importer.getToContext(), DC, Loc, Name.getAsIdentifierInfo(), T, TInfo, BitWidth, D->isMutable()); + ToField->setAccess(D->getAccess()); ToField->setLexicalDeclContext(LexicalDC); Importer.Imported(D, ToField); LexicalDC->addDecl(ToField); return ToField; } +Decl *ASTNodeImporter::VisitObjCIvarDecl(ObjCIvarDecl *D) { + // Import the major distinguishing characteristics of an ivar. + DeclContext *DC, *LexicalDC; + DeclarationName Name; + SourceLocation Loc; + if (ImportDeclParts(D, DC, LexicalDC, Name, Loc)) + return 0; + + // Determine whether we've already imported this ivar + for (DeclContext::lookup_result Lookup = DC->lookup(Name); + Lookup.first != Lookup.second; + ++Lookup.first) { + if (ObjCIvarDecl *FoundIvar = dyn_cast<ObjCIvarDecl>(*Lookup.first)) { + if (Importer.IsStructurallyEquivalent(D->getType(), + FoundIvar->getType())) { + Importer.Imported(D, FoundIvar); + return FoundIvar; + } + + Importer.ToDiag(Loc, diag::err_odr_ivar_type_inconsistent) + << Name << D->getType() << FoundIvar->getType(); + Importer.ToDiag(FoundIvar->getLocation(), diag::note_odr_value_here) + << FoundIvar->getType(); + return 0; + } + } + + // Import the type. + QualType T = Importer.Import(D->getType()); + if (T.isNull()) + return 0; + + TypeSourceInfo *TInfo = Importer.Import(D->getTypeSourceInfo()); + Expr *BitWidth = Importer.Import(D->getBitWidth()); + if (!BitWidth && D->getBitWidth()) + return 0; + + ObjCIvarDecl *ToIvar = ObjCIvarDecl::Create(Importer.getToContext(), DC, + Loc, Name.getAsIdentifierInfo(), + T, TInfo, D->getAccessControl(), + BitWidth); + ToIvar->setLexicalDeclContext(LexicalDC); + Importer.Imported(D, ToIvar); + LexicalDC->addDecl(ToIvar); + return ToIvar; + +} + Decl *ASTNodeImporter::VisitVarDecl(VarDecl *D) { // Import the major distinguishing characteristics of a variable. DeclContext *DC, *LexicalDC; @@ -1922,6 +2100,7 @@ Decl *ASTNodeImporter::VisitVarDecl(VarDecl *D) { VarDecl *ToVar = VarDecl::Create(Importer.getToContext(), DC, Loc, Name.getAsIdentifierInfo(), T, TInfo, D->getStorageClass()); + ToVar->setAccess(D->getAccess()); ToVar->setLexicalDeclContext(LexicalDC); Importer.Imported(D, ToVar); LexicalDC->addDecl(ToVar); @@ -1937,6 +2116,32 @@ Decl *ASTNodeImporter::VisitVarDecl(VarDecl *D) { return ToVar; } +Decl *ASTNodeImporter::VisitImplicitParamDecl(ImplicitParamDecl *D) { + // Parameters are created in the translation unit's context, then moved + // into the function declaration's context afterward. + DeclContext *DC = Importer.getToContext().getTranslationUnitDecl(); + + // Import the name of this declaration. + DeclarationName Name = Importer.Import(D->getDeclName()); + if (D->getDeclName() && !Name) + return 0; + + // Import the location of this declaration. + SourceLocation Loc = Importer.Import(D->getLocation()); + + // Import the parameter's type. + QualType T = Importer.Import(D->getType()); + if (T.isNull()) + return 0; + + // Create the imported parameter. + ImplicitParamDecl *ToParm + = ImplicitParamDecl::Create(Importer.getToContext(), DC, + Loc, Name.getAsIdentifierInfo(), + T); + return Importer.Imported(D, ToParm); +} + Decl *ASTNodeImporter::VisitParmVarDecl(ParmVarDecl *D) { // Parameters are created in the translation unit's context, then moved // into the function declaration's context afterward. @@ -1964,6 +2169,254 @@ Decl *ASTNodeImporter::VisitParmVarDecl(ParmVarDecl *D) { return Importer.Imported(D, ToParm); } +Decl *ASTNodeImporter::VisitObjCMethodDecl(ObjCMethodDecl *D) { + // Import the major distinguishing characteristics of a method. + DeclContext *DC, *LexicalDC; + DeclarationName Name; + SourceLocation Loc; + if (ImportDeclParts(D, DC, LexicalDC, Name, Loc)) + return 0; + + for (DeclContext::lookup_result Lookup = DC->lookup(Name); + Lookup.first != Lookup.second; + ++Lookup.first) { + if (ObjCMethodDecl *FoundMethod = dyn_cast<ObjCMethodDecl>(*Lookup.first)) { + if (FoundMethod->isInstanceMethod() != D->isInstanceMethod()) + continue; + + // Check return types. + if (!Importer.IsStructurallyEquivalent(D->getResultType(), + FoundMethod->getResultType())) { + Importer.ToDiag(Loc, diag::err_odr_objc_method_result_type_inconsistent) + << D->isInstanceMethod() << Name + << D->getResultType() << FoundMethod->getResultType(); + Importer.ToDiag(FoundMethod->getLocation(), + diag::note_odr_objc_method_here) + << D->isInstanceMethod() << Name; + return 0; + } + + // Check the number of parameters. + if (D->param_size() != FoundMethod->param_size()) { + Importer.ToDiag(Loc, diag::err_odr_objc_method_num_params_inconsistent) + << D->isInstanceMethod() << Name + << D->param_size() << FoundMethod->param_size(); + Importer.ToDiag(FoundMethod->getLocation(), + diag::note_odr_objc_method_here) + << D->isInstanceMethod() << Name; + return 0; + } + + // Check parameter types. + for (ObjCMethodDecl::param_iterator P = D->param_begin(), + PEnd = D->param_end(), FoundP = FoundMethod->param_begin(); + P != PEnd; ++P, ++FoundP) { + if (!Importer.IsStructurallyEquivalent((*P)->getType(), + (*FoundP)->getType())) { + Importer.FromDiag((*P)->getLocation(), + diag::err_odr_objc_method_param_type_inconsistent) + << D->isInstanceMethod() << Name + << (*P)->getType() << (*FoundP)->getType(); + Importer.ToDiag((*FoundP)->getLocation(), diag::note_odr_value_here) + << (*FoundP)->getType(); + return 0; + } + } + + // Check variadic/non-variadic. + // Check the number of parameters. + if (D->isVariadic() != FoundMethod->isVariadic()) { + Importer.ToDiag(Loc, diag::err_odr_objc_method_variadic_inconsistent) + << D->isInstanceMethod() << Name; + Importer.ToDiag(FoundMethod->getLocation(), + diag::note_odr_objc_method_here) + << D->isInstanceMethod() << Name; + return 0; + } + + // FIXME: Any other bits we need to merge? + return Importer.Imported(D, FoundMethod); + } + } + + // Import the result type. + QualType ResultTy = Importer.Import(D->getResultType()); + if (ResultTy.isNull()) + return 0; + + ObjCMethodDecl *ToMethod + = ObjCMethodDecl::Create(Importer.getToContext(), + Loc, + Importer.Import(D->getLocEnd()), + Name.getObjCSelector(), + ResultTy, DC, + D->isInstanceMethod(), + D->isVariadic(), + D->isSynthesized(), + D->getImplementationControl()); + + // FIXME: When we decide to merge method definitions, we'll need to + // deal with implicit parameters. + + // Import the parameters + llvm::SmallVector<ParmVarDecl *, 5> ToParams; + for (ObjCMethodDecl::param_iterator FromP = D->param_begin(), + FromPEnd = D->param_end(); + FromP != FromPEnd; + ++FromP) { + ParmVarDecl *ToP = cast_or_null<ParmVarDecl>(Importer.Import(*FromP)); + if (!ToP) + return 0; + + ToParams.push_back(ToP); + } + + // Set the parameters. + for (unsigned I = 0, N = ToParams.size(); I != N; ++I) { + ToParams[I]->setOwningFunction(ToMethod); + ToMethod->addDecl(ToParams[I]); + } + ToMethod->setMethodParams(Importer.getToContext(), + ToParams.data(), ToParams.size()); + + ToMethod->setLexicalDeclContext(LexicalDC); + Importer.Imported(D, ToMethod); + LexicalDC->addDecl(ToMethod); + return ToMethod; +} + +Decl *ASTNodeImporter::VisitObjCCategoryDecl(ObjCCategoryDecl *D) { + // Import the major distinguishing characteristics of a category. + DeclContext *DC, *LexicalDC; + DeclarationName Name; + SourceLocation Loc; + if (ImportDeclParts(D, DC, LexicalDC, Name, Loc)) + return 0; + + ObjCInterfaceDecl *ToInterface + = cast_or_null<ObjCInterfaceDecl>(Importer.Import(D->getClassInterface())); + if (!ToInterface) + return 0; + + // Determine if we've already encountered this category. + ObjCCategoryDecl *MergeWithCategory + = ToInterface->FindCategoryDeclaration(Name.getAsIdentifierInfo()); + ObjCCategoryDecl *ToCategory = MergeWithCategory; + if (!ToCategory) { + ToCategory = ObjCCategoryDecl::Create(Importer.getToContext(), DC, + Importer.Import(D->getAtLoc()), + Loc, + Importer.Import(D->getCategoryNameLoc()), + Name.getAsIdentifierInfo()); + ToCategory->setLexicalDeclContext(LexicalDC); + LexicalDC->addDecl(ToCategory); + Importer.Imported(D, ToCategory); + + // Link this category into its class's category list. + ToCategory->setClassInterface(ToInterface); + ToCategory->insertNextClassCategory(); + + // Import protocols + llvm::SmallVector<ObjCProtocolDecl *, 4> Protocols; + llvm::SmallVector<SourceLocation, 4> ProtocolLocs; + ObjCCategoryDecl::protocol_loc_iterator FromProtoLoc + = D->protocol_loc_begin(); + for (ObjCCategoryDecl::protocol_iterator FromProto = D->protocol_begin(), + FromProtoEnd = D->protocol_end(); + FromProto != FromProtoEnd; + ++FromProto, ++FromProtoLoc) { + ObjCProtocolDecl *ToProto + = cast_or_null<ObjCProtocolDecl>(Importer.Import(*FromProto)); + if (!ToProto) + return 0; + Protocols.push_back(ToProto); + ProtocolLocs.push_back(Importer.Import(*FromProtoLoc)); + } + + // FIXME: If we're merging, make sure that the protocol list is the same. + ToCategory->setProtocolList(Protocols.data(), Protocols.size(), + ProtocolLocs.data(), Importer.getToContext()); + + } else { + Importer.Imported(D, ToCategory); + } + + // Import all of the members of this category. + ImportDeclContext(D); + + // If we have an implementation, import it as well. + if (D->getImplementation()) { + ObjCCategoryImplDecl *Impl + = cast<ObjCCategoryImplDecl>(Importer.Import(D->getImplementation())); + if (!Impl) + return 0; + + ToCategory->setImplementation(Impl); + } + + return ToCategory; +} + +Decl *ASTNodeImporter::VisitObjCProtocolDecl(ObjCProtocolDecl *D) { + // Import the major distinguishing characteristics of a protocol. + DeclContext *DC, *LexicalDC; + DeclarationName Name; + SourceLocation Loc; + if (ImportDeclParts(D, DC, LexicalDC, Name, Loc)) + return 0; + + ObjCProtocolDecl *MergeWithProtocol = 0; + for (DeclContext::lookup_result Lookup = DC->lookup(Name); + Lookup.first != Lookup.second; + ++Lookup.first) { + if (!(*Lookup.first)->isInIdentifierNamespace(Decl::IDNS_ObjCProtocol)) + continue; + + if ((MergeWithProtocol = dyn_cast<ObjCProtocolDecl>(*Lookup.first))) + break; + } + + ObjCProtocolDecl *ToProto = MergeWithProtocol; + if (!ToProto || ToProto->isForwardDecl()) { + if (!ToProto) { + ToProto = ObjCProtocolDecl::Create(Importer.getToContext(), DC, Loc, + Name.getAsIdentifierInfo()); + ToProto->setForwardDecl(D->isForwardDecl()); + ToProto->setLexicalDeclContext(LexicalDC); + LexicalDC->addDecl(ToProto); + } + Importer.Imported(D, ToProto); + + // Import protocols + llvm::SmallVector<ObjCProtocolDecl *, 4> Protocols; + llvm::SmallVector<SourceLocation, 4> ProtocolLocs; + ObjCProtocolDecl::protocol_loc_iterator + FromProtoLoc = D->protocol_loc_begin(); + for (ObjCProtocolDecl::protocol_iterator FromProto = D->protocol_begin(), + FromProtoEnd = D->protocol_end(); + FromProto != FromProtoEnd; + ++FromProto, ++FromProtoLoc) { + ObjCProtocolDecl *ToProto + = cast_or_null<ObjCProtocolDecl>(Importer.Import(*FromProto)); + if (!ToProto) + return 0; + Protocols.push_back(ToProto); + ProtocolLocs.push_back(Importer.Import(*FromProtoLoc)); + } + + // FIXME: If we're merging, make sure that the protocol list is the same. + ToProto->setProtocolList(Protocols.data(), Protocols.size(), + ProtocolLocs.data(), Importer.getToContext()); + } else { + Importer.Imported(D, ToProto); + } + + // Import all of the members of this protocol. + ImportDeclContext(D); + + return ToProto; +} + Decl *ASTNodeImporter::VisitObjCInterfaceDecl(ObjCInterfaceDecl *D) { // Import the major distinguishing characteristics of an @interface. DeclContext *DC, *LexicalDC; @@ -1992,14 +2445,12 @@ Decl *ASTNodeImporter::VisitObjCInterfaceDecl(ObjCInterfaceDecl *D) { Importer.Import(D->getClassLoc()), D->isForwardDecl(), D->isImplicitInterfaceDecl()); + ToIface->setForwardDecl(D->isForwardDecl()); ToIface->setLexicalDeclContext(LexicalDC); LexicalDC->addDecl(ToIface); } Importer.Imported(D, ToIface); - // Import superclass - // FIXME: If we're merging, make sure that both decls have the same - // superclass. if (D->getSuperClass()) { ObjCInterfaceDecl *Super = cast_or_null<ObjCInterfaceDecl>(Importer.Import(D->getSuperClass())); @@ -2031,20 +2482,47 @@ Decl *ASTNodeImporter::VisitObjCInterfaceDecl(ObjCInterfaceDecl *D) { ToIface->setProtocolList(Protocols.data(), Protocols.size(), ProtocolLocs.data(), Importer.getToContext()); - // FIXME: Import categories - // Import @end range ToIface->setAtEndRange(Importer.Import(D->getAtEndRange())); } else { Importer.Imported(D, ToIface); + + // Check for consistency of superclasses. + DeclarationName FromSuperName, ToSuperName; + if (D->getSuperClass()) + FromSuperName = Importer.Import(D->getSuperClass()->getDeclName()); + if (ToIface->getSuperClass()) + ToSuperName = ToIface->getSuperClass()->getDeclName(); + if (FromSuperName != ToSuperName) { + Importer.ToDiag(ToIface->getLocation(), + diag::err_odr_objc_superclass_inconsistent) + << ToIface->getDeclName(); + if (ToIface->getSuperClass()) + Importer.ToDiag(ToIface->getSuperClassLoc(), + diag::note_odr_objc_superclass) + << ToIface->getSuperClass()->getDeclName(); + else + Importer.ToDiag(ToIface->getLocation(), + diag::note_odr_objc_missing_superclass); + if (D->getSuperClass()) + Importer.FromDiag(D->getSuperClassLoc(), + diag::note_odr_objc_superclass) + << D->getSuperClass()->getDeclName(); + else + Importer.FromDiag(D->getLocation(), + diag::note_odr_objc_missing_superclass); + return 0; + } } + // Import categories. When the categories themselves are imported, they'll + // hook themselves into this interface. + for (ObjCCategoryDecl *FromCat = D->getCategoryList(); FromCat; + FromCat = FromCat->getNextClassCategory()) + Importer.Import(FromCat); + // Import all of the members of this class. - for (DeclContext::decl_iterator FromMem = D->decls_begin(), - FromMemEnd = D->decls_end(); - FromMem != FromMemEnd; - ++FromMem) - Importer.Import(*FromMem); + ImportDeclContext(D); // If we have an @implementation, import it as well. if (D->getImplementation()) { @@ -2056,7 +2534,151 @@ Decl *ASTNodeImporter::VisitObjCInterfaceDecl(ObjCInterfaceDecl *D) { ToIface->setImplementation(Impl); } - return 0; + return ToIface; +} + +Decl *ASTNodeImporter::VisitObjCPropertyDecl(ObjCPropertyDecl *D) { + // Import the major distinguishing characteristics of an @property. + DeclContext *DC, *LexicalDC; + DeclarationName Name; + SourceLocation Loc; + if (ImportDeclParts(D, DC, LexicalDC, Name, Loc)) + return 0; + + // Check whether we have already imported this property. + for (DeclContext::lookup_result Lookup = DC->lookup(Name); + Lookup.first != Lookup.second; + ++Lookup.first) { + if (ObjCPropertyDecl *FoundProp + = dyn_cast<ObjCPropertyDecl>(*Lookup.first)) { + // Check property types. + if (!Importer.IsStructurallyEquivalent(D->getType(), + FoundProp->getType())) { + Importer.ToDiag(Loc, diag::err_odr_objc_property_type_inconsistent) + << Name << D->getType() << FoundProp->getType(); + Importer.ToDiag(FoundProp->getLocation(), diag::note_odr_value_here) + << FoundProp->getType(); + return 0; + } + + // FIXME: Check property attributes, getters, setters, etc.? + + // Consider these properties to be equivalent. + Importer.Imported(D, FoundProp); + return FoundProp; + } + } + + // Import the type. + QualType T = Importer.Import(D->getType()); + if (T.isNull()) + return 0; + + // Create the new property. + ObjCPropertyDecl *ToProperty + = ObjCPropertyDecl::Create(Importer.getToContext(), DC, Loc, + Name.getAsIdentifierInfo(), + Importer.Import(D->getAtLoc()), + T, + D->getPropertyImplementation()); + Importer.Imported(D, ToProperty); + ToProperty->setLexicalDeclContext(LexicalDC); + LexicalDC->addDecl(ToProperty); + + ToProperty->setPropertyAttributes(D->getPropertyAttributes()); + ToProperty->setGetterName(Importer.Import(D->getGetterName())); + ToProperty->setSetterName(Importer.Import(D->getSetterName())); + ToProperty->setGetterMethodDecl( + cast_or_null<ObjCMethodDecl>(Importer.Import(D->getGetterMethodDecl()))); + ToProperty->setSetterMethodDecl( + cast_or_null<ObjCMethodDecl>(Importer.Import(D->getSetterMethodDecl()))); + ToProperty->setPropertyIvarDecl( + cast_or_null<ObjCIvarDecl>(Importer.Import(D->getPropertyIvarDecl()))); + return ToProperty; +} + +Decl * +ASTNodeImporter::VisitObjCForwardProtocolDecl(ObjCForwardProtocolDecl *D) { + // Import the context of this declaration. + DeclContext *DC = Importer.ImportContext(D->getDeclContext()); + if (!DC) + return 0; + + DeclContext *LexicalDC = DC; + if (D->getDeclContext() != D->getLexicalDeclContext()) { + LexicalDC = Importer.ImportContext(D->getLexicalDeclContext()); + if (!LexicalDC) + return 0; + } + + // Import the location of this declaration. + SourceLocation Loc = Importer.Import(D->getLocation()); + + llvm::SmallVector<ObjCProtocolDecl *, 4> Protocols; + llvm::SmallVector<SourceLocation, 4> Locations; + ObjCForwardProtocolDecl::protocol_loc_iterator FromProtoLoc + = D->protocol_loc_begin(); + for (ObjCForwardProtocolDecl::protocol_iterator FromProto + = D->protocol_begin(), FromProtoEnd = D->protocol_end(); + FromProto != FromProtoEnd; + ++FromProto, ++FromProtoLoc) { + ObjCProtocolDecl *ToProto + = cast_or_null<ObjCProtocolDecl>(Importer.Import(*FromProto)); + if (!ToProto) + continue; + + Protocols.push_back(ToProto); + Locations.push_back(Importer.Import(*FromProtoLoc)); + } + + ObjCForwardProtocolDecl *ToForward + = ObjCForwardProtocolDecl::Create(Importer.getToContext(), DC, Loc, + Protocols.data(), Protocols.size(), + Locations.data()); + ToForward->setLexicalDeclContext(LexicalDC); + LexicalDC->addDecl(ToForward); + Importer.Imported(D, ToForward); + return ToForward; +} + +Decl *ASTNodeImporter::VisitObjCClassDecl(ObjCClassDecl *D) { + // Import the context of this declaration. + DeclContext *DC = Importer.ImportContext(D->getDeclContext()); + if (!DC) + return 0; + + DeclContext *LexicalDC = DC; + if (D->getDeclContext() != D->getLexicalDeclContext()) { + LexicalDC = Importer.ImportContext(D->getLexicalDeclContext()); + if (!LexicalDC) + return 0; + } + + // Import the location of this declaration. + SourceLocation Loc = Importer.Import(D->getLocation()); + + llvm::SmallVector<ObjCInterfaceDecl *, 4> Interfaces; + llvm::SmallVector<SourceLocation, 4> Locations; + for (ObjCClassDecl::iterator From = D->begin(), FromEnd = D->end(); + From != FromEnd; ++From) { + ObjCInterfaceDecl *ToIface + = cast_or_null<ObjCInterfaceDecl>(Importer.Import(From->getInterface())); + if (!ToIface) + continue; + + Interfaces.push_back(ToIface); + Locations.push_back(Importer.Import(From->getLocation())); + } + + ObjCClassDecl *ToClass = ObjCClassDecl::Create(Importer.getToContext(), DC, + Loc, + Interfaces.data(), + Locations.data(), + Interfaces.size()); + ToClass->setLexicalDeclContext(LexicalDC); + LexicalDC->addDecl(ToClass); + Importer.Imported(D, ToClass); + return ToClass; } //---------------------------------------------------------------------------- @@ -2078,6 +2700,30 @@ Expr *ASTNodeImporter::VisitExpr(Expr *E) { return 0; } +Expr *ASTNodeImporter::VisitDeclRefExpr(DeclRefExpr *E) { + NestedNameSpecifier *Qualifier = 0; + if (E->getQualifier()) { + Qualifier = Importer.Import(E->getQualifier()); + if (!E->getQualifier()) + return 0; + } + + ValueDecl *ToD = cast_or_null<ValueDecl>(Importer.Import(E->getDecl())); + if (!ToD) + return 0; + + QualType T = Importer.Import(E->getType()); + if (T.isNull()) + return 0; + + return DeclRefExpr::Create(Importer.getToContext(), Qualifier, + Importer.Import(E->getQualifierRange()), + ToD, + Importer.Import(E->getLocation()), + T, + /*FIXME:TemplateArgs=*/0); +} + Expr *ASTNodeImporter::VisitIntegerLiteral(IntegerLiteral *E) { QualType T = Importer.Import(E->getType()); if (T.isNull()) @@ -2087,6 +2733,110 @@ Expr *ASTNodeImporter::VisitIntegerLiteral(IntegerLiteral *E) { IntegerLiteral(E->getValue(), T, Importer.Import(E->getLocation())); } +Expr *ASTNodeImporter::VisitCharacterLiteral(CharacterLiteral *E) { + QualType T = Importer.Import(E->getType()); + if (T.isNull()) + return 0; + + return new (Importer.getToContext()) CharacterLiteral(E->getValue(), + E->isWide(), T, + Importer.Import(E->getLocation())); +} + +Expr *ASTNodeImporter::VisitParenExpr(ParenExpr *E) { + Expr *SubExpr = Importer.Import(E->getSubExpr()); + if (!SubExpr) + return 0; + + return new (Importer.getToContext()) + ParenExpr(Importer.Import(E->getLParen()), + Importer.Import(E->getRParen()), + SubExpr); +} + +Expr *ASTNodeImporter::VisitUnaryOperator(UnaryOperator *E) { + QualType T = Importer.Import(E->getType()); + if (T.isNull()) + return 0; + + Expr *SubExpr = Importer.Import(E->getSubExpr()); + if (!SubExpr) + return 0; + + return new (Importer.getToContext()) UnaryOperator(SubExpr, E->getOpcode(), + T, + Importer.Import(E->getOperatorLoc())); +} + +Expr *ASTNodeImporter::VisitSizeOfAlignOfExpr(SizeOfAlignOfExpr *E) { + QualType ResultType = Importer.Import(E->getType()); + + if (E->isArgumentType()) { + TypeSourceInfo *TInfo = Importer.Import(E->getArgumentTypeInfo()); + if (!TInfo) + return 0; + + return new (Importer.getToContext()) SizeOfAlignOfExpr(E->isSizeOf(), + TInfo, ResultType, + Importer.Import(E->getOperatorLoc()), + Importer.Import(E->getRParenLoc())); + } + + Expr *SubExpr = Importer.Import(E->getArgumentExpr()); + if (!SubExpr) + return 0; + + return new (Importer.getToContext()) SizeOfAlignOfExpr(E->isSizeOf(), + SubExpr, ResultType, + Importer.Import(E->getOperatorLoc()), + Importer.Import(E->getRParenLoc())); +} + +Expr *ASTNodeImporter::VisitBinaryOperator(BinaryOperator *E) { + QualType T = Importer.Import(E->getType()); + if (T.isNull()) + return 0; + + Expr *LHS = Importer.Import(E->getLHS()); + if (!LHS) + return 0; + + Expr *RHS = Importer.Import(E->getRHS()); + if (!RHS) + return 0; + + return new (Importer.getToContext()) BinaryOperator(LHS, RHS, E->getOpcode(), + T, + Importer.Import(E->getOperatorLoc())); +} + +Expr *ASTNodeImporter::VisitCompoundAssignOperator(CompoundAssignOperator *E) { + QualType T = Importer.Import(E->getType()); + if (T.isNull()) + return 0; + + QualType CompLHSType = Importer.Import(E->getComputationLHSType()); + if (CompLHSType.isNull()) + return 0; + + QualType CompResultType = Importer.Import(E->getComputationResultType()); + if (CompResultType.isNull()) + return 0; + + Expr *LHS = Importer.Import(E->getLHS()); + if (!LHS) + return 0; + + Expr *RHS = Importer.Import(E->getRHS()); + if (!RHS) + return 0; + + return new (Importer.getToContext()) + CompoundAssignOperator(LHS, RHS, E->getOpcode(), + T, CompLHSType, CompResultType, + Importer.Import(E->getOperatorLoc())); +} + Expr *ASTNodeImporter::VisitImplicitCastExpr(ImplicitCastExpr *E) { QualType T = Importer.Import(E->getType()); if (T.isNull()) @@ -2101,6 +2851,25 @@ Expr *ASTNodeImporter::VisitImplicitCastExpr(ImplicitCastExpr *E) { E->isLvalueCast()); } +Expr *ASTNodeImporter::VisitCStyleCastExpr(CStyleCastExpr *E) { + QualType T = Importer.Import(E->getType()); + if (T.isNull()) + return 0; + + Expr *SubExpr = Importer.Import(E->getSubExpr()); + if (!SubExpr) + return 0; + + TypeSourceInfo *TInfo = Importer.Import(E->getTypeInfoAsWritten()); + if (!TInfo && E->getTypeInfoAsWritten()) + return 0; + + return new (Importer.getToContext()) CStyleCastExpr(T, E->getCastKind(), + SubExpr, TInfo, + Importer.Import(E->getLParenLoc()), + Importer.Import(E->getRParenLoc())); +} + ASTImporter::ASTImporter(Diagnostic &Diags, ASTContext &ToContext, FileManager &ToFileManager, ASTContext &FromContext, FileManager &FromFileManager) @@ -2359,6 +3128,17 @@ IdentifierInfo *ASTImporter::Import(IdentifierInfo *FromId) { return &ToContext.Idents.get(FromId->getName()); } +Selector ASTImporter::Import(Selector FromSel) { + if (FromSel.isNull()) + return Selector(); + + llvm::SmallVector<IdentifierInfo *, 4> Idents; + Idents.push_back(Import(FromSel.getIdentifierInfoForSlot(0))); + for (unsigned I = 1, N = FromSel.getNumArgs(); I < N; ++I) + Idents.push_back(Import(FromSel.getIdentifierInfoForSlot(I))); + return ToContext.Selectors.getSelector(FromSel.getNumArgs(), Idents.data()); +} + DeclarationName ASTImporter::HandleNameConflict(DeclarationName Name, DeclContext *DC, unsigned IDNS, @@ -2388,7 +3168,7 @@ bool ASTImporter::IsStructurallyEquivalent(QualType From, QualType To) { if (Pos != ImportedTypes.end() && ToContext.hasSameType(Import(From), To)) return true; - StructuralEquivalenceContext SEC(FromContext, ToContext, Diags, + StructuralEquivalenceContext Ctx(FromContext, ToContext, Diags, NonEquivalentDecls); - return SEC.IsStructurallyEquivalent(From, To); + return Ctx.IsStructurallyEquivalent(From, To); } diff --git a/lib/AST/AttrImpl.cpp b/lib/AST/AttrImpl.cpp index d81979734b3a..423aa065e57c 100644 --- a/lib/AST/AttrImpl.cpp +++ b/lib/AST/AttrImpl.cpp @@ -74,37 +74,40 @@ void NonNullAttr::Destroy(ASTContext &C) { // FIXME: Can we use variadic macro to define DEF_SIMPLE_ATTR_CLONE for // "non-simple" classes? -DEF_SIMPLE_ATTR_CLONE(Packed) DEF_SIMPLE_ATTR_CLONE(AlwaysInline) -DEF_SIMPLE_ATTR_CLONE(Malloc) -DEF_SIMPLE_ATTR_CLONE(NoReturn) DEF_SIMPLE_ATTR_CLONE(AnalyzerNoReturn) +DEF_SIMPLE_ATTR_CLONE(BaseCheck) +DEF_SIMPLE_ATTR_CLONE(CDecl) +DEF_SIMPLE_ATTR_CLONE(CFReturnsNotRetained) +DEF_SIMPLE_ATTR_CLONE(CFReturnsRetained) +DEF_SIMPLE_ATTR_CLONE(Const) +DEF_SIMPLE_ATTR_CLONE(DLLExport) +DEF_SIMPLE_ATTR_CLONE(DLLImport) DEF_SIMPLE_ATTR_CLONE(Deprecated) +DEF_SIMPLE_ATTR_CLONE(FastCall) DEF_SIMPLE_ATTR_CLONE(Final) -DEF_SIMPLE_ATTR_CLONE(Unavailable) -DEF_SIMPLE_ATTR_CLONE(Unused) -DEF_SIMPLE_ATTR_CLONE(Used) -DEF_SIMPLE_ATTR_CLONE(Weak) -DEF_SIMPLE_ATTR_CLONE(WeakImport) +DEF_SIMPLE_ATTR_CLONE(Hiding) +DEF_SIMPLE_ATTR_CLONE(Malloc) +DEF_SIMPLE_ATTR_CLONE(NSReturnsNotRetained) +DEF_SIMPLE_ATTR_CLONE(NSReturnsRetained) +DEF_SIMPLE_ATTR_CLONE(NoDebug) +DEF_SIMPLE_ATTR_CLONE(NoInline) +DEF_SIMPLE_ATTR_CLONE(NoReturn) DEF_SIMPLE_ATTR_CLONE(NoThrow) -DEF_SIMPLE_ATTR_CLONE(Const) +DEF_SIMPLE_ATTR_CLONE(ObjCException) +DEF_SIMPLE_ATTR_CLONE(ObjCNSObject) +DEF_SIMPLE_ATTR_CLONE(Override) +DEF_SIMPLE_ATTR_CLONE(Packed) DEF_SIMPLE_ATTR_CLONE(Pure) -DEF_SIMPLE_ATTR_CLONE(FastCall) DEF_SIMPLE_ATTR_CLONE(StdCall) -DEF_SIMPLE_ATTR_CLONE(CDecl) DEF_SIMPLE_ATTR_CLONE(TransparentUnion) -DEF_SIMPLE_ATTR_CLONE(ObjCNSObject) -DEF_SIMPLE_ATTR_CLONE(ObjCException) -DEF_SIMPLE_ATTR_CLONE(NoDebug) +DEF_SIMPLE_ATTR_CLONE(Unavailable) +DEF_SIMPLE_ATTR_CLONE(Unused) +DEF_SIMPLE_ATTR_CLONE(Used) DEF_SIMPLE_ATTR_CLONE(WarnUnusedResult) -DEF_SIMPLE_ATTR_CLONE(NoInline) -DEF_SIMPLE_ATTR_CLONE(CFReturnsRetained) -DEF_SIMPLE_ATTR_CLONE(NSReturnsRetained) -DEF_SIMPLE_ATTR_CLONE(BaseCheck) -DEF_SIMPLE_ATTR_CLONE(Hiding) -DEF_SIMPLE_ATTR_CLONE(Override) -DEF_SIMPLE_ATTR_CLONE(DLLImport) -DEF_SIMPLE_ATTR_CLONE(DLLExport) +DEF_SIMPLE_ATTR_CLONE(Weak) +DEF_SIMPLE_ATTR_CLONE(WeakImport) +DEF_SIMPLE_ATTR_CLONE(WeakRef) DEF_SIMPLE_ATTR_CLONE(X86ForceAlignArgPointer) Attr* PragmaPackAttr::clone(ASTContext &C) const { @@ -139,6 +142,10 @@ Attr *IBOutletAttr::clone(ASTContext &C) const { return ::new (C) IBOutletAttr; } +Attr *IBActionAttr::clone(ASTContext &C) const { + return ::new (C) IBActionAttr; +} + Attr *GNUInlineAttr::clone(ASTContext &C) const { return ::new (C) GNUInlineAttr; } @@ -190,5 +197,3 @@ Attr *ReqdWorkGroupSizeAttr::clone(ASTContext &C) const { Attr *MSP430InterruptAttr::clone(ASTContext &C) const { return ::new (C) MSP430InterruptAttr(Number); } - - diff --git a/lib/AST/CXXInheritance.cpp b/lib/AST/CXXInheritance.cpp index 99f908caeab6..70f8ee4bca5e 100644 --- a/lib/AST/CXXInheritance.cpp +++ b/lib/AST/CXXInheritance.cpp @@ -90,6 +90,17 @@ bool CXXRecordDecl::isDerivedFrom(CXXRecordDecl *Base, CXXBasePaths &Paths) cons return lookupInBases(&FindBaseClass, Base->getCanonicalDecl(), Paths); } +bool CXXRecordDecl::isVirtuallyDerivedFrom(CXXRecordDecl *Base) const { + CXXBasePaths Paths(/*FindAmbiguities=*/false, /*RecordPaths=*/false, + /*DetectVirtual=*/false); + + if (getCanonicalDecl() == Base->getCanonicalDecl()) + return false; + + Paths.setOrigin(const_cast<CXXRecordDecl*>(this)); + return lookupInBases(&FindVirtualBaseClass, Base->getCanonicalDecl(), Paths); +} + static bool BaseIsNot(const CXXRecordDecl *Base, void *OpaqueTarget) { // OpaqueTarget is a CXXRecordDecl*. return Base->getCanonicalDecl() != (const CXXRecordDecl*) OpaqueTarget; @@ -140,18 +151,20 @@ bool CXXRecordDecl::forallBases(ForallBasesCallback *BaseMatches, return AllMatches; } -bool CXXRecordDecl::lookupInBases(BaseMatchesCallback *BaseMatches, - void *UserData, - CXXBasePaths &Paths) const { +bool CXXBasePaths::lookupInBases(ASTContext &Context, + const CXXRecordDecl *Record, + CXXRecordDecl::BaseMatchesCallback *BaseMatches, + void *UserData) { bool FoundPath = false; // The access of the path down to this record. - AccessSpecifier AccessToHere = Paths.ScratchPath.Access; - bool IsFirstStep = Paths.ScratchPath.empty(); + AccessSpecifier AccessToHere = ScratchPath.Access; + bool IsFirstStep = ScratchPath.empty(); - ASTContext &Context = getASTContext(); - for (base_class_const_iterator BaseSpec = bases_begin(), - BaseSpecEnd = bases_end(); BaseSpec != BaseSpecEnd; ++BaseSpec) { + for (CXXRecordDecl::base_class_const_iterator BaseSpec = Record->bases_begin(), + BaseSpecEnd = Record->bases_end(); + BaseSpec != BaseSpecEnd; + ++BaseSpec) { // Find the record of the base class subobjects for this type. QualType BaseType = Context.getCanonicalType(BaseSpec->getType()) .getUnqualifiedType(); @@ -167,31 +180,31 @@ bool CXXRecordDecl::lookupInBases(BaseMatchesCallback *BaseMatches, // Determine whether we need to visit this base class at all, // updating the count of subobjects appropriately. - std::pair<bool, unsigned>& Subobjects = Paths.ClassSubobjects[BaseType]; + std::pair<bool, unsigned>& Subobjects = ClassSubobjects[BaseType]; bool VisitBase = true; bool SetVirtual = false; if (BaseSpec->isVirtual()) { VisitBase = !Subobjects.first; Subobjects.first = true; - if (Paths.isDetectingVirtual() && Paths.DetectedVirtual == 0) { + if (isDetectingVirtual() && DetectedVirtual == 0) { // If this is the first virtual we find, remember it. If it turns out // there is no base path here, we'll reset it later. - Paths.DetectedVirtual = BaseType->getAs<RecordType>(); + DetectedVirtual = BaseType->getAs<RecordType>(); SetVirtual = true; } } else ++Subobjects.second; - if (Paths.isRecordingPaths()) { + if (isRecordingPaths()) { // Add this base specifier to the current path. CXXBasePathElement Element; Element.Base = &*BaseSpec; - Element.Class = this; + Element.Class = Record; if (BaseSpec->isVirtual()) Element.SubobjectNumber = 0; else Element.SubobjectNumber = Subobjects.second; - Paths.ScratchPath.push_back(Element); + ScratchPath.push_back(Element); // Calculate the "top-down" access to this base class. // The spec actually describes this bottom-up, but top-down is @@ -209,22 +222,22 @@ bool CXXRecordDecl::lookupInBases(BaseMatchesCallback *BaseMatches, // 3. Otherwise, overall access is determined by the most restrictive // access in the sequence. if (IsFirstStep) - Paths.ScratchPath.Access = BaseSpec->getAccessSpecifier(); + ScratchPath.Access = BaseSpec->getAccessSpecifier(); else - Paths.ScratchPath.Access - = MergeAccess(AccessToHere, BaseSpec->getAccessSpecifier()); + ScratchPath.Access = CXXRecordDecl::MergeAccess(AccessToHere, + BaseSpec->getAccessSpecifier()); } // Track whether there's a path involving this specific base. bool FoundPathThroughBase = false; - if (BaseMatches(BaseSpec, Paths.ScratchPath, UserData)) { + if (BaseMatches(BaseSpec, ScratchPath, UserData)) { // We've found a path that terminates at this base. FoundPath = FoundPathThroughBase = true; - if (Paths.isRecordingPaths()) { + if (isRecordingPaths()) { // We have a path. Make a copy of it before moving on. - Paths.Paths.push_back(Paths.ScratchPath); - } else if (!Paths.isFindingAmbiguities()) { + Paths.push_back(ScratchPath); + } else if (!isFindingAmbiguities()) { // We found a path and we don't care about ambiguities; // return immediately. return FoundPath; @@ -233,7 +246,7 @@ bool CXXRecordDecl::lookupInBases(BaseMatchesCallback *BaseMatches, CXXRecordDecl *BaseRecord = cast<CXXRecordDecl>(BaseSpec->getType()->getAs<RecordType>() ->getDecl()); - if (BaseRecord->lookupInBases(BaseMatches, UserData, Paths)) { + if (lookupInBases(Context, BaseRecord, BaseMatches, UserData)) { // C++ [class.member.lookup]p2: // A member name f in one sub-object B hides a member name f in // a sub-object A if A is a base class sub-object of B. Any @@ -243,29 +256,96 @@ bool CXXRecordDecl::lookupInBases(BaseMatchesCallback *BaseMatches, // There is a path to a base class that meets the criteria. If we're // not collecting paths or finding ambiguities, we're done. FoundPath = FoundPathThroughBase = true; - if (!Paths.isFindingAmbiguities()) + if (!isFindingAmbiguities()) return FoundPath; } } // Pop this base specifier off the current path (if we're // collecting paths). - if (Paths.isRecordingPaths()) { - Paths.ScratchPath.pop_back(); + if (isRecordingPaths()) { + ScratchPath.pop_back(); } // If we set a virtual earlier, and this isn't a path, forget it again. if (SetVirtual && !FoundPathThroughBase) { - Paths.DetectedVirtual = 0; + DetectedVirtual = 0; } } // Reset the scratch path access. - Paths.ScratchPath.Access = AccessToHere; + ScratchPath.Access = AccessToHere; return FoundPath; } +bool CXXRecordDecl::lookupInBases(BaseMatchesCallback *BaseMatches, + void *UserData, + CXXBasePaths &Paths) const { + // If we didn't find anything, report that. + if (!Paths.lookupInBases(getASTContext(), this, BaseMatches, UserData)) + return false; + + // If we're not recording paths or we won't ever find ambiguities, + // we're done. + if (!Paths.isRecordingPaths() || !Paths.isFindingAmbiguities()) + return true; + + // C++ [class.member.lookup]p6: + // When virtual base classes are used, a hidden declaration can be + // reached along a path through the sub-object lattice that does + // not pass through the hiding declaration. This is not an + // ambiguity. The identical use with nonvirtual base classes is an + // ambiguity; in that case there is no unique instance of the name + // that hides all the others. + // + // FIXME: This is an O(N^2) algorithm, but DPG doesn't see an easy + // way to make it any faster. + for (CXXBasePaths::paths_iterator P = Paths.begin(), PEnd = Paths.end(); + P != PEnd; /* increment in loop */) { + bool Hidden = false; + + for (CXXBasePath::iterator PE = P->begin(), PEEnd = P->end(); + PE != PEEnd && !Hidden; ++PE) { + if (PE->Base->isVirtual()) { + CXXRecordDecl *VBase = 0; + if (const RecordType *Record = PE->Base->getType()->getAs<RecordType>()) + VBase = cast<CXXRecordDecl>(Record->getDecl()); + if (!VBase) + break; + + // The declaration(s) we found along this path were found in a + // subobject of a virtual base. Check whether this virtual + // base is a subobject of any other path; if so, then the + // declaration in this path are hidden by that patch. + for (CXXBasePaths::paths_iterator HidingP = Paths.begin(), + HidingPEnd = Paths.end(); + HidingP != HidingPEnd; + ++HidingP) { + CXXRecordDecl *HidingClass = 0; + if (const RecordType *Record + = HidingP->back().Base->getType()->getAs<RecordType>()) + HidingClass = cast<CXXRecordDecl>(Record->getDecl()); + if (!HidingClass) + break; + + if (HidingClass->isVirtuallyDerivedFrom(VBase)) { + Hidden = true; + break; + } + } + } + } + + if (Hidden) + P = Paths.Paths.erase(P); + else + ++P; + } + + return true; +} + bool CXXRecordDecl::FindBaseClass(const CXXBaseSpecifier *Specifier, CXXBasePath &Path, void *BaseRecord) { @@ -275,6 +355,16 @@ bool CXXRecordDecl::FindBaseClass(const CXXBaseSpecifier *Specifier, ->getCanonicalDecl() == BaseRecord; } +bool CXXRecordDecl::FindVirtualBaseClass(const CXXBaseSpecifier *Specifier, + CXXBasePath &Path, + void *BaseRecord) { + assert(((Decl *)BaseRecord)->getCanonicalDecl() == BaseRecord && + "User data for FindBaseClass is not canonical!"); + return Specifier->isVirtual() && + Specifier->getType()->getAs<RecordType>()->getDecl() + ->getCanonicalDecl() == BaseRecord; +} + bool CXXRecordDecl::FindTagMember(const CXXBaseSpecifier *Specifier, CXXBasePath &Path, void *Name) { diff --git a/lib/AST/Decl.cpp b/lib/AST/Decl.cpp index 5acb82f31a29..23f5fba437a5 100644 --- a/lib/AST/Decl.cpp +++ b/lib/AST/Decl.cpp @@ -680,12 +680,12 @@ const Expr *VarDecl::getAnyInitializer(const VarDecl *&D) const { } bool VarDecl::isOutOfLine() const { - if (!isStaticDataMember()) - return false; - if (Decl::isOutOfLine()) return true; - + + if (!isStaticDataMember()) + return false; + // If this static data member was instantiated from a static data member of // a class template, check whether that static data member was defined // out-of-line. diff --git a/lib/AST/DeclBase.cpp b/lib/AST/DeclBase.cpp index 863a1cbd03c4..47b7e7efb60e 100644 --- a/lib/AST/DeclBase.cpp +++ b/lib/AST/DeclBase.cpp @@ -194,6 +194,24 @@ ASTContext &Decl::getASTContext() const { return getTranslationUnitDecl()->getASTContext(); } +bool Decl::isUsed() const { + if (Used) + return true; + + // Check for used attribute. + if (hasAttr<UsedAttr>()) + return true; + + // Check redeclarations for used attribute. + for (redecl_iterator I = redecls_begin(), E = redecls_end(); I != E; ++I) { + if (I->hasAttr<UsedAttr>() || I->Used) + return true; + } + + return false; +} + + unsigned Decl::getIdentifierNamespaceForKind(Kind DeclKind) { switch (DeclKind) { case Function: @@ -418,7 +436,8 @@ void Decl::CheckAccessDeclContext() const { // FunctionDecl) // 4. the context is not a record if (isa<TranslationUnitDecl>(this) || - !isa<CXXRecordDecl>(getDeclContext())) + !isa<CXXRecordDecl>(getDeclContext()) || + isInvalidDecl()) return; assert(Access != AS_none && diff --git a/lib/AST/DeclCXX.cpp b/lib/AST/DeclCXX.cpp index b0569d68015f..9b693af5bc92 100644 --- a/lib/AST/DeclCXX.cpp +++ b/lib/AST/DeclCXX.cpp @@ -94,9 +94,7 @@ CXXRecordDecl::setBases(CXXBaseSpecifier const * const *Bases, // Keep track of inherited vbases for this base class. const CXXBaseSpecifier *Base = Bases[i]; QualType BaseType = Base->getType(); - // Skip template types. - // FIXME. This means that this list must be rebuilt during template - // instantiation. + // Skip dependent types; we can't do any checking on them now. if (BaseType->isDependentType()) continue; CXXRecordDecl *BaseClassDecl @@ -143,6 +141,9 @@ CXXRecordDecl::setBases(CXXBaseSpecifier const * const *Bases, data().NumVBases = vbaseCount; for (int i = 0; i < vbaseCount; i++) { QualType QT = UniqueVbases[i]->getType(); + // Skip dependent types; we can't do any checking on them now. + if (QT->isDependentType()) + continue; CXXRecordDecl *VBaseClassDecl = cast<CXXRecordDecl>(QT->getAs<RecordType>()->getDecl()); data().VBases[i] = @@ -543,14 +544,14 @@ CXXRecordDecl::getDefaultConstructor(ASTContext &Context) { return 0; } -CXXDestructorDecl *CXXRecordDecl::getDestructor(ASTContext &Context) { +CXXDestructorDecl *CXXRecordDecl::getDestructor(ASTContext &Context) const { QualType ClassType = Context.getTypeDeclType(this); DeclarationName Name = Context.DeclarationNames.getCXXDestructorName( Context.getCanonicalType(ClassType)); - DeclContext::lookup_iterator I, E; + DeclContext::lookup_const_iterator I, E; llvm::tie(I, E) = lookup(Name); assert(I != E && "Did not find a destructor!"); @@ -573,7 +574,13 @@ bool CXXMethodDecl::isUsualDeallocationFunction() const { if (getOverloadedOperator() != OO_Delete && getOverloadedOperator() != OO_Array_Delete) return false; - + + // C++ [basic.stc.dynamic.deallocation]p2: + // A template instance is never a usual deallocation function, + // regardless of its signature. + if (getPrimaryTemplate()) + return false; + // C++ [basic.stc.dynamic.deallocation]p2: // If a class T has a member deallocation function named operator delete // with exactly one parameter, then that function is a usual (non-placement) @@ -604,51 +611,20 @@ bool CXXMethodDecl::isUsualDeallocationFunction() const { return true; } -typedef llvm::DenseMap<const CXXMethodDecl*, - std::vector<const CXXMethodDecl *> *> - OverriddenMethodsMapTy; - -// FIXME: We hate static data. This doesn't survive PCH saving/loading, and -// the vtable building code uses it at CG time. -static OverriddenMethodsMapTy *OverriddenMethods = 0; - void CXXMethodDecl::addOverriddenMethod(const CXXMethodDecl *MD) { assert(MD->isCanonicalDecl() && "Method is not canonical!"); assert(!MD->getParent()->isDependentContext() && "Can't add an overridden method to a class template!"); - // FIXME: The CXXMethodDecl dtor needs to remove and free the entry. - - if (!OverriddenMethods) - OverriddenMethods = new OverriddenMethodsMapTy(); - - std::vector<const CXXMethodDecl *> *&Methods = (*OverriddenMethods)[this]; - if (!Methods) - Methods = new std::vector<const CXXMethodDecl *>; - - Methods->push_back(MD); + getASTContext().addOverriddenMethod(this, MD); } CXXMethodDecl::method_iterator CXXMethodDecl::begin_overridden_methods() const { - if (!OverriddenMethods) - return 0; - - OverriddenMethodsMapTy::iterator it = OverriddenMethods->find(this); - if (it == OverriddenMethods->end() || it->second->empty()) - return 0; - - return &(*it->second)[0]; + return getASTContext().overridden_methods_begin(this); } CXXMethodDecl::method_iterator CXXMethodDecl::end_overridden_methods() const { - if (!OverriddenMethods) - return 0; - - OverriddenMethodsMapTy::iterator it = OverriddenMethods->find(this); - if (it == OverriddenMethods->end() || it->second->empty()) - return 0; - - return &(*it->second)[0] + it->second->size(); + return getASTContext().overridden_methods_end(this); } QualType CXXMethodDecl::getThisType(ASTContext &C) const { diff --git a/lib/AST/DeclObjC.cpp b/lib/AST/DeclObjC.cpp index 131e098d0467..8decafa35e34 100644 --- a/lib/AST/DeclObjC.cpp +++ b/lib/AST/DeclObjC.cpp @@ -202,6 +202,17 @@ void ObjCInterfaceDecl::mergeClassExtensionProtocolList( setProtocolList(ProtocolRefs.data(), NumProtoRefs, ProtocolLocs.data(), C); } +/// getClassExtension - Find class extension of the given class. +// FIXME. can speed it up, if need be. +ObjCCategoryDecl* ObjCInterfaceDecl::getClassExtension() const { + const ObjCInterfaceDecl* ClassDecl = this; + for (ObjCCategoryDecl *CDecl = ClassDecl->getCategoryList(); CDecl; + CDecl = CDecl->getNextClassCategory()) + if (CDecl->IsClassExtension()) + return CDecl; + return 0; +} + ObjCIvarDecl *ObjCInterfaceDecl::lookupInstanceVariable(IdentifierInfo *ID, ObjCInterfaceDecl *&clsDeclared) { ObjCInterfaceDecl* ClassDecl = this; @@ -210,6 +221,12 @@ ObjCIvarDecl *ObjCInterfaceDecl::lookupInstanceVariable(IdentifierInfo *ID, clsDeclared = ClassDecl; return I; } + if (const ObjCCategoryDecl *CDecl = ClassDecl->getClassExtension()) + if (ObjCIvarDecl *I = CDecl->getIvarDecl(ID)) { + clsDeclared = ClassDecl; + return I; + } + ClassDecl = ClassDecl->getSuperClass(); } return NULL; diff --git a/lib/AST/Expr.cpp b/lib/AST/Expr.cpp index 4cb0aa4560de..a2914bc6bf4e 100644 --- a/lib/AST/Expr.cpp +++ b/lib/AST/Expr.cpp @@ -1120,8 +1120,15 @@ Expr::isLvalueResult Expr::isLvalueInternal(ASTContext &Ctx) const { return LV_Valid; break; case ImplicitCastExprClass: - return cast<ImplicitCastExpr>(this)->isLvalueCast()? LV_Valid - : LV_InvalidExpression; + if (cast<ImplicitCastExpr>(this)->isLvalueCast()) + return LV_Valid; + + // If this is a conversion to a class temporary, make a note of + // that. + if (Ctx.getLangOptions().CPlusPlus && getType()->isRecordType()) + return LV_ClassTemporary; + + break; case ParenExprClass: // C99 6.5.1p5 return cast<ParenExpr>(this)->getSubExpr()->isLvalue(Ctx); case BinaryOperatorClass: @@ -1171,9 +1178,15 @@ Expr::isLvalueResult Expr::isLvalueInternal(ASTContext &Ctx) const { if (ReturnType->isLValueReferenceType()) return LV_Valid; + // If the function is returning a class temporary, make a note of + // that. + if (Ctx.getLangOptions().CPlusPlus && ReturnType->isRecordType()) + return LV_ClassTemporary; + break; } case CompoundLiteralExprClass: // C99 6.5.2.5p5 + // FIXME: Is this what we want in C++? return LV_Valid; case ChooseExprClass: // __builtin_choose_expr is an lvalue if the selected operand is. @@ -1207,6 +1220,13 @@ Expr::isLvalueResult Expr::isLvalueInternal(ASTContext &Ctx) const { if (cast<ExplicitCastExpr>(this)->getTypeAsWritten()-> isLValueReferenceType()) return LV_Valid; + + // If this is a conversion to a class temporary, make a note of + // that. + if (Ctx.getLangOptions().CPlusPlus && + cast<ExplicitCastExpr>(this)->getTypeAsWritten()->isRecordType()) + return LV_ClassTemporary; + break; case CXXTypeidExprClass: // C++ 5.2.8p1: The result of a typeid expression is an lvalue of ... @@ -1253,6 +1273,11 @@ Expr::isLvalueResult Expr::isLvalueInternal(ASTContext &Ctx) const { return LV_Valid; break; + case Expr::CXXConstructExprClass: + case Expr::CXXTemporaryObjectExprClass: + case Expr::CXXZeroInitValueExprClass: + return LV_ClassTemporary; + default: break; } @@ -1296,6 +1321,8 @@ Expr::isModifiableLvalue(ASTContext &Ctx, SourceLocation *Loc) const { case LV_SubObjCPropertySetting: return MLV_SubObjCPropertySetting; case LV_SubObjCPropertyGetterSetting: return MLV_SubObjCPropertyGetterSetting; + case LV_ClassTemporary: + return MLV_ClassTemporary; } // The following is illegal: @@ -1655,11 +1682,18 @@ static ICEDiag CheckICE(const Expr* E, ASTContext &Ctx) { return NoDiag(); if (Ctx.getLangOptions().CPlusPlus && E->getType().getCVRQualifiers() == Qualifiers::Const) { + const NamedDecl *D = cast<DeclRefExpr>(E)->getDecl(); + + // Parameter variables are never constants. Without this check, + // getAnyInitializer() can find a default argument, which leads + // to chaos. + if (isa<ParmVarDecl>(D)) + return ICEDiag(2, cast<DeclRefExpr>(E)->getLocation()); + // C++ 7.1.5.1p2 // A variable of non-volatile const-qualified integral or enumeration // type initialized by an ICE can be used in ICEs. - if (const VarDecl *Dcl = - dyn_cast<VarDecl>(cast<DeclRefExpr>(E)->getDecl())) { + if (const VarDecl *Dcl = dyn_cast<VarDecl>(D)) { Qualifiers Quals = Ctx.getCanonicalType(Dcl->getType()).getQualifiers(); if (Quals.hasVolatile() || !Quals.hasConst()) return ICEDiag(2, cast<DeclRefExpr>(E)->getLocation()); diff --git a/lib/AST/ExprCXX.cpp b/lib/AST/ExprCXX.cpp index f4b8333dd3ae..b9a4ee6e4d2c 100644 --- a/lib/AST/ExprCXX.cpp +++ b/lib/AST/ExprCXX.cpp @@ -15,6 +15,7 @@ #include "clang/AST/DeclCXX.h" #include "clang/AST/DeclTemplate.h" #include "clang/AST/ExprCXX.h" +#include "clang/AST/TypeLoc.h" using namespace clang; //===----------------------------------------------------------------------===// @@ -121,6 +122,27 @@ Stmt::child_iterator CXXPseudoDestructorExpr::child_end() { return &Base + 1; } +PseudoDestructorTypeStorage::PseudoDestructorTypeStorage(TypeSourceInfo *Info) + : Type(Info) +{ + Location = Info->getTypeLoc().getSourceRange().getBegin(); +} + +QualType CXXPseudoDestructorExpr::getDestroyedType() const { + if (TypeSourceInfo *TInfo = DestroyedType.getTypeSourceInfo()) + return TInfo->getType(); + + return QualType(); +} + +SourceRange CXXPseudoDestructorExpr::getSourceRange() const { + SourceLocation End = DestroyedType.getLocation(); + if (TypeSourceInfo *TInfo = DestroyedType.getTypeSourceInfo()) + End = TInfo->getTypeLoc().getSourceRange().getEnd(); + return SourceRange(Base->getLocStart(), End); +} + + // UnresolvedLookupExpr UnresolvedLookupExpr * UnresolvedLookupExpr::Create(ASTContext &C, bool Dependent, diff --git a/lib/AST/ExprConstant.cpp b/lib/AST/ExprConstant.cpp index 1a44cd02d9c1..e03669246e88 100644 --- a/lib/AST/ExprConstant.cpp +++ b/lib/AST/ExprConstant.cpp @@ -1560,6 +1560,31 @@ static bool EvaluateFloat(const Expr* E, APFloat& Result, EvalInfo &Info) { return FloatExprEvaluator(Info, Result).Visit(const_cast<Expr*>(E)); } +static bool TryEvaluateBuiltinNaN(ASTContext &Context, + QualType ResultTy, + const Expr *Arg, + bool SNaN, + llvm::APFloat &Result) { + const StringLiteral *S = dyn_cast<StringLiteral>(Arg->IgnoreParenCasts()); + if (!S) return false; + + const llvm::fltSemantics &Sem = Context.getFloatTypeSemantics(ResultTy); + + llvm::APInt fill; + + // Treat empty strings as if they were zero. + if (S->getString().empty()) + fill = llvm::APInt(32, 0); + else if (S->getString().getAsInteger(0, fill)) + return false; + + if (SNaN) + Result = llvm::APFloat::getSNaN(Sem, false, &fill); + else + Result = llvm::APFloat::getQNaN(Sem, false, &fill); + return true; +} + bool FloatExprEvaluator::VisitCallExpr(const CallExpr *E) { switch (E->isBuiltinCall(Info.Ctx)) { default: return false; @@ -1575,24 +1600,19 @@ bool FloatExprEvaluator::VisitCallExpr(const CallExpr *E) { return true; } + case Builtin::BI__builtin_nans: + case Builtin::BI__builtin_nansf: + case Builtin::BI__builtin_nansl: + return TryEvaluateBuiltinNaN(Info.Ctx, E->getType(), E->getArg(0), + true, Result); + case Builtin::BI__builtin_nan: case Builtin::BI__builtin_nanf: case Builtin::BI__builtin_nanl: // If this is __builtin_nan() turn this into a nan, otherwise we // can't constant fold it. - if (const StringLiteral *S = - dyn_cast<StringLiteral>(E->getArg(0)->IgnoreParenCasts())) { - if (!S->isWide()) { - const llvm::fltSemantics &Sem = - Info.Ctx.getFloatTypeSemantics(E->getType()); - unsigned Type = 0; - if (!S->getString().empty() && S->getString().getAsInteger(0, Type)) - return false; - Result = llvm::APFloat::getNaN(Sem, false, Type); - return true; - } - } - return false; + return TryEvaluateBuiltinNaN(Info.Ctx, E->getType(), E->getArg(0), + false, Result); case Builtin::BI__builtin_fabs: case Builtin::BI__builtin_fabsf: diff --git a/lib/AST/RecordLayoutBuilder.cpp b/lib/AST/RecordLayoutBuilder.cpp index 50acd15fde05..10c5089f2253 100644 --- a/lib/AST/RecordLayoutBuilder.cpp +++ b/lib/AST/RecordLayoutBuilder.cpp @@ -487,6 +487,7 @@ void ASTRecordLayoutBuilder::Layout(const RecordDecl *D) { FinishLayout(); } +// FIXME. Impl is no longer needed. void ASTRecordLayoutBuilder::Layout(const ObjCInterfaceDecl *D, const ObjCImplementationDecl *Impl) { if (ObjCInterfaceDecl *SD = D->getSuperClass()) { @@ -508,10 +509,9 @@ void ASTRecordLayoutBuilder::Layout(const ObjCInterfaceDecl *D, if (const AlignedAttr *AA = D->getAttr<AlignedAttr>()) UpdateAlignment(AA->getMaxAlignment()); - // Layout each ivar sequentially. llvm::SmallVector<ObjCIvarDecl*, 16> Ivars; - Ctx.ShallowCollectObjCIvars(D, Ivars, Impl); + Ctx.ShallowCollectObjCIvars(D, Ivars); for (unsigned i = 0, e = Ivars.size(); i != e; ++i) LayoutField(Ivars[i]); diff --git a/lib/AST/StmtPrinter.cpp b/lib/AST/StmtPrinter.cpp index 3ae306d3c7ac..da43878628fb 100644 --- a/lib/AST/StmtPrinter.cpp +++ b/lib/AST/StmtPrinter.cpp @@ -1120,7 +1120,10 @@ void StmtPrinter::VisitCXXPseudoDestructorExpr(CXXPseudoDestructorExpr *E) { E->getQualifier()->print(OS, Policy); std::string TypeS; - E->getDestroyedType().getAsStringInternal(TypeS, Policy); + if (IdentifierInfo *II = E->getDestroyedTypeIdentifier()) + OS << II->getName(); + else + E->getDestroyedType().getAsStringInternal(TypeS, Policy); OS << TypeS; } diff --git a/lib/Analysis/AnalysisContext.cpp b/lib/Analysis/AnalysisContext.cpp index ccd5088f2ec7..d9933e85cb91 100644 --- a/lib/Analysis/AnalysisContext.cpp +++ b/lib/Analysis/AnalysisContext.cpp @@ -186,6 +186,18 @@ LocationContext::getStackFrameForDeclContext(const DeclContext *DC) const { return NULL; } +bool LocationContext::isParentOf(const LocationContext *LC) const { + do { + const LocationContext *Parent = LC->getParent(); + if (Parent == this) + return true; + else + LC = Parent; + } while (LC); + + return false; +} + //===----------------------------------------------------------------------===// // Lazily generated map to query the external variables referenced by a Block. //===----------------------------------------------------------------------===// diff --git a/lib/Analysis/CFG.cpp b/lib/Analysis/CFG.cpp index 5b8aeae5d1c5..a4a021f20b21 100644 --- a/lib/Analysis/CFG.cpp +++ b/lib/Analysis/CFG.cpp @@ -38,11 +38,16 @@ static SourceLocation GetEndLoc(Decl* D) { class AddStmtChoice { public: - enum Kind { NotAlwaysAdd = 0, AlwaysAdd, AlwaysAddAsLValue }; -public: - AddStmtChoice(Kind kind) : k(kind) {} - bool alwaysAdd() const { return k != NotAlwaysAdd; } - bool asLValue() const { return k == AlwaysAddAsLValue; } + enum Kind { NotAlwaysAdd = 0, + AlwaysAdd = 1, + AsLValueNotAlwaysAdd = 2, + AlwaysAddAsLValue = 3 }; + + AddStmtChoice(Kind kind) : k(kind) {} + + bool alwaysAdd() const { return (unsigned)k & 0x1; } + bool asLValue() const { return k >= AlwaysAddAsLValue; } + private: Kind k; }; @@ -589,7 +594,7 @@ CFGBlock *CFGBuilder::VisitCallExpr(CallExpr *C, AddStmtChoice asc) { AddEHEdge = false; if (!NoReturn && !AddEHEdge) - return VisitStmt(C, asc); + return VisitStmt(C, AddStmtChoice::AlwaysAdd); if (Block) { Succ = Block; @@ -771,18 +776,10 @@ CFGBlock *CFGBuilder::VisitDeclSubExpr(Decl* D) { Expr *Init = VD->getInit(); if (Init) { - // Optimization: Don't create separate block-level statements for literals. - switch (Init->getStmtClass()) { - case Stmt::IntegerLiteralClass: - case Stmt::CharacterLiteralClass: - case Stmt::StringLiteralClass: - break; - default: - Block = addStmt(Init, - VD->getType()->isReferenceType() - ? AddStmtChoice::AlwaysAddAsLValue - : AddStmtChoice::AlwaysAdd); - } + AddStmtChoice::Kind k = + VD->getType()->isReferenceType() ? AddStmtChoice::AsLValueNotAlwaysAdd + : AddStmtChoice::NotAlwaysAdd; + Visit(Init, AddStmtChoice(k)); } // If the type of VD is a VLA, then we must process its size expressions. diff --git a/lib/Analysis/CMakeLists.txt b/lib/Analysis/CMakeLists.txt index 4f8259e44939..b4e0e242485b 100644 --- a/lib/Analysis/CMakeLists.txt +++ b/lib/Analysis/CMakeLists.txt @@ -5,6 +5,7 @@ add_clang_library(clangAnalysis CFG.cpp LiveVariables.cpp PrintfFormatString.cpp + ReachableCode.cpp UninitializedValues.cpp ) diff --git a/lib/Analysis/LiveVariables.cpp b/lib/Analysis/LiveVariables.cpp index 94ed75286dee..01a36a1074e8 100644 --- a/lib/Analysis/LiveVariables.cpp +++ b/lib/Analysis/LiveVariables.cpp @@ -86,6 +86,12 @@ LiveVariables::LiveVariables(AnalysisContext &AC) { RegisterDecls R(getAnalysisData()); cfg.VisitBlockStmts(R); + + // Register all parameters even if they didn't occur in the function body. + if (const FunctionDecl *FD = dyn_cast<FunctionDecl>(AC.getDecl())) + for (FunctionDecl::param_const_iterator PI = FD->param_begin(), + PE = FD->param_end(); PI != PE; ++PI) + getAnalysisData().Register(*PI); } //===----------------------------------------------------------------------===// @@ -274,9 +280,16 @@ void TransferFuncs::VisitDeclStmt(DeclStmt* DS) { for (DeclStmt::decl_iterator DI=DS->decl_begin(), DE = DS->decl_end(); DI != DE; ++DI) if (VarDecl* VD = dyn_cast<VarDecl>(*DI)) { - // The initializer is evaluated after the variable comes into scope. + // Update liveness information by killing the VarDecl. + unsigned bit = AD.getIdx(VD); + LiveState.getDeclBit(bit) = Dead | AD.AlwaysLive.getDeclBit(bit); + + // The initializer is evaluated after the variable comes into scope, but + // before the DeclStmt (which binds the value to the variable). // Since this is a reverse dataflow analysis, we must evaluate the - // transfer function for this expression first. + // transfer function for this expression after the DeclStmt. If the + // initializer references the variable (which is bad) then we extend + // its liveness. if (Expr* Init = VD->getInit()) Visit(Init); @@ -286,10 +299,6 @@ void TransferFuncs::VisitDeclStmt(DeclStmt* DS) { StmtIterator E; for (; I != E; ++I) Visit(*I); } - - // Update liveness information by killing the VarDecl. - unsigned bit = AD.getIdx(VD); - LiveState.getDeclBit(bit) = Dead | AD.AlwaysLive.getDeclBit(bit); } } diff --git a/lib/Analysis/PrintfFormatString.cpp b/lib/Analysis/PrintfFormatString.cpp index 55abd1077150..46acc8a377bf 100644 --- a/lib/Analysis/PrintfFormatString.cpp +++ b/lib/Analysis/PrintfFormatString.cpp @@ -15,10 +15,12 @@ #include "clang/Analysis/Analyses/PrintfFormatString.h" #include "clang/AST/ASTContext.h" -using clang::analyze_printf::FormatSpecifier; -using clang::analyze_printf::OptionalAmount; using clang::analyze_printf::ArgTypeResult; +using clang::analyze_printf::FormatSpecifier; using clang::analyze_printf::FormatStringHandler; +using clang::analyze_printf::OptionalAmount; +using clang::analyze_printf::PositionContext; + using namespace clang; namespace { @@ -66,24 +68,19 @@ static OptionalAmount ParseAmount(const char *&Beg, const char *E) { const char *I = Beg; UpdateOnReturn <const char*> UpdateBeg(Beg, I); - bool foundDigits = false; unsigned accumulator = 0; + bool hasDigits = false; for ( ; I != E; ++I) { char c = *I; if (c >= '0' && c <= '9') { - foundDigits = true; + hasDigits = true; accumulator += (accumulator * 10) + (c - '0'); continue; } - if (foundDigits) - return OptionalAmount(accumulator, Beg); - - if (c == '*') { - ++I; - return OptionalAmount(OptionalAmount::Arg, Beg); - } + if (hasDigits) + return OptionalAmount(OptionalAmount::Constant, accumulator, Beg); break; } @@ -91,9 +88,129 @@ static OptionalAmount ParseAmount(const char *&Beg, const char *E) { return OptionalAmount(); } +static OptionalAmount ParseNonPositionAmount(const char *&Beg, const char *E, + unsigned &argIndex) { + if (*Beg == '*') { + ++Beg; + return OptionalAmount(OptionalAmount::Arg, argIndex++, Beg); + } + + return ParseAmount(Beg, E); +} + +static OptionalAmount ParsePositionAmount(FormatStringHandler &H, + const char *Start, + const char *&Beg, const char *E, + PositionContext p) { + if (*Beg == '*') { + const char *I = Beg + 1; + const OptionalAmount &Amt = ParseAmount(I, E); + + if (Amt.getHowSpecified() == OptionalAmount::NotSpecified) { + H.HandleInvalidPosition(Beg, I - Beg, p); + return OptionalAmount(false); + } + + if (I== E) { + // No more characters left? + H.HandleIncompleteFormatSpecifier(Start, E - Start); + return OptionalAmount(false); + } + + assert(Amt.getHowSpecified() == OptionalAmount::Constant); + + if (*I == '$') { + // Special case: '*0$', since this is an easy mistake. + if (Amt.getConstantAmount() == 0) { + H.HandleZeroPosition(Beg, I - Beg + 1); + return OptionalAmount(false); + } + + const char *Tmp = Beg; + Beg = ++I; + + return OptionalAmount(OptionalAmount::Arg, Amt.getConstantAmount() - 1, + Tmp); + } + + H.HandleInvalidPosition(Beg, I - Beg, p); + return OptionalAmount(false); + } + + return ParseAmount(Beg, E); +} + +static bool ParsePrecision(FormatStringHandler &H, FormatSpecifier &FS, + const char *Start, const char *&Beg, const char *E, + unsigned *argIndex) { + if (argIndex) { + FS.setPrecision(ParseNonPositionAmount(Beg, E, *argIndex)); + } + else { + const OptionalAmount Amt = ParsePositionAmount(H, Start, Beg, E, + analyze_printf::PrecisionPos); + if (Amt.isInvalid()) + return true; + FS.setPrecision(Amt); + } + return false; +} + +static bool ParseFieldWidth(FormatStringHandler &H, FormatSpecifier &FS, + const char *Start, const char *&Beg, const char *E, + unsigned *argIndex) { + // FIXME: Support negative field widths. + if (argIndex) { + FS.setFieldWidth(ParseNonPositionAmount(Beg, E, *argIndex)); + } + else { + const OptionalAmount Amt = ParsePositionAmount(H, Start, Beg, E, + analyze_printf::FieldWidthPos); + if (Amt.isInvalid()) + return true; + FS.setFieldWidth(Amt); + } + return false; +} + + +static bool ParseArgPosition(FormatStringHandler &H, + FormatSpecifier &FS, const char *Start, + const char *&Beg, const char *E) { + + using namespace clang::analyze_printf; + const char *I = Beg; + + const OptionalAmount &Amt = ParseAmount(I, E); + + if (I == E) { + // No more characters left? + H.HandleIncompleteFormatSpecifier(Start, E - Start); + return true; + } + + if (Amt.getHowSpecified() == OptionalAmount::Constant && *(I++) == '$') { + // Special case: '%0$', since this is an easy mistake. + if (Amt.getConstantAmount() == 0) { + H.HandleZeroPosition(Start, I - Start); + return true; + } + + FS.setArgIndex(Amt.getConstantAmount() - 1); + FS.setUsesPositionalArg(); + // Update the caller's pointer if we decided to consume + // these characters. + Beg = I; + return false; + } + + return false; +} + static FormatSpecifierResult ParseFormatSpecifier(FormatStringHandler &H, const char *&Beg, - const char *E) { + const char *E, + unsigned &argIndex) { using namespace clang::analyze_printf; @@ -126,6 +243,14 @@ static FormatSpecifierResult ParseFormatSpecifier(FormatStringHandler &H, } FormatSpecifier FS; + if (ParseArgPosition(H, FS, Start, I, E)) + return true; + + if (I == E) { + // No more characters left? + H.HandleIncompleteFormatSpecifier(Start, E - Start); + return true; + } // Look for flags (if any). bool hasMore = true; @@ -149,7 +274,9 @@ static FormatSpecifierResult ParseFormatSpecifier(FormatStringHandler &H, } // Look for the field width (if any). - FS.setFieldWidth(ParseAmount(I, E)); + if (ParseFieldWidth(H, FS, Start, I, E, + FS.usesPositionalArg() ? 0 : &argIndex)) + return true; if (I == E) { // No more characters left? @@ -165,7 +292,9 @@ static FormatSpecifierResult ParseFormatSpecifier(FormatStringHandler &H, return true; } - FS.setPrecision(ParseAmount(I, E)); + if (ParsePrecision(H, FS, Start, I, E, + FS.usesPositionalArg() ? 0 : &argIndex)) + return true; if (I == E) { // No more characters left? @@ -214,44 +343,53 @@ static FormatSpecifierResult ParseFormatSpecifier(FormatStringHandler &H, default: break; // C99: 7.19.6.1 (section 8). - case 'd': k = ConversionSpecifier::dArg; break; - case 'i': k = ConversionSpecifier::iArg; break; - case 'o': k = ConversionSpecifier::oArg; break; - case 'u': k = ConversionSpecifier::uArg; break; - case 'x': k = ConversionSpecifier::xArg; break; - case 'X': k = ConversionSpecifier::XArg; break; - case 'f': k = ConversionSpecifier::fArg; break; - case 'F': k = ConversionSpecifier::FArg; break; - case 'e': k = ConversionSpecifier::eArg; break; + case '%': k = ConversionSpecifier::PercentArg; break; + case 'A': k = ConversionSpecifier::AArg; break; case 'E': k = ConversionSpecifier::EArg; break; - case 'g': k = ConversionSpecifier::gArg; break; + case 'F': k = ConversionSpecifier::FArg; break; case 'G': k = ConversionSpecifier::GArg; break; + case 'X': k = ConversionSpecifier::XArg; break; case 'a': k = ConversionSpecifier::aArg; break; - case 'A': k = ConversionSpecifier::AArg; break; case 'c': k = ConversionSpecifier::IntAsCharArg; break; - case 's': k = ConversionSpecifier::CStrArg; break; - case 'p': k = ConversionSpecifier::VoidPtrArg; break; + case 'd': k = ConversionSpecifier::dArg; break; + case 'e': k = ConversionSpecifier::eArg; break; + case 'f': k = ConversionSpecifier::fArg; break; + case 'g': k = ConversionSpecifier::gArg; break; + case 'i': k = ConversionSpecifier::iArg; break; case 'n': k = ConversionSpecifier::OutIntPtrArg; break; - case '%': k = ConversionSpecifier::PercentArg; break; + case 'o': k = ConversionSpecifier::oArg; break; + case 'p': k = ConversionSpecifier::VoidPtrArg; break; + case 's': k = ConversionSpecifier::CStrArg; break; + case 'u': k = ConversionSpecifier::uArg; break; + case 'x': k = ConversionSpecifier::xArg; break; + // Mac OS X (unicode) specific + case 'C': k = ConversionSpecifier::CArg; break; + case 'S': k = ConversionSpecifier::UnicodeStrArg; break; // Objective-C. case '@': k = ConversionSpecifier::ObjCObjArg; break; // Glibc specific. case 'm': k = ConversionSpecifier::PrintErrno; break; } - FS.setConversionSpecifier(ConversionSpecifier(conversionPosition, k)); + ConversionSpecifier CS(conversionPosition, k); + FS.setConversionSpecifier(CS); + if (CS.consumesDataArgument() && !FS.usesPositionalArg()) + FS.setArgIndex(argIndex++); if (k == ConversionSpecifier::InvalidSpecifier) { - H.HandleInvalidConversionSpecifier(FS, Beg, I - Beg); - return false; // Keep processing format specifiers. + // Assume the conversion takes one argument. + return !H.HandleInvalidConversionSpecifier(FS, Beg, I - Beg); } return FormatSpecifierResult(Start, FS); } bool clang::analyze_printf::ParseFormatString(FormatStringHandler &H, const char *I, const char *E) { + + unsigned argIndex = 0; + // Keep looking for a format specifier until we have exhausted the string. while (I != E) { - const FormatSpecifierResult &FSR = ParseFormatSpecifier(H, I, E); + const FormatSpecifierResult &FSR = ParseFormatSpecifier(H, I, E, argIndex); // Did a fail-stop error of any kind occur when parsing the specifier? // If so, don't do any more processing. if (FSR.shouldStop()) @@ -345,8 +483,10 @@ bool ArgTypeResult::matchesType(ASTContext &C, QualType argTy) const { if (!PT) return false; - QualType pointeeTy = PT->getPointeeType(); - return pointeeTy == C.WCharTy; + QualType pointeeTy = + C.getCanonicalType(PT->getPointeeType()).getUnqualifiedType(); + + return pointeeTy == C.getWCharType(); } return false; @@ -359,7 +499,7 @@ QualType ArgTypeResult::getRepresentativeType(ASTContext &C) const { if (K == CStrTy) return C.getPointerType(C.CharTy); if (K == WCStrTy) - return C.getPointerType(C.WCharTy); + return C.getPointerType(C.getWCharType()); if (K == ObjCPointerTy) return C.ObjCBuiltinIdTy; @@ -426,9 +566,17 @@ ArgTypeResult FormatSpecifier::getArgType(ASTContext &Ctx) const { return Ctx.DoubleTy; } - if (CS.getKind() == ConversionSpecifier::CStrArg) - return ArgTypeResult(LM == AsWideChar ? ArgTypeResult::WCStrTy - : ArgTypeResult::CStrTy); + switch (CS.getKind()) { + case ConversionSpecifier::CStrArg: + return ArgTypeResult(LM == AsWideChar ? ArgTypeResult::WCStrTy : ArgTypeResult::CStrTy); + case ConversionSpecifier::UnicodeStrArg: + // FIXME: This appears to be Mac OS X specific. + return ArgTypeResult::WCStrTy; + case ConversionSpecifier::CArg: + return Ctx.WCharTy; + default: + break; + } // FIXME: Handle other cases. return ArgTypeResult(); diff --git a/lib/Analysis/ReachableCode.cpp b/lib/Analysis/ReachableCode.cpp new file mode 100644 index 000000000000..f959e5cd43e1 --- /dev/null +++ b/lib/Analysis/ReachableCode.cpp @@ -0,0 +1,278 @@ +//=- ReachableCodePathInsensitive.cpp ---------------------------*- C++ --*-==// +// +// The LLVM Compiler Infrastructure +// +// This file is distributed under the University of Illinois Open Source +// License. See LICENSE.TXT for details. +// +//===----------------------------------------------------------------------===// +// +// This file implements a flow-sensitive, path-insensitive analysis of +// determining reachable blocks within a CFG. +// +//===----------------------------------------------------------------------===// + +#include "llvm/ADT/BitVector.h" +#include "llvm/ADT/SmallVector.h" +#include "clang/AST/Expr.h" +#include "clang/AST/ExprCXX.h" +#include "clang/AST/StmtCXX.h" +#include "clang/Analysis/Analyses/ReachableCode.h" +#include "clang/Analysis/CFG.h" +#include "clang/Analysis/AnalysisContext.h" +#include "clang/Basic/SourceManager.h" + +using namespace clang; + +static SourceLocation GetUnreachableLoc(const CFGBlock &b, SourceRange &R1, + SourceRange &R2) { + const Stmt *S = 0; + unsigned sn = 0; + R1 = R2 = SourceRange(); + +top: + if (sn < b.size()) + S = b[sn].getStmt(); + else if (b.getTerminator()) + S = b.getTerminator(); + else + return SourceLocation(); + + switch (S->getStmtClass()) { + case Expr::BinaryOperatorClass: { + const BinaryOperator *BO = cast<BinaryOperator>(S); + if (BO->getOpcode() == BinaryOperator::Comma) { + if (sn+1 < b.size()) + return b[sn+1].getStmt()->getLocStart(); + const CFGBlock *n = &b; + while (1) { + if (n->getTerminator()) + return n->getTerminator()->getLocStart(); + if (n->succ_size() != 1) + return SourceLocation(); + n = n[0].succ_begin()[0]; + if (n->pred_size() != 1) + return SourceLocation(); + if (!n->empty()) + return n[0][0].getStmt()->getLocStart(); + } + } + R1 = BO->getLHS()->getSourceRange(); + R2 = BO->getRHS()->getSourceRange(); + return BO->getOperatorLoc(); + } + case Expr::UnaryOperatorClass: { + const UnaryOperator *UO = cast<UnaryOperator>(S); + R1 = UO->getSubExpr()->getSourceRange(); + return UO->getOperatorLoc(); + } + case Expr::CompoundAssignOperatorClass: { + const CompoundAssignOperator *CAO = cast<CompoundAssignOperator>(S); + R1 = CAO->getLHS()->getSourceRange(); + R2 = CAO->getRHS()->getSourceRange(); + return CAO->getOperatorLoc(); + } + case Expr::ConditionalOperatorClass: { + const ConditionalOperator *CO = cast<ConditionalOperator>(S); + return CO->getQuestionLoc(); + } + case Expr::MemberExprClass: { + const MemberExpr *ME = cast<MemberExpr>(S); + R1 = ME->getSourceRange(); + return ME->getMemberLoc(); + } + case Expr::ArraySubscriptExprClass: { + const ArraySubscriptExpr *ASE = cast<ArraySubscriptExpr>(S); + R1 = ASE->getLHS()->getSourceRange(); + R2 = ASE->getRHS()->getSourceRange(); + return ASE->getRBracketLoc(); + } + case Expr::CStyleCastExprClass: { + const CStyleCastExpr *CSC = cast<CStyleCastExpr>(S); + R1 = CSC->getSubExpr()->getSourceRange(); + return CSC->getLParenLoc(); + } + case Expr::CXXFunctionalCastExprClass: { + const CXXFunctionalCastExpr *CE = cast <CXXFunctionalCastExpr>(S); + R1 = CE->getSubExpr()->getSourceRange(); + return CE->getTypeBeginLoc(); + } + case Expr::ImplicitCastExprClass: + ++sn; + goto top; + case Stmt::CXXTryStmtClass: { + return cast<CXXTryStmt>(S)->getHandler(0)->getCatchLoc(); + } + default: ; + } + R1 = S->getSourceRange(); + return S->getLocStart(); +} + +static SourceLocation MarkLiveTop(const CFGBlock *Start, + llvm::BitVector &reachable, + SourceManager &SM) { + + // Prep work worklist. + llvm::SmallVector<const CFGBlock*, 32> WL; + WL.push_back(Start); + + SourceRange R1, R2; + SourceLocation top = GetUnreachableLoc(*Start, R1, R2); + + bool FromMainFile = false; + bool FromSystemHeader = false; + bool TopValid = false; + + if (top.isValid()) { + FromMainFile = SM.isFromMainFile(top); + FromSystemHeader = SM.isInSystemHeader(top); + TopValid = true; + } + + // Solve + while (!WL.empty()) { + const CFGBlock *item = WL.back(); + WL.pop_back(); + + SourceLocation c = GetUnreachableLoc(*item, R1, R2); + if (c.isValid() + && (!TopValid + || (SM.isFromMainFile(c) && !FromMainFile) + || (FromSystemHeader && !SM.isInSystemHeader(c)) + || SM.isBeforeInTranslationUnit(c, top))) { + top = c; + FromMainFile = SM.isFromMainFile(top); + FromSystemHeader = SM.isInSystemHeader(top); + } + + reachable.set(item->getBlockID()); + for (CFGBlock::const_succ_iterator I=item->succ_begin(), E=item->succ_end(); + I != E; ++I) + if (const CFGBlock *B = *I) { + unsigned blockID = B->getBlockID(); + if (!reachable[blockID]) { + reachable.set(blockID); + WL.push_back(B); + } + } + } + + return top; +} + +static int LineCmp(const void *p1, const void *p2) { + SourceLocation *Line1 = (SourceLocation *)p1; + SourceLocation *Line2 = (SourceLocation *)p2; + return !(*Line1 < *Line2); +} + +namespace { +struct ErrLoc { + SourceLocation Loc; + SourceRange R1; + SourceRange R2; + ErrLoc(SourceLocation l, SourceRange r1, SourceRange r2) + : Loc(l), R1(r1), R2(r2) { } +}; +} +namespace clang { namespace reachable_code { + +/// ScanReachableFromBlock - Mark all blocks reachable from Start. +/// Returns the total number of blocks that were marked reachable. +unsigned ScanReachableFromBlock(const CFGBlock &Start, + llvm::BitVector &Reachable) { + unsigned count = 0; + llvm::SmallVector<const CFGBlock*, 32> WL; + + // Prep work queue + Reachable.set(Start.getBlockID()); + ++count; + WL.push_back(&Start); + + // Find the reachable blocks from 'Start'. + while (!WL.empty()) { + const CFGBlock *item = WL.back(); + WL.pop_back(); + + // Look at the successors and mark then reachable. + for (CFGBlock::const_succ_iterator I=item->succ_begin(), E=item->succ_end(); + I != E; ++I) + if (const CFGBlock *B = *I) { + unsigned blockID = B->getBlockID(); + if (!Reachable[blockID]) { + Reachable.set(blockID); + ++count; + WL.push_back(B); + } + } + } + return count; +} + +void FindUnreachableCode(AnalysisContext &AC, Callback &CB) { + CFG *cfg = AC.getCFG(); + if (!cfg) + return; + + // Scan for reachable blocks. + llvm::BitVector reachable(cfg->getNumBlockIDs()); + unsigned numReachable = ScanReachableFromBlock(cfg->getEntry(), reachable); + + // If there are no unreachable blocks, we're done. + if (numReachable == cfg->getNumBlockIDs()) + return; + + SourceRange R1, R2; + + llvm::SmallVector<ErrLoc, 24> lines; + bool AddEHEdges = AC.getAddEHEdges(); + + // First, give warnings for blocks with no predecessors, as they + // can't be part of a loop. + for (CFG::iterator I = cfg->begin(), E = cfg->end(); I != E; ++I) { + CFGBlock &b = **I; + if (!reachable[b.getBlockID()]) { + if (b.pred_empty()) { + if (!AddEHEdges && dyn_cast_or_null<CXXTryStmt>(b.getTerminator())) { + // When not adding EH edges from calls, catch clauses + // can otherwise seem dead. Avoid noting them as dead. + numReachable += ScanReachableFromBlock(b, reachable); + continue; + } + SourceLocation c = GetUnreachableLoc(b, R1, R2); + if (!c.isValid()) { + // Blocks without a location can't produce a warning, so don't mark + // reachable blocks from here as live. + reachable.set(b.getBlockID()); + ++numReachable; + continue; + } + lines.push_back(ErrLoc(c, R1, R2)); + // Avoid excessive errors by marking everything reachable from here + numReachable += ScanReachableFromBlock(b, reachable); + } + } + } + + if (numReachable < cfg->getNumBlockIDs()) { + // And then give warnings for the tops of loops. + for (CFG::iterator I = cfg->begin(), E = cfg->end(); I != E; ++I) { + CFGBlock &b = **I; + if (!reachable[b.getBlockID()]) + // Avoid excessive errors by marking everything reachable from here + lines.push_back(ErrLoc(MarkLiveTop(&b, reachable, + AC.getASTContext().getSourceManager()), + SourceRange(), SourceRange())); + } + } + + llvm::array_pod_sort(lines.begin(), lines.end(), LineCmp); + + for (llvm::SmallVectorImpl<ErrLoc>::iterator I=lines.begin(), E=lines.end(); + I != E; ++I) + if (I->Loc.isValid()) + CB.HandleUnreachable(I->Loc, I->R1, I->R2); +} + +}} // end namespace clang::reachable_code diff --git a/lib/Analysis/UninitializedValues.cpp b/lib/Analysis/UninitializedValues.cpp index bdc0e7c621f7..7a628642dc99 100644 --- a/lib/Analysis/UninitializedValues.cpp +++ b/lib/Analysis/UninitializedValues.cpp @@ -134,8 +134,12 @@ bool TransferFuncs::VisitDeclStmt(DeclStmt* S) { for (DeclStmt::decl_iterator I=S->decl_begin(), E=S->decl_end(); I!=E; ++I) { VarDecl *VD = dyn_cast<VarDecl>(*I); if (VD && VD->isBlockVarDecl()) { - if (Stmt* I = VD->getInit()) - V(VD,AD) = AD.FullUninitTaint ? V(cast<Expr>(I),AD) : Initialized; + if (Stmt* I = VD->getInit()) { + // Visit the subexpression to check for uses of uninitialized values, + // even if we don't propagate that value. + bool isSubExprUninit = Visit(I); + V(VD,AD) = AD.FullUninitTaint ? isSubExprUninit : Initialized; + } else { // Special case for declarations of array types. For things like: // diff --git a/lib/Basic/Diagnostic.cpp b/lib/Basic/Diagnostic.cpp index 094f7760a8ec..f7ec873e4c15 100644 --- a/lib/Basic/Diagnostic.cpp +++ b/lib/Basic/Diagnostic.cpp @@ -387,123 +387,6 @@ Diagnostic::getDiagnosticLevel(unsigned DiagID, unsigned DiagClass) const { return Result; } -static bool ReadUnsigned(const char *&Memory, const char *MemoryEnd, - unsigned &Value) { - if (Memory + sizeof(unsigned) > MemoryEnd) - return true; - - memmove(&Value, Memory, sizeof(unsigned)); - Memory += sizeof(unsigned); - return false; -} - -static bool ReadSourceLocation(FileManager &FM, SourceManager &SM, - const char *&Memory, const char *MemoryEnd, - SourceLocation &Location) { - // Read the filename. - unsigned FileNameLen = 0; - if (ReadUnsigned(Memory, MemoryEnd, FileNameLen) || - Memory + FileNameLen > MemoryEnd) - return true; - - llvm::StringRef FileName(Memory, FileNameLen); - Memory += FileNameLen; - - // Read the line, column. - unsigned Line = 0, Column = 0; - if (ReadUnsigned(Memory, MemoryEnd, Line) || - ReadUnsigned(Memory, MemoryEnd, Column)) - return true; - - if (FileName.empty()) { - Location = SourceLocation(); - return false; - } - - const FileEntry *File = FM.getFile(FileName); - if (!File) - return true; - - // Make sure that this file has an entry in the source manager. - if (!SM.hasFileInfo(File)) - SM.createFileID(File, SourceLocation(), SrcMgr::C_User); - - Location = SM.getLocation(File, Line, Column); - return false; -} - -DiagnosticBuilder Diagnostic::Deserialize(FileManager &FM, SourceManager &SM, - const char *&Memory, - const char *MemoryEnd) { - if (Memory == MemoryEnd) - return DiagnosticBuilder(0); - - // Read the severity level. - unsigned Level = 0; - if (ReadUnsigned(Memory, MemoryEnd, Level) || Level > Fatal) - return DiagnosticBuilder(0); - - // Read the source location. - SourceLocation Location; - if (ReadSourceLocation(FM, SM, Memory, MemoryEnd, Location)) - return DiagnosticBuilder(0); - - // Read the diagnostic text. - if (Memory == MemoryEnd) - return DiagnosticBuilder(0); - - unsigned MessageLen = 0; - if (ReadUnsigned(Memory, MemoryEnd, MessageLen) || - Memory + MessageLen > MemoryEnd) - return DiagnosticBuilder(0); - - llvm::StringRef Message(Memory, MessageLen); - Memory += MessageLen; - - // At this point, we have enough information to form a diagnostic. Do so. - unsigned DiagID = getCustomDiagID((enum Level)Level, Message); - DiagnosticBuilder DB = Report(FullSourceLoc(Location, SM), DiagID); - if (Memory == MemoryEnd) - return DB; - - // Read the source ranges. - unsigned NumSourceRanges = 0; - if (ReadUnsigned(Memory, MemoryEnd, NumSourceRanges)) - return DB; - for (unsigned I = 0; I != NumSourceRanges; ++I) { - SourceLocation Begin, End; - if (ReadSourceLocation(FM, SM, Memory, MemoryEnd, Begin) || - ReadSourceLocation(FM, SM, Memory, MemoryEnd, End)) - return DB; - - DB << SourceRange(Begin, End); - } - - // Read the fix-it hints. - unsigned NumFixIts = 0; - if (ReadUnsigned(Memory, MemoryEnd, NumFixIts)) - return DB; - for (unsigned I = 0; I != NumFixIts; ++I) { - SourceLocation RemoveBegin, RemoveEnd, InsertionLoc; - unsigned InsertLen = 0; - if (ReadSourceLocation(FM, SM, Memory, MemoryEnd, RemoveBegin) || - ReadSourceLocation(FM, SM, Memory, MemoryEnd, RemoveEnd) || - ReadSourceLocation(FM, SM, Memory, MemoryEnd, InsertionLoc) || - ReadUnsigned(Memory, MemoryEnd, InsertLen) || - Memory + InsertLen > MemoryEnd) - return DB; - - CodeModificationHint Hint; - Hint.RemoveRange = SourceRange(RemoveBegin, RemoveEnd); - Hint.InsertionLoc = InsertionLoc; - Hint.CodeToInsert.assign(Memory, Memory + InsertLen); - Memory += InsertLen; - DB << Hint; - } - - return DB; -} - struct WarningOption { const char *Name; const short *Members; @@ -1036,6 +919,31 @@ FormatDiagnostic(const char *DiagStr, const char *DiagEnd, } } +StoredDiagnostic::StoredDiagnostic() { } + +StoredDiagnostic::StoredDiagnostic(Diagnostic::Level Level, + llvm::StringRef Message) + : Level(Level), Loc(), Message(Message) { } + +StoredDiagnostic::StoredDiagnostic(Diagnostic::Level Level, + const DiagnosticInfo &Info) + : Level(Level), Loc(Info.getLocation()) +{ + llvm::SmallString<64> Message; + Info.FormatDiagnostic(Message); + this->Message.assign(Message.begin(), Message.end()); + + Ranges.reserve(Info.getNumRanges()); + for (unsigned I = 0, N = Info.getNumRanges(); I != N; ++I) + Ranges.push_back(Info.getRange(I)); + + FixIts.reserve(Info.getNumCodeModificationHints()); + for (unsigned I = 0, N = Info.getNumCodeModificationHints(); I != N; ++I) + FixIts.push_back(Info.getCodeModificationHint(I)); +} + +StoredDiagnostic::~StoredDiagnostic() { } + static void WriteUnsigned(llvm::raw_ostream &OS, unsigned Value) { OS.write((const char *)&Value, sizeof(unsigned)); } @@ -1065,27 +973,27 @@ static void WriteSourceLocation(llvm::raw_ostream &OS, WriteUnsigned(OS, SM->getColumnNumber(Decomposed.first, Decomposed.second)); } -void DiagnosticInfo::Serialize(Diagnostic::Level DiagLevel, - llvm::raw_ostream &OS) const { +void StoredDiagnostic::Serialize(llvm::raw_ostream &OS) const { SourceManager *SM = 0; if (getLocation().isValid()) SM = &const_cast<SourceManager &>(getLocation().getManager()); + // Write a short header to help identify diagnostics. + OS << (char)0x06 << (char)0x07; + // Write the diagnostic level and location. - WriteUnsigned(OS, (unsigned)DiagLevel); + WriteUnsigned(OS, (unsigned)Level); WriteSourceLocation(OS, SM, getLocation()); // Write the diagnostic message. llvm::SmallString<64> Message; - FormatDiagnostic(Message); - WriteString(OS, Message); + WriteString(OS, getMessage()); // Count the number of ranges that don't point into macros, since // only simple file ranges serialize well. unsigned NumNonMacroRanges = 0; - for (unsigned I = 0, N = getNumRanges(); I != N; ++I) { - SourceRange R = getRange(I); - if (R.getBegin().isMacroID() || R.getEnd().isMacroID()) + for (range_iterator R = range_begin(), REnd = range_end(); R != REnd; ++R) { + if (R->getBegin().isMacroID() || R->getEnd().isMacroID()) continue; ++NumNonMacroRanges; @@ -1094,44 +1002,185 @@ void DiagnosticInfo::Serialize(Diagnostic::Level DiagLevel, // Write the ranges. WriteUnsigned(OS, NumNonMacroRanges); if (NumNonMacroRanges) { - for (unsigned I = 0, N = getNumRanges(); I != N; ++I) { - SourceRange R = getRange(I); - if (R.getBegin().isMacroID() || R.getEnd().isMacroID()) + for (range_iterator R = range_begin(), REnd = range_end(); R != REnd; ++R) { + if (R->getBegin().isMacroID() || R->getEnd().isMacroID()) continue; - WriteSourceLocation(OS, SM, R.getBegin()); - WriteSourceLocation(OS, SM, R.getEnd()); + WriteSourceLocation(OS, SM, R->getBegin()); + WriteSourceLocation(OS, SM, R->getEnd()); } } // Determine if all of the fix-its involve rewrites with simple file // locations (not in macro instantiations). If so, we can write // fix-it information. - unsigned NumFixIts = getNumCodeModificationHints(); - for (unsigned I = 0; I != NumFixIts; ++I) { - const CodeModificationHint &Hint = getCodeModificationHint(I); - if (Hint.RemoveRange.isValid() && - (Hint.RemoveRange.getBegin().isMacroID() || - Hint.RemoveRange.getEnd().isMacroID())) { + unsigned NumFixIts = 0; + for (fixit_iterator F = fixit_begin(), FEnd = fixit_end(); F != FEnd; ++F) { + if (F->RemoveRange.isValid() && + (F->RemoveRange.getBegin().isMacroID() || + F->RemoveRange.getEnd().isMacroID())) { NumFixIts = 0; break; } - if (Hint.InsertionLoc.isValid() && Hint.InsertionLoc.isMacroID()) { + if (F->InsertionLoc.isValid() && F->InsertionLoc.isMacroID()) { NumFixIts = 0; break; } + + ++NumFixIts; } // Write the fix-its. WriteUnsigned(OS, NumFixIts); + for (fixit_iterator F = fixit_begin(), FEnd = fixit_end(); F != FEnd; ++F) { + WriteSourceLocation(OS, SM, F->RemoveRange.getBegin()); + WriteSourceLocation(OS, SM, F->RemoveRange.getEnd()); + WriteSourceLocation(OS, SM, F->InsertionLoc); + WriteString(OS, F->CodeToInsert); + } +} + +static bool ReadUnsigned(const char *&Memory, const char *MemoryEnd, + unsigned &Value) { + if (Memory + sizeof(unsigned) > MemoryEnd) + return true; + + memmove(&Value, Memory, sizeof(unsigned)); + Memory += sizeof(unsigned); + return false; +} + +static bool ReadSourceLocation(FileManager &FM, SourceManager &SM, + const char *&Memory, const char *MemoryEnd, + SourceLocation &Location) { + // Read the filename. + unsigned FileNameLen = 0; + if (ReadUnsigned(Memory, MemoryEnd, FileNameLen) || + Memory + FileNameLen > MemoryEnd) + return true; + + llvm::StringRef FileName(Memory, FileNameLen); + Memory += FileNameLen; + + // Read the line, column. + unsigned Line = 0, Column = 0; + if (ReadUnsigned(Memory, MemoryEnd, Line) || + ReadUnsigned(Memory, MemoryEnd, Column)) + return true; + + if (FileName.empty()) { + Location = SourceLocation(); + return false; + } + + const FileEntry *File = FM.getFile(FileName); + if (!File) + return true; + + // Make sure that this file has an entry in the source manager. + if (!SM.hasFileInfo(File)) + SM.createFileID(File, SourceLocation(), SrcMgr::C_User); + + Location = SM.getLocation(File, Line, Column); + return false; +} + +StoredDiagnostic +StoredDiagnostic::Deserialize(FileManager &FM, SourceManager &SM, + const char *&Memory, const char *MemoryEnd) { + while (true) { + if (Memory == MemoryEnd) + return StoredDiagnostic(); + + if (*Memory != 0x06) { + ++Memory; + continue; + } + + ++Memory; + if (Memory == MemoryEnd) + return StoredDiagnostic(); + + if (*Memory != 0x07) { + ++Memory; + continue; + } + + // We found the header. We're done. + ++Memory; + break; + } + + // Read the severity level. + unsigned Level = 0; + if (ReadUnsigned(Memory, MemoryEnd, Level) || Level > Diagnostic::Fatal) + return StoredDiagnostic(); + + // Read the source location. + SourceLocation Location; + if (ReadSourceLocation(FM, SM, Memory, MemoryEnd, Location)) + return StoredDiagnostic(); + + // Read the diagnostic text. + if (Memory == MemoryEnd) + return StoredDiagnostic(); + + unsigned MessageLen = 0; + if (ReadUnsigned(Memory, MemoryEnd, MessageLen) || + Memory + MessageLen > MemoryEnd) + return StoredDiagnostic(); + + llvm::StringRef Message(Memory, MessageLen); + Memory += MessageLen; + + + // At this point, we have enough information to form a diagnostic. Do so. + StoredDiagnostic Diag; + Diag.Level = (Diagnostic::Level)Level; + Diag.Loc = FullSourceLoc(Location, SM); + Diag.Message = Message; + if (Memory == MemoryEnd) + return Diag; + + // Read the source ranges. + unsigned NumSourceRanges = 0; + if (ReadUnsigned(Memory, MemoryEnd, NumSourceRanges)) + return Diag; + for (unsigned I = 0; I != NumSourceRanges; ++I) { + SourceLocation Begin, End; + if (ReadSourceLocation(FM, SM, Memory, MemoryEnd, Begin) || + ReadSourceLocation(FM, SM, Memory, MemoryEnd, End)) + return Diag; + + Diag.Ranges.push_back(SourceRange(Begin, End)); + } + + // Read the fix-it hints. + unsigned NumFixIts = 0; + if (ReadUnsigned(Memory, MemoryEnd, NumFixIts)) + return Diag; for (unsigned I = 0; I != NumFixIts; ++I) { - const CodeModificationHint &Hint = getCodeModificationHint(I); - WriteSourceLocation(OS, SM, Hint.RemoveRange.getBegin()); - WriteSourceLocation(OS, SM, Hint.RemoveRange.getEnd()); - WriteSourceLocation(OS, SM, Hint.InsertionLoc); - WriteString(OS, Hint.CodeToInsert); + SourceLocation RemoveBegin, RemoveEnd, InsertionLoc; + unsigned InsertLen = 0; + if (ReadSourceLocation(FM, SM, Memory, MemoryEnd, RemoveBegin) || + ReadSourceLocation(FM, SM, Memory, MemoryEnd, RemoveEnd) || + ReadSourceLocation(FM, SM, Memory, MemoryEnd, InsertionLoc) || + ReadUnsigned(Memory, MemoryEnd, InsertLen) || + Memory + InsertLen > MemoryEnd) { + Diag.FixIts.clear(); + return Diag; + } + + CodeModificationHint Hint; + Hint.RemoveRange = SourceRange(RemoveBegin, RemoveEnd); + Hint.InsertionLoc = InsertionLoc; + Hint.CodeToInsert.assign(Memory, Memory + InsertLen); + Memory += InsertLen; + Diag.FixIts.push_back(Hint); } + + return Diag; } /// IncludeInDiagnosticCounts - This method (whose default implementation diff --git a/lib/Basic/SourceManager.cpp b/lib/Basic/SourceManager.cpp index b91671ad17b1..0c22de7bddb1 100644 --- a/lib/Basic/SourceManager.cpp +++ b/lib/Basic/SourceManager.cpp @@ -980,20 +980,6 @@ SourceLocation SourceManager::getLocation(const FileEntry *SourceFile, if (Content->SourceLineCache == 0) ComputeLineNumbers(Content, ContentCacheAlloc); - if (Line > Content->NumLines) - return SourceLocation(); - - unsigned FilePos = Content->SourceLineCache[Line - 1]; - const char *Buf = Content->getBuffer()->getBufferStart() + FilePos; - unsigned BufLength = Content->getBuffer()->getBufferEnd() - Buf; - unsigned i = 0; - - // Check that the given column is valid. - while (i < BufLength-1 && i < Col-1 && Buf[i] != '\n' && Buf[i] != '\r') - ++i; - if (i < Col-1) - return SourceLocation(); - // Find the first file ID that corresponds to the given file. FileID FirstFID; @@ -1020,6 +1006,24 @@ SourceLocation SourceManager::getLocation(const FileEntry *SourceFile, if (FirstFID.isInvalid()) return SourceLocation(); + if (Line > Content->NumLines) { + unsigned Size = Content->getBuffer()->getBufferSize(); + if (Size > 0) + --Size; + return getLocForStartOfFile(FirstFID).getFileLocWithOffset(Size); + } + + unsigned FilePos = Content->SourceLineCache[Line - 1]; + const char *Buf = Content->getBuffer()->getBufferStart() + FilePos; + unsigned BufLength = Content->getBuffer()->getBufferEnd() - Buf; + unsigned i = 0; + + // Check that the given column is valid. + while (i < BufLength-1 && i < Col-1 && Buf[i] != '\n' && Buf[i] != '\r') + ++i; + if (i < Col-1) + return getLocForStartOfFile(FirstFID).getFileLocWithOffset(FilePos + i); + return getLocForStartOfFile(FirstFID).getFileLocWithOffset(FilePos + Col - 1); } diff --git a/lib/Basic/Targets.cpp b/lib/Basic/Targets.cpp index c1cd96e361ed..b8fe53599b52 100644 --- a/lib/Basic/Targets.cpp +++ b/lib/Basic/Targets.cpp @@ -436,11 +436,13 @@ void PPCTargetInfo::getTargetDefines(const LangOptions &Opts, // Target identification. Builder.defineMacro("__ppc__"); Builder.defineMacro("_ARCH_PPC"); + Builder.defineMacro("__powerpc__"); Builder.defineMacro("__POWERPC__"); if (PointerWidth == 64) { Builder.defineMacro("_ARCH_PPC64"); Builder.defineMacro("_LP64"); Builder.defineMacro("__LP64__"); + Builder.defineMacro("__powerpc64__"); Builder.defineMacro("__ppc64__"); } else { Builder.defineMacro("__ppc__"); @@ -571,9 +573,12 @@ void PPCTargetInfo::getGCCRegAliases(const GCCRegAlias *&Aliases, namespace { class PPC32TargetInfo : public PPCTargetInfo { public: - PPC32TargetInfo(const std::string& triple) : PPCTargetInfo(triple) { + PPC32TargetInfo(const std::string &triple) : PPCTargetInfo(triple) { DescriptionString = "E-p:32:32:32-i1:8:8-i8:8:8-i16:16:16-i32:32:32-" "i64:64:64-f32:32:32-f64:64:64-v128:128:128-n32"; + + if (getTriple().getOS() == llvm::Triple::FreeBSD) + this->SizeType = TargetInfo::UnsignedInt; } }; } // end anonymous namespace. @@ -1919,13 +1924,39 @@ namespace { namespace { class MipsTargetInfo : public TargetInfo { + std::string ABI, CPU; static const TargetInfo::GCCRegAlias GCCRegAliases[]; static const char * const GCCRegNames[]; public: - MipsTargetInfo(const std::string& triple) : TargetInfo(triple) { + MipsTargetInfo(const std::string& triple) : TargetInfo(triple), ABI("o32") { DescriptionString = "E-p:32:32:32-i1:8:8-i8:8:32-i16:16:32-i32:32:32-" "i64:32:64-f32:32:32-f64:64:64-v64:64:64-n32"; } + virtual const char *getABI() const { return ABI.c_str(); } + virtual bool setABI(const std::string &Name) { + + if ((Name == "o32") || (Name == "eabi")) { + ABI = Name; + return true; + } else + return false; + } + virtual bool setCPU(const std::string &Name) { + CPU = Name; + return true; + } + void getDefaultFeatures(const std::string &CPU, + llvm::StringMap<bool> &Features) const { + Features[ABI] = true; + Features[CPU] = true; + } + virtual void getArchDefines(const LangOptions &Opts, + MacroBuilder &Builder) const { + if (ABI == "o32") + Builder.defineMacro("__mips_o32"); + else if (ABI == "eabi") + Builder.defineMacro("__mips_eabi"); + } virtual void getTargetDefines(const LangOptions &Opts, MacroBuilder &Builder) const { DefineStd(Builder, "mips", Opts); @@ -1933,6 +1964,7 @@ public: DefineStd(Builder, "MIPSEB", Opts); Builder.defineMacro("_MIPSEB"); Builder.defineMacro("__REGISTER_PREFIX__", ""); + getArchDefines(Opts, Builder); } virtual void getTargetBuiltins(const Builtin::Info *&Records, unsigned &NumRecords) const { @@ -2044,6 +2076,7 @@ void MipselTargetInfo::getTargetDefines(const LangOptions &Opts, DefineStd(Builder, "MIPSEL", Opts); Builder.defineMacro("_MIPSEL"); Builder.defineMacro("__REGISTER_PREFIX__", ""); + getArchDefines(Opts, Builder); } } // end anonymous namespace. @@ -2096,6 +2129,8 @@ static TargetInfo *AllocateTarget(const std::string &T) { case llvm::Triple::ppc: if (os == llvm::Triple::Darwin) return new DarwinTargetInfo<PPCTargetInfo>(T); + else if (os == llvm::Triple::FreeBSD) + return new FreeBSDTargetInfo<PPC32TargetInfo>(T); return new PPC32TargetInfo(T); case llvm::Triple::ppc64: @@ -2103,6 +2138,8 @@ static TargetInfo *AllocateTarget(const std::string &T) { return new DarwinTargetInfo<PPC64TargetInfo>(T); else if (os == llvm::Triple::Lv2) return new PS3PPUTargetInfo<PPC64TargetInfo>(T); + else if (os == llvm::Triple::FreeBSD) + return new FreeBSDTargetInfo<PPC64TargetInfo>(T); return new PPC64TargetInfo(T); case llvm::Triple::sparc: diff --git a/lib/Basic/Version.cpp b/lib/Basic/Version.cpp index 98cf42b8c3d9..4d903055b5b9 100644 --- a/lib/Basic/Version.cpp +++ b/lib/Basic/Version.cpp @@ -40,15 +40,15 @@ llvm::StringRef getClangRepositoryPath() { } std::string getClangRevision() { -#ifndef SVN_REVISION - // Subversion was not available at build time? - return ""; -#else - std::string revision; - llvm::raw_string_ostream OS(revision); - OS << strtol(SVN_REVISION, 0, 10); - return revision; +#ifdef SVN_REVISION + if (SVN_REVISION[0] != '\0') { + std::string revision; + llvm::raw_string_ostream OS(revision); + OS << strtol(SVN_REVISION, 0, 10); + return revision; + } #endif + return ""; } std::string getClangFullRepositoryVersion() { diff --git a/lib/Checker/BasicStore.cpp b/lib/Checker/BasicStore.cpp index 6ef29429f681..d93a6658c681 100644 --- a/lib/Checker/BasicStore.cpp +++ b/lib/Checker/BasicStore.cpp @@ -95,6 +95,8 @@ public: const char *sep); private: + SVal LazyRetrieve(Store store, const TypedRegion *R); + ASTContext& getContext() { return StateMgr.getContext(); } }; @@ -126,6 +128,25 @@ static bool isHigherOrderRawPtr(QualType T, ASTContext &C) { } } +SVal BasicStoreManager::LazyRetrieve(Store store, const TypedRegion *R) { + const VarRegion *VR = dyn_cast<VarRegion>(R); + if (!VR) + return UnknownVal(); + + const VarDecl *VD = VR->getDecl(); + QualType T = VD->getType(); + + // Only handle simple types that we can symbolicate. + if (!SymbolManager::canSymbolicate(T) || !T->isScalarType()) + return UnknownVal(); + + // Globals and parameters start with symbolic values. + // Local variables initially are undefined. + if (VR->hasGlobalsOrParametersStorage()) + return ValMgr.getRegionValueSymbolVal(R); + return UndefinedVal(); +} + SVal BasicStoreManager::Retrieve(Store store, Loc loc, QualType T) { if (isa<UnknownVal>(loc)) return UnknownVal(); @@ -142,11 +163,13 @@ SVal BasicStoreManager::Retrieve(Store store, Loc loc, QualType T) { BindingsTy B = GetBindings(store); BindingsTy::data_type *Val = B.lookup(R); + const TypedRegion *TR = cast<TypedRegion>(R); - if (!Val) - break; + if (Val) + return CastRetrievedVal(*Val, TR, T); - return CastRetrievedVal(*Val, cast<TypedRegion>(R), T); + SVal V = LazyRetrieve(store, TR); + return V.isUnknownOrUndef() ? V : CastRetrievedVal(V, TR, T); } case loc::ConcreteIntKind: @@ -319,7 +342,7 @@ Store BasicStoreManager::scanForIvars(Stmt *B, const Decl* SelfDecl, const Expr *Base = IV->getBase()->IgnoreParenCasts(); if (const DeclRefExpr *DR = dyn_cast<DeclRefExpr>(Base)) { if (DR->getDecl() == SelfDecl) { - const MemRegion *IVR = MRMgr.getObjCIvarRegion(IV->getDecl(), + const ObjCIvarRegion *IVR = MRMgr.getObjCIvarRegion(IV->getDecl(), SelfRegion); SVal X = ValMgr.getRegionValueSymbolVal(IVR); St = Bind(St, ValMgr.makeLoc(IVR), X); @@ -351,10 +374,10 @@ Store BasicStoreManager::getInitialStore(const LocationContext *InitLoc) { if (MD->getSelfDecl() == PD) { // FIXME: Add type constraints (when they become available) to // SelfRegion? (i.e., it implements MD->getClassInterface()). - const MemRegion *VR = MRMgr.getVarRegion(PD, InitLoc); + const VarRegion *VR = MRMgr.getVarRegion(PD, InitLoc); const MemRegion *SelfRegion = - ValMgr.getRegionValueSymbolVal(VR).getAsRegion(); - assert(SelfRegion); + ValMgr.getRegionValueSymbolVal(VR).getAsRegion(); + assert(SelfRegion); St = Bind(St, ValMgr.makeLoc(VR), loc::MemRegionVal(SelfRegion)); // Scan the method for ivar references. While this requires an // entire AST scan, the cost should not be high in practice. @@ -362,21 +385,8 @@ Store BasicStoreManager::getInitialStore(const LocationContext *InitLoc) { } } } - else if (VarDecl* VD = dyn_cast<VarDecl>(ND)) { - // Only handle simple types that we can symbolicate. - if (!SymbolManager::canSymbolicate(VD->getType())) - continue; - - // Initialize globals and parameters to symbolic values. - // Initialize local variables to undefined. - const MemRegion *R = ValMgr.getRegionManager().getVarRegion(VD, InitLoc); - SVal X = UndefinedVal(); - if (R->hasGlobalsOrParametersStorage()) - X = ValMgr.getRegionValueSymbolVal(R); - - St = Bind(St, ValMgr.makeLoc(R), X); - } } + return St; } diff --git a/lib/Checker/BuiltinFunctionChecker.cpp b/lib/Checker/BuiltinFunctionChecker.cpp index 8711492049c5..9c8b51657b26 100644 --- a/lib/Checker/BuiltinFunctionChecker.cpp +++ b/lib/Checker/BuiltinFunctionChecker.cpp @@ -14,7 +14,6 @@ #include "GRExprEngineInternalChecks.h" #include "clang/Checker/PathSensitive/Checker.h" #include "clang/Basic/Builtins.h" -#include "llvm/ADT/StringSwitch.h" using namespace clang; diff --git a/lib/Checker/CFRefCount.cpp b/lib/Checker/CFRefCount.cpp index 324916a6f6eb..ecb98a0496f0 100644 --- a/lib/Checker/CFRefCount.cpp +++ b/lib/Checker/CFRefCount.cpp @@ -12,26 +12,26 @@ // //===----------------------------------------------------------------------===// +#include "clang/AST/DeclObjC.h" +#include "clang/AST/StmtVisitor.h" #include "clang/Basic/LangOptions.h" #include "clang/Basic/SourceManager.h" -#include "clang/Checker/PathSensitive/GRExprEngineBuilders.h" -#include "clang/Checker/PathSensitive/GRStateTrait.h" +#include "clang/Checker/BugReporter/BugReporter.h" #include "clang/Checker/BugReporter/PathDiagnostic.h" -#include "clang/Checker/Checkers/LocalCheckers.h" #include "clang/Checker/BugReporter/PathDiagnostic.h" -#include "clang/Checker/BugReporter/BugReporter.h" -#include "clang/Checker/PathSensitive/SymbolManager.h" -#include "clang/Checker/PathSensitive/GRTransferFuncs.h" -#include "clang/Checker/PathSensitive/CheckerVisitor.h" +#include "clang/Checker/Checkers/LocalCheckers.h" #include "clang/Checker/DomainSpecific/CocoaConventions.h" -#include "clang/AST/DeclObjC.h" -#include "clang/AST/StmtVisitor.h" +#include "clang/Checker/PathSensitive/CheckerVisitor.h" +#include "clang/Checker/PathSensitive/GRExprEngineBuilders.h" +#include "clang/Checker/PathSensitive/GRStateTrait.h" +#include "clang/Checker/PathSensitive/GRTransferFuncs.h" +#include "clang/Checker/PathSensitive/SymbolManager.h" #include "llvm/ADT/DenseMap.h" #include "llvm/ADT/FoldingSet.h" -#include "llvm/ADT/ImmutableMap.h" #include "llvm/ADT/ImmutableList.h" -#include "llvm/ADT/StringExtras.h" +#include "llvm/ADT/ImmutableMap.h" #include "llvm/ADT/STLExtras.h" +#include "llvm/ADT/StringExtras.h" #include <stdarg.h> using namespace clang; @@ -1222,6 +1222,12 @@ RetainSummaryManager::updateSummaryFromAnnotations(RetainSummary &Summ, else if (FD->getAttr<CFReturnsRetainedAttr>()) { Summ.setRetEffect(RetEffect::MakeOwned(RetEffect::CF, true)); } + else if (FD->getAttr<NSReturnsNotRetainedAttr>()) { + Summ.setRetEffect(RetEffect::MakeNotOwned(RetEffect::ObjC)); + } + else if (FD->getAttr<CFReturnsNotRetainedAttr>()) { + Summ.setRetEffect(RetEffect::MakeNotOwned(RetEffect::CF)); + } } else if (RetTy->getAs<PointerType>()) { if (FD->getAttr<CFReturnsRetainedAttr>()) { @@ -1244,6 +1250,10 @@ RetainSummaryManager::updateSummaryFromAnnotations(RetainSummary &Summ, Summ.setRetEffect(ObjCAllocRetE); return; } + if (MD->getAttr<NSReturnsNotRetainedAttr>()) { + Summ.setRetEffect(RetEffect::MakeNotOwned(RetEffect::ObjC)); + return; + } isTrackedLoc = true; } @@ -1251,8 +1261,12 @@ RetainSummaryManager::updateSummaryFromAnnotations(RetainSummary &Summ, if (!isTrackedLoc) isTrackedLoc = MD->getResultType()->getAs<PointerType>() != NULL; - if (isTrackedLoc && MD->getAttr<CFReturnsRetainedAttr>()) - Summ.setRetEffect(RetEffect::MakeOwned(RetEffect::CF, true)); + if (isTrackedLoc) { + if (MD->getAttr<CFReturnsRetainedAttr>()) + Summ.setRetEffect(RetEffect::MakeOwned(RetEffect::CF, true)); + else if (MD->getAttr<CFReturnsNotRetainedAttr>()) + Summ.setRetEffect(RetEffect::MakeNotOwned(RetEffect::CF)); + } } RetainSummary* diff --git a/lib/Checker/CMakeLists.txt b/lib/Checker/CMakeLists.txt index 7b21d08dcb71..c5bd2eb7cc2c 100644 --- a/lib/Checker/CMakeLists.txt +++ b/lib/Checker/CMakeLists.txt @@ -18,7 +18,6 @@ add_clang_library(clangChecker CheckDeadStores.cpp CheckObjCDealloc.cpp CheckObjCInstMethSignature.cpp - CheckObjCUnusedIVars.cpp CheckSecuritySyntaxOnly.cpp CheckSizeofPointer.cpp Checker.cpp @@ -35,6 +34,7 @@ add_clang_library(clangChecker GRExprEngineExperimentalChecks.cpp GRState.cpp LLVMConventionsChecker.cpp + MacOSXAPIChecker.cpp MallocChecker.cpp ManagerRegistry.cpp MemRegion.cpp @@ -42,6 +42,7 @@ add_clang_library(clangChecker NSErrorChecker.cpp NoReturnFunctionChecker.cpp OSAtomicChecker.cpp + ObjCUnusedIVarsChecker.cpp PathDiagnostic.cpp PointerArithChecker.cpp PointerSubChecker.cpp @@ -62,6 +63,7 @@ add_clang_library(clangChecker UndefResultChecker.cpp UndefinedArraySubscriptChecker.cpp UndefinedAssignmentChecker.cpp + UnixAPIChecker.cpp VLASizeChecker.cpp ValueManager.cpp ) diff --git a/lib/Checker/CallInliner.cpp b/lib/Checker/CallInliner.cpp index d94994b19437..88e1a05d1191 100644 --- a/lib/Checker/CallInliner.cpp +++ b/lib/Checker/CallInliner.cpp @@ -26,7 +26,6 @@ public: } virtual bool EvalCallExpr(CheckerContext &C, const CallExpr *CE); - virtual void EvalEndPath(GREndPathNodeBuilder &B,void *tag,GRExprEngine &Eng); }; } @@ -43,71 +42,13 @@ bool CallInliner::EvalCallExpr(CheckerContext &C, const CallExpr *CE) { if (!FD) return false; - if (!FD->isThisDeclarationADefinition()) + if (!FD->getBody(FD)) return false; - GRStmtNodeBuilder &Builder = C.getNodeBuilder(); - // Make a new LocationContext. - const StackFrameContext *LocCtx = C.getAnalysisManager().getStackFrame(FD, - C.getPredecessor()->getLocationContext(), CE, - Builder.getBlock(), Builder.getIndex()); - - CFGBlock const *Entry = &(LocCtx->getCFG()->getEntry()); - - assert (Entry->empty() && "Entry block must be empty."); - - assert (Entry->succ_size() == 1 && "Entry block must have 1 successor."); - - // Get the solitary successor. - CFGBlock const *SuccB = *(Entry->succ_begin()); - - // Construct an edge representing the starting location in the function. - BlockEdge Loc(Entry, SuccB, LocCtx); - - state = C.getStoreManager().EnterStackFrame(state, LocCtx); - // This is a hack. We really should not use the GRStmtNodeBuilder. - bool isNew; - GRExprEngine &Eng = C.getEngine(); - ExplodedNode *Pred = C.getPredecessor(); - - - ExplodedNode *SuccN = Eng.getGraph().getNode(Loc, state, &isNew); - SuccN->addPredecessor(Pred, Eng.getGraph()); - C.getNodeBuilder().Deferred.erase(Pred); - - if (isNew) - Builder.getWorkList()->Enqueue(SuccN); - - Builder.HasGeneratedNode = true; + // Now we have the definition of the callee, create a CallEnter node. + CallEnter Loc(CE, FD, C.getPredecessor()->getLocationContext()); + C.addTransition(state, Loc); return true; } -void CallInliner::EvalEndPath(GREndPathNodeBuilder &B, void *tag, - GRExprEngine &Eng) { - const GRState *state = B.getState(); - ExplodedNode *Pred = B.getPredecessor(); - const StackFrameContext *LocCtx = - cast<StackFrameContext>(Pred->getLocationContext()); - - const Stmt *CE = LocCtx->getCallSite(); - - // Check if this is the top level stack frame. - if (!LocCtx->getParent()) - return; - - PostStmt NodeLoc(CE, LocCtx->getParent()); - - bool isNew; - ExplodedNode *Succ = Eng.getGraph().getNode(NodeLoc, state, &isNew); - Succ->addPredecessor(Pred, Eng.getGraph()); - - // When creating the new work list unit, increment the statement index to - // point to the statement after the CallExpr. - if (isNew) - B.getWorkList().Enqueue(Succ, - *const_cast<CFGBlock*>(LocCtx->getCallSiteBlock()), - LocCtx->getIndex() + 1); - - B.HasGeneratedNode = true; -} diff --git a/lib/Checker/CheckDeadStores.cpp b/lib/Checker/CheckDeadStores.cpp index 4a7ca705488a..31f9390e6228 100644 --- a/lib/Checker/CheckDeadStores.cpp +++ b/lib/Checker/CheckDeadStores.cpp @@ -142,7 +142,8 @@ public: if (VarDecl *VD = dyn_cast<VarDecl>(DR->getDecl())) { // Special case: check for assigning null to a pointer. // This is a common form of defensive programming. - if (VD->getType()->isPointerType()) { + QualType T = VD->getType(); + if (T->isPointerType() || T->isObjCObjectPointerType()) { if (B->getRHS()->isNullPointerConstant(Ctx, Expr::NPC_ValueDependentIsNull)) return; diff --git a/lib/Checker/FlatStore.cpp b/lib/Checker/FlatStore.cpp index dac66def5dc9..07a54fb48736 100644 --- a/lib/Checker/FlatStore.cpp +++ b/lib/Checker/FlatStore.cpp @@ -97,7 +97,7 @@ SVal FlatStoreManager::RetrieveRegionWithNoBinding(const MemRegion *R, if (R->hasStackNonParametersStorage()) return UndefinedVal(); else - return ValMgr.getRegionValueSymbolVal(R, T); + return ValMgr.getRegionValueSymbolVal(cast<TypedRegion>(R)); } Store FlatStoreManager::Bind(Store store, Loc L, SVal val) { diff --git a/lib/Checker/GRCoreEngine.cpp b/lib/Checker/GRCoreEngine.cpp index d54b0777eda7..a9347d01641c 100644 --- a/lib/Checker/GRCoreEngine.cpp +++ b/lib/Checker/GRCoreEngine.cpp @@ -144,6 +144,14 @@ void GRCoreEngine::ProcessSwitch(GRSwitchNodeBuilder& Builder) { SubEngine.ProcessSwitch(Builder); } +void GRCoreEngine::ProcessCallEnter(GRCallEnterNodeBuilder &Builder) { + SubEngine.ProcessCallEnter(Builder); +} + +void GRCoreEngine::ProcessCallExit(GRCallExitNodeBuilder &Builder) { + SubEngine.ProcessCallExit(Builder); +} + /// ExecuteWorkList - Run the worklist algorithm for a maximum number of steps. bool GRCoreEngine::ExecuteWorkList(const LocationContext *L, unsigned Steps) { @@ -196,6 +204,15 @@ bool GRCoreEngine::ExecuteWorkList(const LocationContext *L, unsigned Steps) { assert (false && "BlockExit location never occur in forward analysis."); break; + case ProgramPoint::CallEnterKind: + HandleCallEnter(cast<CallEnter>(Node->getLocation()), WU.getBlock(), + WU.getIndex(), Node); + break; + + case ProgramPoint::CallExitKind: + HandleCallExit(cast<CallExit>(Node->getLocation()), Node); + break; + default: assert(isa<PostStmt>(Node->getLocation())); HandlePostStmt(cast<PostStmt>(Node->getLocation()), WU.getBlock(), @@ -207,6 +224,17 @@ bool GRCoreEngine::ExecuteWorkList(const LocationContext *L, unsigned Steps) { return WList->hasWork(); } +void GRCoreEngine::HandleCallEnter(const CallEnter &L, const CFGBlock *Block, + unsigned Index, ExplodedNode *Pred) { + GRCallEnterNodeBuilder Builder(*this, Pred, L.getCallExpr(), L.getCallee(), + Block, Index); + ProcessCallEnter(Builder); +} + +void GRCoreEngine::HandleCallExit(const CallExit &L, ExplodedNode *Pred) { + GRCallExitNodeBuilder Builder(*this, Pred); + ProcessCallExit(Builder); +} void GRCoreEngine::HandleBlockEdge(const BlockEdge& L, ExplodedNode* Pred) { @@ -384,11 +412,11 @@ void GRCoreEngine::GenerateNode(const ProgramPoint& Loc, GRStmtNodeBuilder::GRStmtNodeBuilder(CFGBlock* b, unsigned idx, ExplodedNode* N, GRCoreEngine* e, GRStateManager &mgr) - : Eng(*e), B(*b), Idx(idx), Pred(N), LastNode(N), Mgr(mgr), Auditor(0), + : Eng(*e), B(*b), Idx(idx), Pred(N), Mgr(mgr), Auditor(0), PurgingDeadSymbols(false), BuildSinks(false), HasGeneratedNode(false), PointKind(ProgramPoint::PostStmtKind), Tag(0) { Deferred.insert(N); - CleanedState = getLastNode()->getState(); + CleanedState = Pred->getState(); } GRStmtNodeBuilder::~GRStmtNodeBuilder() { @@ -400,6 +428,14 @@ GRStmtNodeBuilder::~GRStmtNodeBuilder() { void GRStmtNodeBuilder::GenerateAutoTransition(ExplodedNode* N) { assert (!N->isSink()); + // Check if this node entered a callee. + if (isa<CallEnter>(N->getLocation())) { + // Still use the index of the CallExpr. It's needed to create the callee + // StackFrameContext. + Eng.WList->Enqueue(N, B, Idx); + return; + } + PostStmt Loc(getStmt(), N->getLocationContext()); if (Loc == N->getLocation()) { @@ -462,11 +498,9 @@ GRStmtNodeBuilder::generateNodeInternal(const ProgramPoint &Loc, if (IsNew) { Deferred.insert(N); - LastNode = N; return N; } - LastNode = NULL; return NULL; } @@ -576,7 +610,13 @@ GRSwitchNodeBuilder::generateDefaultCaseNode(const GRState* St, bool isSink) { GREndPathNodeBuilder::~GREndPathNodeBuilder() { // Auto-generate an EOP node if one has not been generated. - if (!HasGeneratedNode) generateNode(Pred->State); + if (!HasGeneratedNode) { + // If we are in an inlined call, generate CallExit node. + if (Pred->getLocationContext()->getParent()) + GenerateCallExitNode(Pred->State); + else + generateNode(Pred->State); + } } ExplodedNode* @@ -597,3 +637,57 @@ GREndPathNodeBuilder::generateNode(const GRState* State, const void *tag, return NULL; } + +void GREndPathNodeBuilder::GenerateCallExitNode(const GRState *state) { + HasGeneratedNode = true; + // Create a CallExit node and enqueue it. + const StackFrameContext *LocCtx + = cast<StackFrameContext>(Pred->getLocationContext()); + const Stmt *CE = LocCtx->getCallSite(); + + // Use the the callee location context. + CallExit Loc(CE, LocCtx); + + bool isNew; + ExplodedNode *Node = Eng.G->getNode(Loc, state, &isNew); + Node->addPredecessor(Pred, *Eng.G); + + if (isNew) + Eng.WList->Enqueue(Node); +} + + +void GRCallEnterNodeBuilder::GenerateNode(const GRState *state, + const LocationContext *LocCtx) { + // Get the callee entry block. + const CFGBlock *Entry = &(LocCtx->getCFG()->getEntry()); + assert(Entry->empty()); + assert(Entry->succ_size() == 1); + + // Get the solitary successor. + const CFGBlock *SuccB = *(Entry->succ_begin()); + + // Construct an edge representing the starting location in the callee. + BlockEdge Loc(Entry, SuccB, LocCtx); + + bool isNew; + ExplodedNode *Node = Eng.G->getNode(Loc, state, &isNew); + Node->addPredecessor(const_cast<ExplodedNode*>(Pred), *Eng.G); + + if (isNew) + Eng.WList->Enqueue(Node); +} + +void GRCallExitNodeBuilder::GenerateNode(const GRState *state) { + // Get the callee's location context. + const StackFrameContext *LocCtx + = cast<StackFrameContext>(Pred->getLocationContext()); + + PostStmt Loc(LocCtx->getCallSite(), LocCtx->getParent()); + bool isNew; + ExplodedNode *Node = Eng.G->getNode(Loc, state, &isNew); + Node->addPredecessor(const_cast<ExplodedNode*>(Pred), *Eng.G); + if (isNew) + Eng.WList->Enqueue(Node, *const_cast<CFGBlock*>(LocCtx->getCallSiteBlock()), + LocCtx->getIndex() + 1); +} diff --git a/lib/Checker/GRExprEngine.cpp b/lib/Checker/GRExprEngine.cpp index 7f863193743b..ad229c7b8fbc 100644 --- a/lib/Checker/GRExprEngine.cpp +++ b/lib/Checker/GRExprEngine.cpp @@ -37,6 +37,15 @@ using llvm::dyn_cast_or_null; using llvm::cast; using llvm::APSInt; +namespace { + // Trait class for recording returned expression in the state. + struct ReturnExpr { + static int TagInt; + typedef const Stmt *data_type; + }; + int ReturnExpr::TagInt; +} + //===----------------------------------------------------------------------===// // Utility functions. //===----------------------------------------------------------------------===// @@ -318,6 +327,8 @@ static void RegisterInternalChecks(GRExprEngine &Eng) { RegisterNoReturnFunctionChecker(Eng); RegisterBuiltinFunctionChecker(Eng); RegisterOSAtomicChecker(Eng); + RegisterUnixAPIChecker(Eng); + RegisterMacOSXAPIChecker(Eng); } GRExprEngine::GRExprEngine(AnalysisManager &mgr, GRTransferFuncs *tf) @@ -458,7 +469,7 @@ void GRExprEngine::ProcessStmt(CFGElement CE, GRStmtNodeBuilder& builder) { "Error evaluating statement"); Builder = &builder; - EntryNode = builder.getLastNode(); + EntryNode = builder.getBasePredecessor(); // Set up our simple checks. if (BatchAuditor) @@ -1288,6 +1299,37 @@ void GRExprEngine::ProcessSwitch(GRSwitchNodeBuilder& builder) { if (defaultIsFeasible) builder.generateDefaultCaseNode(DefaultSt); } +void GRExprEngine::ProcessCallEnter(GRCallEnterNodeBuilder &B) { + const FunctionDecl *FD = B.getCallee(); + const StackFrameContext *LocCtx = AMgr.getStackFrame(FD, + B.getLocationContext(), + B.getCallExpr(), + B.getBlock(), + B.getIndex()); + + const GRState *state = B.getState(); + state = getStoreManager().EnterStackFrame(state, LocCtx); + + B.GenerateNode(state, LocCtx); +} + +void GRExprEngine::ProcessCallExit(GRCallExitNodeBuilder &B) { + const GRState *state = B.getState(); + const ExplodedNode *Pred = B.getPredecessor(); + const StackFrameContext *LocCtx = + cast<StackFrameContext>(Pred->getLocationContext()); + const Stmt *CE = LocCtx->getCallSite(); + + // If the callee returns an expression, bind its value to CallExpr. + const Stmt *ReturnedExpr = state->get<ReturnExpr>(); + if (ReturnedExpr) { + SVal RetVal = state->getSVal(ReturnedExpr); + state = state->BindExpr(CE, RetVal); + } + + B.GenerateNode(state); +} + //===----------------------------------------------------------------------===// // Transfer functions: logical operations ('&&', '||'). //===----------------------------------------------------------------------===// @@ -2316,8 +2358,9 @@ void GRExprEngine::VisitDeclStmt(DeclStmt *DS, ExplodedNode *Pred, // Recover some path-sensitivity if a scalar value evaluated to // UnknownVal. - if (InitVal.isUnknown() || - !getConstraintManager().canReasonAbout(InitVal)) { + if ((InitVal.isUnknown() || + !getConstraintManager().canReasonAbout(InitVal)) && + !VD->getType()->isReferenceType()) { InitVal = ValMgr.getConjuredSymbolVal(NULL, InitEx, Builder->getCurrentBlockCount()); } @@ -2855,10 +2898,19 @@ void GRExprEngine::VisitAsmStmtHelperInputs(AsmStmt* A, void GRExprEngine::VisitReturnStmt(ReturnStmt *RS, ExplodedNode *Pred, ExplodedNodeSet &Dst) { - ExplodedNodeSet Src; if (Expr *RetE = RS->getRetValue()) { - Visit(RetE, Pred, Src); + // Record the returned expression in the state. + { + static int Tag = 0; + SaveAndRestore<const void *> OldTag(Builder->Tag, &Tag); + const GRState *state = GetState(Pred); + state = state->set<ReturnExpr>(RetE); + Pred = Builder->generateNode(RetE, state, Pred); + } + // We may get a NULL Pred because we generated a cached node. + if (Pred) + Visit(RetE, Pred, Src); } else { Src.Add(Pred); @@ -3139,6 +3191,14 @@ struct DOTGraphTraits<ExplodedNode*> : assert (false); break; + case ProgramPoint::CallEnterKind: + Out << "CallEnter"; + break; + + case ProgramPoint::CallExitKind: + Out << "CallExit"; + break; + default: { if (StmtPoint *L = dyn_cast<StmtPoint>(&Loc)) { const Stmt* S = L->getStmt(); diff --git a/lib/Checker/GRExprEngineInternalChecks.h b/lib/Checker/GRExprEngineInternalChecks.h index 64a930d504cf..d1176001cac7 100644 --- a/lib/Checker/GRExprEngineInternalChecks.h +++ b/lib/Checker/GRExprEngineInternalChecks.h @@ -19,27 +19,33 @@ namespace clang { class GRExprEngine; +// Foundational checks that handle basic semantics. void RegisterAdjustedReturnValueChecker(GRExprEngine &Eng); +void RegisterArrayBoundChecker(GRExprEngine &Eng); void RegisterAttrNonNullChecker(GRExprEngine &Eng); +void RegisterBuiltinFunctionChecker(GRExprEngine &Eng); +void RegisterCallAndMessageChecker(GRExprEngine &Eng); +void RegisterCastToStructChecker(GRExprEngine &Eng); void RegisterDereferenceChecker(GRExprEngine &Eng); void RegisterDivZeroChecker(GRExprEngine &Eng); +void RegisterFixedAddressChecker(GRExprEngine &Eng); +void RegisterNoReturnFunctionChecker(GRExprEngine &Eng); +void RegisterPointerArithChecker(GRExprEngine &Eng); +void RegisterPointerSubChecker(GRExprEngine &Eng); void RegisterReturnPointerRangeChecker(GRExprEngine &Eng); -void RegisterReturnStackAddressChecker(GRExprEngine &Eng); +void RegisterReturnStackAddressChecker(GRExprEngine &Eng); void RegisterReturnUndefChecker(GRExprEngine &Eng); -void RegisterVLASizeChecker(GRExprEngine &Eng); -void RegisterPointerSubChecker(GRExprEngine &Eng); -void RegisterPointerArithChecker(GRExprEngine &Eng); -void RegisterFixedAddressChecker(GRExprEngine &Eng); -void RegisterCastToStructChecker(GRExprEngine &Eng); -void RegisterCallAndMessageChecker(GRExprEngine &Eng); -void RegisterArrayBoundChecker(GRExprEngine &Eng); -void RegisterUndefinedArraySubscriptChecker(GRExprEngine &Eng); -void RegisterUndefinedAssignmentChecker(GRExprEngine &Eng); void RegisterUndefBranchChecker(GRExprEngine &Eng); void RegisterUndefCapturedBlockVarChecker(GRExprEngine &Eng); void RegisterUndefResultChecker(GRExprEngine &Eng); -void RegisterNoReturnFunctionChecker(GRExprEngine &Eng); -void RegisterBuiltinFunctionChecker(GRExprEngine &Eng); +void RegisterUndefinedArraySubscriptChecker(GRExprEngine &Eng); +void RegisterUndefinedAssignmentChecker(GRExprEngine &Eng); +void RegisterVLASizeChecker(GRExprEngine &Eng); + +// API checks. +void RegisterMacOSXAPIChecker(GRExprEngine &Eng); void RegisterOSAtomicChecker(GRExprEngine &Eng); +void RegisterUnixAPIChecker(GRExprEngine &Eng); + } // end clang namespace #endif diff --git a/lib/Checker/MacOSXAPIChecker.cpp b/lib/Checker/MacOSXAPIChecker.cpp new file mode 100644 index 000000000000..9621e853bc48 --- /dev/null +++ b/lib/Checker/MacOSXAPIChecker.cpp @@ -0,0 +1,141 @@ +// MacOSXAPIChecker.h - Checks proper use of various MacOS X APIs --*- C++ -*-// +// +// The LLVM Compiler Infrastructure +// +// This file is distributed under the University of Illinois Open Source +// License. See LICENSE.TXT for details. +// +//===----------------------------------------------------------------------===// +// +// This defines MacOSXAPIChecker, which is an assortment of checks on calls +// to various, widely used Mac OS X functions. +// +// FIXME: What's currently in BasicObjCFoundationChecks.cpp should be migrated +// to here, using the new Checker interface. +// +//===----------------------------------------------------------------------===// + +#include "GRExprEngineInternalChecks.h" +#include "clang/Basic/TargetInfo.h" +#include "clang/Checker/BugReporter/BugReporter.h" +#include "clang/Checker/PathSensitive/CheckerVisitor.h" +#include "clang/Checker/PathSensitive/GRStateTrait.h" +#include "llvm/ADT/SmallString.h" +#include "llvm/ADT/StringSwitch.h" +#include "llvm/Support/raw_ostream.h" + +using namespace clang; + +namespace { +class MacOSXAPIChecker : public CheckerVisitor<MacOSXAPIChecker> { + enum SubChecks { + DispatchOnce = 0, + DispatchOnceF, + NumChecks + }; + + BugType *BTypes[NumChecks]; + +public: + MacOSXAPIChecker() { memset(BTypes, 0, sizeof(*BTypes) * NumChecks); } + static void *getTag() { static unsigned tag = 0; return &tag; } + + void PreVisitCallExpr(CheckerContext &C, const CallExpr *CE); +}; +} //end anonymous namespace + +void clang::RegisterMacOSXAPIChecker(GRExprEngine &Eng) { + if (Eng.getContext().Target.getTriple().getVendor() == llvm::Triple::Apple) + Eng.registerCheck(new MacOSXAPIChecker()); +} + +//===----------------------------------------------------------------------===// +// dispatch_once and dispatch_once_f +//===----------------------------------------------------------------------===// + +static void CheckDispatchOnce(CheckerContext &C, const CallExpr *CE, + BugType *&BT, const IdentifierInfo *FI) { + + if (!BT) { + llvm::SmallString<128> S; + llvm::raw_svector_ostream os(S); + os << "Improper use of '" << FI->getName() << '\''; + BT = new BugType(os.str(), "Mac OS X API"); + } + + if (CE->getNumArgs() < 1) + return; + + // Check if the first argument is stack allocated. If so, issue a warning + // because that's likely to be bad news. + const GRState *state = C.getState(); + const MemRegion *R = state->getSVal(CE->getArg(0)).getAsRegion(); + if (!R || !isa<StackSpaceRegion>(R->getMemorySpace())) + return; + + ExplodedNode *N = C.GenerateSink(state); + if (!N) + return; + + llvm::SmallString<256> S; + llvm::raw_svector_ostream os(S); + os << "Call to '" << FI->getName() << "' uses"; + if (const VarRegion *VR = dyn_cast<VarRegion>(R)) + os << " the local variable '" << VR->getDecl()->getName() << '\''; + else + os << " stack allocated memory"; + os << " for the predicate value. Using such transient memory for " + "the predicate is potentially dangerous."; + if (isa<VarRegion>(R) && isa<StackLocalsSpaceRegion>(R->getMemorySpace())) + os << " Perhaps you intended to declare the variable as 'static'?"; + + EnhancedBugReport *report = new EnhancedBugReport(*BT, os.str(), N); + report->addRange(CE->getArg(0)->getSourceRange()); + C.EmitReport(report); +} + +//===----------------------------------------------------------------------===// +// Central dispatch function. +//===----------------------------------------------------------------------===// + +typedef void (*SubChecker)(CheckerContext &C, const CallExpr *CE, BugType *&BT, + const IdentifierInfo *FI); +namespace { + class SubCheck { + SubChecker SC; + BugType **BT; + public: + SubCheck(SubChecker sc, BugType *& bt) : SC(sc), BT(&bt) {} + SubCheck() : SC(NULL), BT(NULL) {} + + void run(CheckerContext &C, const CallExpr *CE, + const IdentifierInfo *FI) const { + if (SC) + SC(C, CE, *BT, FI); + } + }; +} // end anonymous namespace + +void MacOSXAPIChecker::PreVisitCallExpr(CheckerContext &C, const CallExpr *CE) { + // FIXME: Mostly copy and paste from UnixAPIChecker. Should refactor. + const GRState *state = C.getState(); + const Expr *Callee = CE->getCallee(); + const FunctionTextRegion *Fn = + dyn_cast_or_null<FunctionTextRegion>(state->getSVal(Callee).getAsRegion()); + + if (!Fn) + return; + + const IdentifierInfo *FI = Fn->getDecl()->getIdentifier(); + if (!FI) + return; + + const SubCheck &SC = + llvm::StringSwitch<SubCheck>(FI->getName()) + .Case("dispatch_once", SubCheck(CheckDispatchOnce, BTypes[DispatchOnce])) + .Case("dispatch_once_f", SubCheck(CheckDispatchOnce, + BTypes[DispatchOnceF])) + .Default(SubCheck()); + + SC.run(C, CE, FI); +} diff --git a/lib/Checker/MemRegion.cpp b/lib/Checker/MemRegion.cpp index 194015a11b11..9a26988fcf1d 100644 --- a/lib/Checker/MemRegion.cpp +++ b/lib/Checker/MemRegion.cpp @@ -419,20 +419,27 @@ const REG *MemRegionManager::LazyAllocate(REG*& region, ARG a) { const StackLocalsSpaceRegion* MemRegionManager::getStackLocalsRegion(const StackFrameContext *STC) { assert(STC); - if (STC == cachedStackLocalsFrame) - return cachedStackLocalsRegion; - cachedStackLocalsFrame = STC; - return LazyAllocate(cachedStackLocalsRegion, STC); + StackLocalsSpaceRegion *&R = StackLocalsSpaceRegions[STC]; + + if (R) + return R; + + R = A.Allocate<StackLocalsSpaceRegion>(); + new (R) StackLocalsSpaceRegion(this, STC); + return R; } const StackArgumentsSpaceRegion * MemRegionManager::getStackArgumentsRegion(const StackFrameContext *STC) { assert(STC); - if (STC == cachedStackArgumentsFrame) - return cachedStackArgumentsRegion; - - cachedStackArgumentsFrame = STC; - return LazyAllocate(cachedStackArgumentsRegion, STC); + StackArgumentsSpaceRegion *&R = StackArgumentsSpaceRegions[STC]; + + if (R) + return R; + + R = A.Allocate<StackArgumentsSpaceRegion>(); + new (R) StackArgumentsSpaceRegion(this, STC); + return R; } const GlobalsSpaceRegion *MemRegionManager::getGlobalsRegion() { diff --git a/lib/Checker/OSAtomicChecker.cpp b/lib/Checker/OSAtomicChecker.cpp index 7f4aeca33178..e743528e2399 100644 --- a/lib/Checker/OSAtomicChecker.cpp +++ b/lib/Checker/OSAtomicChecker.cpp @@ -14,7 +14,6 @@ #include "GRExprEngineInternalChecks.h" #include "clang/Checker/PathSensitive/Checker.h" #include "clang/Basic/Builtins.h" -#include "llvm/ADT/StringSwitch.h" using namespace clang; diff --git a/lib/Checker/CheckObjCUnusedIVars.cpp b/lib/Checker/ObjCUnusedIVarsChecker.cpp index f2cf58191632..04d897aec894 100644 --- a/lib/Checker/CheckObjCUnusedIVars.cpp +++ b/lib/Checker/ObjCUnusedIVarsChecker.cpp @@ -1,4 +1,4 @@ -//==- CheckObjCUnusedIVars.cpp - Check for unused ivars ----------*- C++ -*-==// +//==- ObjCUnusedIVarsChecker.cpp - Check for unused ivars --------*- C++ -*-==// // // The LLVM Compiler Infrastructure // @@ -68,14 +68,14 @@ static void Scan(IvarUsageMap& M, const ObjCContainerDecl* D) { for (ObjCContainerDecl::instmeth_iterator I = D->instmeth_begin(), E = D->instmeth_end(); I!=E; ++I) Scan(M, (*I)->getBody()); - - if (const ObjCImplementationDecl *ID = dyn_cast<ObjCImplementationDecl>(D)) { + + if (const ObjCImplementationDecl *ID = dyn_cast<ObjCImplementationDecl>(D)) { // Scan for @synthesized property methods that act as setters/getters // to an ivar. for (ObjCImplementationDecl::propimpl_iterator I = ID->propimpl_begin(), E = ID->propimpl_end(); I!=E; ++I) Scan(M, *I); - + // Scan the associated categories as well. for (const ObjCCategoryDecl *CD = ID->getClassInterface()->getCategoryList(); CD ; @@ -92,7 +92,7 @@ static void Scan(IvarUsageMap &M, const DeclContext *C, const FileID FID, I!=E; ++I) if (const FunctionDecl *FD = dyn_cast<FunctionDecl>(*I)) { SourceLocation L = FD->getLocStart(); - if (SM.getFileID(L) == FID) + if (SM.getFileID(L) == FID) Scan(M, FD->getBody()); } } @@ -109,12 +109,12 @@ void clang::CheckObjCUnusedIvar(const ObjCImplementationDecl *D, const ObjCIvarDecl* ID = *I; - // Ignore ivars that aren't private. - if (ID->getAccessControl() != ObjCIvarDecl::Private) - continue; - - // Skip IB Outlets. - if (ID->getAttr<IBOutletAttr>()) + // Ignore ivars that... + // (a) aren't private + // (b) explicitly marked unused + // (c) are iboutlets + if (ID->getAccessControl() != ObjCIvarDecl::Private || + ID->getAttr<UnusedAttr>() || ID->getAttr<IBOutletAttr>()) continue; M[ID] = Unused; @@ -122,11 +122,10 @@ void clang::CheckObjCUnusedIvar(const ObjCImplementationDecl *D, if (M.empty()) return; - + // Now scan the implementation declaration. Scan(M, D); - // Any potentially unused ivars? bool hasUnused = false; for (IvarUsageMap::iterator I = M.begin(), E = M.end(); I!=E; ++I) @@ -134,10 +133,10 @@ void clang::CheckObjCUnusedIvar(const ObjCImplementationDecl *D, hasUnused = true; break; } - + if (!hasUnused) return; - + // We found some potentially unused ivars. Scan the entire translation unit // for functions inside the @implementation that reference these ivars. // FIXME: In the future hopefully we can just use the lexical DeclContext diff --git a/lib/Checker/RegionStore.cpp b/lib/Checker/RegionStore.cpp index f70105af1379..fd48f72dd4ae 100644 --- a/lib/Checker/RegionStore.cpp +++ b/lib/Checker/RegionStore.cpp @@ -975,8 +975,10 @@ SVal RegionStoreManager::Retrieve(Store store, Loc L, QualType T) { if (isa<AllocaRegion>(MR) || isa<SymbolicRegion>(MR)) MR = GetElementZeroRegion(MR, T); - if (isa<CodeTextRegion>(MR)) + if (isa<CodeTextRegion>(MR)) { + assert(0 && "Why load from a code text region?"); return UnknownVal(); + } // FIXME: Perhaps this method should just take a 'const MemRegion*' argument // instead of 'Loc', and have the other Loc cases handled at a higher level. @@ -1068,7 +1070,7 @@ SVal RegionStoreManager::Retrieve(Store store, Loc L, QualType T) { } // All other values are symbolic. - return ValMgr.getRegionValueSymbolVal(R, RTy); + return ValMgr.getRegionValueSymbolVal(R); } std::pair<Store, const MemRegion *> @@ -1229,7 +1231,7 @@ SVal RegionStoreManager::RetrieveFieldOrElementCommon(Store store, } // All other values are symbolic. - return ValMgr.getRegionValueSymbolVal(R, Ty); + return ValMgr.getRegionValueSymbolVal(R); } SVal RegionStoreManager::RetrieveObjCIvar(Store store, const ObjCIvarRegion* R){ @@ -1269,11 +1271,11 @@ SVal RegionStoreManager::RetrieveVar(Store store, const VarRegion *R) { if (isa<UnknownSpaceRegion>(MS) || isa<StackArgumentsSpaceRegion>(MS)) - return ValMgr.getRegionValueSymbolVal(R, T); + return ValMgr.getRegionValueSymbolVal(R); if (isa<GlobalsSpaceRegion>(MS)) { if (VD->isFileVarDecl()) - return ValMgr.getRegionValueSymbolVal(R, T); + return ValMgr.getRegionValueSymbolVal(R); if (T->isIntegerType()) return ValMgr.makeIntVal(0, T); @@ -1291,7 +1293,7 @@ SVal RegionStoreManager::RetrieveLazySymbol(const TypedRegion *R) { QualType valTy = R->getValueType(getContext()); // All other values are symbolic. - return ValMgr.getRegionValueSymbolVal(R, valTy); + return ValMgr.getRegionValueSymbolVal(R); } SVal RegionStoreManager::RetrieveStruct(Store store, const TypedRegion* R) { diff --git a/lib/Checker/SymbolManager.cpp b/lib/Checker/SymbolManager.cpp index 40bdcf65bca4..f2d630cdf64b 100644 --- a/lib/Checker/SymbolManager.cpp +++ b/lib/Checker/SymbolManager.cpp @@ -14,6 +14,7 @@ #include "clang/Checker/PathSensitive/SymbolManager.h" #include "clang/Checker/PathSensitive/MemRegion.h" +#include "clang/Analysis/AnalysisContext.h" #include "llvm/Support/raw_ostream.h" using namespace clang; @@ -78,14 +79,14 @@ void SymbolRegionValue::dumpToStream(llvm::raw_ostream& os) const { } const SymbolRegionValue* -SymbolManager::getRegionValueSymbol(const MemRegion* R, QualType T) { +SymbolManager::getRegionValueSymbol(const TypedRegion* R) { llvm::FoldingSetNodeID profile; - SymbolRegionValue::Profile(profile, R, T); + SymbolRegionValue::Profile(profile, R); void* InsertPos; SymExpr *SD = DataSet.FindNodeOrInsertPos(profile, InsertPos); if (!SD) { SD = (SymExpr*) BPAlloc.Allocate<SymbolRegionValue>(); - new (SD) SymbolRegionValue(SymbolCounter, R, T); + new (SD) SymbolRegionValue(SymbolCounter, R); DataSet.InsertNode(SD, InsertPos); ++SymbolCounter; } @@ -175,13 +176,7 @@ QualType SymbolDerived::getType(ASTContext& Ctx) const { } QualType SymbolRegionValue::getType(ASTContext& C) const { - if (!T.isNull()) - return T; - - if (const TypedRegion* TR = dyn_cast<TypedRegion>(R)) - return TR->getValueType(C); - - return QualType(); + return R->getValueType(C); } SymbolManager::~SymbolManager() {} @@ -222,7 +217,11 @@ bool SymbolReaper::isLive(SymbolRef sym) { bool SymbolReaper::isLive(const Stmt *Loc, const VarRegion *VR) const { const StackFrameContext *SFC = VR->getStackFrame(); - return SFC == CurrentStackFrame ? Liveness.isLive(Loc, VR->getDecl()) : true; + + if (SFC == CurrentStackFrame) + return Liveness.isLive(Loc, VR->getDecl()); + else + return SFC->isParentOf(CurrentStackFrame); } SymbolVisitor::~SymbolVisitor() {} diff --git a/lib/Checker/UnixAPIChecker.cpp b/lib/Checker/UnixAPIChecker.cpp new file mode 100644 index 000000000000..7ff817ae7677 --- /dev/null +++ b/lib/Checker/UnixAPIChecker.cpp @@ -0,0 +1,154 @@ +//= UnixAPIChecker.h - Checks preconditions for various Unix APIs --*- C++ -*-// +// +// The LLVM Compiler Infrastructure +// +// This file is distributed under the University of Illinois Open Source +// License. See LICENSE.TXT for details. +// +//===----------------------------------------------------------------------===// +// +// This defines UnixAPIChecker, which is an assortment of checks on calls +// to various, widely used UNIX/Posix functions. +// +//===----------------------------------------------------------------------===// + +#include "clang/Checker/PathSensitive/CheckerVisitor.h" +#include "clang/Checker/BugReporter/BugReporter.h" +#include "clang/Checker/PathSensitive/GRStateTrait.h" +#include "llvm/ADT/StringSwitch.h" +#include "GRExprEngineInternalChecks.h" +#include <fcntl.h> + +using namespace clang; + +namespace { +class UnixAPIChecker : public CheckerVisitor<UnixAPIChecker> { + enum SubChecks { + OpenFn = 0, + NumChecks + }; + + BugType *BTypes[NumChecks]; + +public: + UnixAPIChecker() { memset(BTypes, 0, sizeof(*BTypes) * NumChecks); } + static void *getTag() { static unsigned tag = 0; return &tag; } + + void PreVisitCallExpr(CheckerContext &C, const CallExpr *CE); +}; +} //end anonymous namespace + +void clang::RegisterUnixAPIChecker(GRExprEngine &Eng) { + Eng.registerCheck(new UnixAPIChecker()); +} + +//===----------------------------------------------------------------------===// +// Utility functions. +//===----------------------------------------------------------------------===// + +static inline void LazyInitialize(BugType *&BT, const char *name) { + if (BT) + return; + BT = new BugType(name, "Unix API"); +} + +//===----------------------------------------------------------------------===// +// "open" (man 2 open) +//===----------------------------------------------------------------------===// + +static void CheckOpen(CheckerContext &C, const CallExpr *CE, BugType *&BT) { + LazyInitialize(BT, "Improper use of 'open'"); + + // Look at the 'oflags' argument for the O_CREAT flag. + const GRState *state = C.getState(); + + if (CE->getNumArgs() < 2) { + // The frontend should issue a warning for this case, so this is a sanity + // check. + return; + } + + // Now check if oflags has O_CREAT set. + const Expr *oflagsEx = CE->getArg(1); + const SVal V = state->getSVal(oflagsEx); + if (!isa<NonLoc>(V)) { + // The case where 'V' can be a location can only be due to a bad header, + // so in this case bail out. + return; + } + NonLoc oflags = cast<NonLoc>(V); + NonLoc ocreateFlag = + cast<NonLoc>(C.getValueManager().makeIntVal((uint64_t) O_CREAT, + oflagsEx->getType())); + SVal maskedFlagsUC = C.getSValuator().EvalBinOpNN(state, BinaryOperator::And, + oflags, ocreateFlag, + oflagsEx->getType()); + if (maskedFlagsUC.isUnknownOrUndef()) + return; + DefinedSVal maskedFlags = cast<DefinedSVal>(maskedFlagsUC); + + // Check if maskedFlags is non-zero. + const GRState *trueState, *falseState; + llvm::tie(trueState, falseState) = state->Assume(maskedFlags); + + // Only emit an error if the value of 'maskedFlags' is properly + // constrained; + if (!(trueState && !falseState)) + return; + + if (CE->getNumArgs() < 3) { + ExplodedNode *N = C.GenerateSink(trueState); + if (!N) + return; + + EnhancedBugReport *report = + new EnhancedBugReport(*BT, + "Call to 'open' requires a third argument when " + "the 'O_CREAT' flag is set", N); + report->addRange(oflagsEx->getSourceRange()); + C.EmitReport(report); + } +} + +//===----------------------------------------------------------------------===// +// Central dispatch function. +//===----------------------------------------------------------------------===// + +typedef void (*SubChecker)(CheckerContext &C, const CallExpr *CE, BugType *&BT); +namespace { + class SubCheck { + SubChecker SC; + BugType **BT; + public: + SubCheck(SubChecker sc, BugType *& bt) : SC(sc), BT(&bt) {} + SubCheck() : SC(NULL), BT(NULL) {} + + void run(CheckerContext &C, const CallExpr *CE) const { + if (SC) + SC(C, CE, *BT); + } + }; +} // end anonymous namespace + +void UnixAPIChecker::PreVisitCallExpr(CheckerContext &C, const CallExpr *CE) { + // Get the callee. All the functions we care about are C functions + // with simple identifiers. + const GRState *state = C.getState(); + const Expr *Callee = CE->getCallee(); + const FunctionTextRegion *Fn = + dyn_cast_or_null<FunctionTextRegion>(state->getSVal(Callee).getAsRegion()); + + if (!Fn) + return; + + const IdentifierInfo *FI = Fn->getDecl()->getIdentifier(); + if (!FI) + return; + + const SubCheck &SC = + llvm::StringSwitch<SubCheck>(FI->getName()) + .Case("open", SubCheck(CheckOpen, BTypes[OpenFn])) + .Default(SubCheck()); + + SC.run(C, CE); +} diff --git a/lib/Checker/ValueManager.cpp b/lib/Checker/ValueManager.cpp index 5359489a2299..aa0c3c877dde 100644 --- a/lib/Checker/ValueManager.cpp +++ b/lib/Checker/ValueManager.cpp @@ -70,18 +70,14 @@ SVal ValueManager::convertToArrayIndex(SVal V) { return SVator->EvalCastNL(cast<NonLoc>(V), ArrayIndexTy); } -DefinedOrUnknownSVal ValueManager::getRegionValueSymbolVal(const MemRegion* R, - QualType T) { - - if (T.isNull()) { - const TypedRegion* TR = cast<TypedRegion>(R); - T = TR->getValueType(SymMgr.getContext()); - } +DefinedOrUnknownSVal +ValueManager::getRegionValueSymbolVal(const TypedRegion* R) { + QualType T = R->getValueType(SymMgr.getContext()); if (!SymbolManager::canSymbolicate(T)) return UnknownVal(); - SymbolRef sym = SymMgr.getRegionValueSymbol(R, T); + SymbolRef sym = SymMgr.getRegionValueSymbol(R); if (Loc::IsLocType(T)) return loc::MemRegionVal(MemMgr.getSymbolicRegion(sym)); diff --git a/lib/CodeGen/CGBlocks.cpp b/lib/CodeGen/CGBlocks.cpp index 46b62441d6e4..7076067e4381 100644 --- a/lib/CodeGen/CGBlocks.cpp +++ b/lib/CodeGen/CGBlocks.cpp @@ -24,7 +24,7 @@ using namespace clang; using namespace CodeGen; llvm::Constant *CodeGenFunction:: -BuildDescriptorBlockDecl(bool BlockHasCopyDispose, CharUnits Size, +BuildDescriptorBlockDecl(const BlockExpr *BE, bool BlockHasCopyDispose, CharUnits Size, const llvm::StructType* Ty, std::vector<HelperInfo> *NoteForHelper) { const llvm::Type *UnsignedLongTy @@ -43,6 +43,7 @@ BuildDescriptorBlockDecl(bool BlockHasCopyDispose, CharUnits Size, C = llvm::ConstantInt::get(UnsignedLongTy, Size.getQuantity()); Elts.push_back(C); + // optional copy/dispose helpers if (BlockHasCopyDispose) { // copy_func_helper_decl Elts.push_back(BuildCopyHelper(Ty, NoteForHelper)); @@ -51,6 +52,17 @@ BuildDescriptorBlockDecl(bool BlockHasCopyDispose, CharUnits Size, Elts.push_back(BuildDestroyHelper(Ty, NoteForHelper)); } + // Signature. non-optional ObjC-style method descriptor @encode sequence + std::string BlockTypeEncoding; + CGM.getContext().getObjCEncodingForBlock(BE, BlockTypeEncoding); + + Elts.push_back(llvm::ConstantExpr::getBitCast( + CGM.GetAddrOfConstantCString(BlockTypeEncoding), PtrToInt8Ty)); + + // Layout. + C = llvm::ConstantInt::get(UnsignedLongTy, 0); + Elts.push_back(C); + C = llvm::ConstantStruct::get(VMContext, Elts, false); C = new llvm::GlobalVariable(CGM.getModule(), C->getType(), true, @@ -110,19 +122,6 @@ static bool CanBlockBeGlobal(const CodeGenFunction::BlockInfo &Info) { /// invoke function. static void AllocateAllBlockDeclRefs(const CodeGenFunction::BlockInfo &Info, CodeGenFunction *CGF) { - // Always allocate self, as it is often handy in the debugger, even if there - // is no codegen in the block that uses it. This is also useful to always do - // this as if we didn't, we'd have to figure out all code that uses a self - // pointer, including implicit uses. - if (const ObjCMethodDecl *OMD - = dyn_cast_or_null<ObjCMethodDecl>(CGF->CurFuncDecl)) { - ImplicitParamDecl *SelfDecl = OMD->getSelfDecl(); - BlockDeclRefExpr *BDRE = new (CGF->getContext()) - BlockDeclRefExpr(SelfDecl, - SelfDecl->getType(), SourceLocation(), false); - CGF->AllocateBlockDecl(BDRE); - } - // FIXME: Also always forward the this pointer in C++ as well. for (size_t i = 0; i < Info.DeclRefs.size(); ++i) @@ -148,30 +147,14 @@ llvm::Value *CodeGenFunction::BuildBlockLiteralTmp(const BlockExpr *BE) { size_t BlockFields = 5; - bool hasIntrospection = CGM.getContext().getLangOptions().BlockIntrospection; - - if (hasIntrospection) { - BlockFields++; - } std::vector<llvm::Constant*> Elts(BlockFields); - if (hasIntrospection) { - std::string BlockTypeEncoding; - CGM.getContext().getObjCEncodingForBlock(BE, BlockTypeEncoding); - - Elts[5] = llvm::ConstantExpr::getBitCast( - CGM.GetAddrOfConstantCString(BlockTypeEncoding), PtrToInt8Ty); - } - llvm::Constant *C; llvm::Value *V; { // C = BuildBlockStructInitlist(); - unsigned int flags = BLOCK_HAS_DESCRIPTOR; - - if (hasIntrospection) - flags |= BLOCK_HAS_OBJC_TYPE; + unsigned int flags = BLOCK_HAS_OBJC_TYPE; // We run this first so that we set BlockHasCopyDispose from the entire // block literal. @@ -212,7 +195,7 @@ llvm::Value *CodeGenFunction::BuildBlockLiteralTmp(const BlockExpr *BE) { if (subBlockDeclRefDecls.size() == 0) { // __descriptor - Elts[4] = BuildDescriptorBlockDecl(subBlockHasCopyDispose, subBlockSize, + Elts[4] = BuildDescriptorBlockDecl(BE, subBlockHasCopyDispose, subBlockSize, 0, 0); // Optimize to being a global block. @@ -234,8 +217,6 @@ llvm::Value *CodeGenFunction::BuildBlockLiteralTmp(const BlockExpr *BE) { for (int i=0; i<4; ++i) Types[i] = Elts[i]->getType(); Types[4] = PtrToInt8Ty; - if (hasIntrospection) - Types[5] = PtrToInt8Ty; for (unsigned i=0; i < subBlockDeclRefDecls.size(); ++i) { const Expr *E = subBlockDeclRefDecls[i]; @@ -258,8 +239,6 @@ llvm::Value *CodeGenFunction::BuildBlockLiteralTmp(const BlockExpr *BE) { for (unsigned i=0; i<4; ++i) Builder.CreateStore(Elts[i], Builder.CreateStructGEP(V, i, "block.tmp")); - if (hasIntrospection) - Builder.CreateStore(Elts[5], Builder.CreateStructGEP(V, 5, "block.tmp")); for (unsigned i=0; i < subBlockDeclRefDecls.size(); ++i) { @@ -348,7 +327,8 @@ llvm::Value *CodeGenFunction::BuildBlockLiteralTmp(const BlockExpr *BE) { NoteForHelper.resize(helpersize); // __descriptor - llvm::Value *Descriptor = BuildDescriptorBlockDecl(subBlockHasCopyDispose, + llvm::Value *Descriptor = BuildDescriptorBlockDecl(BE, + subBlockHasCopyDispose, subBlockSize, Ty, &NoteForHelper); Descriptor = Builder.CreateBitCast(Descriptor, PtrToInt8Ty); @@ -384,6 +364,16 @@ const llvm::Type *BlockModule::getBlockDescriptorType() { // struct __block_descriptor { // unsigned long reserved; // unsigned long block_size; + // + // // later, the following will be added + // + // struct { + // void (*copyHelper)(); + // void (*copyHelper)(); + // } helpers; // !!! optional + // + // const char *signature; // the block signature + // const char *layout; // reserved // }; BlockDescriptorType = llvm::StructType::get(UnsignedLongTy->getContext(), UnsignedLongTy, @@ -412,20 +402,8 @@ const llvm::Type *BlockModule::getGenericBlockLiteralType() { // int __reserved; // void (*__invoke)(void *); // struct __block_descriptor *__descriptor; - // // GNU runtime only: - // const char *types; // }; - if (CGM.getContext().getLangOptions().BlockIntrospection) - GenericBlockLiteralType = llvm::StructType::get(IntTy->getContext(), - PtrToInt8Ty, - IntTy, - IntTy, - PtrToInt8Ty, - BlockDescPtrTy, - PtrToInt8Ty, - NULL); - else - GenericBlockLiteralType = llvm::StructType::get(IntTy->getContext(), + GenericBlockLiteralType = llvm::StructType::get(IntTy->getContext(), PtrToInt8Ty, IntTy, IntTy, @@ -439,40 +417,6 @@ const llvm::Type *BlockModule::getGenericBlockLiteralType() { return GenericBlockLiteralType; } -const llvm::Type *BlockModule::getGenericExtendedBlockLiteralType() { - if (GenericExtendedBlockLiteralType) - return GenericExtendedBlockLiteralType; - - const llvm::Type *BlockDescPtrTy = - llvm::PointerType::getUnqual(getBlockDescriptorType()); - - const llvm::IntegerType *IntTy = cast<llvm::IntegerType>( - getTypes().ConvertType(getContext().IntTy)); - - // struct __block_literal_generic { - // void *__isa; - // int __flags; - // int __reserved; - // void (*__invoke)(void *); - // struct __block_descriptor *__descriptor; - // void *__copy_func_helper_decl; - // void *__destroy_func_decl; - // }; - GenericExtendedBlockLiteralType = llvm::StructType::get(IntTy->getContext(), - PtrToInt8Ty, - IntTy, - IntTy, - PtrToInt8Ty, - BlockDescPtrTy, - PtrToInt8Ty, - PtrToInt8Ty, - NULL); - - getModule().addTypeName("struct.__block_literal_extended_generic", - GenericExtendedBlockLiteralType); - - return GenericExtendedBlockLiteralType; -} RValue CodeGenFunction::EmitBlockCallExpr(const CallExpr* E, ReturnValueSlot ReturnValue) { @@ -603,7 +547,7 @@ BlockModule::GetAddrOfGlobalBlock(const BlockExpr *BE, const char * n) { const llvm::IntegerType *IntTy = cast<llvm::IntegerType>( getTypes().ConvertType(getContext().IntTy)); - llvm::Constant *DescriptorFields[2]; + llvm::Constant *DescriptorFields[4]; // Reserved DescriptorFields[0] = llvm::Constant::getNullValue(UnsignedLongTy); @@ -614,9 +558,21 @@ BlockModule::GetAddrOfGlobalBlock(const BlockExpr *BE, const char * n) { CGM.GetTargetTypeStoreSize(getGenericBlockLiteralType()); DescriptorFields[1] = llvm::ConstantInt::get(UnsignedLongTy,BlockLiteralSize.getQuantity()); + + // signature. non-optional ObjC-style method descriptor @encode sequence + std::string BlockTypeEncoding; + CGM.getContext().getObjCEncodingForBlock(BE, BlockTypeEncoding); + DescriptorFields[2] = llvm::ConstantExpr::getBitCast( + CGM.GetAddrOfConstantCString(BlockTypeEncoding), PtrToInt8Ty); + + // layout + DescriptorFields[3] = + llvm::ConstantInt::get(UnsignedLongTy,0); + + // build the structure from the 4 elements llvm::Constant *DescriptorStruct = - llvm::ConstantStruct::get(VMContext, &DescriptorFields[0], 2, false); + llvm::ConstantStruct::get(VMContext, &DescriptorFields[0], 4, false); llvm::GlobalVariable *Descriptor = new llvm::GlobalVariable(getModule(), DescriptorStruct->getType(), true, @@ -625,8 +581,6 @@ BlockModule::GetAddrOfGlobalBlock(const BlockExpr *BE, const char * n) { int FieldCount = 5; // Generate the constants for the block literal. - if (CGM.getContext().getLangOptions().BlockIntrospection) - FieldCount = 6; std::vector<llvm::Constant*> LiteralFields(FieldCount); @@ -649,10 +603,8 @@ BlockModule::GetAddrOfGlobalBlock(const BlockExpr *BE, const char * n) { LiteralFields[0] = getNSConcreteGlobalBlock(); // Flags - LiteralFields[1] = CGM.getContext().getLangOptions().BlockIntrospection ? - llvm::ConstantInt::get(IntTy, BLOCK_IS_GLOBAL | BLOCK_HAS_DESCRIPTOR | - BLOCK_HAS_OBJC_TYPE) : - llvm::ConstantInt::get(IntTy, BLOCK_IS_GLOBAL | BLOCK_HAS_DESCRIPTOR); + LiteralFields[1] = + llvm::ConstantInt::get(IntTy, BLOCK_IS_GLOBAL | BLOCK_HAS_OBJC_TYPE); // Reserved LiteralFields[2] = llvm::Constant::getNullValue(IntTy); @@ -663,14 +615,6 @@ BlockModule::GetAddrOfGlobalBlock(const BlockExpr *BE, const char * n) { // Descriptor LiteralFields[4] = Descriptor; - // Type encoding - if (CGM.getContext().getLangOptions().BlockIntrospection) { - std::string BlockTypeEncoding; - CGM.getContext().getObjCEncodingForBlock(BE, BlockTypeEncoding); - - LiteralFields[5] = CGM.GetAddrOfConstantCString(BlockTypeEncoding); - } - llvm::Constant *BlockLiteralStruct = llvm::ConstantStruct::get(VMContext, LiteralFields, false); diff --git a/lib/CodeGen/CGBlocks.h b/lib/CodeGen/CGBlocks.h index a9f5ae05c109..39f26f8b1363 100644 --- a/lib/CodeGen/CGBlocks.h +++ b/lib/CodeGen/CGBlocks.h @@ -51,12 +51,9 @@ class CodeGenModule; class BlockBase { public: enum { - BLOCK_NEEDS_FREE = (1 << 24), BLOCK_HAS_COPY_DISPOSE = (1 << 25), BLOCK_HAS_CXX_OBJ = (1 << 26), - BLOCK_IS_GC = (1 << 27), BLOCK_IS_GLOBAL = (1 << 28), - BLOCK_HAS_DESCRIPTOR = (1 << 29), BLOCK_HAS_OBJC_TYPE = (1 << 30) }; }; @@ -80,7 +77,6 @@ public: const llvm::Type *getBlockDescriptorType(); const llvm::Type *getGenericBlockLiteralType(); - const llvm::Type *getGenericExtendedBlockLiteralType(); llvm::Constant *GetAddrOfGlobalBlock(const BlockExpr *BE, const char *); @@ -94,7 +90,7 @@ public: const llvm::Type *BlockDescriptorType; const llvm::Type *GenericBlockLiteralType; - const llvm::Type *GenericExtendedBlockLiteralType; + struct { int GlobalUniqueCount; } Block; @@ -111,7 +107,7 @@ public: : Context(C), TheModule(M), TheTargetData(TD), Types(T), CGM(CodeGen), VMContext(M.getContext()), NSConcreteGlobalBlock(0), NSConcreteStackBlock(0), BlockDescriptorType(0), - GenericBlockLiteralType(0), GenericExtendedBlockLiteralType(0), + GenericBlockLiteralType(0), BlockObjectAssign(0), BlockObjectDispose(0) { Block.GlobalUniqueCount = 0; PtrToInt8Ty = llvm::Type::getInt8PtrTy(M.getContext()); diff --git a/lib/CodeGen/CGBuiltin.cpp b/lib/CodeGen/CGBuiltin.cpp index beaf7b89c003..0f5e90fb15aa 100644 --- a/lib/CodeGen/CGBuiltin.cpp +++ b/lib/CodeGen/CGBuiltin.cpp @@ -11,6 +11,7 @@ // //===----------------------------------------------------------------------===// +#include "TargetInfo.h" #include "CodeGenFunction.h" #include "CodeGenModule.h" #include "clang/Basic/TargetInfo.h" @@ -19,6 +20,7 @@ #include "clang/AST/Decl.h" #include "clang/Basic/TargetBuiltins.h" #include "llvm/Intrinsics.h" +#include "llvm/Target/TargetData.h" using namespace clang; using namespace CodeGen; using namespace llvm; @@ -57,6 +59,10 @@ static RValue EmitBinaryAtomicPost(CodeGenFunction& CGF, return RValue::get(CGF.Builder.CreateBinOp(Op, Result, Operand)); } +static llvm::ConstantInt *getInt32(llvm::LLVMContext &Context, int32_t Value) { + return llvm::ConstantInt::get(llvm::Type::getInt32Ty(Context), Value); +} + RValue CodeGenFunction::EmitBuiltinExpr(const FunctionDecl *FD, unsigned BuiltinID, const CallExpr *E) { // See if we can constant fold this builtin. If so, don't emit it at all. @@ -341,6 +347,20 @@ RValue CodeGenFunction::EmitBuiltinExpr(const FunctionDecl *FD, llvm::ConstantInt::get(llvm::Type::getInt32Ty(VMContext), 1)); return RValue::get(Address); } + case Builtin::BI__builtin_dwarf_cfa: { + // The offset in bytes from the first argument to the CFA. + // + // Why on earth is this in the frontend? Is there any reason at + // all that the backend can't reasonably determine this while + // lowering llvm.eh.dwarf.cfa()? + // + // TODO: If there's a satisfactory reason, add a target hook for + // this instead of hard-coding 0, which is correct for most targets. + int32_t Offset = 0; + + Value *F = CGM.getIntrinsic(Intrinsic::eh_dwarf_cfa, 0, 0); + return RValue::get(Builder.CreateCall(F, getInt32(VMContext, Offset))); + } case Builtin::BI__builtin_return_address: { Value *Depth = EmitScalarExpr(E->getArg(0)); Depth = Builder.CreateIntCast(Depth, @@ -358,13 +378,64 @@ RValue CodeGenFunction::EmitBuiltinExpr(const FunctionDecl *FD, return RValue::get(Builder.CreateCall(F, Depth)); } case Builtin::BI__builtin_extract_return_addr: { - // FIXME: There should be a target hook for this - return RValue::get(EmitScalarExpr(E->getArg(0))); + Value *Address = EmitScalarExpr(E->getArg(0)); + Value *Result = getTargetHooks().decodeReturnAddress(*this, Address); + return RValue::get(Result); + } + case Builtin::BI__builtin_frob_return_addr: { + Value *Address = EmitScalarExpr(E->getArg(0)); + Value *Result = getTargetHooks().encodeReturnAddress(*this, Address); + return RValue::get(Result); + } + case Builtin::BI__builtin_eh_return: { + Value *Int = EmitScalarExpr(E->getArg(0)); + Value *Ptr = EmitScalarExpr(E->getArg(1)); + + const llvm::IntegerType *IntTy = cast<llvm::IntegerType>(Int->getType()); + assert((IntTy->getBitWidth() == 32 || IntTy->getBitWidth() == 64) && + "LLVM's __builtin_eh_return only supports 32- and 64-bit variants"); + Value *F = CGM.getIntrinsic(IntTy->getBitWidth() == 32 + ? Intrinsic::eh_return_i32 + : Intrinsic::eh_return_i64, + 0, 0); + Builder.CreateCall2(F, Int, Ptr); + Value *V = Builder.CreateUnreachable(); + Builder.ClearInsertionPoint(); + return RValue::get(V); } case Builtin::BI__builtin_unwind_init: { Value *F = CGM.getIntrinsic(Intrinsic::eh_unwind_init, 0, 0); return RValue::get(Builder.CreateCall(F)); } + case Builtin::BI__builtin_extend_pointer: { + // Extends a pointer to the size of an _Unwind_Word, which is + // uint64_t on all platforms. Generally this gets poked into a + // register and eventually used as an address, so if the + // addressing registers are wider than pointers and the platform + // doesn't implicitly ignore high-order bits when doing + // addressing, we need to make sure we zext / sext based on + // the platform's expectations. + // + // See: http://gcc.gnu.org/ml/gcc-bugs/2002-02/msg00237.html + + LLVMContext &C = CGM.getLLVMContext(); + + // Cast the pointer to intptr_t. + Value *Ptr = EmitScalarExpr(E->getArg(0)); + const llvm::IntegerType *IntPtrTy = CGM.getTargetData().getIntPtrType(C); + Value *Result = Builder.CreatePtrToInt(Ptr, IntPtrTy, "extend.cast"); + + // If that's 64 bits, we're done. + if (IntPtrTy->getBitWidth() == 64) + return RValue::get(Result); + + // Otherwise, ask the codegen data what to do. + const llvm::IntegerType *Int64Ty = llvm::IntegerType::get(C, 64); + if (getTargetHooks().extendPointerWithSExt()) + return RValue::get(Builder.CreateSExt(Result, Int64Ty, "extend.sext")); + else + return RValue::get(Builder.CreateZExt(Result, Int64Ty, "extend.zext")); + } #if 0 // FIXME: Finish/enable when LLVM backend support stabilizes case Builtin::BI__builtin_setjmp: { diff --git a/lib/CodeGen/CGCXX.cpp b/lib/CodeGen/CGCXX.cpp index 28c4c6b4b57b..4889fc08f488 100644 --- a/lib/CodeGen/CGCXX.cpp +++ b/lib/CodeGen/CGCXX.cpp @@ -22,33 +22,182 @@ #include "clang/AST/DeclCXX.h" #include "clang/AST/DeclObjC.h" #include "clang/AST/StmtCXX.h" +#include "clang/CodeGen/CodeGenOptions.h" #include "llvm/ADT/StringExtras.h" using namespace clang; using namespace CodeGen; +/// Determines whether the given function has a trivial body that does +/// not require any specific codegen. +static bool HasTrivialBody(const FunctionDecl *FD) { + Stmt *S = FD->getBody(); + if (!S) + return true; + if (isa<CompoundStmt>(S) && cast<CompoundStmt>(S)->body_empty()) + return true; + return false; +} + +/// Try to emit a base destructor as an alias to its primary +/// base-class destructor. +bool CodeGenModule::TryEmitBaseDestructorAsAlias(const CXXDestructorDecl *D) { + if (!getCodeGenOpts().CXXCtorDtorAliases) + return true; + + // If the destructor doesn't have a trivial body, we have to emit it + // separately. + if (!HasTrivialBody(D)) + return true; + + const CXXRecordDecl *Class = D->getParent(); + + // If we need to manipulate a VTT parameter, give up. + if (Class->getNumVBases()) { + // Extra Credit: passing extra parameters is perfectly safe + // in many calling conventions, so only bail out if the ctor's + // calling convention is nonstandard. + return true; + } + + // If any fields have a non-trivial destructor, we have to emit it + // separately. + for (CXXRecordDecl::field_iterator I = Class->field_begin(), + E = Class->field_end(); I != E; ++I) + if (const RecordType *RT = (*I)->getType()->getAs<RecordType>()) + if (!cast<CXXRecordDecl>(RT->getDecl())->hasTrivialDestructor()) + return true; + + // Try to find a unique base class with a non-trivial destructor. + const CXXRecordDecl *UniqueBase = 0; + for (CXXRecordDecl::base_class_const_iterator I = Class->bases_begin(), + E = Class->bases_end(); I != E; ++I) { + + // We're in the base destructor, so skip virtual bases. + if (I->isVirtual()) continue; + + // Skip base classes with trivial destructors. + const CXXRecordDecl *Base + = cast<CXXRecordDecl>(I->getType()->getAs<RecordType>()->getDecl()); + if (Base->hasTrivialDestructor()) continue; + + // If we've already found a base class with a non-trivial + // destructor, give up. + if (UniqueBase) return true; + UniqueBase = Base; + } + + // If we didn't find any bases with a non-trivial destructor, then + // the base destructor is actually effectively trivial, which can + // happen if it was needlessly user-defined or if there are virtual + // bases with non-trivial destructors. + if (!UniqueBase) + return true; + + /// If we don't have a definition for the destructor yet, don't + /// emit. We can't emit aliases to declarations; that's just not + /// how aliases work. + const CXXDestructorDecl *BaseD = UniqueBase->getDestructor(getContext()); + if (!BaseD->isImplicit() && !BaseD->getBody()) + return true; + + // If the base is at a non-zero offset, give up. + const ASTRecordLayout &ClassLayout = Context.getASTRecordLayout(Class); + if (ClassLayout.getBaseClassOffset(UniqueBase) != 0) + return true; + + return TryEmitDefinitionAsAlias(GlobalDecl(D, Dtor_Base), + GlobalDecl(BaseD, Dtor_Base)); +} +/// Try to emit a definition as a global alias for another definition. +bool CodeGenModule::TryEmitDefinitionAsAlias(GlobalDecl AliasDecl, + GlobalDecl TargetDecl) { + if (!getCodeGenOpts().CXXCtorDtorAliases) + return true; + + // The alias will use the linkage of the referrent. If we can't + // support aliases with that linkage, fail. + llvm::GlobalValue::LinkageTypes Linkage + = getFunctionLinkage(cast<FunctionDecl>(AliasDecl.getDecl())); + + switch (Linkage) { + // We can definitely emit aliases to definitions with external linkage. + case llvm::GlobalValue::ExternalLinkage: + case llvm::GlobalValue::ExternalWeakLinkage: + break; + + // Same with local linkage. + case llvm::GlobalValue::InternalLinkage: + case llvm::GlobalValue::PrivateLinkage: + case llvm::GlobalValue::LinkerPrivateLinkage: + break; + + // We should try to support linkonce linkages. + case llvm::GlobalValue::LinkOnceAnyLinkage: + case llvm::GlobalValue::LinkOnceODRLinkage: + return true; + + // Other linkages will probably never be supported. + default: + return true; + } + + // Derive the type for the alias. + const llvm::PointerType *AliasType + = getTypes().GetFunctionType(AliasDecl)->getPointerTo(); + + // Find the referrent. Some aliases might require a bitcast, in + // which case the caller is responsible for ensuring the soundness + // of these semantics. + llvm::GlobalValue *Ref = cast<llvm::GlobalValue>(GetAddrOfGlobal(TargetDecl)); + llvm::Constant *Aliasee = Ref; + if (Ref->getType() != AliasType) + Aliasee = llvm::ConstantExpr::getBitCast(Ref, AliasType); + + // Create the alias with no name. + llvm::GlobalAlias *Alias = + new llvm::GlobalAlias(AliasType, Linkage, "", Aliasee, &getModule()); + + // Switch any previous uses to the alias. + const char *MangledName = getMangledName(AliasDecl); + llvm::GlobalValue *&Entry = GlobalDeclMap[MangledName]; + if (Entry) { + assert(Entry->isDeclaration() && "definition already exists for alias"); + assert(Entry->getType() == AliasType && + "declaration exists with different type"); + Entry->replaceAllUsesWith(Alias); + Entry->eraseFromParent(); + } + Entry = Alias; -llvm::Value *CodeGenFunction::LoadCXXThis() { - assert(isa<CXXMethodDecl>(CurFuncDecl) && - "Must be in a C++ member function decl to load 'this'"); - assert(cast<CXXMethodDecl>(CurFuncDecl)->isInstance() && - "Must be in a C++ member function decl to load 'this'"); + // Finally, set up the alias with its proper name and attributes. + Alias->setName(MangledName); + SetCommonAttributes(AliasDecl.getDecl(), Alias); - // FIXME: What if we're inside a block? - // ans: See how CodeGenFunction::LoadObjCSelf() uses - // CodeGenFunction::BlockForwardSelf() for how to do this. - return Builder.CreateLoad(LocalDeclMap[CXXThisDecl], "this"); + return false; } void CodeGenModule::EmitCXXConstructors(const CXXConstructorDecl *D) { + // The constructor used for constructing this as a complete class; + // constucts the virtual bases, then calls the base constructor. EmitGlobal(GlobalDecl(D, Ctor_Complete)); + + // The constructor used for constructing this as a base class; + // ignores virtual bases. EmitGlobal(GlobalDecl(D, Ctor_Base)); } void CodeGenModule::EmitCXXConstructor(const CXXConstructorDecl *D, CXXCtorType Type) { + // The complete constructor is equivalent to the base constructor + // for classes with no virtual bases. Try to emit it as an alias. + if (Type == Ctor_Complete && + !D->getParent()->getNumVBases() && + !TryEmitDefinitionAsAlias(GlobalDecl(D, Ctor_Complete), + GlobalDecl(D, Ctor_Base))) + return; - llvm::Function *Fn = GetAddrOfCXXConstructor(D, Type); + llvm::Function *Fn = cast<llvm::Function>(GetAddrOfCXXConstructor(D, Type)); CodeGenFunction(*this).GenerateCode(GlobalDecl(D, Type), Fn); @@ -56,15 +205,17 @@ void CodeGenModule::EmitCXXConstructor(const CXXConstructorDecl *D, SetLLVMFunctionAttributesForDefinition(D, Fn); } -llvm::Function * +llvm::GlobalValue * CodeGenModule::GetAddrOfCXXConstructor(const CXXConstructorDecl *D, CXXCtorType Type) { + const char *Name = getMangledCXXCtorName(D, Type); + if (llvm::GlobalValue *V = GlobalDeclMap[Name]) + return V; + const FunctionProtoType *FPT = D->getType()->getAs<FunctionProtoType>(); const llvm::FunctionType *FTy = getTypes().GetFunctionType(getTypes().getFunctionInfo(D, Type), FPT->isVariadic()); - - const char *Name = getMangledCXXCtorName(D, Type); return cast<llvm::Function>( GetOrCreateLLVMFunction(Name, FTy, GlobalDecl(D, Type))); } @@ -79,15 +230,39 @@ const char *CodeGenModule::getMangledCXXCtorName(const CXXConstructorDecl *D, } void CodeGenModule::EmitCXXDestructors(const CXXDestructorDecl *D) { + // The destructor in a virtual table is always a 'deleting' + // destructor, which calls the complete destructor and then uses the + // appropriate operator delete. if (D->isVirtual()) EmitGlobal(GlobalDecl(D, Dtor_Deleting)); + + // The destructor used for destructing this as a most-derived class; + // call the base destructor and then destructs any virtual bases. EmitGlobal(GlobalDecl(D, Dtor_Complete)); + + // The destructor used for destructing this as a base class; ignores + // virtual bases. EmitGlobal(GlobalDecl(D, Dtor_Base)); } void CodeGenModule::EmitCXXDestructor(const CXXDestructorDecl *D, CXXDtorType Type) { - llvm::Function *Fn = GetAddrOfCXXDestructor(D, Type); + // The complete destructor is equivalent to the base destructor for + // classes with no virtual bases, so try to emit it as an alias. + if (Type == Dtor_Complete && + !D->getParent()->getNumVBases() && + !TryEmitDefinitionAsAlias(GlobalDecl(D, Dtor_Complete), + GlobalDecl(D, Dtor_Base))) + return; + + // The base destructor is equivalent to the base destructor of its + // base class if there is exactly one non-virtual base class with a + // non-trivial destructor, there are no fields with a non-trivial + // destructor, and the body of the destructor is trivial. + if (Type == Dtor_Base && !TryEmitBaseDestructorAsAlias(D)) + return; + + llvm::Function *Fn = cast<llvm::Function>(GetAddrOfCXXDestructor(D, Type)); CodeGenFunction(*this).GenerateCode(GlobalDecl(D, Type), Fn); @@ -95,13 +270,16 @@ void CodeGenModule::EmitCXXDestructor(const CXXDestructorDecl *D, SetLLVMFunctionAttributesForDefinition(D, Fn); } -llvm::Function * +llvm::GlobalValue * CodeGenModule::GetAddrOfCXXDestructor(const CXXDestructorDecl *D, CXXDtorType Type) { + const char *Name = getMangledCXXDtorName(D, Type); + if (llvm::GlobalValue *V = GlobalDeclMap[Name]) + return V; + const llvm::FunctionType *FTy = getTypes().GetFunctionType(getTypes().getFunctionInfo(D, Type), false); - const char *Name = getMangledCXXDtorName(D, Type); return cast<llvm::Function>( GetOrCreateLLVMFunction(Name, FTy, GlobalDecl(D, Type))); } diff --git a/lib/CodeGen/CGCall.cpp b/lib/CodeGen/CGCall.cpp index b064c125ad00..072b1f6585fd 100644 --- a/lib/CodeGen/CGCall.cpp +++ b/lib/CodeGen/CGCall.cpp @@ -41,21 +41,54 @@ static unsigned ClangCallConvToLLVMCallConv(CallingConv CC) { } } -const -CGFunctionInfo &CodeGenTypes::getFunctionInfo(const FunctionNoProtoType *FTNP) { - return getFunctionInfo(FTNP->getResultType(), - llvm::SmallVector<QualType, 16>(), - FTNP->getCallConv(), FTNP->getNoReturnAttr()); +/// Derives the 'this' type for codegen purposes, i.e. ignoring method +/// qualification. +/// FIXME: address space qualification? +static CanQualType GetThisType(ASTContext &Context, const CXXRecordDecl *RD) { + QualType RecTy = Context.getTagDeclType(RD)->getCanonicalTypeInternal(); + return Context.getPointerType(CanQualType::CreateUnsafe(RecTy)); } -const -CGFunctionInfo &CodeGenTypes::getFunctionInfo(const FunctionProtoType *FTP) { - llvm::SmallVector<QualType, 16> ArgTys; +/// Returns the canonical formal type of the given C++ method. +static CanQual<FunctionProtoType> GetFormalType(const CXXMethodDecl *MD) { + return MD->getType()->getCanonicalTypeUnqualified() + .getAs<FunctionProtoType>(); +} + +/// Returns the "extra-canonicalized" return type, which discards +/// qualifiers on the return type. Codegen doesn't care about them, +/// and it makes ABI code a little easier to be able to assume that +/// all parameter and return types are top-level unqualified. +static CanQualType GetReturnType(QualType RetTy) { + return RetTy->getCanonicalTypeUnqualified().getUnqualifiedType(); +} + +const CGFunctionInfo & +CodeGenTypes::getFunctionInfo(CanQual<FunctionNoProtoType> FTNP) { + return getFunctionInfo(FTNP->getResultType().getUnqualifiedType(), + llvm::SmallVector<CanQualType, 16>(), + FTNP->getCallConv(), + FTNP->getNoReturnAttr()); +} + +/// \param Args - contains any initial parameters besides those +/// in the formal type +static const CGFunctionInfo &getFunctionInfo(CodeGenTypes &CGT, + llvm::SmallVectorImpl<CanQualType> &ArgTys, + CanQual<FunctionProtoType> FTP) { // FIXME: Kill copy. for (unsigned i = 0, e = FTP->getNumArgs(); i != e; ++i) ArgTys.push_back(FTP->getArgType(i)); - return getFunctionInfo(FTP->getResultType(), ArgTys, - FTP->getCallConv(), FTP->getNoReturnAttr()); + CanQualType ResTy = FTP->getResultType().getUnqualifiedType(); + return CGT.getFunctionInfo(ResTy, ArgTys, + FTP->getCallConv(), + FTP->getNoReturnAttr()); +} + +const CGFunctionInfo & +CodeGenTypes::getFunctionInfo(CanQual<FunctionProtoType> FTP) { + llvm::SmallVector<CanQualType, 16> ArgTys; + return ::getFunctionInfo(*this, ArgTys, FTP); } static CallingConv getCallingConventionForDecl(const Decl *D) { @@ -71,67 +104,51 @@ static CallingConv getCallingConventionForDecl(const Decl *D) { const CGFunctionInfo &CodeGenTypes::getFunctionInfo(const CXXRecordDecl *RD, const FunctionProtoType *FTP) { - llvm::SmallVector<QualType, 16> ArgTys; - + llvm::SmallVector<CanQualType, 16> ArgTys; + // Add the 'this' pointer. - ArgTys.push_back(Context.getPointerType(Context.getTagDeclType(RD))); - - for (unsigned i = 0, e = FTP->getNumArgs(); i != e; ++i) - ArgTys.push_back(FTP->getArgType(i)); - - // FIXME: Set calling convention correctly, it needs to be associated with the - // type somehow. - return getFunctionInfo(FTP->getResultType(), ArgTys, - FTP->getCallConv(), FTP->getNoReturnAttr()); + ArgTys.push_back(GetThisType(Context, RD)); + + return ::getFunctionInfo(*this, ArgTys, + FTP->getCanonicalTypeUnqualified().getAs<FunctionProtoType>()); } const CGFunctionInfo &CodeGenTypes::getFunctionInfo(const CXXMethodDecl *MD) { - llvm::SmallVector<QualType, 16> ArgTys; + llvm::SmallVector<CanQualType, 16> ArgTys; + // Add the 'this' pointer unless this is a static method. if (MD->isInstance()) - ArgTys.push_back(MD->getThisType(Context)); + ArgTys.push_back(GetThisType(Context, MD->getParent())); - const FunctionProtoType *FTP = MD->getType()->getAs<FunctionProtoType>(); - for (unsigned i = 0, e = FTP->getNumArgs(); i != e; ++i) - ArgTys.push_back(FTP->getArgType(i)); - return getFunctionInfo(FTP->getResultType(), ArgTys, FTP->getCallConv(), - FTP->getNoReturnAttr()); + return ::getFunctionInfo(*this, ArgTys, GetFormalType(MD)); } const CGFunctionInfo &CodeGenTypes::getFunctionInfo(const CXXConstructorDecl *D, CXXCtorType Type) { - llvm::SmallVector<QualType, 16> ArgTys; + llvm::SmallVector<CanQualType, 16> ArgTys; // Add the 'this' pointer. - ArgTys.push_back(D->getThisType(Context)); + ArgTys.push_back(GetThisType(Context, D->getParent())); // Check if we need to add a VTT parameter (which has type void **). if (Type == Ctor_Base && D->getParent()->getNumVBases() != 0) ArgTys.push_back(Context.getPointerType(Context.VoidPtrTy)); - - const FunctionProtoType *FTP = D->getType()->getAs<FunctionProtoType>(); - for (unsigned i = 0, e = FTP->getNumArgs(); i != e; ++i) - ArgTys.push_back(FTP->getArgType(i)); - return getFunctionInfo(FTP->getResultType(), ArgTys, FTP->getCallConv(), - FTP->getNoReturnAttr()); + + return ::getFunctionInfo(*this, ArgTys, GetFormalType(D)); } const CGFunctionInfo &CodeGenTypes::getFunctionInfo(const CXXDestructorDecl *D, CXXDtorType Type) { - llvm::SmallVector<QualType, 16> ArgTys; + llvm::SmallVector<CanQualType, 16> ArgTys; // Add the 'this' pointer. - ArgTys.push_back(D->getThisType(Context)); + ArgTys.push_back(GetThisType(Context, D->getParent())); // Check if we need to add a VTT parameter (which has type void **). if (Type == Dtor_Base && D->getParent()->getNumVBases() != 0) ArgTys.push_back(Context.getPointerType(Context.VoidPtrTy)); - - const FunctionProtoType *FTP = D->getType()->getAs<FunctionProtoType>(); - for (unsigned i = 0, e = FTP->getNumArgs(); i != e; ++i) - ArgTys.push_back(FTP->getArgType(i)); - return getFunctionInfo(FTP->getResultType(), ArgTys, FTP->getCallConv(), - FTP->getNoReturnAttr()); + + return ::getFunctionInfo(*this, ArgTys, GetFormalType(D)); } const CGFunctionInfo &CodeGenTypes::getFunctionInfo(const FunctionDecl *FD) { @@ -139,30 +156,25 @@ const CGFunctionInfo &CodeGenTypes::getFunctionInfo(const FunctionDecl *FD) { if (MD->isInstance()) return getFunctionInfo(MD); - const FunctionType *FTy = FD->getType()->getAs<FunctionType>(); - if (const FunctionNoProtoType *FNTP = dyn_cast<FunctionNoProtoType>(FTy)) - return getFunctionInfo(FNTP->getResultType(), - llvm::SmallVector<QualType, 16>(), - FNTP->getCallConv(), FNTP->getNoReturnAttr()); - - const FunctionProtoType *FPT = cast<FunctionProtoType>(FTy); - llvm::SmallVector<QualType, 16> ArgTys; - // FIXME: Kill copy. - for (unsigned i = 0, e = FPT->getNumArgs(); i != e; ++i) - ArgTys.push_back(FPT->getArgType(i)); - return getFunctionInfo(FPT->getResultType(), ArgTys, - FPT->getCallConv(), FPT->getNoReturnAttr()); + CanQualType FTy = FD->getType()->getCanonicalTypeUnqualified(); + assert(isa<FunctionType>(FTy)); + if (isa<FunctionNoProtoType>(FTy)) + return getFunctionInfo(FTy.getAs<FunctionNoProtoType>()); + assert(isa<FunctionProtoType>(FTy)); + return getFunctionInfo(FTy.getAs<FunctionProtoType>()); } const CGFunctionInfo &CodeGenTypes::getFunctionInfo(const ObjCMethodDecl *MD) { - llvm::SmallVector<QualType, 16> ArgTys; - ArgTys.push_back(MD->getSelfDecl()->getType()); - ArgTys.push_back(Context.getObjCSelType()); + llvm::SmallVector<CanQualType, 16> ArgTys; + ArgTys.push_back(Context.getCanonicalParamType(MD->getSelfDecl()->getType())); + ArgTys.push_back(Context.getCanonicalParamType(Context.getObjCSelType())); // FIXME: Kill copy? for (ObjCMethodDecl::param_iterator i = MD->param_begin(), - e = MD->param_end(); i != e; ++i) - ArgTys.push_back((*i)->getType()); - return getFunctionInfo(MD->getResultType(), ArgTys, + e = MD->param_end(); i != e; ++i) { + ArgTys.push_back(Context.getCanonicalParamType((*i)->getType())); + } + return getFunctionInfo(GetReturnType(MD->getResultType()), + ArgTys, getCallingConventionForDecl(MD), /*NoReturn*/ false); } @@ -185,11 +197,11 @@ const CGFunctionInfo &CodeGenTypes::getFunctionInfo(QualType ResTy, CallingConv CC, bool NoReturn) { // FIXME: Kill copy. - llvm::SmallVector<QualType, 16> ArgTys; + llvm::SmallVector<CanQualType, 16> ArgTys; for (CallArgList::const_iterator i = Args.begin(), e = Args.end(); i != e; ++i) - ArgTys.push_back(i->second); - return getFunctionInfo(ResTy, ArgTys, CC, NoReturn); + ArgTys.push_back(Context.getCanonicalParamType(i->second)); + return getFunctionInfo(GetReturnType(ResTy), ArgTys, CC, NoReturn); } const CGFunctionInfo &CodeGenTypes::getFunctionInfo(QualType ResTy, @@ -197,17 +209,23 @@ const CGFunctionInfo &CodeGenTypes::getFunctionInfo(QualType ResTy, CallingConv CC, bool NoReturn) { // FIXME: Kill copy. - llvm::SmallVector<QualType, 16> ArgTys; + llvm::SmallVector<CanQualType, 16> ArgTys; for (FunctionArgList::const_iterator i = Args.begin(), e = Args.end(); i != e; ++i) - ArgTys.push_back(i->second); - return getFunctionInfo(ResTy, ArgTys, CC, NoReturn); + ArgTys.push_back(Context.getCanonicalParamType(i->second)); + return getFunctionInfo(GetReturnType(ResTy), ArgTys, CC, NoReturn); } -const CGFunctionInfo &CodeGenTypes::getFunctionInfo(QualType ResTy, - const llvm::SmallVector<QualType, 16> &ArgTys, +const CGFunctionInfo &CodeGenTypes::getFunctionInfo(CanQualType ResTy, + const llvm::SmallVectorImpl<CanQualType> &ArgTys, CallingConv CallConv, bool NoReturn) { +#ifndef NDEBUG + for (llvm::SmallVectorImpl<CanQualType>::const_iterator + I = ArgTys.begin(), E = ArgTys.end(); I != E; ++I) + assert(I->isCanonicalAsParam()); +#endif + unsigned CC = ClangCallConvToLLVMCallConv(CallConv); // Lookup or create unique function info. @@ -232,8 +250,8 @@ const CGFunctionInfo &CodeGenTypes::getFunctionInfo(QualType ResTy, CGFunctionInfo::CGFunctionInfo(unsigned _CallingConvention, bool _NoReturn, - QualType ResTy, - const llvm::SmallVector<QualType, 16> &ArgTys) + CanQualType ResTy, + const llvm::SmallVectorImpl<CanQualType> &ArgTys) : CallingConvention(_CallingConvention), EffectiveCallingConvention(_CallingConvention), NoReturn(_NoReturn) @@ -416,6 +434,18 @@ bool CodeGenModule::ReturnTypeUsesSret(const CGFunctionInfo &FI) { return FI.getReturnInfo().isIndirect(); } +const llvm::FunctionType *CodeGenTypes::GetFunctionType(GlobalDecl GD) { + const CGFunctionInfo &FI = getFunctionInfo(GD); + + // For definition purposes, don't consider a K&R function variadic. + bool Variadic = false; + if (const FunctionProtoType *FPT = + cast<FunctionDecl>(GD.getDecl())->getType()->getAs<FunctionProtoType>()) + Variadic = FPT->isVariadic(); + + return GetFunctionType(FI, Variadic); +} + const llvm::FunctionType * CodeGenTypes::GetFunctionType(const CGFunctionInfo &FI, bool IsVariadic) { std::vector<const llvm::Type*> ArgTys; diff --git a/lib/CodeGen/CGCall.h b/lib/CodeGen/CGCall.h index 9601e9ae9a27..3d81165b1bf1 100644 --- a/lib/CodeGen/CGCall.h +++ b/lib/CodeGen/CGCall.h @@ -18,6 +18,7 @@ #include "llvm/ADT/FoldingSet.h" #include "llvm/Value.h" #include "clang/AST/Type.h" +#include "clang/AST/CanonicalType.h" #include "CGValue.h" @@ -57,7 +58,7 @@ namespace CodeGen { /// function definition. class CGFunctionInfo : public llvm::FoldingSetNode { struct ArgInfo { - QualType type; + CanQualType type; ABIArgInfo info; }; @@ -81,8 +82,8 @@ namespace CodeGen { CGFunctionInfo(unsigned CallingConvention, bool NoReturn, - QualType ResTy, - const llvm::SmallVector<QualType, 16> &ArgTys); + CanQualType ResTy, + const llvm::SmallVectorImpl<CanQualType> &ArgTys); ~CGFunctionInfo() { delete[] Args; } const_arg_iterator arg_begin() const { return Args + 1; } @@ -107,7 +108,7 @@ namespace CodeGen { EffectiveCallingConvention = Value; } - QualType getReturnType() const { return Args[0].type; } + CanQualType getReturnType() const { return Args[0].type; } ABIArgInfo &getReturnInfo() { return Args[0].info; } const ABIArgInfo &getReturnInfo() const { return Args[0].info; } @@ -123,14 +124,16 @@ namespace CodeGen { static void Profile(llvm::FoldingSetNodeID &ID, unsigned CallingConvention, bool NoReturn, - QualType ResTy, + CanQualType ResTy, Iterator begin, Iterator end) { ID.AddInteger(CallingConvention); ID.AddBoolean(NoReturn); ResTy.Profile(ID); - for (; begin != end; ++begin) - begin->Profile(ID); + for (; begin != end; ++begin) { + CanQualType T = *begin; // force iterator to be over canonical types + T.Profile(ID); + } } }; diff --git a/lib/CodeGen/CGClass.cpp b/lib/CodeGen/CGClass.cpp index fa5a47f31564..99c6dfd7ebc4 100644 --- a/lib/CodeGen/CGClass.cpp +++ b/lib/CodeGen/CGClass.cpp @@ -14,6 +14,7 @@ #include "CodeGenFunction.h" #include "clang/AST/CXXInheritance.h" #include "clang/AST/RecordLayout.h" +#include "clang/AST/StmtCXX.h" using namespace clang; using namespace CodeGen; @@ -477,12 +478,21 @@ static llvm::Value *GetVTTParameter(CodeGenFunction &CGF, GlobalDecl GD) { const CXXRecordDecl *RD = cast<CXXMethodDecl>(CGF.CurFuncDecl)->getParent(); const CXXRecordDecl *Base = cast<CXXMethodDecl>(GD.getDecl())->getParent(); - + llvm::Value *VTT; - uint64_t SubVTTIndex = - CGF.CGM.getVtableInfo().getSubVTTIndex(RD, Base); - assert(SubVTTIndex != 0 && "Sub-VTT index must be greater than zero!"); + uint64_t SubVTTIndex; + + // If the record matches the base, this is the complete ctor/dtor + // variant calling the base variant in a class with virtual bases. + if (RD == Base) { + assert(!CGVtableInfo::needsVTTParameter(CGF.CurGD) && + "doing no-op VTT offset in base dtor/ctor?"); + SubVTTIndex = 0; + } else { + SubVTTIndex = CGF.CGM.getVtableInfo().getSubVTTIndex(RD, Base); + assert(SubVTTIndex != 0 && "Sub-VTT index must be greater than zero!"); + } if (CGVtableInfo::needsVTTParameter(CGF.CurGD)) { // A VTT parameter was passed to the constructor, use it. @@ -590,19 +600,6 @@ void CodeGenFunction::EmitClassCopyAssignment( Callee, ReturnValueSlot(), CallArgs, MD); } -/// SynthesizeDefaultConstructor - synthesize a default constructor -void -CodeGenFunction::SynthesizeDefaultConstructor(const CXXConstructorDecl *Ctor, - CXXCtorType Type, - llvm::Function *Fn, - const FunctionArgList &Args) { - assert(!Ctor->isTrivial() && "shouldn't need to generate trivial ctor"); - StartFunction(GlobalDecl(Ctor, Type), Ctor->getResultType(), Fn, Args, - SourceLocation()); - EmitCtorPrologue(Ctor, Type); - FinishFunction(); -} - /// SynthesizeCXXCopyConstructor - This routine implicitly defines body of a /// copy constructor, in accordance with section 12.8 (p7 and p8) of C++03 /// The implicitly-defined copy constructor for class X performs a memberwise @@ -619,16 +616,12 @@ CodeGenFunction::SynthesizeDefaultConstructor(const CXXConstructorDecl *Ctor, /// implicitly-defined copy constructor void -CodeGenFunction::SynthesizeCXXCopyConstructor(const CXXConstructorDecl *Ctor, - CXXCtorType Type, - llvm::Function *Fn, - const FunctionArgList &Args) { +CodeGenFunction::SynthesizeCXXCopyConstructor(const FunctionArgList &Args) { + const CXXConstructorDecl *Ctor = cast<CXXConstructorDecl>(CurGD.getDecl()); const CXXRecordDecl *ClassDecl = Ctor->getParent(); assert(!ClassDecl->hasUserDeclaredCopyConstructor() && "SynthesizeCXXCopyConstructor - copy constructor has definition already"); assert(!Ctor->isTrivial() && "shouldn't need to generate trivial ctor"); - StartFunction(GlobalDecl(Ctor, Type), Ctor->getResultType(), Fn, Args, - SourceLocation()); FunctionArgList::const_iterator i = Args.begin(); const VarDecl *ThisArg = i->first; @@ -698,7 +691,6 @@ CodeGenFunction::SynthesizeCXXCopyConstructor(const CXXConstructorDecl *Ctor, } InitializeVtablePtrs(ClassDecl); - FinishFunction(); } /// SynthesizeCXXCopyAssignment - Implicitly define copy assignment operator. @@ -721,14 +713,11 @@ CodeGenFunction::SynthesizeCXXCopyConstructor(const CXXConstructorDecl *Ctor, /// /// if the subobject is of scalar type, the built-in assignment operator is /// used. -void CodeGenFunction::SynthesizeCXXCopyAssignment(const CXXMethodDecl *CD, - llvm::Function *Fn, - const FunctionArgList &Args) { - +void CodeGenFunction::SynthesizeCXXCopyAssignment(const FunctionArgList &Args) { + const CXXMethodDecl *CD = cast<CXXMethodDecl>(CurGD.getDecl()); const CXXRecordDecl *ClassDecl = cast<CXXRecordDecl>(CD->getDeclContext()); assert(!ClassDecl->hasUserDeclaredCopyAssignment() && "SynthesizeCXXCopyAssignment - copy assignment has user declaration"); - StartFunction(CD, CD->getResultType(), Fn, Args, SourceLocation()); FunctionArgList::const_iterator i = Args.begin(); const VarDecl *ThisArg = i->first; @@ -796,8 +785,6 @@ void CodeGenFunction::SynthesizeCXXCopyAssignment(const CXXMethodDecl *CD, // return *this; Builder.CreateStore(LoadOfThis, ReturnValue); - - FinishFunction(); } static void EmitBaseInitializer(CodeGenFunction &CGF, @@ -904,6 +891,101 @@ static void EmitMemberInitializer(CodeGenFunction &CGF, } } +/// Checks whether the given constructor is a valid subject for the +/// complete-to-base constructor delegation optimization, i.e. +/// emitting the complete constructor as a simple call to the base +/// constructor. +static bool IsConstructorDelegationValid(const CXXConstructorDecl *Ctor) { + + // Currently we disable the optimization for classes with virtual + // bases because (1) the addresses of parameter variables need to be + // consistent across all initializers but (2) the delegate function + // call necessarily creates a second copy of the parameter variable. + // + // The limiting example (purely theoretical AFAIK): + // struct A { A(int &c) { c++; } }; + // struct B : virtual A { + // B(int count) : A(count) { printf("%d\n", count); } + // }; + // ...although even this example could in principle be emitted as a + // delegation since the address of the parameter doesn't escape. + if (Ctor->getParent()->getNumVBases()) { + // TODO: white-list trivial vbase initializers. This case wouldn't + // be subject to the restrictions below. + + // TODO: white-list cases where: + // - there are no non-reference parameters to the constructor + // - the initializers don't access any non-reference parameters + // - the initializers don't take the address of non-reference + // parameters + // - etc. + // If we ever add any of the above cases, remember that: + // - function-try-blocks will always blacklist this optimization + // - we need to perform the constructor prologue and cleanup in + // EmitConstructorBody. + + return false; + } + + // We also disable the optimization for variadic functions because + // it's impossible to "re-pass" varargs. + if (Ctor->getType()->getAs<FunctionProtoType>()->isVariadic()) + return false; + + return true; +} + +/// EmitConstructorBody - Emits the body of the current constructor. +void CodeGenFunction::EmitConstructorBody(FunctionArgList &Args) { + const CXXConstructorDecl *Ctor = cast<CXXConstructorDecl>(CurGD.getDecl()); + CXXCtorType CtorType = CurGD.getCtorType(); + + // Before we go any further, try the complete->base constructor + // delegation optimization. + if (CtorType == Ctor_Complete && IsConstructorDelegationValid(Ctor)) { + EmitDelegateCXXConstructorCall(Ctor, Ctor_Base, Args); + return; + } + + Stmt *Body = Ctor->getBody(); + + // Enter the function-try-block before the constructor prologue if + // applicable. + CXXTryStmtInfo TryInfo; + bool IsTryBody = (Body && isa<CXXTryStmt>(Body)); + + if (IsTryBody) + TryInfo = EnterCXXTryStmt(*cast<CXXTryStmt>(Body)); + + unsigned CleanupStackSize = CleanupEntries.size(); + + // Emit the constructor prologue, i.e. the base and member + // initializers. + EmitCtorPrologue(Ctor, CtorType); + + // Emit the body of the statement. + if (IsTryBody) + EmitStmt(cast<CXXTryStmt>(Body)->getTryBlock()); + else if (Body) + EmitStmt(Body); + else { + assert(Ctor->isImplicit() && "bodyless ctor not implicit"); + if (!Ctor->isDefaultConstructor()) { + assert(Ctor->isCopyConstructor()); + SynthesizeCXXCopyConstructor(Args); + } + } + + // Emit any cleanup blocks associated with the member or base + // initializers, which includes (along the exceptional path) the + // destructors for those members and bases that were fully + // constructed. + EmitCleanupBlocks(CleanupStackSize); + + if (IsTryBody) + ExitCXXTryStmt(*cast<CXXTryStmt>(Body), TryInfo); +} + /// EmitCtorPrologue - This routine generates necessary code to initialize /// base classes and non-static data members belonging to this constructor. void CodeGenFunction::EmitCtorPrologue(const CXXConstructorDecl *CD, @@ -938,10 +1020,87 @@ void CodeGenFunction::EmitCtorPrologue(const CXXConstructorDecl *CD, } } +/// EmitDestructorBody - Emits the body of the current destructor. +void CodeGenFunction::EmitDestructorBody(FunctionArgList &Args) { + const CXXDestructorDecl *Dtor = cast<CXXDestructorDecl>(CurGD.getDecl()); + CXXDtorType DtorType = CurGD.getDtorType(); + + Stmt *Body = Dtor->getBody(); + + // If the body is a function-try-block, enter the try before + // anything else --- unless we're in a deleting destructor, in which + // case we're just going to call the complete destructor and then + // call operator delete() on the way out. + CXXTryStmtInfo TryInfo; + bool isTryBody = (DtorType != Dtor_Deleting && + Body && isa<CXXTryStmt>(Body)); + if (isTryBody) + TryInfo = EnterCXXTryStmt(*cast<CXXTryStmt>(Body)); + + llvm::BasicBlock *DtorEpilogue = createBasicBlock("dtor.epilogue"); + PushCleanupBlock(DtorEpilogue); + + bool SkipBody = false; // should get jump-threaded + + // If this is the deleting variant, just invoke the complete + // variant, then call the appropriate operator delete() on the way + // out. + if (DtorType == Dtor_Deleting) { + EmitCXXDestructorCall(Dtor, Dtor_Complete, LoadCXXThis()); + SkipBody = true; + + // If this is the complete variant, just invoke the base variant; + // the epilogue will destruct the virtual bases. But we can't do + // this optimization if the body is a function-try-block, because + // we'd introduce *two* handler blocks. + } else if (!isTryBody && DtorType == Dtor_Complete) { + EmitCXXDestructorCall(Dtor, Dtor_Base, LoadCXXThis()); + SkipBody = true; + + // Otherwise, we're in the base variant, so we need to ensure the + // vtable ptrs are right before emitting the body. + } else { + InitializeVtablePtrs(Dtor->getParent()); + } + + // Emit the body of the statement. + if (SkipBody) + (void) 0; + else if (isTryBody) + EmitStmt(cast<CXXTryStmt>(Body)->getTryBlock()); + else if (Body) + EmitStmt(Body); + else { + assert(Dtor->isImplicit() && "bodyless dtor not implicit"); + // nothing to do besides what's in the epilogue + } + + // Jump to the cleanup block. + CleanupBlockInfo Info = PopCleanupBlock(); + assert(Info.CleanupBlock == DtorEpilogue && "Block mismatch!"); + EmitBlock(DtorEpilogue); + + // Emit the destructor epilogue now. If this is a complete + // destructor with a function-try-block, perform the base epilogue + // as well. + if (isTryBody && DtorType == Dtor_Complete) + EmitDtorEpilogue(Dtor, Dtor_Base); + EmitDtorEpilogue(Dtor, DtorType); + + // Link up the cleanup information. + if (Info.SwitchBlock) + EmitBlock(Info.SwitchBlock); + if (Info.EndBlock) + EmitBlock(Info.EndBlock); + + // Exit the try if applicable. + if (isTryBody) + ExitCXXTryStmt(*cast<CXXTryStmt>(Body), TryInfo); +} + /// EmitDtorEpilogue - Emit all code that comes at the end of class's /// destructor. This is to call destructors on members and base classes /// in reverse order of their construction. -/// FIXME: This needs to take a CXXDtorType. void CodeGenFunction::EmitDtorEpilogue(const CXXDestructorDecl *DD, CXXDtorType DtorType) { assert(!DD->isTrivial() && @@ -949,6 +1108,44 @@ void CodeGenFunction::EmitDtorEpilogue(const CXXDestructorDecl *DD, const CXXRecordDecl *ClassDecl = DD->getParent(); + // In a deleting destructor, we've already called the complete + // destructor as a subroutine, so we just have to delete the + // appropriate value. + if (DtorType == Dtor_Deleting) { + assert(DD->getOperatorDelete() && + "operator delete missing - EmitDtorEpilogue"); + EmitDeleteCall(DD->getOperatorDelete(), LoadCXXThis(), + getContext().getTagDeclType(ClassDecl)); + return; + } + + // For complete destructors, we've already called the base + // destructor (in GenerateBody), so we just need to destruct all the + // virtual bases. + if (DtorType == Dtor_Complete) { + // Handle virtual bases. + for (CXXRecordDecl::reverse_base_class_const_iterator I = + ClassDecl->vbases_rbegin(), E = ClassDecl->vbases_rend(); + I != E; ++I) { + const CXXBaseSpecifier &Base = *I; + CXXRecordDecl *BaseClassDecl + = cast<CXXRecordDecl>(Base.getType()->getAs<RecordType>()->getDecl()); + + // Ignore trivial destructors. + if (BaseClassDecl->hasTrivialDestructor()) + continue; + const CXXDestructorDecl *D = BaseClassDecl->getDestructor(getContext()); + llvm::Value *V = GetAddressOfBaseOfCompleteClass(LoadCXXThis(), + true, + ClassDecl, + BaseClassDecl); + EmitCXXDestructorCall(D, Dtor_Base, V); + } + return; + } + + assert(DtorType == Dtor_Base); + // Collect the fields. llvm::SmallVector<const FieldDecl *, 16> FieldDecls; for (CXXRecordDecl::field_iterator I = ClassDecl->field_begin(), @@ -1021,51 +1218,6 @@ void CodeGenFunction::EmitDtorEpilogue(const CXXDestructorDecl *DD, /*NullCheckValue=*/false); EmitCXXDestructorCall(D, Dtor_Base, V); } - - // If we're emitting a base destructor, we don't want to emit calls to the - // virtual bases. - if (DtorType == Dtor_Base) - return; - - // Handle virtual bases. - for (CXXRecordDecl::reverse_base_class_const_iterator I = - ClassDecl->vbases_rbegin(), E = ClassDecl->vbases_rend(); I != E; ++I) { - const CXXBaseSpecifier &Base = *I; - CXXRecordDecl *BaseClassDecl - = cast<CXXRecordDecl>(Base.getType()->getAs<RecordType>()->getDecl()); - - // Ignore trivial destructors. - if (BaseClassDecl->hasTrivialDestructor()) - continue; - const CXXDestructorDecl *D = BaseClassDecl->getDestructor(getContext()); - llvm::Value *V = GetAddressOfBaseOfCompleteClass(LoadCXXThis(), - true, - ClassDecl, - BaseClassDecl); - EmitCXXDestructorCall(D, Dtor_Base, V); - } - - // If we have a deleting destructor, emit a call to the delete operator. - if (DtorType == Dtor_Deleting) { - assert(DD->getOperatorDelete() && - "operator delete missing - EmitDtorEpilogue"); - EmitDeleteCall(DD->getOperatorDelete(), LoadCXXThis(), - getContext().getTagDeclType(ClassDecl)); - } -} - -void CodeGenFunction::SynthesizeDefaultDestructor(const CXXDestructorDecl *Dtor, - CXXDtorType DtorType, - llvm::Function *Fn, - const FunctionArgList &Args) { - assert(!Dtor->getParent()->hasUserDeclaredDestructor() && - "SynthesizeDefaultDestructor - destructor has user declaration"); - - StartFunction(GlobalDecl(Dtor, DtorType), Dtor->getResultType(), Fn, Args, - SourceLocation()); - InitializeVtablePtrs(Dtor->getParent()); - EmitDtorEpilogue(Dtor, DtorType); - FinishFunction(); } /// EmitCXXAggrConstructorCall - This routine essentially creates a (nested) @@ -1303,6 +1455,71 @@ CodeGenFunction::EmitCXXConstructorCall(const CXXConstructorDecl *D, EmitCXXMemberCall(D, Callee, ReturnValueSlot(), This, VTT, ArgBeg, ArgEnd); } +void +CodeGenFunction::EmitDelegateCXXConstructorCall(const CXXConstructorDecl *Ctor, + CXXCtorType CtorType, + const FunctionArgList &Args) { + CallArgList DelegateArgs; + + FunctionArgList::const_iterator I = Args.begin(), E = Args.end(); + assert(I != E && "no parameters to constructor"); + + // this + DelegateArgs.push_back(std::make_pair(RValue::get(LoadCXXThis()), + I->second)); + ++I; + + // vtt + if (llvm::Value *VTT = GetVTTParameter(*this, GlobalDecl(Ctor, CtorType))) { + QualType VoidPP = getContext().getPointerType(getContext().VoidPtrTy); + DelegateArgs.push_back(std::make_pair(RValue::get(VTT), VoidPP)); + + if (CGVtableInfo::needsVTTParameter(CurGD)) { + assert(I != E && "cannot skip vtt parameter, already done with args"); + assert(I->second == VoidPP && "skipping parameter not of vtt type"); + ++I; + } + } + + // Explicit arguments. + for (; I != E; ++I) { + + const VarDecl *Param = I->first; + QualType ArgType = Param->getType(); // because we're passing it to itself + + // StartFunction converted the ABI-lowered parameter(s) into a + // local alloca. We need to turn that into an r-value suitable + // for EmitCall. + llvm::Value *Local = GetAddrOfLocalVar(Param); + RValue Arg; + + // For the most part, we just need to load the alloca, except: + // 1) aggregate r-values are actually pointers to temporaries, and + // 2) references to aggregates are pointers directly to the aggregate. + // I don't know why references to non-aggregates are different here. + if (ArgType->isReferenceType()) { + const ReferenceType *RefType = ArgType->getAs<ReferenceType>(); + if (hasAggregateLLVMType(RefType->getPointeeType())) + Arg = RValue::getAggregate(Local); + else + // Locals which are references to scalars are represented + // with allocas holding the pointer. + Arg = RValue::get(Builder.CreateLoad(Local)); + } else { + if (hasAggregateLLVMType(ArgType)) + Arg = RValue::getAggregate(Local); + else + Arg = RValue::get(EmitLoadOfScalar(Local, false, ArgType)); + } + + DelegateArgs.push_back(std::make_pair(Arg, ArgType)); + } + + EmitCall(CGM.getTypes().getFunctionInfo(Ctor, CtorType), + CGM.GetAddrOfCXXConstructor(Ctor, CtorType), + ReturnValueSlot(), DelegateArgs, Ctor); +} + void CodeGenFunction::EmitCXXDestructorCall(const CXXDestructorDecl *DD, CXXDtorType Type, llvm::Value *This) { @@ -1405,11 +1622,3 @@ void CodeGenFunction::InitializeVtablePtrsRecursive( // Store address point Builder.CreateStore(VtableAddressPoint, VtableField); } - -llvm::Value *CodeGenFunction::LoadCXXVTT() { - assert((isa<CXXConstructorDecl>(CurFuncDecl) || - isa<CXXDestructorDecl>(CurFuncDecl)) && - "Must be in a C++ ctor or dtor to load the vtt parameter"); - - return Builder.CreateLoad(LocalDeclMap[CXXVTTDecl], "vtt"); -} diff --git a/lib/CodeGen/CGDebugInfo.cpp b/lib/CodeGen/CGDebugInfo.cpp index 5b9c6b055e0e..0f3502e9bea3 100644 --- a/lib/CodeGen/CGDebugInfo.cpp +++ b/lib/CodeGen/CGDebugInfo.cpp @@ -1034,6 +1034,28 @@ llvm::DIType CGDebugInfo::CreateType(const TagType *Ty, return llvm::DIType(); } +llvm::DIType CGDebugInfo::CreateType(const VectorType *Ty, + llvm::DICompileUnit Unit) { + llvm::DIType ElementTy = getOrCreateType(Ty->getElementType(), Unit); + uint64_t NumElems = Ty->getNumElements(); + if (NumElems > 0) + --NumElems; + llvm::SmallVector<llvm::DIDescriptor, 8> Subscripts; + Subscripts.push_back(DebugFactory.GetOrCreateSubrange(0, NumElems)); + + llvm::DIArray SubscriptArray = + DebugFactory.GetOrCreateArray(Subscripts.data(), Subscripts.size()); + + uint64_t Size = CGM.getContext().getTypeSize(Ty); + uint64_t Align = CGM.getContext().getTypeAlign(Ty); + + return + DebugFactory.CreateCompositeType(llvm::dwarf::DW_TAG_vector_type, + Unit, "", llvm::DICompileUnit(), + 0, Size, Align, 0, 0, + ElementTy, SubscriptArray); +} + llvm::DIType CGDebugInfo::CreateType(const ArrayType *Ty, llvm::DICompileUnit Unit) { uint64_t Size; @@ -1214,9 +1236,10 @@ llvm::DIType CGDebugInfo::CreateTypeNode(QualType Ty, // FIXME: Handle these. case Type::ExtVector: - case Type::Vector: return llvm::DIType(); - + + case Type::Vector: + return CreateType(cast<VectorType>(Ty), Unit); case Type::ObjCObjectPointer: return CreateType(cast<ObjCObjectPointerType>(Ty), Unit); case Type::ObjCInterface: @@ -1351,10 +1374,13 @@ void CGDebugInfo::EmitStopPoint(llvm::Function *Fn, CGBuilderTy &Builder) { /// EmitRegionStart- Constructs the debug code for entering a declarative /// region - "llvm.dbg.region.start.". void CGDebugInfo::EmitRegionStart(llvm::Function *Fn, CGBuilderTy &Builder) { + SourceManager &SM = CGM.getContext().getSourceManager(); + PresumedLoc PLoc = SM.getPresumedLoc(CurLoc); llvm::DIDescriptor D = DebugFactory.CreateLexicalBlock(RegionStack.empty() ? llvm::DIDescriptor() : - llvm::DIDescriptor(RegionStack.back())); + llvm::DIDescriptor(RegionStack.back()), + PLoc.getLine(), PLoc.getColumn()); RegionStack.push_back(D.getNode()); } @@ -1666,7 +1692,7 @@ void CGDebugInfo::EmitGlobalVariable(llvm::GlobalVariable *Var, T = CGM.getContext().getConstantArrayType(ET, ConstVal, ArrayType::Normal, 0); } - llvm::StringRef DeclName = D->getName(); + llvm::StringRef DeclName = Var->getName(); llvm::DIDescriptor DContext = getContextDescriptor(dyn_cast<Decl>(D->getDeclContext()), Unit); DebugFactory.CreateGlobalVariable(DContext, DeclName, diff --git a/lib/CodeGen/CGDebugInfo.h b/lib/CodeGen/CGDebugInfo.h index b2d3a1f1fa53..50f575940886 100644 --- a/lib/CodeGen/CGDebugInfo.h +++ b/lib/CodeGen/CGDebugInfo.h @@ -84,6 +84,7 @@ class CGDebugInfo { llvm::DIType CreateType(const RecordType *Ty, llvm::DICompileUnit U); llvm::DIType CreateType(const ObjCInterfaceType *Ty, llvm::DICompileUnit U); llvm::DIType CreateType(const EnumType *Ty, llvm::DICompileUnit U); + llvm::DIType CreateType(const VectorType *Ty, llvm::DICompileUnit Unit); llvm::DIType CreateType(const ArrayType *Ty, llvm::DICompileUnit U); llvm::DIType CreateType(const LValueReferenceType *Ty, llvm::DICompileUnit U); llvm::DIType CreateType(const MemberPointerType *Ty, llvm::DICompileUnit U); diff --git a/lib/CodeGen/CGException.cpp b/lib/CodeGen/CGException.cpp index d956c1c3cd85..142cb811b059 100644 --- a/lib/CodeGen/CGException.cpp +++ b/lib/CodeGen/CGException.cpp @@ -427,6 +427,26 @@ void CodeGenFunction::EmitEndEHSpec(const Decl *D) { } void CodeGenFunction::EmitCXXTryStmt(const CXXTryStmt &S) { + CXXTryStmtInfo Info = EnterCXXTryStmt(S); + EmitStmt(S.getTryBlock()); + ExitCXXTryStmt(S, Info); +} + +CodeGenFunction::CXXTryStmtInfo +CodeGenFunction::EnterCXXTryStmt(const CXXTryStmt &S) { + CXXTryStmtInfo Info; + Info.SavedLandingPad = getInvokeDest(); + Info.HandlerBlock = createBasicBlock("try.handler"); + Info.FinallyBlock = createBasicBlock("finally"); + + PushCleanupBlock(Info.FinallyBlock); + setInvokeDest(Info.HandlerBlock); + + return Info; +} + +void CodeGenFunction::ExitCXXTryStmt(const CXXTryStmt &S, + CXXTryStmtInfo TryInfo) { // Pointer to the personality function llvm::Constant *Personality = CGM.CreateRuntimeFunction(llvm::FunctionType::get(llvm::Type::getInt32Ty @@ -439,54 +459,12 @@ void CodeGenFunction::EmitCXXTryStmt(const CXXTryStmt &S) { llvm::Value *llvm_eh_selector = CGM.getIntrinsic(llvm::Intrinsic::eh_selector); - llvm::BasicBlock *PrevLandingPad = getInvokeDest(); - llvm::BasicBlock *TryHandler = createBasicBlock("try.handler"); - llvm::BasicBlock *FinallyBlock = createBasicBlock("finally"); + llvm::BasicBlock *PrevLandingPad = TryInfo.SavedLandingPad; + llvm::BasicBlock *TryHandler = TryInfo.HandlerBlock; + llvm::BasicBlock *FinallyBlock = TryInfo.FinallyBlock; llvm::BasicBlock *FinallyRethrow = createBasicBlock("finally.throw"); llvm::BasicBlock *FinallyEnd = createBasicBlock("finally.end"); - // Push an EH context entry, used for handling rethrows. - PushCleanupBlock(FinallyBlock); - - // Emit the statements in the try {} block - setInvokeDest(TryHandler); - - // FIXME: We should not have to do this here. The AST should have the member - // initializers under the CXXTryStmt's TryBlock. - if (OuterTryBlock == &S) { - GlobalDecl GD = CurGD; - const FunctionDecl *FD = cast<FunctionDecl>(GD.getDecl()); - - if (const CXXConstructorDecl *CD = dyn_cast<CXXConstructorDecl>(FD)) { - size_t OldCleanupStackSize = CleanupEntries.size(); - EmitCtorPrologue(CD, CurGD.getCtorType()); - EmitStmt(S.getTryBlock()); - - // If any of the member initializers are temporaries bound to references - // make sure to emit their destructors. - EmitCleanupBlocks(OldCleanupStackSize); - } else if (const CXXDestructorDecl *DD = dyn_cast<CXXDestructorDecl>(FD)) { - llvm::BasicBlock *DtorEpilogue = createBasicBlock("dtor.epilogue"); - PushCleanupBlock(DtorEpilogue); - - InitializeVtablePtrs(DD->getParent()); - EmitStmt(S.getTryBlock()); - - CleanupBlockInfo Info = PopCleanupBlock(); - - assert(Info.CleanupBlock == DtorEpilogue && "Block mismatch!"); - EmitBlock(DtorEpilogue); - EmitDtorEpilogue(DD, GD.getDtorType()); - - if (Info.SwitchBlock) - EmitBlock(Info.SwitchBlock); - if (Info.EndBlock) - EmitBlock(Info.EndBlock); - } else - EmitStmt(S.getTryBlock()); - } else - EmitStmt(S.getTryBlock()); - // Jump to end if there is no exception EmitBranchThroughCleanup(FinallyEnd); diff --git a/lib/CodeGen/CGExpr.cpp b/lib/CodeGen/CGExpr.cpp index 830954fd10cc..030d2c9c9f84 100644 --- a/lib/CodeGen/CGExpr.cpp +++ b/lib/CodeGen/CGExpr.cpp @@ -36,7 +36,17 @@ llvm::AllocaInst *CodeGenFunction::CreateTempAlloca(const llvm::Type *Ty, return new llvm::AllocaInst(Ty, 0, Name, AllocaInsertPt); } -llvm::Value *CodeGenFunction::CreateMemTemp(QualType Ty, const llvm::Twine &Name) { +llvm::Value *CodeGenFunction::CreateIRTemp(QualType Ty, + const llvm::Twine &Name) { + llvm::AllocaInst *Alloc = CreateTempAlloca(ConvertType(Ty), Name); + // FIXME: Should we prefer the preferred type alignment here? + CharUnits Align = getContext().getTypeAlignInChars(Ty); + Alloc->setAlignment(Align.getQuantity()); + return Alloc; +} + +llvm::Value *CodeGenFunction::CreateMemTemp(QualType Ty, + const llvm::Twine &Name) { llvm::AllocaInst *Alloc = CreateTempAlloca(ConvertTypeForMem(Ty), Name); // FIXME: Should we prefer the preferred type alignment here? CharUnits Align = getContext().getTypeAlignInChars(Ty); @@ -1520,9 +1530,7 @@ CodeGenFunction::EmitLValueForFieldInitialization(llvm::Value* BaseValue, } LValue CodeGenFunction::EmitCompoundLiteralLValue(const CompoundLiteralExpr* E){ - llvm::Value *DeclPtr = CreateTempAlloca(ConvertTypeForMem(E->getType()), - ".compoundliteral"); - + llvm::Value *DeclPtr = CreateMemTemp(E->getType(), ".compoundliteral"); const Expr* InitExpr = E->getInitializer(); LValue Result = LValue::MakeAddr(DeclPtr, MakeQualifiers(E->getType())); diff --git a/lib/CodeGen/CGExprAgg.cpp b/lib/CodeGen/CGExprAgg.cpp index 97455c7b13cf..ac189a064904 100644 --- a/lib/CodeGen/CGExprAgg.cpp +++ b/lib/CodeGen/CGExprAgg.cpp @@ -189,7 +189,7 @@ void AggExprEmitter::VisitCastExpr(CastExpr *E) { CGF.ConvertType(PtrTy)); EmitInitializationToLValue(E->getSubExpr(), LValue::MakeAddr(CastPtr, Qualifiers()), - E->getType()); + E->getSubExpr()->getType()); break; } diff --git a/lib/CodeGen/CGObjCGNU.cpp b/lib/CodeGen/CGObjCGNU.cpp index 1d38ef9e2d2f..198e2d12fca3 100644 --- a/lib/CodeGen/CGObjCGNU.cpp +++ b/lib/CodeGen/CGObjCGNU.cpp @@ -56,7 +56,7 @@ private: const llvm::FunctionType *IMPTy; const llvm::PointerType *IdTy; const llvm::PointerType *PtrToIdTy; - QualType ASTIdTy; + CanQualType ASTIdTy; const llvm::IntegerType *IntTy; const llvm::PointerType *PtrTy; const llvm::IntegerType *LongTy; @@ -262,7 +262,7 @@ CGObjCGNU::CGObjCGNU(CodeGen::CodeGenModule &cgm) PtrTy = PtrToInt8Ty; // Object type - ASTIdTy = CGM.getContext().getObjCIdType(); + ASTIdTy = CGM.getContext().getCanonicalType(CGM.getContext().getObjCIdType()); if (QualType() == ASTIdTy) { IdTy = PtrToInt8Ty; } else { @@ -1192,19 +1192,22 @@ llvm::Constant *CGObjCGNU::GeneratePropertyList(const ObjCImplementationDecl *OI iter != endIter ; iter++) { std::vector<llvm::Constant*> Fields; ObjCPropertyDecl *property = (*iter)->getPropertyDecl(); + ObjCPropertyImplDecl *propertyImpl = *iter; + bool isSynthesized = (propertyImpl->getPropertyImplementation() == + ObjCPropertyImplDecl::Synthesize); Fields.push_back(MakeConstantString(property->getNameAsString())); Fields.push_back(llvm::ConstantInt::get(Int8Ty, property->getPropertyAttributes())); - Fields.push_back(llvm::ConstantInt::get(Int8Ty, - (*iter)->getPropertyImplementation() == - ObjCPropertyImplDecl::Synthesize)); + Fields.push_back(llvm::ConstantInt::get(Int8Ty, isSynthesized)); if (ObjCMethodDecl *getter = property->getGetterMethodDecl()) { - InstanceMethodSels.push_back(getter->getSelector()); std::string TypeStr; Context.getObjCEncodingForMethodDecl(getter,TypeStr); llvm::Constant *TypeEncoding = MakeConstantString(TypeStr); - InstanceMethodTypes.push_back(TypeEncoding); + if (isSynthesized) { + InstanceMethodTypes.push_back(TypeEncoding); + InstanceMethodSels.push_back(getter->getSelector()); + } Fields.push_back(MakeConstantString(getter->getSelector().getAsString())); Fields.push_back(TypeEncoding); } else { @@ -1212,11 +1215,13 @@ llvm::Constant *CGObjCGNU::GeneratePropertyList(const ObjCImplementationDecl *OI Fields.push_back(NULLPtr); } if (ObjCMethodDecl *setter = property->getSetterMethodDecl()) { - InstanceMethodSels.push_back(setter->getSelector()); std::string TypeStr; Context.getObjCEncodingForMethodDecl(setter,TypeStr); llvm::Constant *TypeEncoding = MakeConstantString(TypeStr); - InstanceMethodTypes.push_back(TypeEncoding); + if (isSynthesized) { + InstanceMethodTypes.push_back(TypeEncoding); + InstanceMethodSels.push_back(setter->getSelector()); + } Fields.push_back(MakeConstantString(setter->getSelector().getAsString())); Fields.push_back(TypeEncoding); } else { @@ -1685,7 +1690,7 @@ llvm::Constant *CGObjCGNU::EnumerationMutationFunction() { CodeGen::CodeGenTypes &Types = CGM.getTypes(); ASTContext &Ctx = CGM.getContext(); // void objc_enumerationMutation (id) - llvm::SmallVector<QualType,16> Params; + llvm::SmallVector<CanQualType,1> Params; Params.push_back(ASTIdTy); const llvm::FunctionType *FTy = Types.GetFunctionType(Types.getFunctionInfo(Ctx.VoidTy, Params, diff --git a/lib/CodeGen/CGObjCMac.cpp b/lib/CodeGen/CGObjCMac.cpp index b16a510f98f6..475280b6a01e 100644 --- a/lib/CodeGen/CGObjCMac.cpp +++ b/lib/CodeGen/CGObjCMac.cpp @@ -297,9 +297,9 @@ public: CodeGen::CodeGenTypes &Types = CGM.getTypes(); ASTContext &Ctx = CGM.getContext(); // id objc_getProperty (id, SEL, ptrdiff_t, bool) - llvm::SmallVector<QualType,16> Params; - QualType IdType = Ctx.getObjCIdType(); - QualType SelType = Ctx.getObjCSelType(); + llvm::SmallVector<CanQualType,4> Params; + CanQualType IdType = Ctx.getCanonicalParamType(Ctx.getObjCIdType()); + CanQualType SelType = Ctx.getCanonicalParamType(Ctx.getObjCSelType()); Params.push_back(IdType); Params.push_back(SelType); Params.push_back(Ctx.LongTy); @@ -314,9 +314,9 @@ public: CodeGen::CodeGenTypes &Types = CGM.getTypes(); ASTContext &Ctx = CGM.getContext(); // void objc_setProperty (id, SEL, ptrdiff_t, id, bool, bool) - llvm::SmallVector<QualType,16> Params; - QualType IdType = Ctx.getObjCIdType(); - QualType SelType = Ctx.getObjCSelType(); + llvm::SmallVector<CanQualType,6> Params; + CanQualType IdType = Ctx.getCanonicalParamType(Ctx.getObjCIdType()); + CanQualType SelType = Ctx.getCanonicalParamType(Ctx.getObjCSelType()); Params.push_back(IdType); Params.push_back(SelType); Params.push_back(Ctx.LongTy); @@ -333,8 +333,8 @@ public: CodeGen::CodeGenTypes &Types = CGM.getTypes(); ASTContext &Ctx = CGM.getContext(); // void objc_enumerationMutation (id) - llvm::SmallVector<QualType,16> Params; - Params.push_back(Ctx.getObjCIdType()); + llvm::SmallVector<CanQualType,1> Params; + Params.push_back(Ctx.getCanonicalParamType(Ctx.getObjCIdType())); const llvm::FunctionType *FTy = Types.GetFunctionType(Types.getFunctionInfo(Ctx.VoidTy, Params, CC_Default, false), false); @@ -3293,7 +3293,7 @@ llvm::Constant *CGObjCCommonMac::BuildIvarLayout( // Add this implementations synthesized ivars. llvm::SmallVector<ObjCIvarDecl*, 16> Ivars; - CGM.getContext().CollectSynthesizedIvars(OI, Ivars); + CGM.getContext().CollectNonClassIvars(OI, Ivars); for (unsigned k = 0, e = Ivars.size(); k != e; ++k) RecFields.push_back(cast<FieldDecl>(Ivars[k])); @@ -5093,9 +5093,8 @@ CodeGen::RValue CGObjCNonFragileABIMac::EmitMessageSend( // Find the message function name. // FIXME. This is too much work to get the ABI-specific result type needed to // find the message name. - const CGFunctionInfo &FnInfo = Types.getFunctionInfo(ResultType, - llvm::SmallVector<QualType, 16>(), - CC_Default, false); + const CGFunctionInfo &FnInfo + = Types.getFunctionInfo(ResultType, CallArgList(), CC_Default, false); llvm::Constant *Fn = 0; std::string Name("\01l_"); if (CGM.ReturnTypeUsesSret(FnInfo)) { diff --git a/lib/CodeGen/CGVTT.cpp b/lib/CodeGen/CGVTT.cpp index 9714bd9d9678..96c104b22d15 100644 --- a/lib/CodeGen/CGVTT.cpp +++ b/lib/CodeGen/CGVTT.cpp @@ -46,7 +46,8 @@ class VTTBuilder { llvm::DenseMap<std::pair<const CXXRecordDecl *, BaseSubobject>, uint64_t> CtorVtableAddressPoints; - llvm::Constant *getCtorVtable(const BaseSubobject &Base) { + llvm::Constant *getCtorVtable(const BaseSubobject &Base, + bool BaseIsVirtual) { if (!GenerateDefinition) return 0; @@ -54,7 +55,7 @@ class VTTBuilder { if (!CtorVtable) { // Build the vtable. CGVtableInfo::CtorVtableInfo Info - = CGM.getVtableInfo().getCtorVtable(Class, Base); + = CGM.getVtableInfo().getCtorVtable(Class, Base, BaseIsVirtual); CtorVtable = Info.Vtable; @@ -166,7 +167,7 @@ class VTTBuilder { if (BaseMorallyVirtual || VtblClass == Class) init = BuildVtablePtr(vtbl, VtblClass, Base, BaseOffset); else { - init = getCtorVtable(BaseSubobject(Base, BaseOffset)); + init = getCtorVtable(BaseSubobject(Base, BaseOffset), i->isVirtual()); subvtbl = init; subVtblClass = Base; @@ -186,7 +187,8 @@ class VTTBuilder { /// BuiltVTT - Add the VTT to Inits. Offset is the offset in bits to the /// currnet object we're working on. - void BuildVTT(const CXXRecordDecl *RD, uint64_t Offset, bool MorallyVirtual) { + void BuildVTT(const CXXRecordDecl *RD, uint64_t Offset, bool BaseIsVirtual, + bool MorallyVirtual) { // Itanium C++ ABI 2.6.2: // An array of virtual table addresses, called the VTT, is declared for // each class type that has indirect or direct virtual base classes. @@ -204,7 +206,8 @@ class VTTBuilder { Vtable = ClassVtbl; VtableClass = Class; } else { - Vtable = getCtorVtable(BaseSubobject(RD, Offset)); + Vtable = getCtorVtable(BaseSubobject(RD, Offset), + /*IsVirtual=*/BaseIsVirtual); VtableClass = RD; } @@ -235,7 +238,7 @@ class VTTBuilder { const ASTRecordLayout &Layout = CGM.getContext().getASTRecordLayout(RD); uint64_t BaseOffset = Offset + Layout.getBaseClassOffset(Base); - BuildVTT(Base, BaseOffset, MorallyVirtual); + BuildVTT(Base, BaseOffset, /*BaseIsVirtual=*/false, MorallyVirtual); } } @@ -249,7 +252,7 @@ class VTTBuilder { if (i->isVirtual() && !SeenVBase.count(Base)) { SeenVBase.insert(Base); uint64_t BaseOffset = BLayout.getVBaseClassOffset(Base); - BuildVTT(Base, BaseOffset, false); + BuildVTT(Base, BaseOffset, /*BaseIsVirtual=*/true, false); } VirtualVTTs(Base); } @@ -335,13 +338,13 @@ CGVtableInfo::GenerateVTT(llvm::GlobalVariable::LinkageTypes Linkage, CGVtableInfo::CtorVtableInfo CGVtableInfo::getCtorVtable(const CXXRecordDecl *RD, - const BaseSubobject &Base) { + const BaseSubobject &Base, bool BaseIsVirtual) { CtorVtableInfo Info; Info.Vtable = GenerateVtable(llvm::GlobalValue::InternalLinkage, /*GenerateDefinition=*/true, RD, Base.getBase(), Base.getBaseOffset(), - Info.AddressPoints); + BaseIsVirtual, Info.AddressPoints); return Info; } diff --git a/lib/CodeGen/CGVtable.cpp b/lib/CodeGen/CGVtable.cpp index 970bbd777f14..932bd079e93f 100644 --- a/lib/CodeGen/CGVtable.cpp +++ b/lib/CodeGen/CGVtable.cpp @@ -16,6 +16,7 @@ #include "clang/AST/CXXInheritance.h" #include "clang/AST/RecordLayout.h" #include "llvm/ADT/DenseSet.h" +#include "llvm/ADT/SetVector.h" #include "llvm/Support/Compiler.h" #include "llvm/Support/Format.h" #include <cstdio> @@ -25,40 +26,44 @@ using namespace CodeGen; namespace { +/// BaseOffset - Represents an offset from a derived class to a direct or +/// indirect base class. +struct BaseOffset { + /// DerivedClass - The derived class. + const CXXRecordDecl *DerivedClass; + + /// VirtualBase - If the path from the derived class to the base class + /// involves a virtual base class, this holds its declaration. + const CXXRecordDecl *VirtualBase; + + /// NonVirtualOffset - The offset from the derived class to the base class. + /// (Or the offset from the virtual base class to the base class, if the + /// path from the derived class to the base class involves a virtual base + /// class. + int64_t NonVirtualOffset; + + BaseOffset() : DerivedClass(0), VirtualBase(0), NonVirtualOffset(0) { } + BaseOffset(const CXXRecordDecl *DerivedClass, + const CXXRecordDecl *VirtualBase, int64_t NonVirtualOffset) + : DerivedClass(DerivedClass), VirtualBase(VirtualBase), + NonVirtualOffset(NonVirtualOffset) { } + + bool isEmpty() const { return !NonVirtualOffset && !VirtualBase; } +}; + /// FinalOverriders - Contains the final overrider member functions for all /// member functions in the base subobjects of a class. class FinalOverriders { public: - /// BaseOffset - Represents an offset from a derived class to a direct or - /// indirect base class. - struct BaseOffset { - /// DerivedClass - The derived class. - const CXXRecordDecl *DerivedClass; - - /// VirtualBase - If the path from the derived class to the base class - /// involves a virtual base class, this holds its declaration. - const CXXRecordDecl *VirtualBase; - - /// NonVirtualOffset - The offset from the derived class to the base class. - /// Or the offset from the virtual base class to the base class, if the path - /// from the derived class to the base class involves a virtual base class. - int64_t NonVirtualOffset; - - BaseOffset() : DerivedClass(0), VirtualBase(0), NonVirtualOffset(0) { } - BaseOffset(const CXXRecordDecl *DerivedClass, - const CXXRecordDecl *VirtualBase, int64_t NonVirtualOffset) - : DerivedClass(DerivedClass), VirtualBase(VirtualBase), - NonVirtualOffset(NonVirtualOffset) { } - - bool isEmpty() const { return !NonVirtualOffset && !VirtualBase; } - }; - /// OverriderInfo - Information about a final overrider. struct OverriderInfo { /// Method - The method decl of the overrider. const CXXMethodDecl *Method; + + /// Offset - the base offset of the overrider relative to the layout class. + int64_t Offset; - OverriderInfo() : Method(0) { } + OverriderInfo() : Method(0), Offset(0) { } }; private: @@ -93,12 +98,9 @@ private: /// ReturnAdjustments - Holds return adjustments for all the overriders that /// need to perform return value adjustments. AdjustmentOffsetsMapTy ReturnAdjustments; - - /// ThisAdjustments - Holds 'this' adjustments for all the overriders that - /// need them. - AdjustmentOffsetsMapTy ThisAdjustments; - typedef llvm::SmallVector<uint64_t, 1> OffsetVectorTy; + // FIXME: We might be able to get away with making this a SmallSet. + typedef llvm::SmallSetVector<uint64_t, 2> OffsetSetVectorTy; /// SubobjectOffsetsMapTy - This map is used for keeping track of all the /// base subobject offsets that a single class declaration might refer to. @@ -113,12 +115,13 @@ private: /// when we determine that C::f() overrides A::f(), we need to update the /// overriders map for both A-in-B1 and A-in-B2 and the subobject offsets map /// will have the subobject offsets for both A copies. - typedef llvm::DenseMap<const CXXRecordDecl *, OffsetVectorTy> + typedef llvm::DenseMap<const CXXRecordDecl *, OffsetSetVectorTy> SubobjectOffsetsMapTy; /// ComputeFinalOverriders - Compute the final overriders for a given base /// subobject (and all its direct and indirect bases). void ComputeFinalOverriders(BaseSubobject Base, + bool BaseSubobjectIsVisitedVBase, SubobjectOffsetsMapTy &Offsets); /// AddOverriders - Add the final overriders for this base subobject to the @@ -139,17 +142,12 @@ private: const CXXMethodDecl *NewMD, SubobjectOffsetsMapTy &Offsets); - /// ComputeThisAdjustmentBaseOffset - Compute the base offset for adjusting - /// the 'this' pointer from the base subobject to the derived subobject. - BaseOffset ComputeThisAdjustmentBaseOffset(BaseSubobject Base, - BaseSubobject Derived); - static void MergeSubobjectOffsets(const SubobjectOffsetsMapTy &NewOffsets, SubobjectOffsetsMapTy &Offsets); public: explicit FinalOverriders(const CXXRecordDecl *MostDerivedClass); - + /// getOverrider - Get the final overrider for the given method declaration in /// the given base subobject. OverriderInfo getOverrider(BaseSubobject Base, @@ -168,14 +166,6 @@ public: return ReturnAdjustments.lookup(std::make_pair(Base, MD)); } - /// getThisAdjustmentOffset - Get the 'this' pointer adjustment offset for the - /// method decl in the given base subobject. Returns an empty base offset if - /// no adjustment is needed. - BaseOffset getThisAdjustmentOffset(BaseSubobject Base, - const CXXMethodDecl *MD) const { - return ThisAdjustments.lookup(std::make_pair(Base, MD)); - } - /// dump - dump the final overriders. void dump() { assert(VisitedVirtualBases.empty() && @@ -189,6 +179,8 @@ public: void dump(llvm::raw_ostream &Out, BaseSubobject Base); }; +#define DUMP_OVERRIDERS 0 + FinalOverriders::FinalOverriders(const CXXRecordDecl *MostDerivedClass) : MostDerivedClass(MostDerivedClass), Context(MostDerivedClass->getASTContext()), @@ -196,8 +188,11 @@ FinalOverriders::FinalOverriders(const CXXRecordDecl *MostDerivedClass) // Compute the final overriders. SubobjectOffsetsMapTy Offsets; - ComputeFinalOverriders(BaseSubobject(MostDerivedClass, 0), Offsets); - + ComputeFinalOverriders(BaseSubobject(MostDerivedClass, 0), + /*BaseSubobjectIsVisitedVBase=*/false, Offsets); + VisitedVirtualBases.clear(); + +#if DUMP_OVERRIDERS // And dump them (for now). dump(); @@ -212,6 +207,7 @@ FinalOverriders::FinalOverriders(const CXXRecordDecl *MostDerivedClass) for (unsigned I = 0, E = OffsetVector.size(); I != E; ++I) llvm::errs() << " " << I << " - " << OffsetVector[I] << '\n'; } +#endif } void FinalOverriders::AddOverriders(BaseSubobject Base, @@ -232,13 +228,14 @@ void FinalOverriders::AddOverriders(BaseSubobject Base, OverriderInfo& Overrider = OverridersMap[std::make_pair(Base, MD)]; assert(!Overrider.Method && "Overrider should not exist yet!"); + Overrider.Offset = Base.getBaseOffset(); Overrider.Method = MD; } } -static FinalOverriders::BaseOffset -ComputeBaseOffset(ASTContext &Context, const CXXRecordDecl *DerivedRD, - const CXXBasePath &Path) { +static BaseOffset ComputeBaseOffset(ASTContext &Context, + const CXXRecordDecl *DerivedRD, + const CXXBasePath &Path) { int64_t NonVirtualOffset = 0; unsigned NonVirtualStart = 0; @@ -264,37 +261,36 @@ ComputeBaseOffset(ASTContext &Context, const CXXRecordDecl *DerivedRD, // Check the base class offset. const ASTRecordLayout &Layout = Context.getASTRecordLayout(Element.Class); - + const RecordType *BaseType = Element.Base->getType()->getAs<RecordType>(); const CXXRecordDecl *Base = cast<CXXRecordDecl>(BaseType->getDecl()); - + NonVirtualOffset += Layout.getBaseClassOffset(Base); } // FIXME: This should probably use CharUnits or something. Maybe we should // even change the base offsets in ASTRecordLayout to be specified in // CharUnits. - return FinalOverriders::BaseOffset(DerivedRD, VirtualBase, - NonVirtualOffset / 8); + return BaseOffset(DerivedRD, VirtualBase, NonVirtualOffset / 8); } -static FinalOverriders::BaseOffset -ComputeBaseOffset(ASTContext &Context, const CXXRecordDecl *BaseRD, - const CXXRecordDecl *DerivedRD) { +static BaseOffset ComputeBaseOffset(ASTContext &Context, + const CXXRecordDecl *BaseRD, + const CXXRecordDecl *DerivedRD) { CXXBasePaths Paths(/*FindAmbiguities=*/false, /*RecordPaths=*/true, /*DetectVirtual=*/false); if (!const_cast<CXXRecordDecl *>(DerivedRD)-> isDerivedFrom(const_cast<CXXRecordDecl *>(BaseRD), Paths)) { assert(false && "Class must be derived from the passed in base class!"); - return FinalOverriders::BaseOffset(); + return BaseOffset(); } return ComputeBaseOffset(Context, DerivedRD, Paths.front()); } -static FinalOverriders::BaseOffset +static BaseOffset ComputeReturnAdjustmentBaseOffset(ASTContext &Context, const CXXMethodDecl *DerivedMD, const CXXMethodDecl *BaseMD) { @@ -313,7 +309,7 @@ ComputeReturnAdjustmentBaseOffset(ASTContext &Context, if (CanDerivedReturnType == CanBaseReturnType) { // No adjustment needed. - return FinalOverriders::BaseOffset(); + return BaseOffset(); } if (isa<ReferenceType>(CanDerivedReturnType)) { @@ -336,7 +332,7 @@ ComputeReturnAdjustmentBaseOffset(ASTContext &Context, if (CanDerivedReturnType.getUnqualifiedType() == CanBaseReturnType.getUnqualifiedType()) { // No adjustment needed. - return FinalOverriders::BaseOffset(); + return BaseOffset(); } const CXXRecordDecl *DerivedRD = @@ -348,35 +344,6 @@ ComputeReturnAdjustmentBaseOffset(ASTContext &Context, return ComputeBaseOffset(Context, BaseRD, DerivedRD); } -FinalOverriders::BaseOffset -FinalOverriders::ComputeThisAdjustmentBaseOffset(BaseSubobject Base, - BaseSubobject Derived) { - const CXXRecordDecl *BaseRD = Base.getBase(); - const CXXRecordDecl *DerivedRD = Derived.getBase(); - - CXXBasePaths Paths(/*FindAmbiguities=*/true, - /*RecordPaths=*/true, /*DetectVirtual=*/true); - - if (!const_cast<CXXRecordDecl *>(DerivedRD)-> - isDerivedFrom(const_cast<CXXRecordDecl *>(BaseRD), Paths)) { - assert(false && "Class must be derived from the passed in base class!"); - return FinalOverriders::BaseOffset(); - } - - assert(!Paths.getDetectedVirtual() && "FIXME: Handle virtual bases!"); - - BaseOffset Offset; - - // FIXME: This is not going to be enough with virtual bases. - // FIXME: We should not use / 8 here. - int64_t DerivedToBaseOffset = - (Base.getBaseOffset() - Derived.getBaseOffset()) / 8; - - Offset.NonVirtualOffset = -DerivedToBaseOffset; - - return Offset; -} - void FinalOverriders::PropagateOverrider(const CXXMethodDecl *OldMD, BaseSubobject NewBase, const CXXMethodDecl *NewMD, @@ -394,7 +361,7 @@ void FinalOverriders::PropagateOverrider(const CXXMethodDecl *OldMD, /// struct C : B1, B2 { virtual void f(); }; /// /// When overriding A::f with C::f we need to do so in both A subobjects. - const OffsetVectorTy &OffsetVector = Offsets[OverriddenRD]; + const OffsetSetVectorTy &OffsetVector = Offsets[OverriddenRD]; // Go through all the subobjects. for (unsigned I = 0, E = OffsetVector.size(); I != E; ++I) { @@ -419,20 +386,10 @@ void FinalOverriders::PropagateOverrider(const CXXMethodDecl *OldMD, // Store the return adjustment base offset. ReturnAdjustments[SubobjectAndMethod] = ReturnBaseOffset; } - - // Check if we need a 'this' adjustment base offset as well. - if (Offset != NewBase.getBaseOffset()) { - BaseOffset ThisBaseOffset = - ComputeThisAdjustmentBaseOffset(OverriddenSubobject, - NewBase); - assert(!ThisBaseOffset.isEmpty() && - "Should not get an empty 'this' adjustment!"); - - ThisAdjustments[SubobjectAndMethod] = ThisBaseOffset; - } } // Set the new overrider. + Overrider.Offset = NewBase.getBaseOffset(); Overrider.Method = NewMD; // And propagate it further. @@ -448,45 +405,17 @@ FinalOverriders::MergeSubobjectOffsets(const SubobjectOffsetsMapTy &NewOffsets, for (SubobjectOffsetsMapTy::const_iterator I = NewOffsets.begin(), E = NewOffsets.end(); I != E; ++I) { const CXXRecordDecl *NewRD = I->first; - const OffsetVectorTy& NewOffsetVector = I->second; - - OffsetVectorTy &OffsetVector = Offsets[NewRD]; - if (OffsetVector.empty()) { - // There were no previous offsets in this vector, just insert all entries - // from the new offset vector. - OffsetVector.append(NewOffsetVector.begin(), NewOffsetVector.end()); - continue; - } - - // We need to merge the new offsets vector into the old, but we don't want - // to have duplicate entries. Do this by inserting the old offsets in a set - // so they'll be unique. After this, we iterate over the new offset vector - // and only append elements that aren't in the set. + const OffsetSetVectorTy& NewOffsetVector = I->second; - // First, add the existing offsets to the set. - llvm::SmallSet<uint64_t, 4> OffsetSet; - for (unsigned I = 0, E = OffsetVector.size(); I != E; ++I) { - bool Inserted = OffsetSet.insert(OffsetVector[I]); - if (!Inserted) - assert(false && "Set of offsets should be unique!"); - } + OffsetSetVectorTy &OffsetVector = Offsets[NewRD]; - // Next, only add the new offsets if they are not already in the set. - for (unsigned I = 0, E = NewOffsetVector.size(); I != E; ++I) { - uint64_t Offset = NewOffsetVector[I]; - - if (OffsetSet.count(Offset)) { - // Ignore the offset. - continue; - } - - // Otherwise, add it to the offsets vector. - OffsetVector.push_back(Offset); - } + // Merge the new offsets set vector into the old. + OffsetVector.insert(NewOffsetVector.begin(), NewOffsetVector.end()); } } void FinalOverriders::ComputeFinalOverriders(BaseSubobject Base, + bool BaseSubobjectIsVisitedVBase, SubobjectOffsetsMapTy &Offsets) { const CXXRecordDecl *RD = Base.getBase(); const ASTRecordLayout &Layout = Context.getASTRecordLayout(RD); @@ -502,25 +431,51 @@ void FinalOverriders::ComputeFinalOverriders(BaseSubobject Base, if (!BaseDecl->isPolymorphic()) continue; + bool IsVisitedVirtualBase = BaseSubobjectIsVisitedVBase; uint64_t BaseOffset; if (I->isVirtual()) { + if (!VisitedVirtualBases.insert(BaseDecl)) + IsVisitedVirtualBase = true; BaseOffset = MostDerivedClassLayout.getVBaseClassOffset(BaseDecl); } else { BaseOffset = Layout.getBaseClassOffset(BaseDecl) + Base.getBaseOffset(); } // Compute the final overriders for this base. - ComputeFinalOverriders(BaseSubobject(BaseDecl, BaseOffset), NewOffsets); + // We always want to compute the final overriders, even if the base is a + // visited virtual base. Consider: + // + // struct A { + // virtual void f(); + // virtual void g(); + // }; + // + // struct B : virtual A { + // void f(); + // }; + // + // struct C : virtual A { + // void g (); + // }; + // + // struct D : B, C { }; + // + // Here, we still want to compute the overriders for A as a base of C, + // because otherwise we'll miss that C::g overrides A::f. + ComputeFinalOverriders(BaseSubobject(BaseDecl, BaseOffset), + IsVisitedVirtualBase, NewOffsets); } /// Now add the overriders for this particular subobject. - AddOverriders(Base, NewOffsets); + /// (We don't want to do this more than once for a virtual base). + if (!BaseSubobjectIsVisitedVBase) + AddOverriders(Base, NewOffsets); // And merge the newly discovered subobject offsets. MergeSubobjectOffsets(NewOffsets, Offsets); /// Finally, add the offset for our own subobject. - Offsets[RD].push_back(Base.getBaseOffset()); + Offsets[RD].insert(Base.getBaseOffset()); } void FinalOverriders::dump(llvm::raw_ostream &Out, BaseSubobject Base) { @@ -565,9 +520,10 @@ void FinalOverriders::dump(llvm::raw_ostream &Out, BaseSubobject Base) { OverriderInfo Overrider = getOverrider(Base, MD); - Out << " " << MD->getQualifiedNameAsString() << " - "; + Out << " " << MD->getQualifiedNameAsString() << " - ("; Out << Overrider.Method->getQualifiedNameAsString(); - + Out << ", " << Overrider.Offset << ')'; + AdjustmentOffsetsMapTy::const_iterator AI = ReturnAdjustments.find(std::make_pair(Base, MD)); if (AI != ReturnAdjustments.end()) { @@ -580,17 +536,6 @@ void FinalOverriders::dump(llvm::raw_ostream &Out, BaseSubobject Base) { Out << Offset.NonVirtualOffset << " nv]"; } - AI = ThisAdjustments.find(std::make_pair(Base, MD)); - if (AI != ThisAdjustments.end()) { - const BaseOffset &Offset = AI->second; - - Out << " [this-adj: "; - if (Offset.VirtualBase) - Out << Offset.VirtualBase->getQualifiedNameAsString() << " vbase, "; - - Out << Offset.NonVirtualOffset << " nv]"; - } - Out << "\n"; } } @@ -609,9 +554,18 @@ public: CK_CompleteDtorPointer, /// CK_DeletingDtorPointer - A pointer to the deleting destructor. - CK_DeletingDtorPointer + CK_DeletingDtorPointer, + + /// CK_UnusedFunctionPointer - In some cases, a vtable function pointer + /// will end up never being called. Such vtable function pointers are + /// represented as a CK_UnusedFunctionPointer. + CK_UnusedFunctionPointer }; + static VtableComponent MakeVCallOffset(int64_t Offset) { + return VtableComponent(CK_VCallOffset, Offset); + } + static VtableComponent MakeVBaseOffset(int64_t Offset) { return VtableComponent(CK_VBaseOffset, Offset); } @@ -642,11 +596,24 @@ public: reinterpret_cast<uintptr_t>(DD)); } + static VtableComponent MakeUnusedFunction(const CXXMethodDecl *MD) { + assert(!isa<CXXDestructorDecl>(MD) && + "Don't use MakeUnusedFunction with destructors!"); + return VtableComponent(CK_UnusedFunctionPointer, + reinterpret_cast<uintptr_t>(MD)); + } + /// getKind - Get the kind of this vtable component. Kind getKind() const { return (Kind)(Value & 0x7); } + int64_t getVCallOffset() const { + assert(getKind() == CK_VCallOffset && "Invalid component kind!"); + + return getOffset(); + } + int64_t getVBaseOffset() const { assert(getKind() == CK_VBaseOffset && "Invalid component kind!"); @@ -678,6 +645,12 @@ public: return reinterpret_cast<CXXDestructorDecl *>(getPointer()); } + const CXXMethodDecl *getUnusedFunctionDecl() const { + assert(getKind() == CK_UnusedFunctionPointer); + + return reinterpret_cast<CXXMethodDecl *>(getPointer()); + } + private: VtableComponent(Kind ComponentKind, int64_t Offset) { assert((ComponentKind == CK_VCallOffset || @@ -692,7 +665,8 @@ private: assert((ComponentKind == CK_RTTI || ComponentKind == CK_FunctionPointer || ComponentKind == CK_CompleteDtorPointer || - ComponentKind == CK_DeletingDtorPointer) && + ComponentKind == CK_DeletingDtorPointer || + ComponentKind == CK_UnusedFunctionPointer) && "Invalid component kind!"); assert((Ptr & 7) == 0 && "Pointer not sufficiently aligned!"); @@ -711,7 +685,8 @@ private: assert((getKind() == CK_RTTI || getKind() == CK_FunctionPointer || getKind() == CK_CompleteDtorPointer || - getKind() == CK_DeletingDtorPointer) && + getKind() == CK_DeletingDtorPointer || + getKind() == CK_UnusedFunctionPointer) && "Invalid component kind!"); return static_cast<uintptr_t>(Value & ~7ULL); @@ -725,12 +700,334 @@ private: int64_t Value; }; +/// VCallOffsetMap - Keeps track of vcall offsets when building a vtable. +struct VCallOffsetMap { + + typedef std::pair<const CXXMethodDecl *, int64_t> MethodAndOffsetPairTy; + + /// Offsets - Keeps track of methods and their offsets. + // FIXME: This should be a real map and not a vector. + llvm::SmallVector<MethodAndOffsetPairTy, 16> Offsets; + + /// MethodsCanShareVCallOffset - Returns whether two virtual member functions + /// can share the same vcall offset. + static bool MethodsCanShareVCallOffset(const CXXMethodDecl *LHS, + const CXXMethodDecl *RHS); + +public: + /// AddVCallOffset - Adds a vcall offset to the map. Returns true if the + /// add was successful, or false if there was already a member function with + /// the same signature in the map. + bool AddVCallOffset(const CXXMethodDecl *MD, int64_t OffsetOffset); + + /// getVCallOffsetOffset - Returns the vcall offset offset (relative to the + /// vtable address point) for the given virtual member function. + int64_t getVCallOffsetOffset(const CXXMethodDecl *MD); + + // empty - Return whether the offset map is empty or not. + bool empty() const { return Offsets.empty(); } +}; + +static bool HasSameVirtualSignature(const CXXMethodDecl *LHS, + const CXXMethodDecl *RHS) { + ASTContext &C = LHS->getASTContext(); // TODO: thread this down + CanQual<FunctionProtoType> + LT = C.getCanonicalType(LHS->getType()).getAs<FunctionProtoType>(), + RT = C.getCanonicalType(RHS->getType()).getAs<FunctionProtoType>(); + + // Fast-path matches in the canonical types. + if (LT == RT) return true; + + // Force the signatures to match. We can't rely on the overrides + // list here because there isn't necessarily an inheritance + // relationship between the two methods. + if (LT.getQualifiers() != RT.getQualifiers() || + LT->getNumArgs() != RT->getNumArgs()) + return false; + for (unsigned I = 0, E = LT->getNumArgs(); I != E; ++I) + if (LT->getArgType(I) != RT->getArgType(I)) + return false; + return true; +} + +bool VCallOffsetMap::MethodsCanShareVCallOffset(const CXXMethodDecl *LHS, + const CXXMethodDecl *RHS) { + assert(LHS->isVirtual() && "LHS must be virtual!"); + assert(RHS->isVirtual() && "LHS must be virtual!"); + + // A destructor can share a vcall offset with another destructor. + if (isa<CXXDestructorDecl>(LHS)) + return isa<CXXDestructorDecl>(RHS); + + // FIXME: We need to check more things here. + + // The methods must have the same name. + DeclarationName LHSName = LHS->getDeclName(); + DeclarationName RHSName = RHS->getDeclName(); + if (LHSName != RHSName) + return false; + + // And the same signatures. + return HasSameVirtualSignature(LHS, RHS); +} + +bool VCallOffsetMap::AddVCallOffset(const CXXMethodDecl *MD, + int64_t OffsetOffset) { + // Check if we can reuse an offset. + for (unsigned I = 0, E = Offsets.size(); I != E; ++I) { + if (MethodsCanShareVCallOffset(Offsets[I].first, MD)) + return false; + } + + // Add the offset. + Offsets.push_back(MethodAndOffsetPairTy(MD, OffsetOffset)); + return true; +} + +int64_t VCallOffsetMap::getVCallOffsetOffset(const CXXMethodDecl *MD) { + // Look for an offset. + for (unsigned I = 0, E = Offsets.size(); I != E; ++I) { + if (MethodsCanShareVCallOffset(Offsets[I].first, MD)) + return Offsets[I].second; + } + + assert(false && "Should always find a vcall offset offset!"); + return 0; +} + +/// VCallAndVBaseOffsetBuilder - Class for building vcall and vbase offsets. +class VCallAndVBaseOffsetBuilder { + /// MostDerivedClass - The most derived class for which we're building vcall + /// and vbase offsets. + const CXXRecordDecl *MostDerivedClass; + + /// LayoutClass - The class we're using for layout information. Will be + /// different than the most derived class if we're building a construction + /// vtable. + const CXXRecordDecl *LayoutClass; + + /// Context - The ASTContext which we will use for layout information. + ASTContext &Context; + + /// Components - vcall and vbase offset components + typedef llvm::SmallVector<VtableComponent, 64> VtableComponentVectorTy; + VtableComponentVectorTy Components; + + /// VisitedVirtualBases - Visited virtual bases. + llvm::SmallPtrSet<const CXXRecordDecl *, 4> VisitedVirtualBases; + + /// VCallOffsets - Keeps track of vcall offsets. + VCallOffsetMap VCallOffsets; + + /// FinalOverriders - The final overriders of the most derived class. + /// (Can be null when we're not building a vtable of the most derived class). + const FinalOverriders *Overriders; + + /// AddVCallAndVBaseOffsets - Add vcall offsets and vbase offsets for the + /// given base subobject. + void AddVCallAndVBaseOffsets(BaseSubobject Base, bool BaseIsVirtual, + uint64_t RealBaseOffset); + + /// AddVCallOffsets - Add vcall offsets for the given base subobject. + void AddVCallOffsets(BaseSubobject Base, uint64_t VBaseOffset); + + /// AddVBaseOffsets - Add vbase offsets for the given class. + void AddVBaseOffsets(const CXXRecordDecl *Base, uint64_t OffsetInLayoutClass); + +public: + VCallAndVBaseOffsetBuilder(const CXXRecordDecl *MostDerivedClass, + const CXXRecordDecl *LayoutClass, + const FinalOverriders *Overriders, + BaseSubobject Base, bool BaseIsVirtual, + uint64_t OffsetInLayoutClass) + : MostDerivedClass(MostDerivedClass), LayoutClass(LayoutClass), + Context(MostDerivedClass->getASTContext()), Overriders(Overriders) { + + // Add vcall and vbase offsets. + AddVCallAndVBaseOffsets(Base, BaseIsVirtual, OffsetInLayoutClass); + } + + /// Methods for iterating over the components. + typedef VtableComponentVectorTy::const_reverse_iterator const_iterator; + const_iterator components_begin() const { return Components.rbegin(); } + const_iterator components_end() const { return Components.rend(); } + + const VCallOffsetMap& getVCallOffsets() const { return VCallOffsets; } +}; + +void +VCallAndVBaseOffsetBuilder::AddVCallAndVBaseOffsets(BaseSubobject Base, + bool BaseIsVirtual, + uint64_t RealBaseOffset) { + const ASTRecordLayout &Layout = Context.getASTRecordLayout(Base.getBase()); + + // Itanium C++ ABI 2.5.2: + // ..in classes sharing a virtual table with a primary base class, the vcall + // and vbase offsets added by the derived class all come before the vcall + // and vbase offsets required by the base class, so that the latter may be + // laid out as required by the base class without regard to additions from + // the derived class(es). + + // (Since we're emitting the vcall and vbase offsets in reverse order, we'll + // emit them for the primary base first). + if (const CXXRecordDecl *PrimaryBase = Layout.getPrimaryBase()) { + bool PrimaryBaseIsVirtual = Layout.getPrimaryBaseWasVirtual(); + + uint64_t PrimaryBaseOffset; + + // Get the base offset of the primary base. + if (PrimaryBaseIsVirtual) { + assert(Layout.getVBaseClassOffset(PrimaryBase) == 0 && + "Primary vbase should have a zero offset!"); + + const ASTRecordLayout &MostDerivedClassLayout = + Context.getASTRecordLayout(MostDerivedClass); + + PrimaryBaseOffset = + MostDerivedClassLayout.getVBaseClassOffset(PrimaryBase); + } else { + assert(Layout.getBaseClassOffset(PrimaryBase) == 0 && + "Primary base should have a zero offset!"); + + PrimaryBaseOffset = Base.getBaseOffset(); + } + + AddVCallAndVBaseOffsets(BaseSubobject(PrimaryBase, PrimaryBaseOffset), + PrimaryBaseIsVirtual, RealBaseOffset); + } + + AddVBaseOffsets(Base.getBase(), RealBaseOffset); + + // We only want to add vcall offsets for virtual bases. + if (BaseIsVirtual) + AddVCallOffsets(Base, RealBaseOffset); +} + +void VCallAndVBaseOffsetBuilder::AddVCallOffsets(BaseSubobject Base, + uint64_t VBaseOffset) { + const CXXRecordDecl *RD = Base.getBase(); + const ASTRecordLayout &Layout = Context.getASTRecordLayout(RD); + + const CXXRecordDecl *PrimaryBase = Layout.getPrimaryBase(); + + // Handle the primary base first. + if (PrimaryBase) { + uint64_t PrimaryBaseOffset; + + // Get the base offset of the primary base. + if (Layout.getPrimaryBaseWasVirtual()) { + assert(Layout.getVBaseClassOffset(PrimaryBase) == 0 && + "Primary vbase should have a zero offset!"); + + const ASTRecordLayout &MostDerivedClassLayout = + Context.getASTRecordLayout(MostDerivedClass); + + PrimaryBaseOffset = + MostDerivedClassLayout.getVBaseClassOffset(PrimaryBase); + } else { + assert(Layout.getBaseClassOffset(PrimaryBase) == 0 && + "Primary base should have a zero offset!"); + + PrimaryBaseOffset = Base.getBaseOffset(); + } + + AddVCallOffsets(BaseSubobject(PrimaryBase, PrimaryBaseOffset), + VBaseOffset); + } + + // Add the vcall offsets. + for (CXXRecordDecl::method_iterator I = RD->method_begin(), + E = RD->method_end(); I != E; ++I) { + const CXXMethodDecl *MD = *I; + + if (!MD->isVirtual()) + continue; + + // OffsetIndex is the index of this vcall offset, relative to the vtable + // address point. (We subtract 3 to account for the information just + // above the address point, the RTTI info, the offset to top, and the + // vcall offset itself). + int64_t OffsetIndex = -(int64_t)(3 + Components.size()); + + // FIXME: We shouldn't use / 8 here. + int64_t OffsetOffset = OffsetIndex * + (int64_t)Context.Target.getPointerWidth(0) / 8; + + // Don't add a vcall offset if we already have one for this member function + // signature. + if (!VCallOffsets.AddVCallOffset(MD, OffsetOffset)) + continue; + + int64_t Offset = 0; + + if (Overriders) { + // Get the final overrider. + FinalOverriders::OverriderInfo Overrider = + Overriders->getOverrider(Base, MD); + + /// The vcall offset is the offset from the virtual base to the object + /// where the function was overridden. + // FIXME: We should not use / 8 here. + Offset = (int64_t)(Overrider.Offset - VBaseOffset) / 8; + } + + Components.push_back(VtableComponent::MakeVCallOffset(Offset)); + } + + // And iterate over all non-virtual bases (ignoring the primary base). + for (CXXRecordDecl::base_class_const_iterator I = RD->bases_begin(), + E = RD->bases_end(); I != E; ++I) { + + if (I->isVirtual()) + continue; + + const CXXRecordDecl *BaseDecl = + cast<CXXRecordDecl>(I->getType()->getAs<RecordType>()->getDecl()); + if (BaseDecl == PrimaryBase) + continue; + + // Get the base offset of this base. + uint64_t BaseOffset = Base.getBaseOffset() + + Layout.getBaseClassOffset(BaseDecl); + + AddVCallOffsets(BaseSubobject(BaseDecl, BaseOffset), VBaseOffset); + } +} + +void VCallAndVBaseOffsetBuilder::AddVBaseOffsets(const CXXRecordDecl *RD, + uint64_t OffsetInLayoutClass) { + const ASTRecordLayout &LayoutClassLayout = + Context.getASTRecordLayout(LayoutClass); + + // Add vbase offsets. + for (CXXRecordDecl::base_class_const_iterator I = RD->bases_begin(), + E = RD->bases_end(); I != E; ++I) { + const CXXRecordDecl *BaseDecl = + cast<CXXRecordDecl>(I->getType()->getAs<RecordType>()->getDecl()); + + // Check if this is a virtual base that we haven't visited before. + if (I->isVirtual() && VisitedVirtualBases.insert(BaseDecl)) { + // FIXME: We shouldn't use / 8 here. + int64_t Offset = + (int64_t)(LayoutClassLayout.getVBaseClassOffset(BaseDecl) - + OffsetInLayoutClass) / 8; + + Components.push_back(VtableComponent::MakeVBaseOffset(Offset)); + } + + // Check the base class looking for more vbase offsets. + AddVBaseOffsets(BaseDecl, OffsetInLayoutClass); + } +} + /// VtableBuilder - Class for building vtable layout information. class VtableBuilder { public: - /// PrimaryBasesSetTy - A set of direct and indirect primary bases. - typedef llvm::SmallPtrSet<const CXXRecordDecl *, 8> PrimaryBasesSetTy; - + /// PrimaryBasesSetVectorTy - A set vector of direct and indirect + /// primary bases. + typedef llvm::SmallSetVector<const CXXRecordDecl *, 8> + PrimaryBasesSetVectorTy; + private: /// VtableInfo - Global vtable information. CGVtableInfo &VtableInfo; @@ -739,15 +1036,28 @@ private: /// vtable. const CXXRecordDecl *MostDerivedClass; + /// MostDerivedClassOffset - If we're building a construction vtable, this + /// holds the offset from the layout class to the most derived class. + const uint64_t MostDerivedClassOffset; + + /// MostDerivedClassIsVirtual - Whether the most derived class is a virtual + /// base. (This only makes sense when building a construction vtable). + bool MostDerivedClassIsVirtual; + + /// LayoutClass - The class we're using for layout information. Will be + /// different than the most derived class if we're building a construction + /// vtable. + const CXXRecordDecl *LayoutClass; + /// Context - The ASTContext which we will use for layout information. ASTContext &Context; /// FinalOverriders - The final overriders of the most derived class. - FinalOverriders Overriders; + const FinalOverriders Overriders; - /// VCallAndVBaseOffsets - The vcall and vbase offset, of the vtable we're - // building (in reverse order). - llvm::SmallVector<VtableComponent, 64> VCallAndVBaseOffsets; + /// VCallOffsetsForVBases - Keeps track of vcall offsets for the virtual + /// bases in this vtable. + llvm::DenseMap<const CXXRecordDecl *, VCallOffsetMap> VCallOffsetsForVBases; /// Components - The components of the vtable being built. llvm::SmallVector<VtableComponent, 64> Components; @@ -761,7 +1071,7 @@ private: /// nearest virtual base. int64_t NonVirtual; - /// VBaseOffsetOffset - The offset, in bytes, relative to the address point + /// VBaseOffsetOffset - The offset (in bytes), relative to the address point /// of the virtual base class offset. int64_t VBaseOffsetOffset; @@ -774,72 +1084,159 @@ private: llvm::SmallVector<std::pair<uint64_t, ReturnAdjustment>, 16> ReturnAdjustments; + /// MethodInfo - Contains information about a method in a vtable. + /// (Used for computing 'this' pointer adjustment thunks. + struct MethodInfo { + /// BaseOffset - The base offset of this method. + const uint64_t BaseOffset; + + /// VtableIndex - The index in the vtable that this method has. + /// (For destructors, this is the index of the complete destructor). + const uint64_t VtableIndex; + + MethodInfo(uint64_t BaseOffset, uint64_t VtableIndex) + : BaseOffset(BaseOffset), VtableIndex(VtableIndex) { } + + MethodInfo() : BaseOffset(0), VtableIndex(0) { } + }; + + typedef llvm::DenseMap<const CXXMethodDecl *, MethodInfo> MethodInfoMapTy; + + /// MethodInfoMap - The information for all methods in the vtable we're + /// currently building. + MethodInfoMapTy MethodInfoMap; + /// ThisAdjustment - A 'this' pointer adjustment thunk. struct ThisAdjustment { /// NonVirtual - The non-virtual adjustment from the derived object to its /// nearest virtual base. int64_t NonVirtual; - /// FIXME: Add VCallOffsetOffset here. + /// VCallOffsetOffset - The offset (in bytes), relative to the address point, + /// of the virtual call offset. + int64_t VCallOffsetOffset; - ThisAdjustment() : NonVirtual(0) { } + ThisAdjustment() : NonVirtual(0), VCallOffsetOffset(0) { } - bool isEmpty() const { return !NonVirtual; } + bool isEmpty() const { return !NonVirtual && !VCallOffsetOffset; } }; /// ThisAdjustments - The 'this' pointer adjustments needed in this vtable. llvm::SmallVector<std::pair<uint64_t, ThisAdjustment>, 16> ThisAdjustments; + + /// ComputeThisAdjustments - Compute the 'this' pointer adjustments for the + /// part of the vtable we're currently building. + void ComputeThisAdjustments(); typedef llvm::SmallPtrSet<const CXXRecordDecl *, 4> VisitedVirtualBasesSetTy; - /// AddVCallAndVBaseOffsets - Add vcall offsets and vbase offsets for the - /// given class. - void AddVCallAndVBaseOffsets(const CXXRecordDecl *RD, int64_t OffsetToTop, - VisitedVirtualBasesSetTy &VBases); - - /// AddVBaseOffsets - Add vbase offsets for the given class. - void AddVBaseOffsets(const CXXRecordDecl *RD, int64_t OffsetToTop, - VisitedVirtualBasesSetTy &VBases); + /// PrimaryVirtualBases - All known virtual bases who are a primary base of + /// some other base. + VisitedVirtualBasesSetTy PrimaryVirtualBases; /// ComputeReturnAdjustment - Compute the return adjustment given a return /// adjustment base offset. - ReturnAdjustment ComputeReturnAdjustment(FinalOverriders::BaseOffset Offset); + ReturnAdjustment ComputeReturnAdjustment(BaseOffset Offset); - /// ComputeThisAdjustment - Compute the 'this' pointer adjustment given a - /// 'this' pointer adjustment base offset. - ThisAdjustment ComputeThisAdjustment(FinalOverriders::BaseOffset Offset); + /// ComputeThisAdjustmentBaseOffset - Compute the base offset for adjusting + /// the 'this' pointer from the base subobject to the derived subobject. + BaseOffset ComputeThisAdjustmentBaseOffset(BaseSubobject Base, + BaseSubobject Derived) const; + + /// ComputeThisAdjustment - Compute the 'this' pointer adjustment for the + /// given virtual member function and the 'this' pointer adjustment base + /// offset. + ThisAdjustment ComputeThisAdjustment(const CXXMethodDecl *MD, + BaseOffset Offset); /// AddMethod - Add a single virtual member function to the vtable /// components vector. - void AddMethod(const CXXMethodDecl *MD, ReturnAdjustment ReturnAdjustment, - ThisAdjustment ThisAdjustment); + void AddMethod(const CXXMethodDecl *MD, ReturnAdjustment ReturnAdjustment); + /// IsOverriderUsed - Returns whether the overrider will ever be used in this + /// part of the vtable. + /// + /// Itanium C++ ABI 2.5.2: + /// + /// struct A { virtual void f(); }; + /// struct B : virtual public A { int i; }; + /// struct C : virtual public A { int j; }; + /// struct D : public B, public C {}; + /// + /// When B and C are declared, A is a primary base in each case, so although + /// vcall offsets are allocated in the A-in-B and A-in-C vtables, no this + /// adjustment is required and no thunk is generated. However, inside D + /// objects, A is no longer a primary base of C, so if we allowed calls to + /// C::f() to use the copy of A's vtable in the C subobject, we would need + /// to adjust this from C* to B::A*, which would require a third-party + /// thunk. Since we require that a call to C::f() first convert to A*, + /// C-in-D's copy of A's vtable is never referenced, so this is not + /// necessary. + bool IsOverriderUsed(BaseSubobject Base, + BaseSubobject FirstBaseInPrimaryBaseChain, + uint64_t OffsetInLayoutClass, + FinalOverriders::OverriderInfo Overrider) const; + /// AddMethods - Add the methods of this base subobject and all its /// primary bases to the vtable components vector. - void AddMethods(BaseSubobject Base, PrimaryBasesSetTy &PrimaryBases); - - /// LayoutVtable - Layout a vtable and all its secondary vtables. - void LayoutVtable(BaseSubobject Base); + void AddMethods(BaseSubobject Base, BaseSubobject FirstBaseInPrimaryBaseChain, + uint64_t OffsetInLayoutClass, + PrimaryBasesSetVectorTy &PrimaryBases); + + // LayoutVtable - Layout the vtable for the given base class, including its + // secondary vtables and any vtables for virtual bases. + void LayoutVtable(); + + /// LayoutPrimaryAndSecondaryVtables - Layout the primary vtable for the + /// given base subobject, as well as all its secondary vtables. + void LayoutPrimaryAndSecondaryVtables(BaseSubobject Base, + bool BaseIsVirtual, + uint64_t OffsetInLayoutClass); + /// LayoutSecondaryVtables - Layout the secondary vtables for the given base + /// subobject. + void LayoutSecondaryVtables(BaseSubobject Base, uint64_t OffsetInLayoutClass); + + /// DeterminePrimaryVirtualBases - Determine the primary virtual bases in this + /// class hierarchy. + void DeterminePrimaryVirtualBases(const CXXRecordDecl *RD, + VisitedVirtualBasesSetTy &VBases); + + /// LayoutVtablesForVirtualBases - Layout vtables for all virtual bases of the + /// given base (excluding any primary bases). + void LayoutVtablesForVirtualBases(const CXXRecordDecl *RD, + VisitedVirtualBasesSetTy &VBases); + + /// isBuildingConstructionVtable - Return whether this vtable builder is + /// building a construction vtable. + bool isBuildingConstructorVtable() const { + return MostDerivedClass != LayoutClass; + } + public: - VtableBuilder(CGVtableInfo &VtableInfo, const CXXRecordDecl *MostDerivedClass) - : VtableInfo(VtableInfo), MostDerivedClass(MostDerivedClass), - Context(MostDerivedClass->getASTContext()), Overriders(MostDerivedClass) { + VtableBuilder(CGVtableInfo &VtableInfo, const CXXRecordDecl *MostDerivedClass, + uint64_t MostDerivedClassOffset, bool MostDerivedClassIsVirtual, + const CXXRecordDecl *LayoutClass) + : VtableInfo(VtableInfo), MostDerivedClass(MostDerivedClass), + MostDerivedClassOffset(MostDerivedClassOffset), + MostDerivedClassIsVirtual(MostDerivedClassIsVirtual), + LayoutClass(LayoutClass), Context(MostDerivedClass->getASTContext()), + Overriders(MostDerivedClass) { - LayoutVtable(BaseSubobject(MostDerivedClass, 0)); + LayoutVtable(); } /// dumpLayout - Dump the vtable layout. void dumpLayout(llvm::raw_ostream&); }; -/// OverridesMethodInPrimaryBase - Checks whether whether this virtual member -/// function overrides a member function in a direct or indirect primary base. +/// OverridesMethodInBases - Checks whether whether this virtual member +/// function overrides a member function in any of the given bases. /// Returns the overridden member function, or null if none was found. static const CXXMethodDecl * -OverridesMethodInPrimaryBase(const CXXMethodDecl *MD, - VtableBuilder::PrimaryBasesSetTy &PrimaryBases) { +OverridesMethodInBases(const CXXMethodDecl *MD, + VtableBuilder::PrimaryBasesSetVectorTy &Bases) { for (CXXMethodDecl::method_iterator I = MD->begin_overridden_methods(), E = MD->end_overridden_methods(); I != E; ++I) { const CXXMethodDecl *OverriddenMD = *I; @@ -847,15 +1244,77 @@ OverridesMethodInPrimaryBase(const CXXMethodDecl *MD, assert(OverriddenMD->isCanonicalDecl() && "Should have the canonical decl of the overridden RD!"); - if (PrimaryBases.count(OverriddenRD)) + if (Bases.count(OverriddenRD)) return OverriddenMD; } return 0; } +void VtableBuilder::ComputeThisAdjustments() { + std::map<uint64_t, ThisAdjustment> SortedThisAdjustments; + + // Now go through the method info map and see if any of the methods need + // 'this' pointer adjustments. + for (MethodInfoMapTy::const_iterator I = MethodInfoMap.begin(), + E = MethodInfoMap.end(); I != E; ++I) { + const CXXMethodDecl *MD = I->first; + const MethodInfo &MethodInfo = I->second; + + BaseSubobject OverriddenBaseSubobject(MD->getParent(), + MethodInfo.BaseOffset); + + // Get the final overrider for this method. + FinalOverriders::OverriderInfo Overrider = + Overriders.getOverrider(OverriddenBaseSubobject, MD); + + // Check if we need an adjustment. + if (Overrider.Offset == (int64_t)MethodInfo.BaseOffset) + continue; + + uint64_t VtableIndex = MethodInfo.VtableIndex; + + // Ignore adjustments for pure virtual member functions. + if (Overrider.Method->isPure()) + continue; + + // Ignore adjustments for unused function pointers. + if (Components[VtableIndex].getKind() == + VtableComponent::CK_UnusedFunctionPointer) + continue; + + BaseSubobject OverriderBaseSubobject(Overrider.Method->getParent(), + Overrider.Offset); + + // Compute the adjustment offset. + BaseOffset ThisAdjustmentOffset = + ComputeThisAdjustmentBaseOffset(OverriddenBaseSubobject, + OverriderBaseSubobject); + + // Then compute the adjustment itself. + ThisAdjustment ThisAdjustment = ComputeThisAdjustment(Overrider.Method, + ThisAdjustmentOffset); + + // Add it. + SortedThisAdjustments.insert(std::make_pair(VtableIndex, ThisAdjustment)); + + if (isa<CXXDestructorDecl>(MD)) { + // Add an adjustment for the deleting destructor as well. + SortedThisAdjustments.insert(std::make_pair(VtableIndex + 1, + ThisAdjustment)); + } + } + + /// Clear the method info map. + MethodInfoMap.clear(); + + // Add the sorted elements. + ThisAdjustments.append(SortedThisAdjustments.begin(), + SortedThisAdjustments.end()); +} + VtableBuilder::ReturnAdjustment -VtableBuilder::ComputeReturnAdjustment(FinalOverriders::BaseOffset Offset) { +VtableBuilder::ComputeReturnAdjustment(BaseOffset Offset) { ReturnAdjustment Adjustment; if (!Offset.isEmpty()) { @@ -876,79 +1335,96 @@ VtableBuilder::ComputeReturnAdjustment(FinalOverriders::BaseOffset Offset) { return Adjustment; } -VtableBuilder::ThisAdjustment -VtableBuilder::ComputeThisAdjustment(FinalOverriders::BaseOffset Offset) { - ThisAdjustment Adjustment; +BaseOffset +VtableBuilder::ComputeThisAdjustmentBaseOffset(BaseSubobject Base, + BaseSubobject Derived) const { + const CXXRecordDecl *BaseRD = Base.getBase(); + const CXXRecordDecl *DerivedRD = Derived.getBase(); - if (!Offset.isEmpty()) { - assert(!Offset.VirtualBase && "FIXME: Handle virtual bases!"); - Adjustment.NonVirtual = Offset.NonVirtualOffset; + CXXBasePaths Paths(/*FindAmbiguities=*/true, + /*RecordPaths=*/true, /*DetectVirtual=*/true); + + if (!const_cast<CXXRecordDecl *>(DerivedRD)-> + isDerivedFrom(const_cast<CXXRecordDecl *>(BaseRD), Paths)) { + assert(false && "Class must be derived from the passed in base class!"); + return BaseOffset(); } - - return Adjustment; -} -void -VtableBuilder::AddVCallAndVBaseOffsets(const CXXRecordDecl *RD, - int64_t OffsetToTop, - VisitedVirtualBasesSetTy &VBases) { - const ASTRecordLayout &Layout = Context.getASTRecordLayout(RD); + // We have to go through all the paths, and see which one leads us to the + // right base subobject. + for (CXXBasePaths::const_paths_iterator I = Paths.begin(), E = Paths.end(); + I != E; ++I) { + BaseOffset Offset = ComputeBaseOffset(Context, DerivedRD, *I); + + // FIXME: Should not use * 8 here. + uint64_t OffsetToBaseSubobject = Offset.NonVirtualOffset * 8; + + if (Offset.VirtualBase) { + // If we have a virtual base class, the non-virtual offset is relative + // to the virtual base class offset. + const ASTRecordLayout &MostDerivedClassLayout = + Context.getASTRecordLayout(MostDerivedClass); + + /// Get the virtual base offset, relative to the most derived class + /// layout. + OffsetToBaseSubobject += + MostDerivedClassLayout.getVBaseClassOffset(Offset.VirtualBase); + } else { + // Otherwise, the non-virtual offset is relative to the derived class + // offset. + OffsetToBaseSubobject += Derived.getBaseOffset(); + } + + // Check if this path gives us the right base subobject. + if (OffsetToBaseSubobject == Base.getBaseOffset()) { + // Since we're going from the base class _to_ the derived class, we'll + // invert the non-virtual offset here. + Offset.NonVirtualOffset = -Offset.NonVirtualOffset; + return Offset; + } + } - // Itanium C++ ABI 2.5.2: - // ..in classes sharing a virtual table with a primary base class, the vcall - // and vbase offsets added by the derived class all come before the vcall - // and vbase offsets required by the base class, so that the latter may be - // laid out as required by the base class without regard to additions from - // the derived class(es). - - // (Since we're emitting the vcall and vbase offsets in reverse order, we'll - // emit them for the primary base first). - if (const CXXRecordDecl *PrimaryBase = Layout.getPrimaryBase()) - AddVCallAndVBaseOffsets(PrimaryBase, OffsetToTop, VBases); - - AddVBaseOffsets(RD, OffsetToTop, VBases); + return BaseOffset(); } + -void VtableBuilder::AddVBaseOffsets(const CXXRecordDecl *RD, - int64_t OffsetToTop, - VisitedVirtualBasesSetTy &VBases) { - const ASTRecordLayout &MostDerivedClassLayout = - Context.getASTRecordLayout(MostDerivedClass); - - // Add vbase offsets. - for (CXXRecordDecl::base_class_const_iterator I = RD->bases_begin(), - E = RD->bases_end(); I != E; ++I) { - const CXXRecordDecl *BaseDecl = - cast<CXXRecordDecl>(I->getType()->getAs<RecordType>()->getDecl()); - - // Check if this is a virtual base that we haven't visited before. - if (I->isVirtual() && VBases.insert(BaseDecl)) { - // FIXME: We shouldn't use / 8 here. - uint64_t Offset = - OffsetToTop + MostDerivedClassLayout.getVBaseClassOffset(BaseDecl) / 8; - - VCallAndVBaseOffsets.push_back(VtableComponent::MakeVBaseOffset(Offset)); +VtableBuilder::ThisAdjustment +VtableBuilder::ComputeThisAdjustment(const CXXMethodDecl *MD, + BaseOffset Offset) { + ThisAdjustment Adjustment; + + if (!Offset.isEmpty()) { + if (Offset.VirtualBase) { + // Get the vcall offset map for this virtual base. + VCallOffsetMap &VCallOffsets = VCallOffsetsForVBases[Offset.VirtualBase]; + + if (VCallOffsets.empty()) { + // We don't have vcall offsets for this virtual base, go ahead and + // build them. + VCallAndVBaseOffsetBuilder Builder(MostDerivedClass, MostDerivedClass, + /*FinalOverriders=*/0, + BaseSubobject(Offset.VirtualBase, 0), + /*BaseIsVirtual=*/true, + /*OffsetInLayoutClass=*/0); + + VCallOffsets = Builder.getVCallOffsets(); + } + + Adjustment.VCallOffsetOffset = VCallOffsets.getVCallOffsetOffset(MD); } - - // Check the base class looking for more vbase offsets. - AddVBaseOffsets(BaseDecl, OffsetToTop, VBases); + + Adjustment.NonVirtual = Offset.NonVirtualOffset; } + + return Adjustment; } void VtableBuilder::AddMethod(const CXXMethodDecl *MD, - ReturnAdjustment ReturnAdjustment, - ThisAdjustment ThisAdjustment) { + ReturnAdjustment ReturnAdjustment) { if (const CXXDestructorDecl *DD = dyn_cast<CXXDestructorDecl>(MD)) { assert(ReturnAdjustment.isEmpty() && "Destructor can't have return adjustment!"); - // Add the 'this' pointer adjustments if necessary. - if (!ThisAdjustment.isEmpty()) { - ThisAdjustments.push_back(std::make_pair(Components.size(), - ThisAdjustment)); - ThisAdjustments.push_back(std::make_pair(Components.size() + 1, - ThisAdjustment)); - } // Add both the complete destructor and the deleting destructor. Components.push_back(VtableComponent::MakeCompleteDtor(DD)); @@ -959,30 +1435,157 @@ VtableBuilder::AddMethod(const CXXMethodDecl *MD, ReturnAdjustments.push_back(std::make_pair(Components.size(), ReturnAdjustment)); - // Add the 'this' pointer adjustment if necessary. - if (!ThisAdjustment.isEmpty()) - ThisAdjustments.push_back(std::make_pair(Components.size(), - ThisAdjustment)); - // Add the function. Components.push_back(VtableComponent::MakeFunction(MD)); } } +/// OverridesIndirectMethodInBase - Return whether the given member function +/// overrides any methods in the set of given bases. +/// Unlike OverridesMethodInBase, this checks "overriders of overriders". +/// For example, if we have: +/// +/// struct A { virtual void f(); } +/// struct B : A { virtual void f(); } +/// struct C : B { virtual void f(); } +/// +/// OverridesIndirectMethodInBase will return true if given C::f as the method +/// and { A } as the set of bases. +static bool +OverridesIndirectMethodInBases(const CXXMethodDecl *MD, + VtableBuilder::PrimaryBasesSetVectorTy &Bases) { + for (CXXMethodDecl::method_iterator I = MD->begin_overridden_methods(), + E = MD->end_overridden_methods(); I != E; ++I) { + const CXXMethodDecl *OverriddenMD = *I; + const CXXRecordDecl *OverriddenRD = OverriddenMD->getParent(); + assert(OverriddenMD->isCanonicalDecl() && + "Should have the canonical decl of the overridden RD!"); + + if (Bases.count(OverriddenRD)) + return true; + + // Check "indirect overriders". + if (OverridesIndirectMethodInBases(OverriddenMD, Bases)) + return true; + } + + return false; +} + +bool +VtableBuilder::IsOverriderUsed(BaseSubobject Base, + BaseSubobject FirstBaseInPrimaryBaseChain, + uint64_t OffsetInLayoutClass, + FinalOverriders::OverriderInfo Overrider) const { + // If the base and the first base in the primary base chain have the same + // offsets, then this overrider will be used. + if (Base.getBaseOffset() == OffsetInLayoutClass) + return true; + + // We know now that Base (or a direct or indirect base of it) is a primary + // base in part of the class hierarchy, but not a primary base in the most + // derived class. + + // If the overrider is the first base in the primary base chain, we know + // that the overrider will be used. + if (Overrider.Method->getParent() == FirstBaseInPrimaryBaseChain.getBase()) + return true; + + VtableBuilder::PrimaryBasesSetVectorTy PrimaryBases; + + const CXXRecordDecl *RD = FirstBaseInPrimaryBaseChain.getBase(); + PrimaryBases.insert(RD); + + // Now traverse the base chain, starting with the first base, until we find + // the base that is no longer a primary base. + while (true) { + const ASTRecordLayout &Layout = Context.getASTRecordLayout(RD); + const CXXRecordDecl *PrimaryBase = Layout.getPrimaryBase(); + + if (!PrimaryBase) + break; + + if (Layout.getPrimaryBaseWasVirtual()) { + assert(Layout.getVBaseClassOffset(PrimaryBase) == 0 && + "Primary base should always be at offset 0!"); + + const ASTRecordLayout &LayoutClassLayout = + Context.getASTRecordLayout(LayoutClass); + + // Now check if this is the primary base that is not a primary base in the + // most derived class. + if (LayoutClassLayout.getVBaseClassOffset(PrimaryBase) != + OffsetInLayoutClass) { + // We found it, stop walking the chain. + break; + } + } else { + assert(Layout.getBaseClassOffset(PrimaryBase) == 0 && + "Primary base should always be at offset 0!"); + } + + if (!PrimaryBases.insert(PrimaryBase)) + assert(false && "Found a duplicate primary base!"); + + RD = PrimaryBase; + } + + // If the final overrider is an override of one of the primary bases, + // then we know that it will be used. + return OverridesIndirectMethodInBases(Overrider.Method, PrimaryBases); +} + +/// FindNearestOverriddenMethod - Given a method, returns the overridden method +/// from the nearest base. Returns null if no method was found. +static const CXXMethodDecl * +FindNearestOverriddenMethod(const CXXMethodDecl *MD, + VtableBuilder::PrimaryBasesSetVectorTy &Bases) { + for (int I = Bases.size(), E = 0; I != E; --I) { + const CXXRecordDecl *PrimaryBase = Bases[I - 1]; + + // Now check the overriden methods. + for (CXXMethodDecl::method_iterator I = MD->begin_overridden_methods(), + E = MD->end_overridden_methods(); I != E; ++I) { + const CXXMethodDecl *OverriddenMD = *I; + + // We found our overridden method. + if (OverriddenMD->getParent() == PrimaryBase) + return OverriddenMD; + } + } + + return 0; +} + void -VtableBuilder::AddMethods(BaseSubobject Base, PrimaryBasesSetTy &PrimaryBases) { +VtableBuilder::AddMethods(BaseSubobject Base, + BaseSubobject FirstBaseInPrimaryBaseChain, + uint64_t OffsetInLayoutClass, + PrimaryBasesSetVectorTy &PrimaryBases) { const CXXRecordDecl *RD = Base.getBase(); const ASTRecordLayout &Layout = Context.getASTRecordLayout(RD); if (const CXXRecordDecl *PrimaryBase = Layout.getPrimaryBase()) { - if (Layout.getPrimaryBaseWasVirtual()) - assert(false && "FIXME: Handle vbases here."); - else + uint64_t BaseOffset; + if (Layout.getPrimaryBaseWasVirtual()) { + assert(Layout.getVBaseClassOffset(PrimaryBase) == 0 && + "Primary vbase should have a zero offset!"); + + const ASTRecordLayout &MostDerivedClassLayout = + Context.getASTRecordLayout(MostDerivedClass); + + BaseOffset = MostDerivedClassLayout.getVBaseClassOffset(PrimaryBase); + } else { assert(Layout.getBaseClassOffset(PrimaryBase) == 0 && "Primary base should have a zero offset!"); - - AddMethods(BaseSubobject(PrimaryBase, Base.getBaseOffset()), PrimaryBases); + + BaseOffset = Base.getBaseOffset(); + } + + // FIXME: OffsetInLayoutClass is not right here. + AddMethods(BaseSubobject(PrimaryBase, BaseOffset), + FirstBaseInPrimaryBaseChain, OffsetInLayoutClass, PrimaryBases); if (!PrimaryBases.insert(PrimaryBase)) assert(false && "Found a duplicate primary base!"); @@ -1004,47 +1607,90 @@ VtableBuilder::AddMethods(BaseSubobject Base, PrimaryBasesSetTy &PrimaryBases) { // base. If this is the case, and the return type doesn't require adjustment // then we can just use the member function from the primary base. if (const CXXMethodDecl *OverriddenMD = - OverridesMethodInPrimaryBase(MD, PrimaryBases)) { + FindNearestOverriddenMethod(MD, PrimaryBases)) { if (ComputeReturnAdjustmentBaseOffset(Context, MD, - OverriddenMD).isEmpty()) + OverriddenMD).isEmpty()) { + // Replace the method info of the overridden method with our own + // method. + assert(MethodInfoMap.count(OverriddenMD) && + "Did not find the overridden method!"); + MethodInfo &OverriddenMethodInfo = MethodInfoMap[OverriddenMD]; + + MethodInfo MethodInfo(Base.getBaseOffset(), + OverriddenMethodInfo.VtableIndex); + + assert(!MethodInfoMap.count(MD) && + "Should not have method info for this method yet!"); + + MethodInfoMap.insert(std::make_pair(MD, MethodInfo)); + MethodInfoMap.erase(OverriddenMD); continue; + } } + // Insert the method info for this method. + MethodInfo MethodInfo(Base.getBaseOffset(), Components.size()); + + assert(!MethodInfoMap.count(MD) && + "Should not have method info for this method yet!"); + MethodInfoMap.insert(std::make_pair(MD, MethodInfo)); + + // Check if this overrider is going to be used. + if (!IsOverriderUsed(Base, FirstBaseInPrimaryBaseChain, OffsetInLayoutClass, + Overrider)) { + const CXXMethodDecl *OverriderMD = Overrider.Method; + Components.push_back(VtableComponent::MakeUnusedFunction(OverriderMD)); + continue; + } + // Check if this overrider needs a return adjustment. - FinalOverriders::BaseOffset ReturnAdjustmentOffset = + BaseOffset ReturnAdjustmentOffset = Overriders.getReturnAdjustmentOffset(Base, MD); ReturnAdjustment ReturnAdjustment = ComputeReturnAdjustment(ReturnAdjustmentOffset); - // Check if this overrider needs a 'this' pointer adjustment. - FinalOverriders::BaseOffset ThisAdjustmentOffset = - Overriders.getThisAdjustmentOffset(Base, MD); - - ThisAdjustment ThisAdjustment = ComputeThisAdjustment(ThisAdjustmentOffset); - - AddMethod(Overrider.Method, ReturnAdjustment, ThisAdjustment); + AddMethod(Overrider.Method, ReturnAdjustment); } } -void VtableBuilder::LayoutVtable(BaseSubobject Base) { - const CXXRecordDecl *RD = Base.getBase(); - assert(RD->isDynamicClass() && "class does not have a vtable!"); - - int64_t OffsetToTop = -(int64_t)Base.getBaseOffset() / 8; - - // Add vcall and vbase offsets for this vtable. +void VtableBuilder::LayoutVtable() { + LayoutPrimaryAndSecondaryVtables(BaseSubobject(MostDerivedClass, 0), + MostDerivedClassIsVirtual, + MostDerivedClassOffset); + VisitedVirtualBasesSetTy VBases; - AddVCallAndVBaseOffsets(RD, OffsetToTop, VBases); + + // Determine the primary virtual bases. + DeterminePrimaryVirtualBases(MostDerivedClass, VBases); + VBases.clear(); + + LayoutVtablesForVirtualBases(MostDerivedClass, VBases); +} + +void +VtableBuilder::LayoutPrimaryAndSecondaryVtables(BaseSubobject Base, + bool BaseIsVirtual, + uint64_t OffsetInLayoutClass) { + assert(Base.getBase()->isDynamicClass() && "class does not have a vtable!"); - // Reverse them and add them to the vtable components. - std::reverse(VCallAndVBaseOffsets.begin(), VCallAndVBaseOffsets.end()); - Components.append(VCallAndVBaseOffsets.begin(), VCallAndVBaseOffsets.end()); - VCallAndVBaseOffsets.clear(); + // Add vcall and vbase offsets for this vtable. + VCallAndVBaseOffsetBuilder Builder(MostDerivedClass, LayoutClass, &Overriders, + Base, BaseIsVirtual, OffsetInLayoutClass); + Components.append(Builder.components_begin(), Builder.components_end()); + // Check if we need to add these vcall offsets. + if (BaseIsVirtual && !Builder.getVCallOffsets().empty()) { + VCallOffsetMap &VCallOffsets = VCallOffsetsForVBases[Base.getBase()]; + + if (VCallOffsets.empty()) + VCallOffsets = Builder.getVCallOffsets(); + } + // Add the offset to top. - // FIXME: This is not going to be right for construction vtables. // FIXME: We should not use / 8 here. + int64_t OffsetToTop = -(int64_t)(OffsetInLayoutClass - + MostDerivedClassOffset) / 8; Components.push_back(VtableComponent::MakeOffsetToTop(OffsetToTop)); // Next, add the RTTI. @@ -1053,59 +1699,166 @@ void VtableBuilder::LayoutVtable(BaseSubobject Base) { uint64_t AddressPoint = Components.size(); // Now go through all virtual member functions and add them. - PrimaryBasesSetTy PrimaryBases; - AddMethods(Base, PrimaryBases); + PrimaryBasesSetVectorTy PrimaryBases; + AddMethods(Base, Base, OffsetInLayoutClass, PrimaryBases); + + // Compute 'this' pointer adjustments. + ComputeThisAdjustments(); // Record the address point. - AddressPoints.insert(std::make_pair(Base, AddressPoint)); + AddressPoints.insert(std::make_pair(BaseSubobject(Base.getBase(), + OffsetInLayoutClass), + AddressPoint)); // Record the address points for all primary bases. - for (PrimaryBasesSetTy::const_iterator I = PrimaryBases.begin(), + for (PrimaryBasesSetVectorTy::const_iterator I = PrimaryBases.begin(), E = PrimaryBases.end(); I != E; ++I) { const CXXRecordDecl *BaseDecl = *I; // We know that all the primary bases have the same offset as the base // subobject. - BaseSubobject PrimaryBase(BaseDecl, Base.getBaseOffset()); + BaseSubobject PrimaryBase(BaseDecl, OffsetInLayoutClass); AddressPoints.insert(std::make_pair(PrimaryBase, AddressPoint)); } + // Layout secondary vtables. + LayoutSecondaryVtables(Base, OffsetInLayoutClass); +} + +void VtableBuilder::LayoutSecondaryVtables(BaseSubobject Base, + uint64_t OffsetInLayoutClass) { + // Itanium C++ ABI 2.5.2: + // Following the primary virtual table of a derived class are secondary + // virtual tables for each of its proper base classes, except any primary + // base(s) with which it shares its primary virtual table. + + const CXXRecordDecl *RD = Base.getBase(); const ASTRecordLayout &Layout = Context.getASTRecordLayout(RD); const CXXRecordDecl *PrimaryBase = Layout.getPrimaryBase(); - - // Layout secondary vtables. + for (CXXRecordDecl::base_class_const_iterator I = RD->bases_begin(), E = RD->bases_end(); I != E; ++I) { + // Ignore virtual bases, we'll emit them later. + if (I->isVirtual()) + continue; + const CXXRecordDecl *BaseDecl = cast<CXXRecordDecl>(I->getType()->getAs<RecordType>()->getDecl()); // Ignore bases that don't have a vtable. if (!BaseDecl->isDynamicClass()) continue; + + // Get the base offset of this base. + uint64_t RelativeBaseOffset = Layout.getBaseClassOffset(BaseDecl); + uint64_t BaseOffset = Base.getBaseOffset() + RelativeBaseOffset; - // Ignore the primary base. - if (BaseDecl == PrimaryBase) + uint64_t BaseOffsetInLayoutClass = OffsetInLayoutClass + RelativeBaseOffset; + + // Don't emit a secondary vtable for a primary base. We might however want + // to emit secondary vtables for other bases of this base. + if (BaseDecl == PrimaryBase) { + LayoutSecondaryVtables(BaseSubobject(BaseDecl, BaseOffset), + BaseOffsetInLayoutClass); continue; + } - // Ignore virtual bases, we'll emit them later. - if (I->isVirtual()) + // Layout the primary vtable (and any secondary vtables) for this base. + LayoutPrimaryAndSecondaryVtables(BaseSubobject(BaseDecl, BaseOffset), + /*BaseIsVirtual=*/false, + BaseOffsetInLayoutClass); + } +} + +void +VtableBuilder::DeterminePrimaryVirtualBases(const CXXRecordDecl *RD, + VisitedVirtualBasesSetTy &VBases) { + const ASTRecordLayout &Layout = Context.getASTRecordLayout(RD); + + // Check if this base has a primary base. + if (const CXXRecordDecl *PrimaryBase = Layout.getPrimaryBase()) { + + // Check if it's virtual. + if (Layout.getPrimaryBaseWasVirtual()) { + bool IsPrimaryVirtualBase = true; + + if (isBuildingConstructorVtable()) { + // Check if the base is actually a primary base in the class we use for + // layout. + // FIXME: Is this check enough? + if (MostDerivedClassOffset != 0) + IsPrimaryVirtualBase = false; + } + + if (IsPrimaryVirtualBase) + PrimaryVirtualBases.insert(PrimaryBase); + } + } + + // Traverse bases, looking for more primary virtual bases. + for (CXXRecordDecl::base_class_const_iterator I = RD->bases_begin(), + E = RD->bases_end(); I != E; ++I) { + const CXXRecordDecl *BaseDecl = + cast<CXXRecordDecl>(I->getType()->getAs<RecordType>()->getDecl()); + + if (I->isVirtual() && !VBases.insert(BaseDecl)) continue; - - // Get the base offset of this base. - uint64_t BaseOffset = Base.getBaseOffset() + - Layout.getBaseClassOffset(BaseDecl); - // Layout this secondary vtable. - LayoutVtable(BaseSubobject(BaseDecl, BaseOffset)); + DeterminePrimaryVirtualBases(BaseDecl, VBases); + } +} + +void +VtableBuilder::LayoutVtablesForVirtualBases(const CXXRecordDecl *RD, + VisitedVirtualBasesSetTy &VBases) { + // Itanium C++ ABI 2.5.2: + // Then come the virtual base virtual tables, also in inheritance graph + // order, and again excluding primary bases (which share virtual tables with + // the classes for which they are primary). + for (CXXRecordDecl::base_class_const_iterator I = RD->bases_begin(), + E = RD->bases_end(); I != E; ++I) { + const CXXRecordDecl *BaseDecl = + cast<CXXRecordDecl>(I->getType()->getAs<RecordType>()->getDecl()); + + // Check if this base needs a vtable. (If it's virtual, not a primary base + // of some other class, and we haven't visited it before). + if (I->isVirtual() && BaseDecl->isDynamicClass() && + !PrimaryVirtualBases.count(BaseDecl) && VBases.insert(BaseDecl)) { + const ASTRecordLayout &MostDerivedClassLayout = + Context.getASTRecordLayout(MostDerivedClass); + uint64_t BaseOffset = + MostDerivedClassLayout.getVBaseClassOffset(BaseDecl); + + const ASTRecordLayout &LayoutClassLayout = + Context.getASTRecordLayout(LayoutClass); + uint64_t BaseOffsetInLayoutClass = + LayoutClassLayout.getVBaseClassOffset(BaseDecl); + + LayoutPrimaryAndSecondaryVtables(BaseSubobject(BaseDecl, BaseOffset), + /*BaseIsVirtual=*/true, + BaseOffsetInLayoutClass); + } + + // We only need to check the base for virtual base vtables if it actually + // has virtual bases. + if (BaseDecl->getNumVBases()) + LayoutVtablesForVirtualBases(BaseDecl, VBases); } - - // FIXME: Emit vtables for virtual bases here. } /// dumpLayout - Dump the vtable layout. void VtableBuilder::dumpLayout(llvm::raw_ostream& Out) { - - Out << "Vtable for '" << MostDerivedClass->getQualifiedNameAsString(); + + if (MostDerivedClass == LayoutClass) { + Out << "Vtable for '"; + Out << MostDerivedClass->getQualifiedNameAsString(); + } else { + Out << "Construction vtable for ('"; + Out << MostDerivedClass->getQualifiedNameAsString() << "', "; + // FIXME: Don't use / 8 . + Out << MostDerivedClassOffset / 8 << ") in '"; + Out << LayoutClass->getQualifiedNameAsString(); + } Out << "' (" << Components.size() << " entries).\n"; // Iterate through the address points and insert them into a new map where @@ -1125,37 +1878,6 @@ void VtableBuilder::dumpLayout(llvm::raw_ostream& Out) { unsigned NextThisAdjustmentIndex = 0; for (unsigned I = 0, E = Components.size(); I != E; ++I) { uint64_t Index = I; - - if (AddressPointsByIndex.count(I)) { - if (AddressPointsByIndex.count(Index) == 1) { - const BaseSubobject &Base = AddressPointsByIndex.find(Index)->second; - - // FIXME: Instead of dividing by 8, we should be using CharUnits. - Out << " -- (" << Base.getBase()->getQualifiedNameAsString(); - Out << ", " << Base.getBaseOffset() / 8 << ") vtable address --\n"; - } else { - uint64_t BaseOffset = - AddressPointsByIndex.lower_bound(Index)->second.getBaseOffset(); - - // We store the class names in a set to get a stable order. - std::set<std::string> ClassNames; - for (std::multimap<uint64_t, BaseSubobject>::const_iterator I = - AddressPointsByIndex.lower_bound(Index), E = - AddressPointsByIndex.upper_bound(Index); I != E; ++I) { - assert(I->second.getBaseOffset() == BaseOffset && - "Invalid base offset!"); - const CXXRecordDecl *RD = I->second.getBase(); - ClassNames.insert(RD->getQualifiedNameAsString()); - } - - for (std::set<std::string>::const_iterator I = ClassNames.begin(), - E = ClassNames.end(); I != E; ++I) { - // FIXME: Instead of dividing by 8, we should be using CharUnits. - Out << " -- (" << *I; - Out << ", " << BaseOffset / 8 << ") vtable address --\n"; - } - } - } Out << llvm::format("%4d | ", I); @@ -1163,9 +1885,9 @@ void VtableBuilder::dumpLayout(llvm::raw_ostream& Out) { // Dump the component. switch (Component.getKind()) { - // FIXME: Remove this default case. - default: - assert(false && "Unhandled component kind!"); + + case VtableComponent::CK_VCallOffset: + Out << "vcall_offset (" << Component.getVCallOffset() << ")"; break; case VtableComponent::CK_VBaseOffset: @@ -1201,6 +1923,7 @@ void VtableBuilder::dumpLayout(llvm::raw_ostream& Out) { if (Adjustment.VBaseOffsetOffset) Out << ", " << Adjustment.VBaseOffsetOffset << " vbase offset offset"; + Out << ']'; NextReturnAdjustmentIndex++; @@ -1214,7 +1937,10 @@ void VtableBuilder::dumpLayout(llvm::raw_ostream& Out) { Out << "\n [this adjustment: "; Out << Adjustment.NonVirtual << " non-virtual"; - + + if (Adjustment.VCallOffsetOffset) + Out << ", " << Adjustment.VCallOffsetOffset << " vcall offset offset"; + Out << ']'; NextThisAdjustmentIndex++; @@ -1223,31 +1949,94 @@ void VtableBuilder::dumpLayout(llvm::raw_ostream& Out) { break; } - case VtableComponent::CK_CompleteDtorPointer: { + case VtableComponent::CK_CompleteDtorPointer: + case VtableComponent::CK_DeletingDtorPointer: { + bool IsComplete = + Component.getKind() == VtableComponent::CK_CompleteDtorPointer; + const CXXDestructorDecl *DD = Component.getDestructorDecl(); - Out << DD->getQualifiedNameAsString() << "() [complete]"; + Out << DD->getQualifiedNameAsString(); + if (IsComplete) + Out << "() [complete]"; + else + Out << "() [deleting]"; + if (DD->isPure()) Out << " [pure]"; + // If this destructor has a 'this' pointer adjustment, dump it. + if (NextThisAdjustmentIndex < ThisAdjustments.size() && + ThisAdjustments[NextThisAdjustmentIndex].first == I) { + const ThisAdjustment Adjustment = + ThisAdjustments[NextThisAdjustmentIndex].second; + + Out << "\n [this adjustment: "; + Out << Adjustment.NonVirtual << " non-virtual"; + + if (Adjustment.VCallOffsetOffset) + Out << ", " << Adjustment.VCallOffsetOffset << " vcall offset offset"; + + Out << ']'; + + NextThisAdjustmentIndex++; + } + + break; } - case VtableComponent::CK_DeletingDtorPointer: { - const CXXDestructorDecl *DD = Component.getDestructorDecl(); - - Out << DD->getQualifiedNameAsString() << "() [deleting]"; - if (DD->isPure()) - Out << " [pure]"; + case VtableComponent::CK_UnusedFunctionPointer: { + const CXXMethodDecl *MD = Component.getUnusedFunctionDecl(); - break; + std::string Str = + PredefinedExpr::ComputeName(PredefinedExpr::PrettyFunctionNoVirtual, + MD); + Out << "[unused] " << Str; + if (MD->isPure()) + Out << " [pure]"; } } Out << '\n'; + + // Dump the next address point. + uint64_t NextIndex = Index + 1; + if (AddressPointsByIndex.count(NextIndex)) { + if (AddressPointsByIndex.count(NextIndex) == 1) { + const BaseSubobject &Base = + AddressPointsByIndex.find(NextIndex)->second; + + // FIXME: Instead of dividing by 8, we should be using CharUnits. + Out << " -- (" << Base.getBase()->getQualifiedNameAsString(); + Out << ", " << Base.getBaseOffset() / 8 << ") vtable address --\n"; + } else { + uint64_t BaseOffset = + AddressPointsByIndex.lower_bound(NextIndex)->second.getBaseOffset(); + + // We store the class names in a set to get a stable order. + std::set<std::string> ClassNames; + for (std::multimap<uint64_t, BaseSubobject>::const_iterator I = + AddressPointsByIndex.lower_bound(NextIndex), E = + AddressPointsByIndex.upper_bound(NextIndex); I != E; ++I) { + assert(I->second.getBaseOffset() == BaseOffset && + "Invalid base offset!"); + const CXXRecordDecl *RD = I->second.getBase(); + ClassNames.insert(RD->getQualifiedNameAsString()); + } + + for (std::set<std::string>::const_iterator I = ClassNames.begin(), + E = ClassNames.end(); I != E; ++I) { + // FIXME: Instead of dividing by 8, we should be using CharUnits. + Out << " -- (" << *I; + Out << ", " << BaseOffset / 8 << ") vtable address --\n"; + } + } + } } - + + Out << '\n'; } } @@ -1500,10 +2289,10 @@ private: // If already set, note the two sets as the same if (0) printf("%s::%s same as %s::%s\n", - PrevU->getParent()->getNameAsCString(), - PrevU->getNameAsCString(), - U->getParent()->getNameAsCString(), - U->getNameAsCString()); + PrevU->getParent()->getNameAsString().c_str(), + PrevU->getNameAsString().c_str(), + U->getParent()->getNameAsString().c_str(), + U->getNameAsString().c_str()); ForwardUnique[PrevU] = U; return; } @@ -1511,11 +2300,11 @@ private: // Not set, set it now if (0) printf("marking %s::%s %p override as %s::%s\n", - MD->getParent()->getNameAsCString(), - MD->getNameAsCString(), + MD->getParent()->getNameAsString().c_str(), + MD->getNameAsString().c_str(), (void*)MD, - U->getParent()->getNameAsCString(), - U->getNameAsCString()); + U->getParent()->getNameAsString().c_str(), + U->getNameAsString().c_str()); UniqueOverrider[MD] = U; for (CXXMethodDecl::method_iterator mi = MD->begin_overridden_methods(), @@ -1537,8 +2326,8 @@ private: BuildUniqueOverrider(MD, MD); if (0) printf("top set is %s::%s %p\n", - MD->getParent()->getNameAsCString(), - MD->getNameAsCString(), + MD->getParent()->getNameAsString().c_str(), + MD->getNameAsString().c_str(), (void*)MD); ForwardUnique[MD] = MD; } @@ -1573,7 +2362,7 @@ private: A_t::iterator J = I; while (++J != E && DclCmp(I, J) == 0) if (DclIsSame(*I, *J)) { - if (0) printf("connecting %s\n", (*I)->getNameAsCString()); + if (0) printf("connecting %s\n", (*I)->getNameAsString().c_str()); ForwardUnique[*J] = *I; } } @@ -1657,7 +2446,7 @@ public: } //#define D1(x) -#define D1(X) do { if (getenv("DEBUG")) { X; } } while (0) +#define D1(X) do { if (getenv("CLANG_VTABLE_DEBUG")) { X; } } while (0) void GenerateVBaseOffsets(const CXXRecordDecl *RD, uint64_t Offset, bool updateVBIndex, Index_t current_vbindex) { @@ -1801,7 +2590,7 @@ public: return; D1(printf(" vfn for %s at %d\n", - dyn_cast<CXXMethodDecl>(GD.getDecl())->getNameAsCString(), + dyn_cast<CXXMethodDecl>(GD.getDecl())->getNameAsString().c_str(), (int)Methods.size())); // We didn't find an entry in the vtable that we could use, add a new @@ -1824,7 +2613,7 @@ public: idx = VCalls.size()+1; VCalls.push_back(Offset/8 - CurrentVBaseOffset/8); D1(printf(" vcall for %s at %d with delta %d\n", - dyn_cast<CXXMethodDecl>(GD.getDecl())->getNameAsCString(), + dyn_cast<CXXMethodDecl>(GD.getDecl())->getNameAsString().c_str(), (int)-VCalls.size()-3, (int)VCalls[idx-1])); } } @@ -2352,7 +3141,7 @@ void CGVtableInfo::ComputeMethodVtableIndices(const CXXRecordDecl *RD) { // Collect all the primary bases, so we can check whether methods override // a method from the base. - VtableBuilder::PrimaryBasesSetTy PrimaryBases; + VtableBuilder::PrimaryBasesSetVectorTy PrimaryBases; for (ASTRecordLayout::primary_base_info_iterator I = Layout.primary_base_begin(), E = Layout.primary_base_end(); I != E; ++I) @@ -2370,7 +3159,7 @@ void CGVtableInfo::ComputeMethodVtableIndices(const CXXRecordDecl *RD) { // Check if this method overrides a method in the primary base. if (const CXXMethodDecl *OverriddenMD = - OverridesMethodInPrimaryBase(MD, PrimaryBases)) { + OverridesMethodInBases(MD, PrimaryBases)) { // Check if converting from the return type of the method to the // return type of the overridden method requires conversion. if (ComputeReturnAdjustmentBaseOffset(CGM.getContext(), MD, @@ -2535,12 +3324,25 @@ CGVtableInfo::GenerateVtable(llvm::GlobalVariable::LinkageTypes Linkage, bool GenerateDefinition, const CXXRecordDecl *LayoutClass, const CXXRecordDecl *RD, uint64_t Offset, + bool IsVirtual, AddressPointsMapTy& AddressPoints) { - if (GenerateDefinition && CGM.getLangOptions().DumpVtableLayouts && - LayoutClass == RD) { - VtableBuilder Builder(*this, RD); - - Builder.dumpLayout(llvm::errs()); + if (GenerateDefinition) { + if (LayoutClass == RD) { + assert(!IsVirtual && + "Can't only have a virtual base in construction vtables!"); + VtableBuilder Builder(*this, RD, Offset, + /*MostDerivedClassIsVirtual=*/false, + LayoutClass); + + if (CGM.getLangOptions().DumpVtableLayouts) + Builder.dumpLayout(llvm::errs()); + } else if (CGM.getLangOptions().DumpVtableLayouts) { + // We only build construction vtables when dumping vtable layouts for now. + VtableBuilder Builder(*this, RD, Offset, + /*MostDerivedClassIsVirtual=*/IsVirtual, + LayoutClass); + Builder.dumpLayout(llvm::errs()); + } } llvm::SmallString<256> OutName; @@ -2601,6 +3403,7 @@ void CGVtableInfo::GenerateClassData(llvm::GlobalVariable::LinkageTypes Linkage, AddressPointsMapTy AddressPoints; Vtable = GenerateVtable(Linkage, /*GenerateDefinition=*/true, RD, RD, 0, + /*IsVirtual=*/false, AddressPoints); GenerateVTT(Linkage, /*GenerateDefinition=*/true, RD); } @@ -2612,7 +3415,7 @@ llvm::GlobalVariable *CGVtableInfo::getVtable(const CXXRecordDecl *RD) { AddressPointsMapTy AddressPoints; Vtable = GenerateVtable(llvm::GlobalValue::ExternalLinkage, /*GenerateDefinition=*/false, RD, RD, 0, - AddressPoints); + /*IsVirtual=*/false, AddressPoints); } return Vtable; diff --git a/lib/CodeGen/CGVtable.h b/lib/CodeGen/CGVtable.h index 471d6384d6b2..6ccb011985fd 100644 --- a/lib/CodeGen/CGVtable.h +++ b/lib/CodeGen/CGVtable.h @@ -185,7 +185,7 @@ private: llvm::GlobalVariable * GenerateVtable(llvm::GlobalVariable::LinkageTypes Linkage, bool GenerateDefinition, const CXXRecordDecl *LayoutClass, - const CXXRecordDecl *RD, uint64_t Offset, + const CXXRecordDecl *RD, uint64_t Offset, bool IsVirtual, AddressPointsMapTy& AddressPoints); llvm::GlobalVariable *GenerateVTT(llvm::GlobalVariable::LinkageTypes Linkage, @@ -239,7 +239,8 @@ public: }; CtorVtableInfo getCtorVtable(const CXXRecordDecl *RD, - const BaseSubobject &Base); + const BaseSubobject &Base, + bool BaseIsVirtual); llvm::GlobalVariable *getVTT(const CXXRecordDecl *RD); diff --git a/lib/CodeGen/CodeGenFunction.cpp b/lib/CodeGen/CodeGenFunction.cpp index 5a4f94e3e092..f45582705618 100644 --- a/lib/CodeGen/CodeGenFunction.cpp +++ b/lib/CodeGen/CodeGenFunction.cpp @@ -30,7 +30,7 @@ CodeGenFunction::CodeGenFunction(CodeGenModule &cgm) Builder(cgm.getModule().getContext()), DebugInfo(0), IndirectBranch(0), SwitchInsn(0), CaseRangeBlock(0), InvokeDest(0), - CXXThisDecl(0), CXXVTTDecl(0), + CXXThisDecl(0), CXXThisValue(0), CXXVTTDecl(0), CXXVTTValue(0), ConditionalBranchLevel(0), TerminateHandler(0), TrapBB(0), UniqueAggrDestructorCount(0) { LLVMIntTy = ConvertType(getContext().IntTy); @@ -197,7 +197,10 @@ void CodeGenFunction::StartFunction(GlobalDecl GD, QualType RetTy, Builder.SetInsertPoint(EntryBB); - QualType FnType = getContext().getFunctionType(RetTy, 0, 0, false, 0); + QualType FnType = getContext().getFunctionType(RetTy, 0, 0, false, 0, + false, false, 0, 0, + /*FIXME?*/false, + /*FIXME?*/CC_Default); // Emit subprogram debug descriptor. if (CGDebugInfo *DI = getDebugInfo()) { @@ -216,15 +219,20 @@ void CodeGenFunction::StartFunction(GlobalDecl GD, QualType RetTy, } else if (CurFnInfo->getReturnInfo().getKind() == ABIArgInfo::Indirect && hasAggregateLLVMType(CurFnInfo->getReturnType())) { // Indirect aggregate return; emit returned value directly into sret slot. - // This reduces code size, and is also affects correctness in C++. + // This reduces code size, and affects correctness in C++. ReturnValue = CurFn->arg_begin(); } else { - ReturnValue = CreateTempAlloca(ConvertType(RetTy), "retval"); + ReturnValue = CreateIRTemp(RetTy, "retval"); } EmitStartEHSpec(CurCodeDecl); EmitFunctionProlog(*CurFnInfo, CurFn, Args); + if (CXXThisDecl) + CXXThisValue = Builder.CreateLoad(LocalDeclMap[CXXThisDecl], "this"); + if (CXXVTTDecl) + CXXVTTValue = Builder.CreateLoad(LocalDeclMap[CXXVTTDecl], "vtt"); + // If any of the arguments have a variably modified type, make sure to // emit the type size. for (FunctionArgList::const_iterator i = Args.begin(), e = Args.end(); @@ -236,6 +244,19 @@ void CodeGenFunction::StartFunction(GlobalDecl GD, QualType RetTy, } } +void CodeGenFunction::EmitFunctionBody(FunctionArgList &Args) { + const FunctionDecl *FD = cast<FunctionDecl>(CurGD.getDecl()); + + Stmt *Body = FD->getBody(); + if (Body) + EmitStmt(Body); + else { + assert(FD->isImplicit() && "non-implicit function def has no body"); + assert(FD->isCopyAssignment() && "implicit function not copy assignment"); + SynthesizeCXXCopyAssignment(Args); + } +} + void CodeGenFunction::GenerateCode(GlobalDecl GD, llvm::Function *Fn) { const FunctionDecl *FD = cast<FunctionDecl>(GD.getDecl()); @@ -246,13 +267,13 @@ void CodeGenFunction::GenerateCode(GlobalDecl GD, llvm::Function *Fn) { FunctionArgList Args; CurGD = GD; - OuterTryBlock = 0; if (const CXXMethodDecl *MD = dyn_cast<CXXMethodDecl>(FD)) { if (MD->isInstance()) { // Create the implicit 'this' decl. // FIXME: I'm not entirely sure I like using a fake decl just for code // generation. Maybe we can come up with a better way? - CXXThisDecl = ImplicitParamDecl::Create(getContext(), 0, SourceLocation(), + CXXThisDecl = ImplicitParamDecl::Create(getContext(), 0, + FD->getLocation(), &getContext().Idents.get("this"), MD->getThisType(getContext())); Args.push_back(std::make_pair(CXXThisDecl, CXXThisDecl->getType())); @@ -262,7 +283,7 @@ void CodeGenFunction::GenerateCode(GlobalDecl GD, llvm::Function *Fn) { // FIXME: The comment about using a fake decl above applies here too. QualType T = getContext().getPointerType(getContext().VoidPtrTy); CXXVTTDecl = - ImplicitParamDecl::Create(getContext(), 0, SourceLocation(), + ImplicitParamDecl::Create(getContext(), 0, FD->getLocation(), &getContext().Idents.get("vtt"), T); Args.push_back(std::make_pair(CXXVTTDecl, CXXVTTDecl->getType())); } @@ -278,80 +299,22 @@ void CodeGenFunction::GenerateCode(GlobalDecl GD, llvm::Function *Fn) { FProto->getArgType(i))); } - if (const CompoundStmt *S = FD->getCompoundBody()) { - StartFunction(GD, FD->getResultType(), Fn, Args, S->getLBracLoc()); - - if (const CXXConstructorDecl *CD = dyn_cast<CXXConstructorDecl>(FD)) { - EmitCtorPrologue(CD, GD.getCtorType()); - EmitStmt(S); - - // If any of the member initializers are temporaries bound to references - // make sure to emit their destructors. - EmitCleanupBlocks(0); - - } else if (const CXXDestructorDecl *DD = dyn_cast<CXXDestructorDecl>(FD)) { - llvm::BasicBlock *DtorEpilogue = createBasicBlock("dtor.epilogue"); - PushCleanupBlock(DtorEpilogue); + SourceRange BodyRange; + if (Stmt *Body = FD->getBody()) BodyRange = Body->getSourceRange(); - InitializeVtablePtrs(DD->getParent()); + // Emit the standard function prologue. + StartFunction(GD, FD->getResultType(), Fn, Args, BodyRange.getBegin()); - EmitStmt(S); - - CleanupBlockInfo Info = PopCleanupBlock(); + // Generate the body of the function. + if (isa<CXXDestructorDecl>(FD)) + EmitDestructorBody(Args); + else if (isa<CXXConstructorDecl>(FD)) + EmitConstructorBody(Args); + else + EmitFunctionBody(Args); - assert(Info.CleanupBlock == DtorEpilogue && "Block mismatch!"); - EmitBlock(DtorEpilogue); - EmitDtorEpilogue(DD, GD.getDtorType()); - - if (Info.SwitchBlock) - EmitBlock(Info.SwitchBlock); - if (Info.EndBlock) - EmitBlock(Info.EndBlock); - } else { - // Just a regular function, emit its body. - EmitStmt(S); - } - - FinishFunction(S->getRBracLoc()); - } else if (FD->isImplicit()) { - const CXXRecordDecl *ClassDecl = - cast<CXXRecordDecl>(FD->getDeclContext()); - (void) ClassDecl; - if (const CXXConstructorDecl *CD = dyn_cast<CXXConstructorDecl>(FD)) { - // FIXME: For C++0x, we want to look for implicit *definitions* of - // these special member functions, rather than implicit *declarations*. - if (CD->isCopyConstructor()) { - assert(!ClassDecl->hasUserDeclaredCopyConstructor() && - "Cannot synthesize a non-implicit copy constructor"); - SynthesizeCXXCopyConstructor(CD, GD.getCtorType(), Fn, Args); - } else if (CD->isDefaultConstructor()) { - assert(!ClassDecl->hasUserDeclaredConstructor() && - "Cannot synthesize a non-implicit default constructor."); - SynthesizeDefaultConstructor(CD, GD.getCtorType(), Fn, Args); - } else { - assert(false && "Implicit constructor cannot be synthesized"); - } - } else if (const CXXDestructorDecl *CD = dyn_cast<CXXDestructorDecl>(FD)) { - assert(!ClassDecl->hasUserDeclaredDestructor() && - "Cannot synthesize a non-implicit destructor"); - SynthesizeDefaultDestructor(CD, GD.getDtorType(), Fn, Args); - } else if (const CXXMethodDecl *MD = dyn_cast<CXXMethodDecl>(FD)) { - assert(MD->isCopyAssignment() && - !ClassDecl->hasUserDeclaredCopyAssignment() && - "Cannot synthesize a method that is not an implicit-defined " - "copy constructor"); - SynthesizeCXXCopyAssignment(MD, Fn, Args); - } else { - assert(false && "Cannot synthesize unknown implicit function"); - } - } else if (const Stmt *S = FD->getBody()) { - if (const CXXTryStmt *TS = dyn_cast<CXXTryStmt>(S)) { - OuterTryBlock = TS; - StartFunction(GD, FD->getResultType(), Fn, Args, TS->getTryLoc()); - EmitStmt(TS); - FinishFunction(TS->getEndLoc()); - } - } + // Emit the standard function epilogue. + FinishFunction(BodyRange.getEnd()); // Destroy the 'this' declaration. if (CXXThisDecl) diff --git a/lib/CodeGen/CodeGenFunction.h b/lib/CodeGen/CodeGenFunction.h index fb2e5fee7309..d582c0def346 100644 --- a/lib/CodeGen/CodeGenFunction.h +++ b/lib/CodeGen/CodeGenFunction.h @@ -55,6 +55,7 @@ namespace clang { class ObjCImplementationDecl; class ObjCPropertyImplDecl; class TargetInfo; + class TargetCodeGenInfo; class VarDecl; class ObjCForCollectionStmt; class ObjCAtTryStmt; @@ -62,7 +63,6 @@ namespace clang { class ObjCAtSynchronizedStmt; namespace CodeGen { - class CodeGenModule; class CodeGenTypes; class CGDebugInfo; class CGFunctionInfo; @@ -91,9 +91,6 @@ public: /// CurGD - The GlobalDecl for the current function being compiled. GlobalDecl CurGD; - /// OuterTryBlock - This is the address of the outter most try block, 0 - /// otherwise. - const Stmt *OuterTryBlock; /// ReturnBlock - Unified return block. llvm::BasicBlock *ReturnBlock; @@ -382,11 +379,13 @@ private: /// CXXThisDecl - When generating code for a C++ member function, /// this will hold the implicit 'this' declaration. ImplicitParamDecl *CXXThisDecl; + llvm::Value *CXXThisValue; /// CXXVTTDecl - When generating code for a base object constructor or /// base object destructor with virtual bases, this will hold the implicit /// VTT parameter. ImplicitParamDecl *CXXVTTDecl; + llvm::Value *CXXVTTValue; /// CXXLiveTemporaryInfo - Holds information about a live C++ temporary. struct CXXLiveTemporaryInfo { @@ -466,7 +465,8 @@ public: //===--------------------------------------------------------------------===// llvm::Value *BuildBlockLiteralTmp(const BlockExpr *); - llvm::Constant *BuildDescriptorBlockDecl(bool BlockHasCopyDispose, + llvm::Constant *BuildDescriptorBlockDecl(const BlockExpr *, + bool BlockHasCopyDispose, CharUnits Size, const llvm::StructType *, std::vector<HelperInfo> *); @@ -492,6 +492,10 @@ public: const FunctionArgList &Args, SourceLocation StartLoc); + void EmitConstructorBody(FunctionArgList &Args); + void EmitDestructorBody(FunctionArgList &Args); + void EmitFunctionBody(FunctionArgList &Args); + /// EmitReturnBlock - Emit the unified return block, trying to avoid its /// emission when possible. void EmitReturnBlock(); @@ -525,24 +529,8 @@ public: llvm::Value *ThisPtr, uint64_t Offset); - void SynthesizeCXXCopyConstructor(const CXXConstructorDecl *Ctor, - CXXCtorType Type, - llvm::Function *Fn, - const FunctionArgList &Args); - - void SynthesizeCXXCopyAssignment(const CXXMethodDecl *CD, - llvm::Function *Fn, - const FunctionArgList &Args); - - void SynthesizeDefaultConstructor(const CXXConstructorDecl *Ctor, - CXXCtorType Type, - llvm::Function *Fn, - const FunctionArgList &Args); - - void SynthesizeDefaultDestructor(const CXXDestructorDecl *Dtor, - CXXDtorType Type, - llvm::Function *Fn, - const FunctionArgList &Args); + void SynthesizeCXXCopyConstructor(const FunctionArgList &Args); + void SynthesizeCXXCopyAssignment(const FunctionArgList &Args); /// EmitDtorEpilogue - Emit all code that comes at the end of class's /// destructor. This is to call destructors on members and base classes in @@ -663,6 +651,13 @@ public: llvm::AllocaInst *CreateTempAlloca(const llvm::Type *Ty, const llvm::Twine &Name = "tmp"); + /// CreateIRTemp - Create a temporary IR object of the given type, with + /// appropriate alignment. This routine should only be used when an temporary + /// value needs to be stored into an alloca (for example, to avoid explicit + /// PHI construction), but the type is the IR type, not the type appropriate + /// for storing in memory. + llvm::Value *CreateIRTemp(QualType T, const llvm::Twine &Name = "tmp"); + /// CreateMemTemp - Create a temporary memory object of the given type, with /// appropriate alignment. llvm::Value *CreateMemTemp(QualType T, const llvm::Twine &Name = "tmp"); @@ -738,11 +733,17 @@ public: /// LoadCXXThis - Load the value of 'this'. This function is only valid while /// generating code for an C++ member function. - llvm::Value *LoadCXXThis(); + llvm::Value *LoadCXXThis() { + assert(CXXThisValue && "no 'this' value for this function"); + return CXXThisValue; + } /// LoadCXXVTT - Load the VTT parameter to base constructors/destructors have /// virtual bases. - llvm::Value *LoadCXXVTT(); + llvm::Value *LoadCXXVTT() { + assert(CXXVTTValue && "no VTT value for this function"); + return CXXVTTValue; + } /// GetAddressOfBaseOfCompleteClass - Convert the given pointer to a /// complete class down to one of its virtual bases. @@ -789,6 +790,9 @@ public: const CXXRecordDecl *BaseClassDecl, QualType Ty); + void EmitDelegateCXXConstructorCall(const CXXConstructorDecl *Ctor, + CXXCtorType CtorType, + const FunctionArgList &Args); void EmitCXXConstructorCall(const CXXConstructorDecl *D, CXXCtorType Type, llvm::Value *This, CallExpr::const_arg_iterator ArgBeg, @@ -916,6 +920,14 @@ public: void EmitObjCAtThrowStmt(const ObjCAtThrowStmt &S); void EmitObjCAtSynchronizedStmt(const ObjCAtSynchronizedStmt &S); + struct CXXTryStmtInfo { + llvm::BasicBlock *SavedLandingPad; + llvm::BasicBlock *HandlerBlock; + llvm::BasicBlock *FinallyBlock; + }; + CXXTryStmtInfo EnterCXXTryStmt(const CXXTryStmt &S); + void ExitCXXTryStmt(const CXXTryStmt &S, CXXTryStmtInfo Info); + void EmitCXXTryStmt(const CXXTryStmt &S); //===--------------------------------------------------------------------===// @@ -1326,6 +1338,10 @@ private: ArgType)); } } + + const TargetCodeGenInfo &getTargetHooks() const { + return CGM.getTargetCodeGenInfo(); + } }; diff --git a/lib/CodeGen/CodeGenModule.cpp b/lib/CodeGen/CodeGenModule.cpp index 5a552c490ac6..91c7322c6767 100644 --- a/lib/CodeGen/CodeGenModule.cpp +++ b/lib/CodeGen/CodeGenModule.cpp @@ -316,24 +316,20 @@ GetLinkageForFunction(ASTContext &Context, const FunctionDecl *FD, return CodeGenModule::GVA_CXXInline; } -/// SetFunctionDefinitionAttributes - Set attributes for a global. -/// -/// FIXME: This is currently only done for aliases and functions, but not for -/// variables (these details are set in EmitGlobalVarDefinition for variables). -void CodeGenModule::SetFunctionDefinitionAttributes(const FunctionDecl *D, - llvm::GlobalValue *GV) { +llvm::GlobalValue::LinkageTypes +CodeGenModule::getFunctionLinkage(const FunctionDecl *D) { GVALinkage Linkage = GetLinkageForFunction(getContext(), D, Features); if (Linkage == GVA_Internal) { - GV->setLinkage(llvm::Function::InternalLinkage); + return llvm::Function::InternalLinkage; } else if (D->hasAttr<DLLExportAttr>()) { - GV->setLinkage(llvm::Function::DLLExportLinkage); + return llvm::Function::DLLExportLinkage; } else if (D->hasAttr<WeakAttr>()) { - GV->setLinkage(llvm::Function::WeakAnyLinkage); + return llvm::Function::WeakAnyLinkage; } else if (Linkage == GVA_C99Inline) { // In C99 mode, 'inline' functions are guaranteed to have a strong // definition somewhere else, so we can use available_externally linkage. - GV->setLinkage(llvm::Function::AvailableExternallyLinkage); + return llvm::Function::AvailableExternallyLinkage; } else if (Linkage == GVA_CXXInline || Linkage == GVA_TemplateInstantiation) { // In C++, the compiler has to emit a definition in every translation unit // that references the function. We should use linkonce_odr because @@ -341,13 +337,22 @@ void CodeGenModule::SetFunctionDefinitionAttributes(const FunctionDecl *D, // don't need to codegen it. b) if the function persists, it needs to be // merged with other definitions. c) C++ has the ODR, so we know the // definition is dependable. - GV->setLinkage(llvm::Function::LinkOnceODRLinkage); + return llvm::Function::LinkOnceODRLinkage; } else { assert(Linkage == GVA_StrongExternal); // Otherwise, we have strong external linkage. - GV->setLinkage(llvm::Function::ExternalLinkage); + return llvm::Function::ExternalLinkage; } +} + +/// SetFunctionDefinitionAttributes - Set attributes for a global. +/// +/// FIXME: This is currently only done for aliases and functions, but not for +/// variables (these details are set in EmitGlobalVarDefinition for variables). +void CodeGenModule::SetFunctionDefinitionAttributes(const FunctionDecl *D, + llvm::GlobalValue *GV) { + GV->setLinkage(getFunctionLinkage(D)); SetCommonAttributes(D, GV); } @@ -747,14 +752,20 @@ llvm::Constant *CodeGenModule::GetOrCreateLLVMFunction(const char *MangledName, // A called constructor which has no definition or declaration need be // synthesized. else if (const CXXConstructorDecl *CD = dyn_cast<CXXConstructorDecl>(FD)) { - if (CD->isImplicit()) + if (CD->isImplicit()) { + assert (CD->isUsed()); DeferredDeclsToEmit.push_back(D); + } } else if (const CXXDestructorDecl *DD = dyn_cast<CXXDestructorDecl>(FD)) { - if (DD->isImplicit()) + if (DD->isImplicit()) { + assert (DD->isUsed()); DeferredDeclsToEmit.push_back(D); + } } else if (const CXXMethodDecl *MD = dyn_cast<CXXMethodDecl>(FD)) { - if (MD->isCopyAssignment() && MD->isImplicit()) + if (MD->isCopyAssignment() && MD->isImplicit()) { + assert (MD->isUsed()); DeferredDeclsToEmit.push_back(D); + } } } @@ -1190,28 +1201,8 @@ static void ReplaceUsesOfNonProtoTypeWithRealFunction(llvm::GlobalValue *Old, void CodeGenModule::EmitGlobalFunctionDefinition(GlobalDecl GD) { - const llvm::FunctionType *Ty; const FunctionDecl *D = cast<FunctionDecl>(GD.getDecl()); - - if (const CXXMethodDecl *MD = dyn_cast<CXXMethodDecl>(D)) { - bool isVariadic = D->getType()->getAs<FunctionProtoType>()->isVariadic(); - - Ty = getTypes().GetFunctionType(getTypes().getFunctionInfo(MD), isVariadic); - } else { - Ty = cast<llvm::FunctionType>(getTypes().ConvertType(D->getType())); - - // As a special case, make sure that definitions of K&R function - // "type foo()" aren't declared as varargs (which forces the backend - // to do unnecessary work). - if (D->getType()->isFunctionNoProtoType()) { - assert(Ty->isVarArg() && "Didn't lower type as expected"); - // Due to stret, the lowered function could have arguments. - // Just create the same type as was lowered by ConvertType - // but strip off the varargs bit. - std::vector<const llvm::Type*> Args(Ty->param_begin(), Ty->param_end()); - Ty = llvm::FunctionType::get(Ty->getReturnType(), Args, false); - } - } + const llvm::FunctionType *Ty = getTypes().GetFunctionType(GD); // Get or create the prototype for the function. llvm::Constant *Entry = GetAddrOfFunction(GD, Ty); @@ -1342,6 +1333,7 @@ void CodeGenModule::EmitAliasDefinition(const ValueDecl *D) { GA->setLinkage(llvm::Function::DLLExportLinkage); } } else if (D->hasAttr<WeakAttr>() || + D->hasAttr<WeakRefAttr>() || D->hasAttr<WeakImportAttr>()) { GA->setLinkage(llvm::Function::WeakAnyLinkage); } diff --git a/lib/CodeGen/CodeGenModule.h b/lib/CodeGen/CodeGenModule.h index 8280766c7035..ac8332647b77 100644 --- a/lib/CodeGen/CodeGenModule.h +++ b/lib/CodeGen/CodeGenModule.h @@ -206,6 +206,19 @@ public: /// GlobalValue. void setGlobalVisibility(llvm::GlobalValue *GV, const Decl *D) const; + llvm::Constant *GetAddrOfGlobal(GlobalDecl GD) { + if (isa<CXXConstructorDecl>(GD.getDecl())) + return GetAddrOfCXXConstructor(cast<CXXConstructorDecl>(GD.getDecl()), + GD.getCtorType()); + else if (isa<CXXDestructorDecl>(GD.getDecl())) + return GetAddrOfCXXDestructor(cast<CXXDestructorDecl>(GD.getDecl()), + GD.getDtorType()); + else if (isa<FunctionDecl>(GD.getDecl())) + return GetAddrOfFunction(GD); + else + return GetAddrOfGlobalVar(cast<VarDecl>(GD.getDecl())); + } + /// GetAddrOfGlobalVar - Return the llvm::Constant for the address of the /// given global variable. If Ty is non-null and if the global doesn't exist, /// then it will be greated with the specified type instead of whatever the @@ -291,13 +304,13 @@ public: /// GetAddrOfCXXConstructor - Return the address of the constructor of the /// given type. - llvm::Function *GetAddrOfCXXConstructor(const CXXConstructorDecl *D, - CXXCtorType Type); + llvm::GlobalValue *GetAddrOfCXXConstructor(const CXXConstructorDecl *D, + CXXCtorType Type); /// GetAddrOfCXXDestructor - Return the address of the constructor of the /// given type. - llvm::Function *GetAddrOfCXXDestructor(const CXXDestructorDecl *D, - CXXDtorType Type); + llvm::GlobalValue *GetAddrOfCXXDestructor(const CXXDestructorDecl *D, + CXXDtorType Type); /// getBuiltinLibFunction - Given a builtin id for a function like /// "__builtin_fabsf", return a Function* for "fabsf". @@ -417,6 +430,9 @@ public: GVA_TemplateInstantiation }; + llvm::GlobalVariable::LinkageTypes + getFunctionLinkage(const FunctionDecl *FD); + /// getVtableLinkage - Return the appropriate linkage for the vtable, VTT, /// and type information of the given class. static llvm::GlobalVariable::LinkageTypes @@ -468,6 +484,9 @@ private: // C++ related functions. + bool TryEmitDefinitionAsAlias(GlobalDecl Alias, GlobalDecl Target); + bool TryEmitBaseDestructorAsAlias(const CXXDestructorDecl *D); + void EmitNamespace(const NamespaceDecl *D); void EmitLinkageSpec(const LinkageSpecDecl *D); diff --git a/lib/CodeGen/CodeGenTypes.cpp b/lib/CodeGen/CodeGenTypes.cpp index 3c20934baf25..4feca4dd7d3d 100644 --- a/lib/CodeGen/CodeGenTypes.cpp +++ b/lib/CodeGen/CodeGenTypes.cpp @@ -190,6 +190,7 @@ const llvm::Type *CodeGenTypes::ConvertNewType(QualType T) { #define ABSTRACT_TYPE(Class, Base) #define NON_CANONICAL_TYPE(Class, Base) case Type::Class: #define DEPENDENT_TYPE(Class, Base) case Type::Class: +#define NON_CANONICAL_UNLESS_DEPENDENT_TYPE(Class, Base) case Type::Class: #include "clang/AST/TypeNodes.def" assert(false && "Non-canonical or dependent types aren't possible."); break; @@ -313,10 +314,14 @@ const llvm::Type *CodeGenTypes::ConvertNewType(QualType T) { // The function type can be built; call the appropriate routines to // build it. if (const FunctionProtoType *FPT = dyn_cast<FunctionProtoType>(&Ty)) - return GetFunctionType(getFunctionInfo(FPT), FPT->isVariadic()); + return GetFunctionType(getFunctionInfo( + CanQual<FunctionProtoType>::CreateUnsafe(QualType(FPT,0))), + FPT->isVariadic()); const FunctionNoProtoType *FNPT = cast<FunctionNoProtoType>(&Ty); - return GetFunctionType(getFunctionInfo(FNPT), true); + return GetFunctionType(getFunctionInfo( + CanQual<FunctionNoProtoType>::CreateUnsafe(QualType(FNPT,0))), + true); } case Type::ObjCInterface: { @@ -386,9 +391,6 @@ const llvm::Type *CodeGenTypes::ConvertNewType(QualType T) { NULL); return PtrDiffTy; } - - case Type::TemplateSpecialization: - assert(false && "Dependent types can't get here"); } // FIXME: implement. diff --git a/lib/CodeGen/CodeGenTypes.h b/lib/CodeGen/CodeGenTypes.h index 87ba0bcfba1d..b2912efb3402 100644 --- a/lib/CodeGen/CodeGenTypes.h +++ b/lib/CodeGen/CodeGenTypes.h @@ -35,6 +35,7 @@ namespace llvm { namespace clang { class ABIInfo; class ASTContext; + template <typename> class CanQual; class CXXConstructorDecl; class CXXDestructorDecl; class CXXMethodDecl; @@ -48,6 +49,7 @@ namespace clang { class TagDecl; class TargetInfo; class Type; + typedef CanQual<Type> CanQualType; namespace CodeGen { class CodeGenTypes; @@ -168,6 +170,8 @@ public: const llvm::FunctionType *GetFunctionType(const CGFunctionInfo &Info, bool IsVariadic); + const llvm::FunctionType *GetFunctionType(GlobalDecl GD); + /// GetFunctionTypeForVtable - Get the LLVM function type for use in a vtable, /// given a CXXMethodDecl. If the method to has an incomplete return type, @@ -184,11 +188,6 @@ public: /// replace the 'opaque' type we previously made for it if applicable. void UpdateCompletedType(const TagDecl *TD); -private: - const CGFunctionInfo &getFunctionInfo(const FunctionNoProtoType *FTNP); - const CGFunctionInfo &getFunctionInfo(const FunctionProtoType *FTP); - -public: /// getFunctionInfo - Get the function info for the specified function decl. const CGFunctionInfo &getFunctionInfo(GlobalDecl GD); @@ -205,6 +204,8 @@ public: return getFunctionInfo(Ty->getResultType(), Args, Ty->getCallConv(), Ty->getNoReturnAttr()); } + const CGFunctionInfo &getFunctionInfo(CanQual<FunctionProtoType> Ty); + const CGFunctionInfo &getFunctionInfo(CanQual<FunctionNoProtoType> Ty); // getFunctionInfo - Get the function info for a member function. const CGFunctionInfo &getFunctionInfo(const CXXRecordDecl *RD, @@ -221,8 +222,12 @@ public: const FunctionArgList &Args, CallingConv CC, bool NoReturn); - const CGFunctionInfo &getFunctionInfo(QualType RetTy, - const llvm::SmallVector<QualType, 16> &ArgTys, + + /// Retrieves the ABI information for the given function signature. + /// + /// \param ArgTys - must all actually be canonical as params + const CGFunctionInfo &getFunctionInfo(CanQualType RetTy, + const llvm::SmallVectorImpl<CanQualType> &ArgTys, CallingConv CC, bool NoReturn); diff --git a/lib/CodeGen/Mangle.cpp b/lib/CodeGen/Mangle.cpp index a302225c7f77..64743c7696f7 100644 --- a/lib/CodeGen/Mangle.cpp +++ b/lib/CodeGen/Mangle.cpp @@ -455,7 +455,9 @@ void CXXNameMangler::mangleUnresolvedScope(NestedNameSpecifier *Qualifier) { mangleType(QualType(Qualifier->getAsType(), 0)); break; case NestedNameSpecifier::Identifier: - mangleUnresolvedScope(Qualifier->getPrefix()); + // Member expressions can have these without prefixes. + if (Qualifier->getPrefix()) + mangleUnresolvedScope(Qualifier->getPrefix()); mangleSourceName(Qualifier->getAsIdentifier()); break; } @@ -1123,6 +1125,42 @@ void CXXNameMangler::mangleType(const TypenameType *T) { Out << 'E'; } +void CXXNameMangler::mangleType(const TypeOfType *T) { + // FIXME: this is pretty unsatisfactory, but there isn't an obvious + // "extension with parameters" mangling. + Out << "u6typeof"; +} + +void CXXNameMangler::mangleType(const TypeOfExprType *T) { + // FIXME: this is pretty unsatisfactory, but there isn't an obvious + // "extension with parameters" mangling. + Out << "u6typeof"; +} + +void CXXNameMangler::mangleType(const DecltypeType *T) { + Expr *E = T->getUnderlyingExpr(); + + // type ::= Dt <expression> E # decltype of an id-expression + // # or class member access + // ::= DT <expression> E # decltype of an expression + + // This purports to be an exhaustive list of id-expressions and + // class member accesses. Note that we do not ignore parentheses; + // parentheses change the semantics of decltype for these + // expressions (and cause the mangler to use the other form). + if (isa<DeclRefExpr>(E) || + isa<MemberExpr>(E) || + isa<UnresolvedLookupExpr>(E) || + isa<DependentScopeDeclRefExpr>(E) || + isa<CXXDependentScopeMemberExpr>(E) || + isa<UnresolvedMemberExpr>(E)) + Out << "Dt"; + else + Out << "DT"; + mangleExpression(E); + Out << 'E'; +} + void CXXNameMangler::mangleIntegerLiteral(QualType T, const llvm::APSInt &Value) { // <expr-primary> ::= L <type> <value number> E # integer literal @@ -1163,20 +1201,14 @@ void CXXNameMangler::mangleCalledExpression(const Expr *E, unsigned Arity) { /// Mangles a member expression. Implicit accesses are not handled, /// but that should be okay, because you shouldn't be able to /// make an implicit access in a function template declaration. -/// -/// The standard ABI does not describe how member expressions should -/// be mangled, so this is very unstandardized. We mangle as if it -/// were a binary operator, except that the RHS is mangled as an -/// abstract name. -/// -/// The standard ABI also does not assign a mangling to the dot -/// operator, so we arbitrarily select 'me'. void CXXNameMangler::mangleMemberExpr(const Expr *Base, bool IsArrow, NestedNameSpecifier *Qualifier, DeclarationName Member, unsigned Arity) { - Out << (IsArrow ? "pt" : "me"); + // gcc-4.4 uses 'dt' for dot expressions, which is reasonable. + // OTOH, gcc also mangles the name as an expression. + Out << (IsArrow ? "pt" : "dt"); mangleExpression(Base); mangleUnresolvedName(Qualifier, Member, Arity); } @@ -1346,10 +1378,16 @@ void CXXNameMangler::mangleExpression(const Expr *E) { break; case Expr::DeclRefExprClass: { - const Decl *D = cast<DeclRefExpr>(E)->getDecl(); + const NamedDecl *D = cast<DeclRefExpr>(E)->getDecl(); switch (D->getKind()) { - default: assert(false && "Unhandled decl kind!"); + default: + // <expr-primary> ::= L <mangled-name> E # external name + Out << 'L'; + mangle(D, "_Z"); + Out << 'E'; + break; + case Decl::NonTypeTemplateParm: { const NonTypeTemplateParmDecl *PD = cast<NonTypeTemplateParmDecl>(D); mangleTemplateParameter(PD->getIndex()); @@ -1363,7 +1401,18 @@ void CXXNameMangler::mangleExpression(const Expr *E) { case Expr::DependentScopeDeclRefExprClass: { const DependentScopeDeclRefExpr *DRE = cast<DependentScopeDeclRefExpr>(E); - const Type *QTy = DRE->getQualifier()->getAsType(); + NestedNameSpecifier *NNS = DRE->getQualifier(); + const Type *QTy = NNS->getAsType(); + + // When we're dealing with a nested-name-specifier that has just a + // dependent identifier in it, mangle that as a typename. FIXME: + // It isn't clear that we ever actually want to have such a + // nested-name-specifier; why not just represent it as a typename type? + if (!QTy && NNS->getAsIdentifier() && NNS->getPrefix()) { + QTy = getASTContext().getTypenameType(NNS->getPrefix(), + NNS->getAsIdentifier()) + .getTypePtr(); + } assert(QTy && "Qualifier was not type!"); // ::= sr <type> <unqualified-name> # dependent name @@ -1648,6 +1697,9 @@ bool CXXNameMangler::mangleStandardSubstitution(const NamedDecl *ND) { if (const ClassTemplateSpecializationDecl *SD = dyn_cast<ClassTemplateSpecializationDecl>(ND)) { + if (!isStdNamespace(SD->getDeclContext())) + return false; + // <substitution> ::= Ss # ::std::basic_string<char, // ::std::char_traits<char>, // ::std::allocator<char> > diff --git a/lib/CodeGen/TargetInfo.cpp b/lib/CodeGen/TargetInfo.cpp index a7c0caa299e7..f4ec914a4e05 100644 --- a/lib/CodeGen/TargetInfo.cpp +++ b/lib/CodeGen/TargetInfo.cpp @@ -972,12 +972,11 @@ ABIArgInfo X86_64ABIInfo::getCoerceResult(QualType Ty, return (Ty->isPromotableIntegerType() ? ABIArgInfo::getExtend() : ABIArgInfo::getDirect()); } else if (CoerceTo == llvm::Type::getDoubleTy(CoerceTo->getContext())) { - // FIXME: It would probably be better to make CGFunctionInfo only map using - // canonical types than to canonize here. - QualType CTy = Context.getCanonicalType(Ty); + assert(Ty.isCanonical() && "should always have a canonical type here"); + assert(!Ty.hasQualifiers() && "should never have a qualified type here"); // Float and double end up in a single SSE reg. - if (CTy == Context.FloatTy || CTy == Context.DoubleTy) + if (Ty == Context.FloatTy || Ty == Context.DoubleTy) return ABIArgInfo::getDirect(); } @@ -1497,9 +1496,29 @@ ABIArgInfo PIC16ABIInfo::classifyArgumentType(QualType Ty, llvm::Value *PIC16ABIInfo::EmitVAArg(llvm::Value *VAListAddr, QualType Ty, CodeGenFunction &CGF) const { - return 0; + const llvm::Type *BP = llvm::PointerType::getUnqual(llvm::Type::getInt8Ty(CGF.getLLVMContext())); + const llvm::Type *BPP = llvm::PointerType::getUnqual(BP); + + CGBuilderTy &Builder = CGF.Builder; + llvm::Value *VAListAddrAsBPP = Builder.CreateBitCast(VAListAddr, BPP, + "ap"); + llvm::Value *Addr = Builder.CreateLoad(VAListAddrAsBPP, "ap.cur"); + llvm::Type *PTy = + llvm::PointerType::getUnqual(CGF.ConvertType(Ty)); + llvm::Value *AddrTyped = Builder.CreateBitCast(Addr, PTy); + + uint64_t Offset = CGF.getContext().getTypeSize(Ty) / 8; + + llvm::Value *NextAddr = + Builder.CreateGEP(Addr, llvm::ConstantInt::get( + llvm::Type::getInt32Ty(CGF.getLLVMContext()), Offset), + "ap.next"); + Builder.CreateStore(NextAddr, VAListAddrAsBPP); + + return AddrTyped; } + // ARM ABI Implementation namespace { diff --git a/lib/CodeGen/TargetInfo.h b/lib/CodeGen/TargetInfo.h index 58b7b79224fd..9e80081429cc 100644 --- a/lib/CodeGen/TargetInfo.h +++ b/lib/CodeGen/TargetInfo.h @@ -17,6 +17,7 @@ namespace llvm { class GlobalValue; + class Value; } namespace clang { @@ -25,6 +26,7 @@ namespace clang { namespace CodeGen { class CodeGenModule; + class CodeGenFunction; } /// TargetCodeGenInfo - This class organizes various target-specific @@ -44,6 +46,35 @@ namespace clang { /// target-specific attributes for the given global. virtual void SetTargetAttributes(const Decl *D, llvm::GlobalValue *GV, CodeGen::CodeGenModule &M) const { } + + /// Controls whether __builtin_extend_pointer should sign-extend + /// pointers to uint64_t or zero-extend them (the default). Has + /// no effect for targets: + /// - that have 64-bit pointers, or + /// - that cannot address through registers larger than pointers, or + /// - that implicitly ignore/truncate the top bits when addressing + /// through such registers. + virtual bool extendPointerWithSExt() const { return false; } + + /// Performs the code-generation required to convert a return + /// address as stored by the system into the actual address of the + /// next instruction that will be executed. + /// + /// Used by __builtin_extract_return_addr(). + virtual llvm::Value *decodeReturnAddress(CodeGen::CodeGenFunction &CGF, + llvm::Value *Address) const { + return Address; + } + + /// Performs the code-generation required to convert the address + /// of an instruction into a return address suitable for storage + /// by the system in a return slot. + /// + /// Used by __builtin_frob_return_addr(). + virtual llvm::Value *encodeReturnAddress(CodeGen::CodeGenFunction &CGF, + llvm::Value *Address) const { + return Address; + } }; } diff --git a/lib/Driver/Driver.cpp b/lib/Driver/Driver.cpp index 15df767d9707..ec8227efb332 100644 --- a/lib/Driver/Driver.cpp +++ b/lib/Driver/Driver.cpp @@ -49,6 +49,7 @@ Driver::Driver(llvm::StringRef _Name, llvm::StringRef _Dir, : Opts(createDriverOptTable()), Diags(_Diags), Name(_Name), Dir(_Dir), DefaultHostTriple(_DefaultHostTriple), DefaultImageName(_DefaultImageName), + DriverTitle("clang \"gcc-compatible\" driver"), Host(0), CCCGenericGCCName("gcc"), CCCIsCXX(false), CCCEcho(false), CCCPrintBindings(false), CheckInputsExist(true), CCCUseClang(true), @@ -273,8 +274,8 @@ void Driver::PrintOptions(const ArgList &Args) const { // FIXME: Move -ccc options to real options in the .td file (or eliminate), and // then move to using OptTable::PrintHelp. void Driver::PrintHelp(bool ShowHidden) const { - getOpts().PrintHelp(llvm::outs(), Name.c_str(), - "clang \"gcc-compatible\" driver", ShowHidden); + getOpts().PrintHelp(llvm::outs(), Name.c_str(), DriverTitle.c_str(), + ShowHidden); } void Driver::PrintVersion(const Compilation &C, llvm::raw_ostream &OS) const { @@ -558,6 +559,17 @@ void Driver::BuildActions(const ArgList &Args, ActionList &Actions) const { if (Ty == types::TY_INVALID) Ty = types::TY_Object; + + // If the driver is invoked as C++ compiler (like clang++ or c++) it + // should autodetect some input files as C++ for g++ compatibility. + if (CCCIsCXX) { + types::ID OldTy = Ty; + Ty = types::lookupCXXTypeForCType(Ty); + + if (Ty != OldTy) + Diag(clang::diag::warn_drv_treating_input_as_cxx) + << getTypeName(OldTy) << getTypeName(Ty); + } } // -ObjC and -ObjC++ override the default language, but only for "source diff --git a/lib/Driver/Tools.cpp b/lib/Driver/Tools.cpp index aff70bc7ba0d..de9bdcc18816 100644 --- a/lib/Driver/Tools.cpp +++ b/lib/Driver/Tools.cpp @@ -480,6 +480,65 @@ void Clang::AddARMTargetArgs(const ArgList &Args, } } +void Clang::AddMIPSTargetArgs(const ArgList &Args, + ArgStringList &CmdArgs) const { + const Driver &D = getToolChain().getDriver(); + + // Select the ABI to use. + const char *ABIName = 0; + if (Arg *A = Args.getLastArg(options::OPT_mabi_EQ)) { + ABIName = A->getValue(Args); + } else { + ABIName = "o32"; + } + + CmdArgs.push_back("-target-abi"); + CmdArgs.push_back(ABIName); + + if (const Arg *A = Args.getLastArg(options::OPT_march_EQ)) { + llvm::StringRef MArch = A->getValue(Args); + CmdArgs.push_back("-target-cpu"); + + if ((MArch == "r2000") || (MArch == "r3000")) + CmdArgs.push_back("mips1"); + else if (MArch == "r6000") + CmdArgs.push_back("mips2"); + else + CmdArgs.push_back(MArch.str().c_str()); + } + + // Select the float ABI as determined by -msoft-float, -mhard-float, and + llvm::StringRef FloatABI; + if (Arg *A = Args.getLastArg(options::OPT_msoft_float, + options::OPT_mhard_float)) { + if (A->getOption().matches(options::OPT_msoft_float)) + FloatABI = "soft"; + else if (A->getOption().matches(options::OPT_mhard_float)) + FloatABI = "hard"; + } + + // If unspecified, choose the default based on the platform. + if (FloatABI.empty()) { + switch (getToolChain().getTriple().getOS()) { + default: + // Assume "soft", but warn the user we are guessing. + FloatABI = "soft"; + D.Diag(clang::diag::warn_drv_assuming_mfloat_abi_is) << "soft"; + break; + } + } + + if (FloatABI == "soft") { + // Floating point operations and argument passing are soft. + // + // FIXME: This changes CPP defines, we need -target-soft-float. + CmdArgs.push_back("-msoft-float"); + } else { + assert(FloatABI == "hard" && "Invalid float abi!"); + CmdArgs.push_back("-mhard-float"); + } +} + void Clang::AddX86TargetArgs(const ArgList &Args, ArgStringList &CmdArgs) const { if (!Args.hasFlag(options::OPT_mred_zone, @@ -799,6 +858,11 @@ void Clang::ConstructJob(Compilation &C, const JobAction &JA, CmdArgs.push_back("Arguments"); } + // Enable -mconstructor-aliases except on darwin, where we have to + // work around a linker bug; see <rdar://problem/7651567>. + if (getToolChain().getTriple().getOS() != llvm::Triple::Darwin) + CmdArgs.push_back("-mconstructor-aliases"); + // This is a coarse approximation of what llvm-gcc actually does, both // -fasynchronous-unwind-tables and -fnon-call-exceptions interact in more // complicated ways. @@ -834,6 +898,11 @@ void Clang::ConstructJob(Compilation &C, const JobAction &JA, AddARMTargetArgs(Args, CmdArgs); break; + case llvm::Triple::mips: + case llvm::Triple::mipsel: + AddMIPSTargetArgs(Args, CmdArgs); + break; + case llvm::Triple::x86: case llvm::Triple::x86_64: AddX86TargetArgs(Args, CmdArgs); @@ -1006,7 +1075,6 @@ void Clang::ConstructJob(Compilation &C, const JobAction &JA, // -fblocks=0 is default. if (Args.hasFlag(options::OPT_fblocks, options::OPT_fno_blocks, getToolChain().IsBlocksDefault())) { - Args.AddLastArg(CmdArgs, options::OPT_fblock_introspection); CmdArgs.push_back("-fblocks"); } @@ -2542,6 +2610,13 @@ void freebsd::Assemble::ConstructJob(Compilation &C, const JobAction &JA, if (getToolChain().getArchName() == "i386") CmdArgs.push_back("--32"); + + // Set byte order explicitly + if (getToolChain().getArchName() == "mips") + CmdArgs.push_back("-EB"); + else if (getToolChain().getArchName() == "mipsel") + CmdArgs.push_back("-EL"); + Args.AddAllArgValues(CmdArgs, options::OPT_Wa_COMMA, options::OPT_Xassembler); @@ -2637,11 +2712,13 @@ void freebsd::Link::ConstructJob(Compilation &C, const JobAction &JA, if (!Args.hasArg(options::OPT_nostdlib) && !Args.hasArg(options::OPT_nodefaultlibs)) { + if (D.CCCIsCXX) { + CmdArgs.push_back("-lstdc++"); + CmdArgs.push_back("-lm"); + } // FIXME: For some reason GCC passes -lgcc and -lgcc_s before adding // the default system libraries. Just mimic this for now. CmdArgs.push_back("-lgcc"); - if (D.CCCIsCXX) - CmdArgs.push_back("-lstdc++"); if (Args.hasArg(options::OPT_static)) { CmdArgs.push_back("-lgcc_eh"); } else { diff --git a/lib/Driver/Tools.h b/lib/Driver/Tools.h index db596417a9d2..7a8f1b7cb703 100644 --- a/lib/Driver/Tools.h +++ b/lib/Driver/Tools.h @@ -34,6 +34,7 @@ namespace tools { const InputInfoList &Inputs) const; void AddARMTargetArgs(const ArgList &Args, ArgStringList &CmdArgs) const; + void AddMIPSTargetArgs(const ArgList &Args, ArgStringList &CmdArgs) const; void AddX86TargetArgs(const ArgList &Args, ArgStringList &CmdArgs) const; public: diff --git a/lib/Driver/Types.cpp b/lib/Driver/Types.cpp index 60d86a62a3a0..8857fb16a304 100644 --- a/lib/Driver/Types.cpp +++ b/lib/Driver/Types.cpp @@ -213,3 +213,19 @@ phases::ID types::getCompilationPhase(ID Id, unsigned N) { return phases::Link; } + +ID types::lookupCXXTypeForCType(ID Id) { + switch (Id) { + default: + return Id; + + case types::TY_C: + return types::TY_CXX; + case types::TY_PP_C: + return types::TY_PP_CXX; + case types::TY_CHeader: + return types::TY_CXXHeader; + case types::TY_PP_CHeader: + return types::TY_PP_CXXHeader; + } +} diff --git a/lib/Frontend/ASTUnit.cpp b/lib/Frontend/ASTUnit.cpp index a0c4889c1631..ef14df10345e 100644 --- a/lib/Frontend/ASTUnit.cpp +++ b/lib/Frontend/ASTUnit.cpp @@ -36,11 +36,11 @@ using namespace clang; ASTUnit::ASTUnit(bool _MainFileIsAST) - : tempFile(false), MainFileIsAST(_MainFileIsAST) { + : MainFileIsAST(_MainFileIsAST) { } ASTUnit::~ASTUnit() { - if (tempFile) - llvm::sys::Path(getPCHFileName()).eraseFromDisk(); + for (unsigned I = 0, N = TemporaryFiles.size(); I != N; ++I) + TemporaryFiles[I].eraseFromDisk(); } namespace { @@ -90,8 +90,46 @@ public: } }; +class StoredDiagnosticClient : public DiagnosticClient { + llvm::SmallVectorImpl<StoredDiagnostic> &StoredDiags; + +public: + explicit StoredDiagnosticClient( + llvm::SmallVectorImpl<StoredDiagnostic> &StoredDiags) + : StoredDiags(StoredDiags) { } + + virtual void HandleDiagnostic(Diagnostic::Level Level, + const DiagnosticInfo &Info); +}; + +/// \brief RAII object that optionally captures diagnostics, if +/// there is no diagnostic client to capture them already. +class CaptureDroppedDiagnostics { + Diagnostic &Diags; + StoredDiagnosticClient Client; + DiagnosticClient *PreviousClient; + +public: + CaptureDroppedDiagnostics(bool RequestCapture, Diagnostic &Diags, + llvm::SmallVectorImpl<StoredDiagnostic> &StoredDiags) + : Diags(Diags), Client(StoredDiags), PreviousClient(Diags.getClient()) + { + if (RequestCapture || Diags.getClient() == 0) + Diags.setClient(&Client); + } + + ~CaptureDroppedDiagnostics() { + Diags.setClient(PreviousClient); + } +}; + } // anonymous namespace +void StoredDiagnosticClient::HandleDiagnostic(Diagnostic::Level Level, + const DiagnosticInfo &Info) { + StoredDiags.push_back(StoredDiagnostic(Level, Info)); +} + const std::string &ASTUnit::getOriginalSourceFileName() { return OriginalSourceFile; } @@ -105,11 +143,16 @@ ASTUnit *ASTUnit::LoadFromPCHFile(const std::string &Filename, Diagnostic &Diags, boo |